summaryrefslogtreecommitdiff
path: root/dotfiles
diff options
context:
space:
mode:
Diffstat (limited to 'dotfiles')
-rw-r--r--dotfiles/system/.config/.cmailpass.gpg1
-rw-r--r--dotfiles/system/.config/.gmailpass.gpg1
-rw-r--r--dotfiles/system/.config/calibre/conversion/azw3_output.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/comic_input.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/debug.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/docx_input.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/docx_output.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/epub_output.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/fb2_input.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/fb2_output.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/heuristics.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/htmlz_output.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/look_and_feel.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/lrf_output.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/metadata.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/mobi_output.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/page_setup.py3
-rw-r--r--dotfiles/system/.config/calibre/conversion/pdb_output.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/pdf_input.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/pdf_output.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/pmlz_output.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/rb_output.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/rtf_input.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/search_and_replace.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/snb_output.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/structure_detection.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/toc.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/txt_input.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/txt_output.py0
-rw-r--r--dotfiles/system/.config/calibre/conversion/txtz_output.py0
-rw-r--r--dotfiles/system/.config/calibre/customize.py.json33
-rw-r--r--dotfiles/system/.config/calibre/device_drivers_KOBOTOUCH.py.json47
-rw-r--r--dotfiles/system/.config/calibre/device_drivers_KOBOTOUCHEXTENDED.py.json62
-rw-r--r--dotfiles/system/.config/calibre/device_drivers_USER_DEFINED.py.json24
-rw-r--r--dotfiles/system/.config/calibre/fonts/scanner_cache.json4
-rw-r--r--dotfiles/system/.config/calibre/history.plist22
-rw-r--r--dotfiles/system/.config/calibre/icons-any.rccbin0 -> 40452503 bytes
-rw-r--r--dotfiles/system/.config/calibre/icons-dark.rccbin0 -> 1291073 bytes
-rw-r--r--dotfiles/system/.config/calibre/metadata-sources-cache.json18
-rw-r--r--dotfiles/system/.config/calibre/metadata_sources/global.json15
-rw-r--r--dotfiles/system/.config/calibre/mtp_devices.json9
-rw-r--r--dotfiles/system/.config/calibre/plugins/Clean Comments.zipbin0 -> 41082 bytes
-rw-r--r--dotfiles/system/.config/calibre/plugins/Extract ISBN.zipbin0 -> 183577 bytes
-rw-r--r--dotfiles/system/.config/calibre/plugins/Favourites Menu.json65
-rw-r--r--dotfiles/system/.config/calibre/plugins/Favourites Menu.zipbin0 -> 124019 bytes
-rw-r--r--dotfiles/system/.config/calibre/plugins/Find Duplicates.json13
-rw-r--r--dotfiles/system/.config/calibre/plugins/Find Duplicates.zipbin0 -> 519469 bytes
-rw-r--r--dotfiles/system/.config/calibre/plugins/Kindle hi-res covers.zipbin0 -> 15129 bytes
-rw-r--r--dotfiles/system/.config/calibre/plugins/Kobo Utilities.json34
-rw-r--r--dotfiles/system/.config/calibre/plugins/Kobo Utilities.zipbin0 -> 1333779 bytes
-rw-r--r--dotfiles/system/.config/calibre/plugins/KoboTouchExtended.zipbin0 -> 49513 bytes
-rw-r--r--dotfiles/system/.config/calibre/plugins/Open With.json61
-rw-r--r--dotfiles/system/.config/calibre/plugins/Open With.zipbin0 -> 225919 bytes
-rw-r--r--dotfiles/system/.config/calibre/plugins/Reading List.json3
-rw-r--r--dotfiles/system/.config/calibre/plugins/Reading List.zipbin0 -> 387112 bytes
-rw-r--r--dotfiles/system/.config/calibre/save_to_disk.py.json14
-rw-r--r--dotfiles/system/.config/calibre/server-config.txt0
-rw-r--r--dotfiles/system/.config/calibre/server-users.sqlitebin0 -> 12288 bytes
-rw-r--r--dotfiles/system/.config/calibre/shortcuts/main.json18
-rw-r--r--dotfiles/system/.config/calibre/tag-map-rules.json10
-rw-r--r--dotfiles/system/.config/calibre/viewer-webengine.json294
-rw-r--r--dotfiles/system/.config/calibre/viewer.json13
-rw-r--r--dotfiles/system/.config/calibre/viewer/annots/19f02e8b622152fd5d7c642d30ecac05080ddf3e9e288a22c4f49866ba57c8b2.json1
-rw-r--r--dotfiles/system/.config/calibre/viewer/annots/5856c3e5aa41dd1b47711fa2b70e5ba9a2f61369f97c7fcc415321753e7c8bea.json1
-rw-r--r--dotfiles/system/.config/calibre/viewer/annots/5d4b018509f9383872d23f1c4a0652d20e908edc16409bc7697635a28f96478e.json1
-rw-r--r--dotfiles/system/.config/calibre/viewer/annots/6fd06a181469267e9c09d240ef2d3cca061e54ce37143a9e142524f61028cdd9.json1
-rw-r--r--dotfiles/system/.config/calibre/viewer/annots/90922c33b4cfd6cdf2f2f462bc5f6e6b0f18bdb829384144fdd13cc3b487deb1.json1
-rw-r--r--dotfiles/system/.config/fontconfig/fonts.conf52
-rw-r--r--dotfiles/system/.config/mpd/mpd.conf433
-rw-r--r--dotfiles/system/.config/mpd/musicpd.conf436
-rw-r--r--dotfiles/system/.config/ncmpcpp/bindings551
-rw-r--r--dotfiles/system/.config/ncmpcpp/config71
-rw-r--r--dotfiles/system/.config/ranger/commands.py62
-rw-r--r--dotfiles/system/.config/ranger/commands_full.py1836
-rw-r--r--dotfiles/system/.config/ranger/rc.conf790
-rw-r--r--dotfiles/system/.config/ranger/rifle.conf257
-rwxr-xr-xdotfiles/system/.config/ranger/scope.sh216
l---------dotfiles/system/.config/sway/config.d/termdrop.conf1
-rw-r--r--dotfiles/system/.config/youtube-dl/youtube-dl.conf11
-rw-r--r--dotfiles/system/.config/zathura/zathurarc8
-rw-r--r--dotfiles/system/.gitconfig17
-rwxr-xr-xdotfiles/system/.local/bin/ec2
-rwxr-xr-xdotfiles/system/.local/bin/em2
-rwxr-xr-xdotfiles/system/.local/bin/et2
-rwxr-xr-xdotfiles/system/.local/bin/extractaudio2
-rwxr-xr-xdotfiles/system/.local/bin/mpd_play_yt_stream14
-rwxr-xr-xdotfiles/system/.local/bin/opus2mp33
-rwxr-xr-xdotfiles/system/.local/bin/ps-mem28
-rwxr-xr-xdotfiles/system/.local/bin/recordnow26
-rw-r--r--dotfiles/system/.local/share/applications/org-protocol.desktop11
-rw-r--r--dotfiles/system/.local/share/thequestionconcerningtechnology.txt180
-rw-r--r--dotfiles/system/.msmtprc38
-rw-r--r--dotfiles/system/.stow-global-ignore2
-rw-r--r--dotfiles/system/music/60s Sounds.m3u3
-rw-r--r--dotfiles/system/music/90s Sounds.m3u3
-rw-r--r--dotfiles/system/music/Ambient Sleeping Pill.m3u9
-rw-r--r--dotfiles/system/music/Andor.m3u1
-rw-r--r--dotfiles/system/music/BAGeL Radio.m3u1
-rw-r--r--dotfiles/system/music/BBC World Service.m3u41
-rw-r--r--dotfiles/system/music/Black Flamingos - Space Bar.m4abin0 -> 3819479 bytes
-rw-r--r--dotfiles/system/music/Blues Radio.m3u1
-rw-r--r--dotfiles/system/music/Dark Ambient.m3u9
-rw-r--r--dotfiles/system/music/Flux FM Radio.m3u3
-rw-r--r--dotfiles/system/music/Jazz Radio Happy Hour.m3u5
-rw-r--r--dotfiles/system/music/Jazz Radio Latin Jazz.m3u5
-rw-r--r--dotfiles/system/music/Jazz Radio New Orleans.m3u1
-rw-r--r--dotfiles/system/music/Jazz Radio Only Women.m3u5
-rw-r--r--dotfiles/system/music/Lofi Girl.m3u3
-rw-r--r--dotfiles/system/music/Malvern Radio International Classical.m3u5
-rw-r--r--dotfiles/system/music/NPR 24 Hour Radio.m3u9
-rw-r--r--dotfiles/system/music/Radio Caprice Acoustic Blues.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Breakbeat.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Classical Baroque.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Classical Cello.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Classical Impressionism.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Classical Lute.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Classical Medieval.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Classical Piano.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Classical Renaissance.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Classical Sonata.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Classical Strings.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Classical Violin.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Delta Blues.m3u5
-rw-r--r--dotfiles/system/music/Radio Caprice Downtempo.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Dubstep.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Gregorian Chants.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Hardcore Punk.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Jazz Bebop.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Jazz Rap.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Old School Hip-Hop.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Oldies.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Reggae Roots.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Reggae.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Street Punk.m3u1
-rw-r--r--dotfiles/system/music/Radio Caprice Trip Hop.m3u4
-rw-r--r--dotfiles/system/music/Radio Swiss Classic French.m3u9
-rw-r--r--dotfiles/system/music/Radio Swiss Classic German.m3u9
-rw-r--r--dotfiles/system/music/Radio Swiss Classic Italian.m3u13
-rw-r--r--dotfiles/system/music/SomaFM Beat Blender.m3u6
-rw-r--r--dotfiles/system/music/SomaFM Black Rock FM.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Boot Liquor.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Cliqhop IDM.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Dark Zone.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Deep Space One.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Digitalis.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Drone Zone.m3u5
-rw-r--r--dotfiles/system/music/SomaFM Dub Step Beyond.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Fluid.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Folk Forward.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Groove Salad Classic.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Groove Salad.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Heavyweight Reggae.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Illinois Street Lounge.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Indie Pop Rocks.m3u4
-rw-r--r--dotfiles/system/music/SomaFM PopTron.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Secret Agent.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Sonic Universe.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Space Station Soma.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Suburbs of Goa.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Synphaera.m3u4
-rw-r--r--dotfiles/system/music/SomaFM The Trip.m3u4
-rw-r--r--dotfiles/system/music/SomaFM Underground 80s.m3u5
-rw-r--r--dotfiles/system/music/SomaFM Vaporwaves.m3u4
-rw-r--r--dotfiles/system/music/SomaFM n5MD Radio.m3u4
-rw-r--r--dotfiles/system/music/Sunday Baroque.m3u1
-rw-r--r--dotfiles/system/music/Surf Rock.m3u37
-rw-r--r--dotfiles/system/music/Venice Classic Radio.m3u1
-rw-r--r--dotfiles/system/music/WWNO.m3u13
-rw-r--r--dotfiles/system/music/WWOZ New Orleans.m3u4
-rw-r--r--dotfiles/system/pictures/cjennings.jpgbin0 -> 31438 bytes
-rw-r--r--dotfiles/system/pictures/devilman.jpgbin0 -> 41707 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/Trolley-New-Orleans.jpgbin0 -> 287530 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/a-sexy-curvy-beautiful-bottom_earth.jpgbin0 -> 176441 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/atari-canyon.pngbin0 -> 6054214 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/barrelled_teahupoo-french-polynesia.jpgbin0 -> 739550 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/beatles_st_pancras_old_church_1968.jpgbin0 -> 80887 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/big-j-mcneely-los-angeles-1951.jpgbin0 -> 233590 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/black.jpgbin0 -> 25537 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/bondi-beach-new-south-wales-australia.jpgbin0 -> 197164 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/capetown-south-africa.jpgbin0 -> 6793104 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/damrak-amsterdam-netherlands.jpgbin0 -> 1520134 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/dark-lion.jpgbin0 -> 419505 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/dolomites-italy.jpgbin0 -> 551757 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/duckdive_teahupoo-french-polynesia.jpgbin0 -> 557884 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/eltz-castle-wiershem-germany.jpgbin0 -> 2517682 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/fu_some-field-near-you.jpgbin0 -> 6806375 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/hawker-sea-fury.jpgbin0 -> 91595 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/highway-59-kansas-us.jpgbin0 -> 336799 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/it.saves.more.than.text.pngbin0 -> 390778 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/jack.rabbit.slims.jpegbin0 -> 138405 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/jackson-lake-lodge-wyoming-us.jpgbin0 -> 265839 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/khan-al-khalili-egypt.jpgbin0 -> 2024124 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/knockturn-alley-london-uk.jpgbin0 -> 3743760 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/last-jedis-neighbor_faroe-islands-denmark.jpgbin0 -> 1218998 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/loch-muick-scotland-uk.jpgbin0 -> 2069036 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/maps.jpgbin0 -> 6982816 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/napa-valley-california-us.jpgbin0 -> 3582085 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/nazaré-portugal.jpgbin0 -> 573000 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/notre-dame-paris-france.jpgbin0 -> 481347 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/petit-piton-st-lucia.jpgbin0 -> 1735652 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/reading-room_new-york-public-library-new-york.us.jpgbin0 -> 4385677 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/saville-dam-barkhamsted-connecticut-us.jpgbin0 -> 2417461 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/teahupoo-french-polynesia.jpgbin0 -> 391815 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/tlulum-mexico.jpgbin0 -> 877326 bytes
-rw-r--r--dotfiles/system/pictures/wallpaper/trinity-college-library-dublin-ireland-uk.jpgbin0 -> 2663941 bytes
205 files changed, 6151 insertions, 0 deletions
diff --git a/dotfiles/system/.config/.cmailpass.gpg b/dotfiles/system/.config/.cmailpass.gpg
new file mode 100644
index 0000000..e2f102e
--- /dev/null
+++ b/dotfiles/system/.config/.cmailpass.gpg
@@ -0,0 +1 @@
+  LFLJEdM0+G 5nn]݋)>{\ޛ\KZȘݝG>ZėӶKv!>W~< \ No newline at end of file
diff --git a/dotfiles/system/.config/.gmailpass.gpg b/dotfiles/system/.config/.gmailpass.gpg
new file mode 100644
index 0000000..cea3fe1
--- /dev/null
+++ b/dotfiles/system/.config/.gmailpass.gpg
@@ -0,0 +1 @@
+  q~9KEp[,/Fd?aNT҆o%#JW-rsW_dMG>v~BzW[hQr \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/conversion/azw3_output.py b/dotfiles/system/.config/calibre/conversion/azw3_output.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/azw3_output.py
diff --git a/dotfiles/system/.config/calibre/conversion/comic_input.py b/dotfiles/system/.config/calibre/conversion/comic_input.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/comic_input.py
diff --git a/dotfiles/system/.config/calibre/conversion/debug.py b/dotfiles/system/.config/calibre/conversion/debug.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/debug.py
diff --git a/dotfiles/system/.config/calibre/conversion/docx_input.py b/dotfiles/system/.config/calibre/conversion/docx_input.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/docx_input.py
diff --git a/dotfiles/system/.config/calibre/conversion/docx_output.py b/dotfiles/system/.config/calibre/conversion/docx_output.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/docx_output.py
diff --git a/dotfiles/system/.config/calibre/conversion/epub_output.py b/dotfiles/system/.config/calibre/conversion/epub_output.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/epub_output.py
diff --git a/dotfiles/system/.config/calibre/conversion/fb2_input.py b/dotfiles/system/.config/calibre/conversion/fb2_input.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/fb2_input.py
diff --git a/dotfiles/system/.config/calibre/conversion/fb2_output.py b/dotfiles/system/.config/calibre/conversion/fb2_output.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/fb2_output.py
diff --git a/dotfiles/system/.config/calibre/conversion/heuristics.py b/dotfiles/system/.config/calibre/conversion/heuristics.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/heuristics.py
diff --git a/dotfiles/system/.config/calibre/conversion/htmlz_output.py b/dotfiles/system/.config/calibre/conversion/htmlz_output.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/htmlz_output.py
diff --git a/dotfiles/system/.config/calibre/conversion/look_and_feel.py b/dotfiles/system/.config/calibre/conversion/look_and_feel.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/look_and_feel.py
diff --git a/dotfiles/system/.config/calibre/conversion/lrf_output.py b/dotfiles/system/.config/calibre/conversion/lrf_output.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/lrf_output.py
diff --git a/dotfiles/system/.config/calibre/conversion/metadata.py b/dotfiles/system/.config/calibre/conversion/metadata.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/metadata.py
diff --git a/dotfiles/system/.config/calibre/conversion/mobi_output.py b/dotfiles/system/.config/calibre/conversion/mobi_output.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/mobi_output.py
diff --git a/dotfiles/system/.config/calibre/conversion/page_setup.py b/dotfiles/system/.config/calibre/conversion/page_setup.py
new file mode 100644
index 0000000..d54ecbb
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/page_setup.py
@@ -0,0 +1,3 @@
+json:{
+ "output_profile": "kobo"
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/conversion/pdb_output.py b/dotfiles/system/.config/calibre/conversion/pdb_output.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/pdb_output.py
diff --git a/dotfiles/system/.config/calibre/conversion/pdf_input.py b/dotfiles/system/.config/calibre/conversion/pdf_input.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/pdf_input.py
diff --git a/dotfiles/system/.config/calibre/conversion/pdf_output.py b/dotfiles/system/.config/calibre/conversion/pdf_output.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/pdf_output.py
diff --git a/dotfiles/system/.config/calibre/conversion/pmlz_output.py b/dotfiles/system/.config/calibre/conversion/pmlz_output.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/pmlz_output.py
diff --git a/dotfiles/system/.config/calibre/conversion/rb_output.py b/dotfiles/system/.config/calibre/conversion/rb_output.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/rb_output.py
diff --git a/dotfiles/system/.config/calibre/conversion/rtf_input.py b/dotfiles/system/.config/calibre/conversion/rtf_input.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/rtf_input.py
diff --git a/dotfiles/system/.config/calibre/conversion/search_and_replace.py b/dotfiles/system/.config/calibre/conversion/search_and_replace.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/search_and_replace.py
diff --git a/dotfiles/system/.config/calibre/conversion/snb_output.py b/dotfiles/system/.config/calibre/conversion/snb_output.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/snb_output.py
diff --git a/dotfiles/system/.config/calibre/conversion/structure_detection.py b/dotfiles/system/.config/calibre/conversion/structure_detection.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/structure_detection.py
diff --git a/dotfiles/system/.config/calibre/conversion/toc.py b/dotfiles/system/.config/calibre/conversion/toc.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/toc.py
diff --git a/dotfiles/system/.config/calibre/conversion/txt_input.py b/dotfiles/system/.config/calibre/conversion/txt_input.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/txt_input.py
diff --git a/dotfiles/system/.config/calibre/conversion/txt_output.py b/dotfiles/system/.config/calibre/conversion/txt_output.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/txt_output.py
diff --git a/dotfiles/system/.config/calibre/conversion/txtz_output.py b/dotfiles/system/.config/calibre/conversion/txtz_output.py
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/conversion/txtz_output.py
diff --git a/dotfiles/system/.config/calibre/customize.py.json b/dotfiles/system/.config/calibre/customize.py.json
new file mode 100644
index 0000000..30fa238
--- /dev/null
+++ b/dotfiles/system/.config/calibre/customize.py.json
@@ -0,0 +1,33 @@
+{
+ "disabled_plugins": {
+ "__class__": "set",
+ "__value__": []
+ },
+ "enabled_plugins": {
+ "__class__": "set",
+ "__value__": [
+ "KoboTouch",
+ "KoboTouchExtended",
+ "Kobo Reader Device Interface",
+ "Google Images",
+ "Big Book Search"
+ ]
+ },
+ "filetype_mapping": {},
+ "plugin_customization": {},
+ "plugins": {
+ "Clean Comments": "/home/cjennings/.config/calibre/plugins/Clean Comments.zip",
+ "Comments Cleaner": "/home/cjennings/.config/calibre/plugins/Comments Cleaner.zip",
+ "Extract ISBN": "/home/cjennings/.config/calibre/plugins/Extract ISBN.zip",
+ "Favourites Menu": "/home/cjennings/.config/calibre/plugins/Favourites Menu.zip",
+ "Find Duplicates": "/home/cjennings/.config/calibre/plugins/Find Duplicates.zip",
+ "KePub Metadata Reader": "/home/cjennings/.config/calibre/plugins/KePub Metadata Reader.zip",
+ "KePub Metadata Writer": "/home/cjennings/.config/calibre/plugins/KePub Metadata Writer.zip",
+ "Kindle hi-res covers": "/home/cjennings/.config/calibre/plugins/Kindle hi-res covers.zip",
+ "Kobo Books": "/home/cjennings/.config/calibre/plugins/Kobo Books.zip",
+ "Kobo Metadata": "/home/cjennings/.config/calibre/plugins/Kobo Metadata.zip",
+ "Kobo Utilities": "/home/cjennings/.config/calibre/plugins/Kobo Utilities.zip",
+ "KoboTouchExtended": "/home/cjennings/.config/calibre/plugins/KoboTouchExtended.zip",
+ "Reading List": "/home/cjennings/.config/calibre/plugins/Reading List.zip"
+ }
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/device_drivers_KOBOTOUCH.py.json b/dotfiles/system/.config/calibre/device_drivers_KOBOTOUCH.py.json
new file mode 100644
index 0000000..5bdd9c4
--- /dev/null
+++ b/dotfiles/system/.config/calibre/device_drivers_KOBOTOUCH.py.json
@@ -0,0 +1,47 @@
+{
+ "bookstats_pagecount_template": "",
+ "bookstats_timetoread_lower_template": "",
+ "bookstats_timetoread_upper_template": "",
+ "bookstats_wordcount_template": "",
+ "collections_columns": "",
+ "collections_template": "",
+ "create_collections": false,
+ "debugging_title": "",
+ "delete_empty_collections": false,
+ "dithered_covers": false,
+ "driver_version": "2.5.1",
+ "extra_customization": [],
+ "format_map": [
+ "kepub",
+ "epub",
+ "cbz",
+ "cbr"
+ ],
+ "ignore_collections_names": "",
+ "keep_cover_aspect": false,
+ "letterbox_fs_covers": false,
+ "letterbox_fs_covers_color": "#000000",
+ "manage_collections": true,
+ "modify_css": false,
+ "override_kobo_replace_existing": true,
+ "png_covers": false,
+ "read_metadata": true,
+ "save_template": "{author_sort}/{title} - {authors}",
+ "show_archived_books": false,
+ "show_previews": false,
+ "show_recommendations": false,
+ "subtitle_template": "",
+ "support_newer_firmware": false,
+ "update_bookstats": false,
+ "update_core_metadata": false,
+ "update_device_metadata": true,
+ "update_purchased_kepubs": false,
+ "update_series": true,
+ "update_subtitle": false,
+ "upload_covers": false,
+ "upload_grayscale": false,
+ "use_author_sort": false,
+ "use_collections_columns": true,
+ "use_collections_template": false,
+ "use_subdirs": true
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/device_drivers_KOBOTOUCHEXTENDED.py.json b/dotfiles/system/.config/calibre/device_drivers_KOBOTOUCHEXTENDED.py.json
new file mode 100644
index 0000000..bfc0600
--- /dev/null
+++ b/dotfiles/system/.config/calibre/device_drivers_KOBOTOUCHEXTENDED.py.json
@@ -0,0 +1,62 @@
+{
+ "bookstats_pagecount_template": "",
+ "bookstats_timetoread_lower_template": "",
+ "bookstats_timetoread_upper_template": "",
+ "bookstats_wordcount_template": "",
+ "clean_markup": false,
+ "collections_columns": "",
+ "collections_template": "",
+ "create_collections": false,
+ "debugging_title": "",
+ "delete_empty_collections": false,
+ "disable_hyphenation": false,
+ "dithered_covers": false,
+ "driver_version": "3.6.3",
+ "extra_customization": [],
+ "extra_features": true,
+ "file_copy_dir": "",
+ "format_map": [
+ "kepub",
+ "epub",
+ "cbr",
+ "cbz"
+ ],
+ "full_page_numbers": false,
+ "hyphenate": false,
+ "hyphenate_chars": 6,
+ "hyphenate_chars_after": 3,
+ "hyphenate_chars_before": 3,
+ "hyphenate_limit_lines": 2,
+ "ignore_collections_names": "",
+ "keep_cover_aspect": false,
+ "kepubify_template": "",
+ "letterbox_fs_covers": false,
+ "letterbox_fs_covers_color": "#000000",
+ "manage_collections": true,
+ "modify_css": false,
+ "override_kobo_replace_existing": true,
+ "png_covers": false,
+ "read_metadata": true,
+ "save_template": "{author_sort}/{title} - {authors}",
+ "show_archived_books": false,
+ "show_previews": false,
+ "show_recommendations": false,
+ "skip_failed": false,
+ "smarten_punctuation": false,
+ "subtitle_template": "",
+ "support_newer_firmware": false,
+ "update_bookstats": false,
+ "update_core_metadata": false,
+ "update_device_metadata": true,
+ "update_purchased_kepubs": false,
+ "update_series": true,
+ "update_subtitle": false,
+ "upload_covers": false,
+ "upload_encumbered": false,
+ "upload_grayscale": false,
+ "use_author_sort": false,
+ "use_collections_columns": true,
+ "use_collections_template": false,
+ "use_subdirs": true,
+ "use_template": false
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/device_drivers_USER_DEFINED.py.json b/dotfiles/system/.config/calibre/device_drivers_USER_DEFINED.py.json
new file mode 100644
index 0000000..7963676
--- /dev/null
+++ b/dotfiles/system/.config/calibre/device_drivers_USER_DEFINED.py.json
@@ -0,0 +1,24 @@
+{
+ "extra_customization": [
+ "",
+ "",
+ "",
+ null,
+ "",
+ "",
+ "",
+ "",
+ "",
+ "",
+ false
+ ],
+ "format_map": [
+ "epub",
+ "mobi",
+ "pdf"
+ ],
+ "read_metadata": true,
+ "save_template": "{author_sort}/{title} - {authors}",
+ "use_author_sort": false,
+ "use_subdirs": true
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/fonts/scanner_cache.json b/dotfiles/system/.config/calibre/fonts/scanner_cache.json
new file mode 100644
index 0000000..5abe2af
--- /dev/null
+++ b/dotfiles/system/.config/calibre/fonts/scanner_cache.json
@@ -0,0 +1,4 @@
+{
+ "fonts": {},
+ "version": 2
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/history.plist b/dotfiles/system/.config/calibre/history.plist
new file mode 100644
index 0000000..c3a71f2
--- /dev/null
+++ b/dotfiles/system/.config/calibre/history.plist
@@ -0,0 +1,22 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+ <key>lineedit_history_choose_library_dialog</key>
+ <array>
+ <string>/home/cjennings/sync/books</string>
+ <string>/home/cjennings/books</string>
+ <string>/home/cjennings/Library</string>
+ </array>
+ <key>lineedit_history_preferences_setting_auto_add_path</key>
+ <array>
+ <string>/home/cjennings/downloads/ebooks</string>
+ <string>/home/cjennings/</string>
+ <string>/home/cjennings/Downloads/ebooks</string>
+ <string>/home/cjennings/Downloads/eBooks</string>
+ <string>/home/cjennings/Documents/eBooks</string>
+ </array>
+ <key>lineedit_history_tag_browser_search</key>
+ <array/>
+</dict>
+</plist>
diff --git a/dotfiles/system/.config/calibre/icons-any.rcc b/dotfiles/system/.config/calibre/icons-any.rcc
new file mode 100644
index 0000000..7538401
--- /dev/null
+++ b/dotfiles/system/.config/calibre/icons-any.rcc
Binary files differ
diff --git a/dotfiles/system/.config/calibre/icons-dark.rcc b/dotfiles/system/.config/calibre/icons-dark.rcc
new file mode 100644
index 0000000..e0376d7
--- /dev/null
+++ b/dotfiles/system/.config/calibre/icons-dark.rcc
Binary files differ
diff --git a/dotfiles/system/.config/calibre/metadata-sources-cache.json b/dotfiles/system/.config/calibre/metadata-sources-cache.json
new file mode 100644
index 0000000..47283b4
--- /dev/null
+++ b/dotfiles/system/.config/calibre/metadata-sources-cache.json
@@ -0,0 +1,18 @@
+{
+ "amazon": "#!/usr/bin/env python\n# vim:fileencoding=UTF-8:ts=4:sw=4:sta:et:sts=4:ai\n# License: GPLv3 Copyright: 2011, Kovid Goyal <kovid at kovidgoyal.net>\nfrom __future__ import absolute_import, division, print_function, unicode_literals\n\nimport re\nimport socket\nimport string\nimport time\nfrom functools import partial\n\ntry:\n from queue import Empty, Queue\nexcept ImportError:\n from Queue import Empty, Queue\n\nfrom threading import Thread\n\ntry:\n from urllib.parse import urlparse\nexcept ImportError:\n from urlparse import urlparse\n\nfrom mechanize import HTTPError\n\nfrom calibre import as_unicode, browser, random_user_agent, xml_replace_entities\nfrom calibre.ebooks.metadata import check_isbn\nfrom calibre.ebooks.metadata.book.base import Metadata\nfrom calibre.ebooks.metadata.sources.base import Option, Source, fixauthors, fixcase\nfrom calibre.ebooks.oeb.base import urlquote\nfrom calibre.utils.icu import lower as icu_lower\nfrom calibre.utils.localization import canonicalize_lang\nfrom calibre.utils.random_ua import accept_header_for_ua\n\n\ndef sort_matches_preferring_kindle_editions(matches):\n upos_map = {url:i for i, url in enumerate(matches)}\n\n def skey(url):\n opos = upos_map[url]\n parts = url.split('/')\n try:\n idx = parts.index('dp')\n except Exception:\n idx = -1\n if idx < 0 or idx + 1 >= len(parts) or not parts[idx+1].startswith('B'):\n return 1, opos\n return 0, opos\n matches.sort(key=skey)\n return matches\n\n\ndef iri_quote_plus(url):\n ans = urlquote(url)\n if isinstance(ans, bytes):\n ans = ans.decode('utf-8')\n return ans.replace('%20', '+')\n\n\ndef user_agent_is_ok(ua):\n return 'Mobile/' not in ua and 'Mobile ' not in ua\n\n\nclass CaptchaError(Exception):\n pass\n\n\nclass SearchFailed(ValueError):\n pass\n\n\nclass UrlNotFound(ValueError):\n\n def __init__(self, url):\n ValueError.__init__(self, 'The URL {} was not found (HTTP 404)'.format(url))\n\n\nclass UrlTimedOut(ValueError):\n\n def __init__(self, url):\n ValueError.__init__(self, 'Timed out fetching {} try again later'.format(url))\n\n\ndef parse_html(raw):\n try:\n from html5_parser import parse\n except ImportError:\n # Old versions of calibre\n import html5lib\n return html5lib.parse(raw, treebuilder='lxml', namespaceHTMLElements=False)\n else:\n return parse(raw)\n\n\ndef parse_details_page(url, log, timeout, browser, domain):\n from lxml.html import tostring\n\n from calibre.ebooks.chardet import xml_to_unicode\n from calibre.utils.cleantext import clean_ascii_chars\n try:\n from calibre.ebooks.metadata.sources.update import search_engines_module\n get_data_for_cached_url = search_engines_module().get_data_for_cached_url\n except Exception:\n def get_data_for_cached_url(*a):\n return None\n raw = get_data_for_cached_url(url)\n if raw:\n log('Using cached details for url:', url)\n else:\n log('Downloading details from:', url)\n try:\n raw = browser.open_novisit(url, timeout=timeout).read().strip()\n except Exception as e:\n if callable(getattr(e, 'getcode', None)) and e.getcode() == 404:\n log.error('URL not found: %r' % url)\n raise UrlNotFound(url)\n attr = getattr(e, 'args', [None])\n attr = attr if attr else [None]\n if isinstance(attr[0], socket.timeout):\n msg = 'Details page timed out. Try again later.'\n log.error(msg)\n raise UrlTimedOut(url)\n else:\n msg = 'Failed to make details query: %r' % url\n log.exception(msg)\n raise ValueError('Could not make details query for {}'.format(url))\n\n oraw = raw\n if 'amazon.com.br' in url:\n # amazon.com.br serves utf-8 but has an incorrect latin1 <meta> tag\n raw = raw.decode('utf-8')\n raw = xml_to_unicode(raw, strip_encoding_pats=True,\n resolve_entities=True)[0]\n if '<title>404 - ' in raw:\n raise ValueError('Got a 404 page for: %r' % url)\n if '>Could not find the requested document in the cache.<' in raw:\n raise ValueError('No cached entry for %s found' % url)\n\n try:\n root = parse_html(clean_ascii_chars(raw))\n except Exception:\n msg = 'Failed to parse amazon details page: %r' % url\n log.exception(msg)\n raise ValueError(msg)\n if domain == 'jp':\n for a in root.xpath('//a[@href]'):\n if ('black-curtain-redirect.html' in a.get('href')) or ('/black-curtain/save-eligibility/black-curtain' in a.get('href')):\n url = a.get('href')\n if url:\n if url.startswith('/'):\n url = 'https://amazon.co.jp' + a.get('href')\n log('Black curtain redirect found, following')\n return parse_details_page(url, log, timeout, browser, domain)\n\n errmsg = root.xpath('//*[@id=\"errorMessage\"]')\n if errmsg:\n msg = 'Failed to parse amazon details page: %r' % url\n msg += tostring(errmsg, method='text', encoding='unicode').strip()\n log.error(msg)\n raise ValueError(msg)\n\n from css_selectors import Select\n selector = Select(root)\n return oraw, root, selector\n\n\ndef parse_asin(root, log, url):\n try:\n link = root.xpath('//link[@rel=\"canonical\" and @href]')\n for l in link:\n return l.get('href').rpartition('/')[-1]\n except Exception:\n log.exception('Error parsing ASIN for url: %r' % url)\n\n\nclass Worker(Thread): # Get details {{{\n\n '''\n Get book details from amazons book page in a separate thread\n '''\n\n def __init__(self, url, result_queue, browser, log, relevance, domain,\n plugin, timeout=20, testing=False, preparsed_root=None,\n cover_url_processor=None, filter_result=None):\n Thread.__init__(self)\n self.cover_url_processor = cover_url_processor\n self.preparsed_root = preparsed_root\n self.daemon = True\n self.testing = testing\n self.url, self.result_queue = url, result_queue\n self.log, self.timeout = log, timeout\n self.filter_result = filter_result or (lambda x, log: True)\n self.relevance, self.plugin = relevance, plugin\n self.browser = browser\n self.cover_url = self.amazon_id = self.isbn = None\n self.domain = domain\n from lxml.html import tostring\n self.tostring = tostring\n\n months = { # {{{\n 'de': {\n 1: ['jän', 'januar'],\n 2: ['februar'],\n 3: ['märz'],\n 5: ['mai'],\n 6: ['juni'],\n 7: ['juli'],\n 10: ['okt', 'oktober'],\n 12: ['dez', 'dezember']\n },\n 'it': {\n 1: ['gennaio', 'enn'],\n 2: ['febbraio', 'febbr'],\n 3: ['marzo'],\n 4: ['aprile'],\n 5: ['maggio', 'magg'],\n 6: ['giugno'],\n 7: ['luglio'],\n 8: ['agosto', 'ag'],\n 9: ['settembre', 'sett'],\n 10: ['ottobre', 'ott'],\n 11: ['novembre'],\n 12: ['dicembre', 'dic'],\n },\n 'fr': {\n 1: ['janv'],\n 2: ['févr'],\n 3: ['mars'],\n 4: ['avril'],\n 5: ['mai'],\n 6: ['juin'],\n 7: ['juil'],\n 8: ['août'],\n 9: ['sept'],\n 10: ['oct', 'octobre'],\n 11: ['nov', 'novembre'],\n 12: ['déc', 'décembre'],\n },\n 'br': {\n 1: ['janeiro'],\n 2: ['fevereiro'],\n 3: ['março'],\n 4: ['abril'],\n 5: ['maio'],\n 6: ['junho'],\n 7: ['julho'],\n 8: ['agosto'],\n 9: ['setembro'],\n 10: ['outubro'],\n 11: ['novembro'],\n 12: ['dezembro'],\n },\n 'es': {\n 1: ['enero'],\n 2: ['febrero'],\n 3: ['marzo'],\n 4: ['abril'],\n 5: ['mayo'],\n 6: ['junio'],\n 7: ['julio'],\n 8: ['agosto'],\n 9: ['septiembre', 'setiembre'],\n 10: ['octubre'],\n 11: ['noviembre'],\n 12: ['diciembre'],\n },\n 'se': {\n 1: ['januari'],\n 2: ['februari'],\n 3: ['mars'],\n 4: ['april'],\n 5: ['maj'],\n 6: ['juni'],\n 7: ['juli'],\n 8: ['augusti'],\n 9: ['september'],\n 10: ['oktober'],\n 11: ['november'],\n 12: ['december'],\n },\n 'jp': {\n 1: ['1月'],\n 2: ['2月'],\n 3: ['3月'],\n 4: ['4月'],\n 5: ['5月'],\n 6: ['6月'],\n 7: ['7月'],\n 8: ['8月'],\n 9: ['9月'],\n 10: ['10月'],\n 11: ['11月'],\n 12: ['12月'],\n },\n 'nl': {\n 1: ['januari'], 2: ['februari'], 3: ['maart'], 5: ['mei'], 6: ['juni'], 7: ['juli'], 8: ['augustus'], 10: ['oktober'],\n }\n\n } # }}}\n\n self.english_months = [None, 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun',\n 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec']\n self.months = months.get(self.domain, {})\n\n self.pd_xpath = '''\n //h2[text()=\"Product Details\" or \\\n text()=\"Produktinformation\" or \\\n text()=\"Dettagli prodotto\" or \\\n text()=\"Product details\" or \\\n text()=\"Détails sur le produit\" or \\\n text()=\"Detalles del producto\" or \\\n text()=\"Detalhes do produto\" or \\\n text()=\"Productgegevens\" or \\\n text()=\"基本信息\" or \\\n starts-with(text(), \"登録情報\")]/../div[@class=\"content\"]\n '''\n # Editor: is for Spanish\n self.publisher_xpath = '''\n descendant::*[starts-with(text(), \"Publisher:\") or \\\n starts-with(text(), \"Verlag:\") or \\\n starts-with(text(), \"Editore:\") or \\\n starts-with(text(), \"Editeur\") or \\\n starts-with(text(), \"Editor:\") or \\\n starts-with(text(), \"Editora:\") or \\\n starts-with(text(), \"Uitgever:\") or \\\n starts-with(text(), \"Utgivare:\") or \\\n starts-with(text(), \"出版社:\")]\n '''\n self.pubdate_xpath = '''\n descendant::*[starts-with(text(), \"Publication Date:\") or \\\n starts-with(text(), \"Audible.com Release Date:\")]\n '''\n self.publisher_names = {'Publisher', 'Uitgever', 'Verlag', 'Utgivare', 'Herausgeber',\n 'Editore', 'Editeur', 'Éditeur', 'Editor', 'Editora', '出版社'}\n\n self.language_xpath = '''\n descendant::*[\n starts-with(text(), \"Language:\") \\\n or text() = \"Language\" \\\n or text() = \"Sprache:\" \\\n or text() = \"Lingua:\" \\\n or text() = \"Idioma:\" \\\n or starts-with(text(), \"Langue\") \\\n or starts-with(text(), \"言語\") \\\n or starts-with(text(), \"Språk\") \\\n or starts-with(text(), \"语种\")\n ]\n '''\n self.language_names = {'Language', 'Sprache', 'Språk',\n 'Lingua', 'Idioma', 'Langue', '言語', 'Taal', '语种'}\n\n self.tags_xpath = '''\n descendant::h2[\n text() = \"Look for Similar Items by Category\" or\n text() = \"Ähnliche Artikel finden\" or\n text() = \"Buscar productos similares por categoría\" or\n text() = \"Ricerca articoli simili per categoria\" or\n text() = \"Rechercher des articles similaires par rubrique\" or\n text() = \"Procure por items similares por categoria\" or\n text() = \"関連商品を探す\"\n ]/../descendant::ul/li\n '''\n\n self.ratings_pat = re.compile(\n r'([0-9.,]+) ?(out of|von|van|su|étoiles sur|つ星のうち|de un máximo de|de|av) '\n r'([\\d\\.]+)( (stars|Sternen|stelle|estrellas|estrelas|sterren|stjärnor)){0,1}'\n )\n self.ratings_pat_cn = re.compile(r'([0-9.]+) 颗星,最多 5 颗星')\n self.ratings_pat_jp = re.compile(r'\\d+つ星のうち([\\d\\.]+)')\n\n lm = {\n 'eng': ('English', 'Englisch', 'Engels', 'Engelska'),\n 'fra': ('French', 'Français'),\n 'ita': ('Italian', 'Italiano'),\n 'deu': ('German', 'Deutsch'),\n 'spa': ('Spanish', 'Espa\\xf1ol', 'Espaniol'),\n 'jpn': ('Japanese', '日本語'),\n 'por': ('Portuguese', 'Português'),\n 'nld': ('Dutch', 'Nederlands',),\n 'chs': ('Chinese', '中文', '简体中文'),\n 'swe': ('Swedish', 'Svenska'),\n }\n self.lang_map = {}\n for code, names in lm.items():\n for name in names:\n self.lang_map[name] = code\n\n self.series_pat = re.compile(\n r'''\n \\|\\s* # Prefix\n (Series)\\s*:\\s* # Series declaration\n (?P<series>.+?)\\s+ # The series name\n \\((Book)\\s* # Book declaration\n (?P<index>[0-9.]+) # Series index\n \\s*\\)\n ''', re.X)\n\n def delocalize_datestr(self, raw):\n if self.domain == 'cn':\n return raw.replace('年', '-').replace('月', '-').replace('日', '')\n if not self.months:\n return raw\n ans = raw.lower()\n for i, vals in self.months.items():\n for x in vals:\n ans = ans.replace(x, self.english_months[i])\n ans = ans.replace(' de ', ' ')\n return ans\n\n def run(self):\n try:\n self.get_details()\n except:\n self.log.exception('get_details failed for url: %r' % self.url)\n\n def get_details(self):\n if self.preparsed_root is None:\n raw, root, selector = parse_details_page(\n self.url, self.log, self.timeout, self.browser, self.domain)\n else:\n raw, root, selector = self.preparsed_root\n\n from css_selectors import Select\n self.selector = Select(root)\n self.parse_details(raw, root)\n\n def parse_details(self, raw, root):\n asin = parse_asin(root, self.log, self.url)\n if not asin and root.xpath('//form[@action=\"/errors/validateCaptcha\"]'):\n raise CaptchaError(\n 'Amazon returned a CAPTCHA page, probably because you downloaded too many books. Wait for some time and try again.')\n if self.testing:\n import tempfile\n import uuid\n with tempfile.NamedTemporaryFile(prefix=(asin or type('')(uuid.uuid4())) + '_',\n suffix='.html', delete=False) as f:\n f.write(raw)\n print('Downloaded HTML for', asin, 'saved in', f.name)\n\n try:\n title = self.parse_title(root)\n except:\n self.log.exception('Error parsing title for url: %r' % self.url)\n title = None\n\n try:\n authors = self.parse_authors(root)\n except:\n self.log.exception('Error parsing authors for url: %r' % self.url)\n authors = []\n\n if not title or not authors or not asin:\n self.log.error(\n 'Could not find title/authors/asin for %r' % self.url)\n self.log.error('ASIN: %r Title: %r Authors: %r' % (asin, title,\n authors))\n return\n\n mi = Metadata(title, authors)\n idtype = 'amazon' if self.domain == 'com' else 'amazon_' + self.domain\n mi.set_identifier(idtype, asin)\n self.amazon_id = asin\n\n try:\n mi.rating = self.parse_rating(root)\n except:\n self.log.exception('Error parsing ratings for url: %r' % self.url)\n\n try:\n mi.comments = self.parse_comments(root, raw)\n except:\n self.log.exception('Error parsing comments for url: %r' % self.url)\n\n try:\n series, series_index = self.parse_series(root)\n if series:\n mi.series, mi.series_index = series, series_index\n elif self.testing:\n mi.series, mi.series_index = 'Dummy series for testing', 1\n except:\n self.log.exception('Error parsing series for url: %r' % self.url)\n\n try:\n mi.tags = self.parse_tags(root)\n except:\n self.log.exception('Error parsing tags for url: %r' % self.url)\n\n try:\n self.cover_url = self.parse_cover(root, raw)\n except:\n self.log.exception('Error parsing cover for url: %r' % self.url)\n if self.cover_url_processor is not None and self.cover_url and self.cover_url.startswith('/'):\n self.cover_url = self.cover_url_processor(self.cover_url)\n mi.has_cover = bool(self.cover_url)\n\n detail_bullets = root.xpath('//*[@data-feature-name=\"detailBullets\"]')\n non_hero = tuple(self.selector(\n 'div#bookDetails_container_div div#nonHeroSection')) or tuple(self.selector(\n '#productDetails_techSpec_sections'))\n feature_and_detail_bullets = root.xpath('//*[@data-feature-name=\"featureBulletsAndDetailBullets\"]')\n if detail_bullets:\n self.parse_detail_bullets(root, mi, detail_bullets[0])\n elif non_hero:\n try:\n self.parse_new_details(root, mi, non_hero[0])\n except:\n self.log.exception(\n 'Failed to parse new-style book details section')\n elif feature_and_detail_bullets:\n self.parse_detail_bullets(root, mi, feature_and_detail_bullets[0], ul_selector='ul')\n\n else:\n pd = root.xpath(self.pd_xpath)\n if pd:\n pd = pd[0]\n\n try:\n isbn = self.parse_isbn(pd)\n if isbn:\n self.isbn = mi.isbn = isbn\n except:\n self.log.exception(\n 'Error parsing ISBN for url: %r' % self.url)\n\n try:\n mi.publisher = self.parse_publisher(pd)\n except:\n self.log.exception(\n 'Error parsing publisher for url: %r' % self.url)\n\n try:\n mi.pubdate = self.parse_pubdate(pd)\n except:\n self.log.exception(\n 'Error parsing publish date for url: %r' % self.url)\n\n try:\n lang = self.parse_language(pd)\n if lang:\n mi.language = lang\n except:\n self.log.exception(\n 'Error parsing language for url: %r' % self.url)\n\n else:\n self.log.warning(\n 'Failed to find product description for url: %r' % self.url)\n\n mi.source_relevance = self.relevance\n\n if self.amazon_id:\n if self.isbn:\n self.plugin.cache_isbn_to_identifier(self.isbn, self.amazon_id)\n if self.cover_url:\n self.plugin.cache_identifier_to_cover_url(self.amazon_id,\n self.cover_url)\n\n self.plugin.clean_downloaded_metadata(mi)\n\n if self.filter_result(mi, self.log):\n self.result_queue.put(mi)\n\n def totext(self, elem, only_printable=False):\n res = self.tostring(elem, encoding='unicode', method='text')\n if only_printable:\n try:\n filtered_characters = [s for s in res if s.isprintable()]\n except AttributeError:\n filtered_characters = [s for s in res if s in string.printable]\n res = ''.join(filtered_characters)\n return res.strip()\n\n def parse_title(self, root):\n\n def sanitize_title(title):\n ans = title.strip()\n if not ans.startswith('['):\n ans = re.sub(r'[(\\[].*[)\\]]', '', title).strip()\n return ans\n\n h1 = root.xpath('//h1[@id=\"title\"]')\n if h1:\n h1 = h1[0]\n for child in h1.xpath('./*[contains(@class, \"a-color-secondary\")]'):\n h1.remove(child)\n return sanitize_title(self.totext(h1))\n # audiobooks\n elem = root.xpath('//*[@id=\"productTitle\"]')\n if elem:\n return sanitize_title(self.totext(elem[0]))\n tdiv = root.xpath('//h1[contains(@class, \"parseasinTitle\")]')\n if not tdiv:\n span = root.xpath('//*[@id=\"ebooksTitle\"]')\n if span:\n return sanitize_title(self.totext(span[0]))\n h1 = root.xpath('//h1[@data-feature-name=\"title\"]')\n if h1:\n return sanitize_title(self.totext(h1[0]))\n raise ValueError('No title block found')\n tdiv = tdiv[0]\n actual_title = tdiv.xpath('descendant::*[@id=\"btAsinTitle\"]')\n if actual_title:\n title = self.tostring(actual_title[0], encoding='unicode',\n method='text').strip()\n else:\n title = self.tostring(tdiv, encoding='unicode',\n method='text').strip()\n return sanitize_title(title)\n\n def parse_authors(self, root):\n for sel in (\n '#byline .author .contributorNameID',\n '#byline .author a.a-link-normal',\n '#bylineInfo .author .contributorNameID',\n '#bylineInfo .author a.a-link-normal',\n '#bylineInfo #bylineContributor',\n '#bylineInfo #contributorLink',\n ):\n matches = tuple(self.selector(sel))\n if matches:\n authors = [self.totext(x) for x in matches]\n return [a for a in authors if a]\n\n x = '//h1[contains(@class, \"parseasinTitle\")]/following-sibling::span/*[(name()=\"a\" and @href) or (name()=\"span\" and @class=\"contributorNameTrigger\")]'\n aname = root.xpath(x)\n if not aname:\n aname = root.xpath('''\n //h1[contains(@class, \"parseasinTitle\")]/following-sibling::*[(name()=\"a\" and @href) or (name()=\"span\" and @class=\"contributorNameTrigger\")]\n ''')\n for x in aname:\n x.tail = ''\n authors = [self.tostring(x, encoding='unicode', method='text').strip() for x\n in aname]\n authors = [a for a in authors if a]\n return authors\n\n def parse_rating(self, root):\n for x in root.xpath('//div[@id=\"cpsims-feature\" or @id=\"purchase-sims-feature\" or @id=\"rhf\"]'):\n # Remove the similar books section as it can cause spurious\n # ratings matches\n x.getparent().remove(x)\n\n rating_paths = (\n '//div[@data-feature-name=\"averageCustomerReviews\" or @id=\"averageCustomerReviews\"]',\n '//div[@class=\"jumpBar\"]/descendant::span[contains(@class,\"asinReviewsSummary\")]',\n '//div[@class=\"buying\"]/descendant::span[contains(@class,\"asinReviewsSummary\")]',\n '//span[@class=\"crAvgStars\"]/descendant::span[contains(@class,\"asinReviewsSummary\")]'\n )\n ratings = None\n for p in rating_paths:\n ratings = root.xpath(p)\n if ratings:\n break\n\n def parse_ratings_text(text):\n try:\n m = self.ratings_pat.match(text)\n return float(m.group(1).replace(',', '.')) / float(m.group(3)) * 5\n except Exception:\n pass\n\n if ratings:\n ratings = ratings[0]\n for elem in ratings.xpath('descendant::*[@title]'):\n t = elem.get('title').strip()\n if self.domain == 'cn':\n m = self.ratings_pat_cn.match(t)\n if m is not None:\n return float(m.group(1))\n elif self.domain == 'jp':\n m = self.ratings_pat_jp.match(t)\n if m is not None:\n return float(m.group(1))\n else:\n ans = parse_ratings_text(t)\n if ans is not None:\n return ans\n for elem in ratings.xpath('descendant::span[@class=\"a-icon-alt\"]'):\n t = self.tostring(\n elem, encoding='unicode', method='text', with_tail=False).strip()\n ans = parse_ratings_text(t)\n if ans is not None:\n return ans\n else:\n # found in kindle book pages on amazon.com\n for x in root.xpath('//a[@id=\"acrCustomerReviewLink\"]'):\n spans = x.xpath('./span')\n if spans:\n txt = self.tostring(spans[0], method='text', encoding='unicode', with_tail=False).strip()\n try:\n return float(txt.replace(',', '.'))\n except Exception:\n pass\n\n def _render_comments(self, desc):\n from calibre.library.comments import sanitize_comments_html\n\n for c in desc.xpath('descendant::noscript'):\n c.getparent().remove(c)\n for c in desc.xpath('descendant::*[@class=\"seeAll\" or'\n ' @class=\"emptyClear\" or @id=\"collapsePS\" or'\n ' @id=\"expandPS\"]'):\n c.getparent().remove(c)\n for b in desc.xpath('descendant::b[@style]'):\n # Bing highlights search results\n s = b.get('style', '')\n if 'color' in s:\n b.tag = 'span'\n del b.attrib['style']\n\n for a in desc.xpath('descendant::a[@href]'):\n del a.attrib['href']\n a.tag = 'span'\n for a in desc.xpath('descendant::span[@class=\"a-text-italic\"]'):\n a.tag = 'i'\n for a in desc.xpath('descendant::span[@class=\"a-text-bold\"]'):\n a.tag = 'b'\n desc = self.tostring(desc, method='html', encoding='unicode').strip()\n desc = xml_replace_entities(desc, 'utf-8')\n\n # Encoding bug in Amazon data U+fffd (replacement char)\n # in some examples it is present in place of '\n desc = desc.replace('\\ufffd', \"'\")\n # remove all attributes from tags\n desc = re.sub(r'<([a-zA-Z0-9]+)\\s[^>]+>', r'<\\1>', desc)\n # Collapse whitespace\n # desc = re.sub(r'\\n+', '\\n', desc)\n # desc = re.sub(r' +', ' ', desc)\n # Remove the notice about text referring to out of print editions\n desc = re.sub(r'(?s)<em>--This text ref.*?</em>', '', desc)\n # Remove comments\n desc = re.sub(r'(?s)<!--.*?-->', '', desc)\n return sanitize_comments_html(desc)\n\n def parse_comments(self, root, raw):\n try:\n from urllib.parse import unquote\n except ImportError:\n from urllib import unquote\n ans = ''\n ovr = tuple(self.selector('#drengr_MobileTabbedDescriptionOverviewContent_feature_div')) or tuple(\n self.selector('#drengr_DesktopTabbedDescriptionOverviewContent_feature_div'))\n if ovr:\n ovr = ovr[0]\n ovr.tag = 'div'\n ans = self._render_comments(ovr)\n ovr = tuple(self.selector('#drengr_MobileTabbedDescriptionEditorialsContent_feature_div')) or tuple(\n self.selector('#drengr_DesktopTabbedDescriptionEditorialsContent_feature_div'))\n if ovr:\n ovr = ovr[0]\n ovr.tag = 'div'\n ans += self._render_comments(ovr)\n else:\n ns = tuple(self.selector('#bookDescription_feature_div noscript'))\n if ns:\n ns = ns[0]\n if len(ns) == 0 and ns.text:\n import html5lib\n\n # html5lib parsed noscript as CDATA\n ns = html5lib.parseFragment(\n '<div>%s</div>' % (ns.text), treebuilder='lxml', namespaceHTMLElements=False)[0]\n else:\n ns.tag = 'div'\n ans = self._render_comments(ns)\n else:\n desc = root.xpath('//div[@id=\"ps-content\"]/div[@class=\"content\"]')\n if desc:\n ans = self._render_comments(desc[0])\n else:\n ns = tuple(self.selector('#bookDescription_feature_div .a-expander-content'))\n if ns:\n ans = self._render_comments(ns[0])\n # audiobooks\n if not ans:\n elem = root.xpath('//*[@id=\"audible_desktopTabbedDescriptionOverviewContent_feature_div\"]')\n if elem:\n ans = self._render_comments(elem[0])\n desc = root.xpath(\n '//div[@id=\"productDescription\"]/*[@class=\"content\"]')\n if desc:\n ans += self._render_comments(desc[0])\n else:\n # Idiot chickens from amazon strike again. This data is now stored\n # in a JS variable inside a script tag URL encoded.\n m = re.search(br'var\\s+iframeContent\\s*=\\s*\"([^\"]+)\"', raw)\n if m is not None:\n try:\n text = unquote(m.group(1)).decode('utf-8')\n nr = parse_html(text)\n desc = nr.xpath(\n '//div[@id=\"productDescription\"]/*[@class=\"content\"]')\n if desc:\n ans += self._render_comments(desc[0])\n except Exception as e:\n self.log.warn(\n 'Parsing of obfuscated product description failed with error: %s' % as_unicode(e))\n else:\n desc = root.xpath('//div[@id=\"productDescription_fullView\"]')\n if desc:\n ans += self._render_comments(desc[0])\n\n return ans\n\n def parse_series(self, root):\n ans = (None, None)\n\n # This is found on kindle pages for books on amazon.com\n series = root.xpath('//*[@id=\"rpi-attribute-book_details-series\"]')\n if series:\n spans = series[0].xpath('descendant::span')\n if spans:\n texts = [self.tostring(x, encoding='unicode', method='text', with_tail=False).strip() for x in spans]\n texts = list(filter(None, texts))\n if len(texts) == 2:\n idxinfo, series = texts\n m = re.search(r'[0-9.]+', idxinfo.strip())\n if m is not None:\n ans = series, float(m.group())\n return ans\n\n # This is found on the paperback/hardback pages for books on amazon.com\n series = root.xpath('//div[@data-feature-name=\"seriesTitle\"]')\n if series:\n series = series[0]\n spans = series.xpath('./span')\n if spans:\n raw = self.tostring(\n spans[0], encoding='unicode', method='text', with_tail=False).strip()\n m = re.search(r'\\s+([0-9.]+)$', raw.strip())\n if m is not None:\n series_index = float(m.group(1))\n s = series.xpath('./a[@id=\"series-page-link\"]')\n if s:\n series = self.tostring(\n s[0], encoding='unicode', method='text', with_tail=False).strip()\n if series:\n ans = (series, series_index)\n else:\n series = root.xpath('//div[@id=\"seriesBulletWidget_feature_div\"]')\n if series:\n a = series[0].xpath('descendant::a')\n if a:\n raw = self.tostring(a[0], encoding='unicode', method='text', with_tail=False)\n if self.domain == 'jp':\n m = re.search(r'(?P<index>[0-9.]+)\\s*(?:巻|冊)\\s*\\(全\\s*([0-9.]+)\\s*(?:巻|冊)\\):\\s*(?P<series>.+)', raw.strip())\n else:\n m = re.search(r'(?:Book|Libro|Buch)\\s+(?P<index>[0-9.]+)\\s+(?:of|de|von)\\s+([0-9.]+)\\s*:\\s*(?P<series>.+)', raw.strip())\n if m is not None:\n ans = (m.group('series').strip(), float(m.group('index')))\n\n # This is found on Kindle edition pages on amazon.com\n if ans == (None, None):\n for span in root.xpath('//div[@id=\"aboutEbooksSection\"]//li/span'):\n text = (span.text or '').strip()\n m = re.match(r'Book\\s+([0-9.]+)', text)\n if m is not None:\n series_index = float(m.group(1))\n a = span.xpath('./a[@href]')\n if a:\n series = self.tostring(\n a[0], encoding='unicode', method='text', with_tail=False).strip()\n if series:\n ans = (series, series_index)\n # This is found on newer Kindle edition pages on amazon.com\n if ans == (None, None):\n for b in root.xpath('//div[@id=\"reviewFeatureGroup\"]/span/b'):\n text = (b.text or '').strip()\n m = re.match(r'Book\\s+([0-9.]+)', text)\n if m is not None:\n series_index = float(m.group(1))\n a = b.getparent().xpath('./a[@href]')\n if a:\n series = self.tostring(\n a[0], encoding='unicode', method='text', with_tail=False).partition('(')[0].strip()\n if series:\n ans = series, series_index\n\n if ans == (None, None):\n desc = root.xpath('//div[@id=\"ps-content\"]/div[@class=\"buying\"]')\n if desc:\n raw = self.tostring(desc[0], method='text', encoding='unicode')\n raw = re.sub(r'\\s+', ' ', raw)\n match = self.series_pat.search(raw)\n if match is not None:\n s, i = match.group('series'), float(match.group('index'))\n if s:\n ans = (s, i)\n if ans[0]:\n ans = (re.sub(r'\\s+Series$', '', ans[0]).strip(), ans[1])\n ans = (re.sub(r'\\(.+?\\s+Series\\)$', '', ans[0]).strip(), ans[1])\n return ans\n\n def parse_tags(self, root):\n ans = []\n exclude_tokens = {'kindle', 'a-z'}\n exclude = {'special features', 'by authors',\n 'authors & illustrators', 'books', 'new; used & rental textbooks'}\n seen = set()\n for li in root.xpath(self.tags_xpath):\n for i, a in enumerate(li.iterdescendants('a')):\n if i > 0:\n # we ignore the first category since it is almost always\n # too broad\n raw = (a.text or '').strip().replace(',', ';')\n lraw = icu_lower(raw)\n tokens = frozenset(lraw.split())\n if raw and lraw not in exclude and not tokens.intersection(exclude_tokens) and lraw not in seen:\n ans.append(raw)\n seen.add(lraw)\n return ans\n\n def parse_cover(self, root, raw=b''):\n # Look for the image URL in javascript, using the first image in the\n # image gallery as the cover\n import json\n imgpat = re.compile(r'\"hiRes\":\"(.+?)\",\"thumb\"')\n for script in root.xpath('//script'):\n m = imgpat.search(script.text or '')\n if m is not None:\n return m.group(1)\n imgpat = re.compile(r''''imageGalleryData'\\s*:\\s*(\\[\\s*{.+])''')\n for script in root.xpath('//script'):\n m = imgpat.search(script.text or '')\n if m is not None:\n try:\n return json.loads(m.group(1))[0]['mainUrl']\n except Exception:\n continue\n\n def clean_img_src(src):\n parts = src.split('/')\n if len(parts) > 3:\n bn = parts[-1]\n sparts = bn.split('_')\n if len(sparts) > 2:\n bn = re.sub(r'\\.\\.jpg$', '.jpg', (sparts[0] + sparts[-1]))\n return ('/'.join(parts[:-1])) + '/' + bn\n\n imgpat2 = re.compile(r'var imageSrc = \"([^\"]+)\"')\n for script in root.xpath('//script'):\n m = imgpat2.search(script.text or '')\n if m is not None:\n src = m.group(1)\n url = clean_img_src(src)\n if url:\n return url\n\n imgs = root.xpath(\n '//img[(@id=\"prodImage\" or @id=\"original-main-image\" or @id=\"main-image\" or @id=\"main-image-nonjs\") and @src]')\n if not imgs:\n imgs = (\n root.xpath('//div[@class=\"main-image-inner-wrapper\"]/img[@src]') or\n root.xpath('//div[@id=\"main-image-container\" or @id=\"ebooks-main-image-container\"]//img[@src]') or\n root.xpath(\n '//div[@id=\"mainImageContainer\"]//img[@data-a-dynamic-image]')\n )\n for img in imgs:\n try:\n idata = json.loads(img.get('data-a-dynamic-image'))\n except Exception:\n imgs = ()\n else:\n mwidth = 0\n try:\n url = None\n for iurl, (width, height) in idata.items():\n if width > mwidth:\n mwidth = width\n url = iurl\n\n return url\n except Exception:\n pass\n\n for img in imgs:\n src = img.get('src')\n if 'data:' in src:\n continue\n if 'loading-' in src:\n js_img = re.search(br'\"largeImage\":\"(https?://[^\"]+)\",', raw)\n if js_img:\n src = js_img.group(1).decode('utf-8')\n if ('/no-image-avail' not in src and 'loading-' not in src and '/no-img-sm' not in src):\n self.log('Found image: %s' % src)\n url = clean_img_src(src)\n if url:\n return url\n\n def parse_detail_bullets(self, root, mi, container, ul_selector='.detail-bullet-list'):\n try:\n ul = next(self.selector(ul_selector, root=container))\n except StopIteration:\n return\n for span in self.selector('.a-list-item', root=ul):\n cells = span.xpath('./span')\n if len(cells) >= 2:\n self.parse_detail_cells(mi, cells[0], cells[1])\n\n def parse_new_details(self, root, mi, non_hero):\n table = non_hero.xpath('descendant::table')[0]\n for tr in table.xpath('descendant::tr'):\n cells = tr.xpath('descendant::*[local-name()=\"td\" or local-name()=\"th\"]')\n if len(cells) == 2:\n self.parse_detail_cells(mi, cells[0], cells[1])\n\n def parse_detail_cells(self, mi, c1, c2):\n name = self.totext(c1, only_printable=True).strip().strip(':').strip()\n val = self.totext(c2)\n val = val.replace('\\u200e', '').replace('\\u200f', '')\n if not val:\n return\n if name in self.language_names:\n ans = self.lang_map.get(val)\n if not ans:\n ans = canonicalize_lang(val)\n if ans:\n mi.language = ans\n elif name in self.publisher_names:\n pub = val.partition(';')[0].partition('(')[0].strip()\n if pub:\n mi.publisher = pub\n date = val.rpartition('(')[-1].replace(')', '').strip()\n try:\n from calibre.utils.date import parse_only_date\n date = self.delocalize_datestr(date)\n mi.pubdate = parse_only_date(date, assume_utc=True)\n except:\n self.log.exception('Failed to parse pubdate: %s' % val)\n elif name in {'ISBN', 'ISBN-10', 'ISBN-13'}:\n ans = check_isbn(val)\n if ans:\n self.isbn = mi.isbn = ans\n elif name in {'Publication date'}:\n from calibre.utils.date import parse_only_date\n date = self.delocalize_datestr(val)\n mi.pubdate = parse_only_date(date, assume_utc=True)\n\n def parse_isbn(self, pd):\n items = pd.xpath(\n 'descendant::*[starts-with(text(), \"ISBN\")]')\n if not items:\n items = pd.xpath(\n 'descendant::b[contains(text(), \"ISBN:\")]')\n for x in reversed(items):\n if x.tail:\n ans = check_isbn(x.tail.strip())\n if ans:\n return ans\n\n def parse_publisher(self, pd):\n for x in reversed(pd.xpath(self.publisher_xpath)):\n if x.tail:\n ans = x.tail.partition(';')[0]\n return ans.partition('(')[0].strip()\n\n def parse_pubdate(self, pd):\n from calibre.utils.date import parse_only_date\n for x in reversed(pd.xpath(self.pubdate_xpath)):\n if x.tail:\n date = x.tail.strip()\n date = self.delocalize_datestr(date)\n try:\n return parse_only_date(date, assume_utc=True)\n except Exception:\n pass\n for x in reversed(pd.xpath(self.publisher_xpath)):\n if x.tail:\n ans = x.tail\n date = ans.rpartition('(')[-1].replace(')', '').strip()\n date = self.delocalize_datestr(date)\n try:\n return parse_only_date(date, assume_utc=True)\n except Exception:\n pass\n\n def parse_language(self, pd):\n for x in reversed(pd.xpath(self.language_xpath)):\n if x.tail:\n raw = x.tail.strip().partition(',')[0].strip()\n ans = self.lang_map.get(raw, None)\n if ans:\n return ans\n ans = canonicalize_lang(ans)\n if ans:\n return ans\n# }}}\n\n\nclass Amazon(Source):\n\n name = 'Amazon.com'\n version = (1, 3, 12)\n minimum_calibre_version = (2, 82, 0)\n description = _('Downloads metadata and covers from Amazon')\n\n capabilities = frozenset(('identify', 'cover'))\n touched_fields = frozenset(('title', 'authors', 'identifier:amazon',\n 'rating', 'comments', 'publisher', 'pubdate',\n 'languages', 'series', 'tags'))\n has_html_comments = True\n supports_gzip_transfer_encoding = True\n prefer_results_with_isbn = False\n\n AMAZON_DOMAINS = {\n 'com': _('US'),\n 'fr': _('France'),\n 'de': _('Germany'),\n 'uk': _('UK'),\n 'au': _('Australia'),\n 'it': _('Italy'),\n 'jp': _('Japan'),\n 'es': _('Spain'),\n 'br': _('Brazil'),\n 'in': _('India'),\n 'nl': _('Netherlands'),\n 'cn': _('China'),\n 'ca': _('Canada'),\n 'se': _('Sweden'),\n }\n\n SERVERS = {\n 'auto': _('Choose server automatically'),\n 'amazon': _('Amazon servers'),\n 'bing': _('Bing search cache'),\n 'google': _('Google search cache'),\n 'wayback': _('Wayback machine cache (slow)'),\n 'ddg': _('DuckDuckGo search and Google cache'),\n }\n\n options = (\n Option('domain', 'choices', 'com', _('Amazon country website to use:'),\n _('Metadata from Amazon will be fetched using this '\n \"country's Amazon website.\"), choices=AMAZON_DOMAINS),\n Option('server', 'choices', 'auto', _('Server to get data from:'),\n _(\n 'Amazon has started blocking attempts to download'\n ' metadata from its servers. To get around this problem,'\n ' calibre can fetch the Amazon data from many different'\n ' places where it is cached. Choose the source you prefer.'\n ), choices=SERVERS),\n Option('use_mobi_asin', 'bool', False, _('Use the MOBI-ASIN for metadata search'),\n _(\n 'Enable this option to search for metadata with an'\n ' ASIN identifier from the MOBI file at the current country website,'\n ' unless any other amazon id is available. Note that if the'\n ' MOBI file came from a different Amazon country store, you could get'\n ' incorrect results.'\n )),\n Option('prefer_kindle_edition', 'bool', False, _('Prefer the Kindle edition, when available'),\n _(\n 'When searching for a book and the search engine returns both paper and Kindle editions,'\n ' always prefer the Kindle edition, instead of whatever the search engine returns at the'\n ' top.')\n ),\n )\n\n def __init__(self, *args, **kwargs):\n Source.__init__(self, *args, **kwargs)\n self.set_amazon_id_touched_fields()\n\n def id_from_url(self, url):\n from polyglot.urllib import urlparse\n purl = urlparse(url)\n if purl.netloc and purl.path and '/dp/' in purl.path:\n host_parts = tuple(x.lower() for x in purl.netloc.split('.'))\n if 'amazon' in host_parts:\n domain = host_parts[-1]\n parts = purl.path.split('/')\n idx = parts.index('dp')\n try:\n val = parts[idx+1]\n except IndexError:\n return\n aid = 'amazon' if domain == 'com' else ('amazon_' + domain)\n return aid, val\n\n def test_fields(self, mi):\n '''\n Return the first field from self.touched_fields that is null on the\n mi object\n '''\n for key in self.touched_fields:\n if key.startswith('identifier:'):\n key = key.partition(':')[-1]\n if key == 'amazon':\n if self.domain != 'com':\n key += '_' + self.domain\n if not mi.has_identifier(key):\n return 'identifier: ' + key\n elif mi.is_null(key):\n return key\n\n @property\n def browser(self):\n br = self._browser\n if br is None:\n ua = 'Mobile '\n while not user_agent_is_ok(ua):\n ua = random_user_agent(allow_ie=False)\n # ua = 'Mozilla/5.0 (Linux; Android 8.0.0; VTR-L29; rv:63.0) Gecko/20100101 Firefox/63.0'\n self._browser = br = browser(user_agent=ua)\n br.set_handle_gzip(True)\n if self.use_search_engine:\n br.addheaders += [\n ('Accept', accept_header_for_ua(ua)),\n ('Upgrade-insecure-requests', '1'),\n ]\n else:\n br.addheaders += [\n ('Accept', accept_header_for_ua(ua)),\n ('Upgrade-insecure-requests', '1'),\n ('Referer', self.referrer_for_domain()),\n ]\n return br\n\n def save_settings(self, *args, **kwargs):\n Source.save_settings(self, *args, **kwargs)\n self.set_amazon_id_touched_fields()\n\n def set_amazon_id_touched_fields(self):\n ident_name = 'identifier:amazon'\n if self.domain != 'com':\n ident_name += '_' + self.domain\n tf = [x for x in self.touched_fields if not\n x.startswith('identifier:amazon')] + [ident_name]\n self.touched_fields = frozenset(tf)\n\n def get_domain_and_asin(self, identifiers, extra_domains=()):\n identifiers = {k.lower(): v for k, v in identifiers.items()}\n for key, val in identifiers.items():\n if key in ('amazon', 'asin'):\n return 'com', val\n if key.startswith('amazon_'):\n domain = key.partition('_')[-1]\n if domain and (domain in self.AMAZON_DOMAINS or domain in extra_domains):\n return domain, val\n if self.prefs['use_mobi_asin']:\n val = identifiers.get('mobi-asin')\n if val is not None:\n return self.domain, val\n return None, None\n\n def referrer_for_domain(self, domain=None):\n domain = domain or self.domain\n return {\n 'uk': 'https://www.amazon.co.uk/',\n 'au': 'https://www.amazon.com.au/',\n 'br': 'https://www.amazon.com.br/',\n 'jp': 'https://www.amazon.co.jp/',\n 'mx': 'https://www.amazon.com.mx/',\n }.get(domain, 'https://www.amazon.%s/' % domain)\n\n def _get_book_url(self, identifiers): # {{{\n domain, asin = self.get_domain_and_asin(\n identifiers, extra_domains=('au', 'ca'))\n if domain and asin:\n url = None\n r = self.referrer_for_domain(domain)\n if r is not None:\n url = r + 'dp/' + asin\n if url:\n idtype = 'amazon' if domain == 'com' else 'amazon_' + domain\n return domain, idtype, asin, url\n\n def get_book_url(self, identifiers):\n ans = self._get_book_url(identifiers)\n if ans is not None:\n return ans[1:]\n\n def get_book_url_name(self, idtype, idval, url):\n if idtype == 'amazon':\n return self.name\n return 'A' + idtype.replace('_', '.')[1:]\n # }}}\n\n @property\n def domain(self):\n x = getattr(self, 'testing_domain', None)\n if x is not None:\n return x\n domain = self.prefs['domain']\n if domain not in self.AMAZON_DOMAINS:\n domain = 'com'\n\n return domain\n\n @property\n def server(self):\n x = getattr(self, 'testing_server', None)\n if x is not None:\n return x\n server = self.prefs['server']\n if server not in self.SERVERS:\n server = 'auto'\n return server\n\n @property\n def use_search_engine(self):\n return self.server != 'amazon'\n\n def clean_downloaded_metadata(self, mi):\n docase = (\n mi.language == 'eng' or\n (mi.is_null('language') and self.domain in {'com', 'uk', 'au'})\n )\n if mi.title and docase:\n # Remove series information from title\n m = re.search(r'\\S+\\s+(\\(.+?\\s+Book\\s+\\d+\\))$', mi.title)\n if m is not None:\n mi.title = mi.title.replace(m.group(1), '').strip()\n mi.title = fixcase(mi.title)\n mi.authors = fixauthors(mi.authors)\n if mi.tags and docase:\n mi.tags = list(map(fixcase, mi.tags))\n mi.isbn = check_isbn(mi.isbn)\n if mi.series and docase:\n mi.series = fixcase(mi.series)\n if mi.title and mi.series:\n for pat in (r':\\s*Book\\s+\\d+\\s+of\\s+%s$', r'\\(%s\\)$', r':\\s*%s\\s+Book\\s+\\d+$'):\n pat = pat % re.escape(mi.series)\n q = re.sub(pat, '', mi.title, flags=re.I).strip()\n if q and q != mi.title:\n mi.title = q\n break\n\n def get_website_domain(self, domain):\n return {'uk': 'co.uk', 'jp': 'co.jp', 'br': 'com.br', 'au': 'com.au'}.get(domain, domain)\n\n def create_query(self, log, title=None, authors=None, identifiers={}, # {{{\n domain=None, for_amazon=True):\n try:\n from urllib.parse import unquote_plus, urlencode\n except ImportError:\n from urllib import unquote_plus, urlencode\n if domain is None:\n domain = self.domain\n\n idomain, asin = self.get_domain_and_asin(identifiers)\n if idomain is not None:\n domain = idomain\n\n # See the amazon detailed search page to get all options\n terms = []\n q = {'search-alias': 'aps',\n 'unfiltered': '1',\n }\n\n if domain == 'com':\n q['sort'] = 'relevanceexprank'\n else:\n q['sort'] = 'relevancerank'\n\n isbn = check_isbn(identifiers.get('isbn', None))\n\n if asin is not None:\n q['field-keywords'] = asin\n terms.append(asin)\n elif isbn is not None:\n q['field-isbn'] = isbn\n if len(isbn) == 13:\n terms.extend('({} OR {}-{})'.format(isbn, isbn[:3], isbn[3:]).split())\n else:\n terms.append(isbn)\n else:\n # Only return book results\n q['search-alias'] = {'br': 'digital-text',\n 'nl': 'aps'}.get(domain, 'stripbooks')\n if title:\n title_tokens = list(self.get_title_tokens(title))\n if title_tokens:\n q['field-title'] = ' '.join(title_tokens)\n terms.extend(title_tokens)\n if authors:\n author_tokens = list(self.get_author_tokens(authors,\n only_first_author=True))\n if author_tokens:\n q['field-author'] = ' '.join(author_tokens)\n terms.extend(author_tokens)\n\n if not ('field-keywords' in q or 'field-isbn' in q or\n ('field-title' in q)):\n # Insufficient metadata to make an identify query\n log.error('Insufficient metadata to construct query, none of title, ISBN or ASIN supplied')\n raise SearchFailed()\n\n if not for_amazon:\n return terms, domain\n\n if domain == 'nl':\n q['__mk_nl_NL'] = 'ÅMÅŽÕÑ'\n if 'field-keywords' not in q:\n q['field-keywords'] = ''\n for f in 'field-isbn field-title field-author'.split():\n q['field-keywords'] += ' ' + q.pop(f, '')\n q['field-keywords'] = q['field-keywords'].strip()\n\n encoded_q = {x.encode('utf-8', 'ignore'): y.encode('utf-8', 'ignore') for x, y in q.items()}\n url_query = urlencode(encoded_q)\n # amazon's servers want IRIs with unicode characters not percent esaped\n parts = []\n for x in url_query.split(b'&' if isinstance(url_query, bytes) else '&'):\n k, v = x.split(b'=' if isinstance(x, bytes) else '=', 1)\n parts.append('{}={}'.format(iri_quote_plus(unquote_plus(k)), iri_quote_plus(unquote_plus(v))))\n url_query = '&'.join(parts)\n url = 'https://www.amazon.%s/s/?' % self.get_website_domain(\n domain) + url_query\n return url, domain\n\n # }}}\n\n def get_cached_cover_url(self, identifiers): # {{{\n url = None\n domain, asin = self.get_domain_and_asin(identifiers)\n if asin is None:\n isbn = identifiers.get('isbn', None)\n if isbn is not None:\n asin = self.cached_isbn_to_identifier(isbn)\n if asin is not None:\n url = self.cached_identifier_to_cover_url(asin)\n\n return url\n # }}}\n\n def parse_results_page(self, root, domain): # {{{\n from lxml.html import tostring\n\n matches = []\n\n def title_ok(title):\n title = title.lower()\n bad = ['bulk pack', '[audiobook]', '[audio cd]',\n '(a book companion)', '( slipcase with door )', ': free sampler']\n if self.domain == 'com':\n bad.extend(['(%s edition)' % x for x in ('spanish', 'german')])\n for x in bad:\n if x in title:\n return False\n if title and title[0] in '[{' and re.search(r'\\(\\s*author\\s*\\)', title) is not None:\n # Bad entries in the catalog\n return False\n return True\n\n for query in (\n '//div[contains(@class, \"s-result-list\")]//h2/a[@href]',\n '//div[contains(@class, \"s-result-list\")]//div[@data-index]//h5//a[@href]',\n r'//li[starts-with(@id, \"result_\")]//a[@href and contains(@class, \"s-access-detail-page\")]',\n '//div[@data-cy=\"title-recipe\"]/a[@href]',\n ):\n result_links = root.xpath(query)\n if result_links:\n break\n for a in result_links:\n title = tostring(a, method='text', encoding='unicode')\n if title_ok(title):\n url = a.get('href')\n if url.startswith('/'):\n url = 'https://www.amazon.%s%s' % (\n self.get_website_domain(domain), url)\n matches.append(url)\n\n if not matches:\n # Previous generation of results page markup\n for div in root.xpath(r'//div[starts-with(@id, \"result_\")]'):\n links = div.xpath(r'descendant::a[@class=\"title\" and @href]')\n if not links:\n # New amazon markup\n links = div.xpath('descendant::h3/a[@href]')\n for a in links:\n title = tostring(a, method='text', encoding='unicode')\n if title_ok(title):\n url = a.get('href')\n if url.startswith('/'):\n url = 'https://www.amazon.%s%s' % (\n self.get_website_domain(domain), url)\n matches.append(url)\n break\n\n if not matches:\n # This can happen for some user agents that Amazon thinks are\n # mobile/less capable\n for td in root.xpath(\n r'//div[@id=\"Results\"]/descendant::td[starts-with(@id, \"search:Td:\")]'):\n for a in td.xpath(r'descendant::td[@class=\"dataColumn\"]/descendant::a[@href]/span[@class=\"srTitle\"]/..'):\n title = tostring(a, method='text', encoding='unicode')\n if title_ok(title):\n url = a.get('href')\n if url.startswith('/'):\n url = 'https://www.amazon.%s%s' % (\n self.get_website_domain(domain), url)\n matches.append(url)\n break\n if not matches and root.xpath('//form[@action=\"/errors/validateCaptcha\"]'):\n raise CaptchaError('Amazon returned a CAPTCHA page. Recently Amazon has begun using statistical'\n ' profiling to block access to its website. As such this metadata plugin is'\n ' unlikely to ever work reliably.')\n\n # Keep only the top 3 matches as the matches are sorted by relevance by\n # Amazon so lower matches are not likely to be very relevant\n return matches[:3]\n # }}}\n\n def search_amazon(self, br, testing, log, abort, title, authors, identifiers, timeout): # {{{\n from calibre.ebooks.chardet import xml_to_unicode\n from calibre.utils.cleantext import clean_ascii_chars\n matches = []\n query, domain = self.create_query(log, title=title, authors=authors,\n identifiers=identifiers)\n time.sleep(1)\n try:\n raw = br.open_novisit(query, timeout=timeout).read().strip()\n except Exception as e:\n if callable(getattr(e, 'getcode', None)) and \\\n e.getcode() == 404:\n log.error('Query malformed: %r' % query)\n raise SearchFailed()\n attr = getattr(e, 'args', [None])\n attr = attr if attr else [None]\n if isinstance(attr[0], socket.timeout):\n msg = _('Amazon timed out. Try again later.')\n log.error(msg)\n else:\n msg = 'Failed to make identify query: %r' % query\n log.exception(msg)\n raise SearchFailed()\n\n raw = clean_ascii_chars(xml_to_unicode(raw,\n strip_encoding_pats=True, resolve_entities=True)[0])\n\n if testing:\n import tempfile\n with tempfile.NamedTemporaryFile(prefix='amazon_results_',\n suffix='.html', delete=False) as f:\n f.write(raw.encode('utf-8'))\n print('Downloaded html for results page saved in', f.name)\n\n matches = []\n found = '<title>404 - ' not in raw\n\n if found:\n try:\n root = parse_html(raw)\n except Exception:\n msg = 'Failed to parse amazon page for query: %r' % query\n log.exception(msg)\n raise SearchFailed()\n\n matches = self.parse_results_page(root, domain)\n\n return matches, query, domain, None\n # }}}\n\n def search_search_engine(self, br, testing, log, abort, title, authors, identifiers, timeout, override_server=None): # {{{\n from calibre.ebooks.metadata.sources.update import search_engines_module\n se = search_engines_module()\n terms, domain = self.create_query(log, title=title, authors=authors,\n identifiers=identifiers, for_amazon=False)\n site = self.referrer_for_domain(\n domain)[len('https://'):].partition('/')[0]\n matches = []\n server = override_server or self.server\n if server == 'bing':\n urlproc, sfunc = se.bing_url_processor, se.bing_search\n elif server == 'wayback':\n urlproc, sfunc = se.wayback_url_processor, se.ddg_search\n elif server == 'ddg':\n urlproc, sfunc = se.ddg_url_processor, se.ddg_search\n elif server == 'google':\n urlproc, sfunc = se.google_url_processor, se.google_search\n else: # auto or unknown\n # urlproc, sfunc = se.google_url_processor, se.google_search\n urlproc, sfunc = se.bing_url_processor, se.bing_search\n try:\n results, qurl = sfunc(terms, site, log=log, br=br, timeout=timeout)\n except HTTPError as err:\n if err.code == 429 and sfunc is se.google_search:\n log('Got too many requests error from Google, trying via DuckDuckGo')\n urlproc, sfunc = se.ddg_url_processor, se.ddg_search\n results, qurl = sfunc(terms, site, log=log, br=br, timeout=timeout)\n else:\n raise\n\n br.set_current_header('Referer', qurl)\n for result in results:\n if abort.is_set():\n return matches, terms, domain, None\n\n purl = urlparse(result.url)\n if '/dp/' in purl.path and site in purl.netloc:\n # We cannot use cached URL as wayback machine no longer caches\n # amazon and Google and Bing web caches are no longer\n # accessible.\n url = result.url\n if url not in matches:\n matches.append(url)\n if len(matches) >= 3:\n break\n else:\n log('Skipping non-book result:', result)\n if not matches:\n log('No search engine results for terms:', ' '.join(terms))\n if urlproc is se.google_url_processor:\n # Google does not cache adult titles\n log('Trying the bing search engine instead')\n return self.search_search_engine(br, testing, log, abort, title, authors, identifiers, timeout, 'bing')\n return matches, terms, domain, urlproc\n # }}}\n\n def identify(self, log, result_queue, abort, title=None, authors=None, # {{{\n identifiers={}, timeout=60):\n '''\n Note this method will retry without identifiers automatically if no\n match is found with identifiers.\n '''\n\n testing = getattr(self, 'running_a_test', False)\n\n udata = self._get_book_url(identifiers)\n br = self.browser\n log('User-agent:', br.current_user_agent())\n log('Server:', self.server)\n if testing:\n print('User-agent:', br.current_user_agent())\n if udata is not None and not self.use_search_engine:\n # Try to directly get details page instead of running a search\n # Cannot use search engine as the directly constructed URL is\n # usually redirected to a full URL by amazon, and is therefore\n # not cached\n domain, idtype, asin, durl = udata\n if durl is not None:\n preparsed_root = parse_details_page(\n durl, log, timeout, br, domain)\n if preparsed_root is not None:\n qasin = parse_asin(preparsed_root[1], log, durl)\n if qasin == asin:\n w = Worker(durl, result_queue, br, log, 0, domain,\n self, testing=testing, preparsed_root=preparsed_root, timeout=timeout)\n try:\n w.get_details()\n return\n except Exception:\n log.exception(\n 'get_details failed for url: %r' % durl)\n func = self.search_search_engine if self.use_search_engine else self.search_amazon\n try:\n matches, query, domain, cover_url_processor = func(\n br, testing, log, abort, title, authors, identifiers, timeout)\n except SearchFailed:\n return\n\n if abort.is_set():\n return\n\n if not matches:\n if identifiers and title and authors:\n log('No matches found with identifiers, retrying using only'\n ' title and authors. Query: %r' % query)\n time.sleep(1)\n return self.identify(log, result_queue, abort, title=title,\n authors=authors, timeout=timeout)\n log.error('No matches found with query: %r' % query)\n return\n\n if self.prefs['prefer_kindle_edition']:\n matches = sort_matches_preferring_kindle_editions(matches)\n\n workers = [Worker(\n url, result_queue, br, log, i, domain, self, testing=testing, timeout=timeout,\n cover_url_processor=cover_url_processor, filter_result=partial(\n self.filter_result, title, authors, identifiers)) for i, url in enumerate(matches)]\n\n for w in workers:\n # Don't send all requests at the same time\n time.sleep(1)\n w.start()\n if abort.is_set():\n return\n\n while not abort.is_set():\n a_worker_is_alive = False\n for w in workers:\n w.join(0.2)\n if abort.is_set():\n break\n if w.is_alive():\n a_worker_is_alive = True\n if not a_worker_is_alive:\n break\n\n return None\n # }}}\n\n def filter_result(self, title, authors, identifiers, mi, log): # {{{\n if not self.use_search_engine:\n return True\n if title is not None:\n import regex\n only_punctuation_pat = regex.compile(r'^\\p{P}+$')\n\n def tokenize_title(x):\n ans = icu_lower(x).replace(\"'\", '').replace('\"', '').rstrip(':')\n if only_punctuation_pat.match(ans) is not None:\n ans = ''\n return ans\n\n tokens = {tokenize_title(x) for x in title.split() if len(x) > 3}\n tokens.discard('')\n if tokens:\n result_tokens = {tokenize_title(x) for x in mi.title.split()}\n result_tokens.discard('')\n if not tokens.intersection(result_tokens):\n log('Ignoring result:', mi.title, 'as its title does not match')\n return False\n if authors:\n author_tokens = set()\n for author in authors:\n author_tokens |= {icu_lower(x) for x in author.split() if len(x) > 2}\n result_tokens = set()\n for author in mi.authors:\n result_tokens |= {icu_lower(x) for x in author.split() if len(x) > 2}\n if author_tokens and not author_tokens.intersection(result_tokens):\n log('Ignoring result:', mi.title, 'by', ' & '.join(mi.authors), 'as its author does not match')\n return False\n return True\n # }}}\n\n def download_cover(self, log, result_queue, abort, # {{{\n title=None, authors=None, identifiers={}, timeout=60, get_best_cover=False):\n cached_url = self.get_cached_cover_url(identifiers)\n if cached_url is None:\n log.info('No cached cover found, running identify')\n rq = Queue()\n self.identify(log, rq, abort, title=title, authors=authors,\n identifiers=identifiers)\n if abort.is_set():\n return\n if abort.is_set():\n return\n results = []\n while True:\n try:\n results.append(rq.get_nowait())\n except Empty:\n break\n results.sort(key=self.identify_results_keygen(\n title=title, authors=authors, identifiers=identifiers))\n for mi in results:\n cached_url = self.get_cached_cover_url(mi.identifiers)\n if cached_url is not None:\n break\n if cached_url is None:\n log.info('No cover found')\n return\n\n if abort.is_set():\n return\n log('Downloading cover from:', cached_url)\n br = self.browser\n if self.use_search_engine:\n br = br.clone_browser()\n br.set_current_header('Referer', self.referrer_for_domain(self.domain))\n try:\n time.sleep(1)\n cdata = br.open_novisit(\n cached_url, timeout=timeout).read()\n result_queue.put((self, cdata))\n except:\n log.exception('Failed to download cover from:', cached_url)\n # }}}\n\n\ndef manual_tests(domain, **kw): # {{{\n # To run these test use:\n # calibre-debug -c \"from calibre.ebooks.metadata.sources.amazon import *; manual_tests('com')\"\n from calibre.ebooks.metadata.sources.test import authors_test, comments_test, isbn_test, series_test, test_identify_plugin, title_test\n all_tests = {}\n all_tests['com'] = [ # {{{\n ( # in title\n {'title': 'Expert C# 2008 Business Objects',\n 'authors': ['Lhotka']},\n [title_test('Expert C#'),\n authors_test(['Rockford Lhotka'])\n ]\n ),\n\n ( # Paperback with series\n {'identifiers': {'amazon': '1423146786'}},\n [title_test('Heroes of Olympus', exact=False), series_test('The Heroes of Olympus', 5)]\n ),\n\n ( # Kindle edition with series\n {'identifiers': {'amazon': 'B0085UEQDO'}},\n [title_test('Three Parts Dead', exact=True),\n series_test('Craft Sequence', 1)]\n ),\n\n ( # + in title and uses id=\"main-image\" for cover\n {'identifiers': {'amazon': '1933988770'}},\n [title_test(\n 'C++ Concurrency in Action: Practical Multithreading', exact=True)]\n ),\n\n\n ( # Different comments markup, using Book Description section\n {'identifiers': {'amazon': '0982514506'}},\n [title_test(\n \"Griffin's Destiny\",\n exact=True),\n comments_test('Jelena'), comments_test('Ashinji'),\n ]\n ),\n\n ( # New search results page markup (Dec 2024)\n {'title': 'Come si scrive un articolo medico-scientifico'},\n [title_test('Come si scrive un articolo medico-scientifico', exact=True)]\n ),\n\n ( # No specific problems\n {'identifiers': {'isbn': '0743273567'}},\n [title_test('the great gatsby'),\n authors_test(['f. Scott Fitzgerald'])]\n ),\n\n ]\n\n # }}}\n\n all_tests['de'] = [ # {{{\n # series\n (\n {'identifiers': {'isbn': '3499275120'}},\n [title_test('Vespasian: Das Schwert des Tribuns: Historischer Roman',\n exact=False), authors_test(['Robert Fabbri']), series_test('Die Vespasian-Reihe', 1)\n ]\n\n ),\n\n ( # umlaut in title/authors\n {'title': 'Flüsternde Wälder',\n 'authors': ['Nicola Förg']},\n [title_test('Flüsternde Wälder'),\n authors_test(['Nicola Förg'], subset=True)\n ]\n ),\n\n (\n {'identifiers': {'isbn': '9783453314979'}},\n [title_test('Die letzten Wächter: Roman',\n exact=False), authors_test(['Sergej Lukianenko'])\n ]\n\n ),\n\n (\n {'identifiers': {'isbn': '3548283519'}},\n [title_test('Wer Wind Sät: Der Fünfte Fall Für Bodenstein Und Kirchhoff',\n exact=False), authors_test(['Nele Neuhaus'])\n ]\n\n ),\n ] # }}}\n\n all_tests['it'] = [ # {{{\n (\n {'identifiers': {'isbn': '8838922195'}},\n [title_test('La briscola in cinque',\n exact=True), authors_test(['Marco Malvaldi'])\n ]\n\n ),\n ] # }}}\n\n all_tests['fr'] = [ # {{{\n (\n {'identifiers': {'amazon_fr': 'B07L7ST4RS'}},\n [title_test('Le secret de Lola', exact=True),\n authors_test(['Amélie BRIZIO'])\n ]\n ),\n (\n {'identifiers': {'isbn': '2221116798'}},\n [title_test(\"L'étrange voyage de Monsieur Daldry\",\n exact=True), authors_test(['Marc Levy'])\n ]\n\n ),\n ] # }}}\n\n all_tests['es'] = [ # {{{\n (\n {'identifiers': {'isbn': '8483460831'}},\n [title_test('Tiempos Interesantes',\n exact=False), authors_test(['Terry Pratchett'])\n ]\n\n ),\n ] # }}}\n\n all_tests['se'] = [ # {{{\n (\n {'identifiers': {'isbn': '9780552140287'}},\n [title_test('Men At Arms: A Discworld Novel: 14',\n exact=False), authors_test(['Terry Pratchett'])\n ]\n\n ),\n ] # }}}\n\n all_tests['jp'] = [ # {{{\n ( # Adult filtering test\n {'identifiers': {'isbn': '4799500066'}},\n [title_test('Bitch Trap'), ]\n ),\n\n ( # isbn -> title, authors\n {'identifiers': {'isbn': '9784101302720'}},\n [title_test('精霊の守り人',\n exact=True), authors_test(['上橋 菜穂子'])\n ]\n ),\n ( # title, authors -> isbn (will use Shift_JIS encoding in query.)\n {'title': '考えない練習',\n 'authors': ['小池 龍之介']},\n [isbn_test('9784093881067'), ]\n ),\n ] # }}}\n\n all_tests['br'] = [ # {{{\n (\n {'title': 'A Ascensão da Sombra'},\n [title_test('A Ascensão da Sombra'), authors_test(['Robert Jordan'])]\n ),\n\n (\n {'title': 'Guerra dos Tronos'},\n [title_test('A Guerra dos Tronos. As Crônicas de Gelo e Fogo - Livro 1'), authors_test(['George R. R. Martin'])\n ]\n\n ),\n ] # }}}\n\n all_tests['nl'] = [ # {{{\n (\n {'title': 'Freakonomics'},\n [title_test('Freakonomics',\n exact=True), authors_test(['Steven Levitt & Stephen Dubner & R. Kuitenbrouwer & O. Brenninkmeijer & A. van Den Berg'])\n ]\n\n ),\n ] # }}}\n\n all_tests['cn'] = [ # {{{\n (\n {'identifiers': {'isbn': '9787115369512'}},\n [title_test('若为自由故 自由软件之父理查德斯托曼传', exact=True),\n authors_test(['[美]sam Williams', '邓楠,李凡希'])]\n ),\n (\n {'title': '爱上Raspberry Pi'},\n [title_test('爱上Raspberry Pi',\n exact=True), authors_test(['Matt Richardson', 'Shawn Wallace', '李凡希'])\n ]\n\n ),\n ] # }}}\n\n all_tests['ca'] = [ # {{{\n ( # Paperback with series\n {'identifiers': {'isbn': '9781623808747'}},\n [title_test('Parting Shot', exact=True),\n authors_test(['Mary Calmes'])]\n ),\n ( # in title\n {'title': 'Expert C# 2008 Business Objects',\n 'authors': ['Lhotka']},\n [title_test('Expert C# 2008 Business Objects'),\n authors_test(['Rockford Lhotka'])]\n ),\n ( # noscript description\n {'identifiers': {'amazon_ca': '162380874X'}},\n [title_test('Parting Shot', exact=True), authors_test(['Mary Calmes'])\n ]\n ),\n ] # }}}\n\n all_tests['in'] = [ # {{{\n ( # Paperback with series\n {'identifiers': {'amazon_in': '1423146786'}},\n [title_test('The Heroes of Olympus, Book Five The Blood of Olympus', exact=True)]\n ),\n ] # }}}\n\n def do_test(domain, start=0, stop=None, server='auto'):\n tests = all_tests[domain]\n if stop is None:\n stop = len(tests)\n tests = tests[start:stop]\n test_identify_plugin(Amazon.name, tests, modify_plugin=lambda p: (\n setattr(p, 'testing_domain', domain),\n setattr(p, 'touched_fields', p.touched_fields - {'tags'}),\n setattr(p, 'testing_server', server),\n ))\n\n do_test(domain, **kw)\n# }}}\n",
+ "big_book_search": "#!/usr/bin/env python\n# vim:fileencoding=UTF-8\nfrom __future__ import absolute_import, division, print_function, unicode_literals\n\n__license__ = 'GPL v3'\n__copyright__ = '2013, Kovid Goyal <kovid@kovidgoyal.net>'\n__docformat__ = 'restructuredtext en'\n\nfrom calibre.ebooks.metadata.sources.base import Option, Source\n\n\ndef get_urls(br, tokens):\n from urllib.parse import quote_plus\n\n from html5_parser import parse\n escaped = (quote_plus(x) for x in tokens if x and x.strip())\n q = '+'.join(escaped)\n url = 'https://bigbooksearch.com/please-dont-scrape-my-site-you-will-put-my-api-key-over-the-usage-limit-and-the-site-will-break/books/'+q\n raw = br.open(url).read()\n root = parse(raw.decode('utf-8'))\n urls = [i.get('src') for i in root.xpath('//img[@src]')]\n return urls\n\n\nclass BigBookSearch(Source):\n\n name = 'Big Book Search'\n version = (1, 0, 1)\n minimum_calibre_version = (2, 80, 0)\n description = _('Downloads multiple book covers from Amazon. Useful to find alternate covers.')\n capabilities = frozenset(['cover'])\n can_get_multiple_covers = True\n options = (Option('max_covers', 'number', 5, _('Maximum number of covers to get'),\n _('The maximum number of covers to process from the search result')),\n )\n supports_gzip_transfer_encoding = True\n\n def download_cover(self, log, result_queue, abort,\n title=None, authors=None, identifiers={}, timeout=30, get_best_cover=False):\n if not title:\n return\n br = self.browser\n tokens = tuple(self.get_title_tokens(title)) + tuple(self.get_author_tokens(authors))\n urls = get_urls(br, tokens)\n self.download_multiple_covers(title, authors, urls, get_best_cover, timeout, result_queue, abort, log)\n\n\ndef test():\n import pprint\n\n from calibre import browser\n br = browser()\n urls = get_urls(br, ['consider', 'phlebas', 'banks'])\n pprint.pprint(urls)\n\n\nif __name__ == '__main__':\n test()\n",
+ "edelweiss": "#!/usr/bin/env python\n# vim:fileencoding=UTF-8:ts=4:sw=4:sta:et:sts=4:fdm=marker:ai\nfrom __future__ import absolute_import, division, print_function, unicode_literals\n\n__license__ = 'GPL v3'\n__copyright__ = '2013, Kovid Goyal <kovid at kovidgoyal.net>'\n__docformat__ = 'restructuredtext en'\n\nimport re\nimport time\nfrom threading import Thread\n\ntry:\n from queue import Empty, Queue\nexcept ImportError:\n from Queue import Empty, Queue\n\nfrom calibre import as_unicode, random_user_agent\nfrom calibre.ebooks.metadata import check_isbn\nfrom calibre.ebooks.metadata.sources.base import Source\n\n\ndef clean_html(raw):\n from calibre.ebooks.chardet import xml_to_unicode\n from calibre.utils.cleantext import clean_ascii_chars\n return clean_ascii_chars(xml_to_unicode(raw, strip_encoding_pats=True,\n resolve_entities=True, assume_utf8=True)[0])\n\n\ndef parse_html(raw):\n raw = clean_html(raw)\n from html5_parser import parse\n return parse(raw)\n\n\ndef astext(node):\n from lxml import etree\n return etree.tostring(node, method='text', encoding='unicode',\n with_tail=False).strip()\n\n\nclass Worker(Thread): # {{{\n\n def __init__(self, basic_data, relevance, result_queue, br, timeout, log, plugin):\n Thread.__init__(self)\n self.daemon = True\n self.basic_data = basic_data\n self.br, self.log, self.timeout = br, log, timeout\n self.result_queue, self.plugin, self.sku = result_queue, plugin, self.basic_data['sku']\n self.relevance = relevance\n\n def run(self):\n url = ('https://www.edelweiss.plus/GetTreelineControl.aspx?controlName=/uc/product/two_Enhanced.ascx&'\n 'sku={0}&idPrefix=content_1_{0}&mode=0'.format(self.sku))\n try:\n raw = self.br.open_novisit(url, timeout=self.timeout).read()\n except:\n self.log.exception('Failed to load comments page: %r'%url)\n return\n\n try:\n mi = self.parse(raw)\n mi.source_relevance = self.relevance\n self.plugin.clean_downloaded_metadata(mi)\n self.result_queue.put(mi)\n except:\n self.log.exception('Failed to parse details for sku: %s'%self.sku)\n\n def parse(self, raw):\n from calibre.ebooks.metadata.book.base import Metadata\n from calibre.utils.date import UNDEFINED_DATE\n root = parse_html(raw)\n mi = Metadata(self.basic_data['title'], self.basic_data['authors'])\n\n # Identifiers\n if self.basic_data['isbns']:\n mi.isbn = self.basic_data['isbns'][0]\n mi.set_identifier('edelweiss', self.sku)\n\n # Tags\n if self.basic_data['tags']:\n mi.tags = self.basic_data['tags']\n mi.tags = [t[1:].strip() if t.startswith('&') else t for t in mi.tags]\n\n # Publisher\n mi.publisher = self.basic_data['publisher']\n\n # Pubdate\n if self.basic_data['pubdate'] and self.basic_data['pubdate'].year != UNDEFINED_DATE:\n mi.pubdate = self.basic_data['pubdate']\n\n # Rating\n if self.basic_data['rating']:\n mi.rating = self.basic_data['rating']\n\n # Comments\n comments = ''\n for cid in ('summary', 'contributorbio', 'quotes_reviews'):\n cid = 'desc_{}{}-content'.format(cid, self.sku)\n div = root.xpath('//*[@id=\"{}\"]'.format(cid))\n if div:\n comments += self.render_comments(div[0])\n if comments:\n mi.comments = comments\n\n mi.has_cover = self.plugin.cached_identifier_to_cover_url(self.sku) is not None\n return mi\n\n def render_comments(self, desc):\n from lxml import etree\n\n from calibre.library.comments import sanitize_comments_html\n for c in desc.xpath('descendant::noscript'):\n c.getparent().remove(c)\n for a in desc.xpath('descendant::a[@href]'):\n del a.attrib['href']\n a.tag = 'span'\n desc = etree.tostring(desc, method='html', encoding='unicode').strip()\n\n # remove all attributes from tags\n desc = re.sub(r'<([a-zA-Z0-9]+)\\s[^>]+>', r'<\\1>', desc)\n # Collapse whitespace\n # desc = re.sub(r'\\n+', '\\n', desc)\n # desc = re.sub(r' +', ' ', desc)\n # Remove comments\n desc = re.sub(r'(?s)<!--.*?-->', '', desc)\n return sanitize_comments_html(desc)\n# }}}\n\n\ndef get_basic_data(browser, log, *skus):\n from mechanize import Request\n\n from calibre.utils.date import parse_only_date\n zeroes = ','.join('0' for sku in skus)\n data = {\n 'skus': ','.join(skus),\n 'drc': zeroes,\n 'startPosition': '0',\n 'sequence': '1',\n 'selected': zeroes,\n 'itemID': '0',\n 'orderID': '0',\n 'mailingID': '',\n 'tContentWidth': '926',\n 'originalOrder': ','.join(type('')(i) for i in range(len(skus))),\n 'selectedOrderID': '0',\n 'selectedSortColumn': '0',\n 'listType': '1',\n 'resultType': '32',\n 'blockView': '1',\n }\n items_data_url = 'https://www.edelweiss.plus/GetTreelineControl.aspx?controlName=/uc/listviews/ListView_Title_Multi.ascx'\n req = Request(items_data_url, data)\n response = browser.open_novisit(req)\n raw = response.read()\n root = parse_html(raw)\n for item in root.xpath('//div[@data-priority]'):\n row = item.getparent().getparent()\n sku = item.get('id').split('-')[-1]\n isbns = [x.strip() for x in row.xpath('descendant::*[contains(@class, \"pev_sku\")]/text()')[0].split(',') if check_isbn(x.strip())]\n isbns.sort(key=len, reverse=True)\n try:\n tags = [x.strip() for x in astext(row.xpath('descendant::*[contains(@class, \"pev_categories\")]')[0]).split('/')]\n except IndexError:\n tags = []\n rating = 0\n for bar in row.xpath('descendant::*[contains(@class, \"bgdColorCommunity\")]/@style'):\n m = re.search(r'width: (\\d+)px;.*max-width: (\\d+)px', bar)\n if m is not None:\n rating = float(m.group(1)) / float(m.group(2))\n break\n try:\n pubdate = parse_only_date(astext(row.xpath('descendant::*[contains(@class, \"pev_shipDate\")]')[0]\n ).split(':')[-1].split(u'\\xa0')[-1].strip(), assume_utc=True)\n except Exception:\n log.exception('Error parsing published date')\n pubdate = None\n authors = []\n for x in [x.strip() for x in row.xpath('descendant::*[contains(@class, \"pev_contributor\")]/@title')]:\n authors.extend(a.strip() for a in x.split(','))\n entry = {\n 'sku': sku,\n 'cover': row.xpath('descendant::img/@src')[0].split('?')[0],\n 'publisher': astext(row.xpath('descendant::*[contains(@class, \"headerPublisher\")]')[0]),\n 'title': astext(row.xpath('descendant::*[@id=\"title_{}\"]'.format(sku))[0]),\n 'authors': authors,\n 'isbns': isbns,\n 'tags': tags,\n 'pubdate': pubdate,\n 'format': ' '.join(row.xpath('descendant::*[contains(@class, \"pev_format\")]/text()')).strip(),\n 'rating': rating,\n }\n if entry['cover'].startswith('/'):\n entry['cover'] = None\n yield entry\n\n\nclass Edelweiss(Source):\n\n name = 'Edelweiss'\n version = (2, 0, 1)\n minimum_calibre_version = (3, 6, 0)\n description = _('Downloads metadata and covers from Edelweiss - A catalog updated by book publishers')\n\n capabilities = frozenset(['identify', 'cover'])\n touched_fields = frozenset([\n 'title', 'authors', 'tags', 'pubdate', 'comments', 'publisher',\n 'identifier:isbn', 'identifier:edelweiss', 'rating'])\n supports_gzip_transfer_encoding = True\n has_html_comments = True\n\n @property\n def user_agent(self):\n # Pass in an index to random_user_agent() to test with a particular\n # user agent\n return random_user_agent(allow_ie=False)\n\n def _get_book_url(self, sku):\n if sku:\n return 'https://www.edelweiss.plus/#sku={}&page=1'.format(sku)\n\n def get_book_url(self, identifiers): # {{{\n sku = identifiers.get('edelweiss', None)\n if sku:\n return 'edelweiss', sku, self._get_book_url(sku)\n\n # }}}\n\n def get_cached_cover_url(self, identifiers): # {{{\n sku = identifiers.get('edelweiss', None)\n if not sku:\n isbn = identifiers.get('isbn', None)\n if isbn is not None:\n sku = self.cached_isbn_to_identifier(isbn)\n return self.cached_identifier_to_cover_url(sku)\n # }}}\n\n def create_query(self, log, title=None, authors=None, identifiers={}):\n try:\n from urllib.parse import urlencode\n except ImportError:\n from urllib import urlencode\n import time\n BASE_URL = ('https://www.edelweiss.plus/GetTreelineControl.aspx?'\n 'controlName=/uc/listviews/controls/ListView_data.ascx&itemID=0&resultType=32&dashboardType=8&itemType=1&dataType=products&keywordSearch&')\n keywords = []\n isbn = check_isbn(identifiers.get('isbn', None))\n if isbn is not None:\n keywords.append(isbn)\n elif title:\n title_tokens = list(self.get_title_tokens(title))\n if title_tokens:\n keywords.extend(title_tokens)\n author_tokens = self.get_author_tokens(authors, only_first_author=True)\n if author_tokens:\n keywords.extend(author_tokens)\n if not keywords:\n return None\n params = {\n 'q': (' '.join(keywords)).encode('utf-8'),\n '_': type('')(int(time.time()))\n }\n return BASE_URL+urlencode(params)\n\n # }}}\n\n def identify(self, log, result_queue, abort, title=None, authors=None, # {{{\n identifiers={}, timeout=30):\n import json\n\n br = self.browser\n br.addheaders = [\n ('Referer', 'https://www.edelweiss.plus/'),\n ('X-Requested-With', 'XMLHttpRequest'),\n ('Cache-Control', 'no-cache'),\n ('Pragma', 'no-cache'),\n ]\n if 'edelweiss' in identifiers:\n items = [identifiers['edelweiss']]\n else:\n log.error('Currently Edelweiss returns random books for search queries')\n return\n query = self.create_query(log, title=title, authors=authors,\n identifiers=identifiers)\n if not query:\n log.error('Insufficient metadata to construct query')\n return\n log('Using query URL:', query)\n try:\n raw = br.open(query, timeout=timeout).read().decode('utf-8')\n except Exception as e:\n log.exception('Failed to make identify query: %r'%query)\n return as_unicode(e)\n items = re.search(r'window[.]items\\s*=\\s*(.+?);', raw)\n if items is None:\n log.error('Failed to get list of matching items')\n log.debug('Response text:')\n log.debug(raw)\n return\n items = json.loads(items.group(1))\n\n if (not items and identifiers and title and authors and\n not abort.is_set()):\n return self.identify(log, result_queue, abort, title=title,\n authors=authors, timeout=timeout)\n\n if not items:\n return\n\n workers = []\n items = items[:5]\n for i, item in enumerate(get_basic_data(self.browser, log, *items)):\n sku = item['sku']\n for isbn in item['isbns']:\n self.cache_isbn_to_identifier(isbn, sku)\n if item['cover']:\n self.cache_identifier_to_cover_url(sku, item['cover'])\n fmt = item['format'].lower()\n if 'audio' in fmt or 'mp3' in fmt:\n continue # Audio-book, ignore\n workers.append(Worker(item, i, result_queue, br.clone_browser(), timeout, log, self))\n\n if not workers:\n return\n\n for w in workers:\n w.start()\n # Don't send all requests at the same time\n time.sleep(0.1)\n\n while not abort.is_set():\n a_worker_is_alive = False\n for w in workers:\n w.join(0.2)\n if abort.is_set():\n break\n if w.is_alive():\n a_worker_is_alive = True\n if not a_worker_is_alive:\n break\n\n # }}}\n\n def download_cover(self, log, result_queue, abort, # {{{\n title=None, authors=None, identifiers={}, timeout=30, get_best_cover=False):\n cached_url = self.get_cached_cover_url(identifiers)\n if cached_url is None:\n log.info('No cached cover found, running identify')\n rq = Queue()\n self.identify(log, rq, abort, title=title, authors=authors,\n identifiers=identifiers)\n if abort.is_set():\n return\n results = []\n while True:\n try:\n results.append(rq.get_nowait())\n except Empty:\n break\n results.sort(key=self.identify_results_keygen(\n title=title, authors=authors, identifiers=identifiers))\n for mi in results:\n cached_url = self.get_cached_cover_url(mi.identifiers)\n if cached_url is not None:\n break\n if cached_url is None:\n log.info('No cover found')\n return\n\n if abort.is_set():\n return\n br = self.browser\n log('Downloading cover from:', cached_url)\n try:\n cdata = br.open_novisit(cached_url, timeout=timeout).read()\n result_queue.put((self, cdata))\n except:\n log.exception('Failed to download cover from:', cached_url)\n # }}}\n\n\nif __name__ == '__main__':\n from calibre.ebooks.metadata.sources.test import authors_test, comments_test, pubdate_test, test_identify_plugin, title_test\n tests = [\n ( # A title and author search\n {'title': \"The Husband's Secret\", 'authors':['Liane Moriarty']},\n [title_test(\"The Husband's Secret\", exact=True),\n authors_test(['Liane Moriarty'])]\n ),\n\n ( # An isbn present in edelweiss\n {'identifiers':{'isbn': '9780312621360'}, },\n [title_test('Flame: A Sky Chasers Novel', exact=True),\n authors_test(['Amy Kathleen Ryan'])]\n ),\n\n # Multiple authors and two part title and no general description\n ({'identifiers':{'edelweiss':'0321180607'}},\n [title_test('XQuery From the Experts: A Guide to the W3C XML Query Language', exact=True),\n authors_test([\n 'Howard Katz', 'Don Chamberlin', 'Denise Draper', 'Mary Fernandez',\n 'Michael Kay', 'Jonathan Robie', 'Michael Rys', 'Jerome Simeon',\n 'Jim Tivy', 'Philip Wadler']),\n pubdate_test(2003, 8, 22),\n comments_test('Jérôme Siméon'), lambda mi: bool(mi.comments and 'No title summary' not in mi.comments)\n ]),\n ]\n start, stop = 0, len(tests)\n\n tests = tests[start:stop]\n test_identify_plugin(Edelweiss.name, tests)\n",
+ "google": "#!/usr/bin/env python\n# vim:fileencoding=UTF-8:ts=4:sw=4:sta:et:sts=4:ai\n# License: GPLv3 Copyright: 2011, Kovid Goyal <kovid at kovidgoyal.net>\nfrom __future__ import absolute_import, division, print_function, unicode_literals\n\nimport hashlib\nimport os\nimport re\nimport sys\nimport tempfile\nimport time\n\nimport regex\n\ntry:\n from queue import Empty, Queue\nexcept ImportError:\n from Queue import Empty, Queue\n\nfrom calibre import as_unicode, prepare_string_for_xml, replace_entities\nfrom calibre.ebooks.chardet import xml_to_unicode\nfrom calibre.ebooks.metadata import authors_to_string, check_isbn\nfrom calibre.ebooks.metadata.book.base import Metadata\nfrom calibre.ebooks.metadata.sources.base import Source\nfrom calibre.utils.cleantext import clean_ascii_chars\nfrom calibre.utils.localization import canonicalize_lang\n\nNAMESPACES = {\n 'openSearch': 'http://a9.com/-/spec/opensearchrss/1.0/',\n 'atom': 'http://www.w3.org/2005/Atom',\n 'dc': 'http://purl.org/dc/terms',\n 'gd': 'http://schemas.google.com/g/2005'\n}\n\n\ndef pretty_google_books_comments(raw):\n raw = replace_entities(raw)\n # Paragraphs in the comments are removed but whatever software googl uses\n # to do this does not insert a space so we often find the pattern\n # word.Capital in the comments which can be used to find paragraph markers.\n parts = []\n for x in re.split(r'([a-z)\"”])(\\.)([A-Z(\"“])', raw):\n if x == '.':\n parts.append('.</p>\\n\\n<p>')\n else:\n parts.append(prepare_string_for_xml(x))\n raw = '<p>' + ''.join(parts) + '</p>'\n return raw\n\n\ndef get_details(browser, url, timeout): # {{{\n try:\n raw = browser.open_novisit(url, timeout=timeout).read()\n except Exception as e:\n gc = getattr(e, 'getcode', lambda: -1)\n if gc() != 403:\n raise\n # Google is throttling us, wait a little\n time.sleep(2)\n raw = browser.open_novisit(url, timeout=timeout).read()\n\n return raw\n# }}}\n\n\nxpath_cache = {}\n\n\ndef XPath(x):\n ans = xpath_cache.get(x)\n if ans is None:\n from lxml import etree\n ans = xpath_cache[x] = etree.XPath(x, namespaces=NAMESPACES)\n return ans\n\n\ndef to_metadata(browser, log, entry_, timeout, running_a_test=False): # {{{\n from lxml import etree\n\n # total_results = XPath('//openSearch:totalResults')\n # start_index = XPath('//openSearch:startIndex')\n # items_per_page = XPath('//openSearch:itemsPerPage')\n entry = XPath('//atom:entry')\n entry_id = XPath('descendant::atom:id')\n url = XPath('descendant::atom:link[@rel=\"self\"]/@href')\n creator = XPath('descendant::dc:creator')\n identifier = XPath('descendant::dc:identifier')\n title = XPath('descendant::dc:title')\n date = XPath('descendant::dc:date')\n publisher = XPath('descendant::dc:publisher')\n subject = XPath('descendant::dc:subject')\n description = XPath('descendant::dc:description')\n language = XPath('descendant::dc:language')\n\n # print(etree.tostring(entry_, pretty_print=True))\n\n def get_text(extra, x):\n try:\n ans = x(extra)\n if ans:\n ans = ans[0].text\n if ans and ans.strip():\n return ans.strip()\n except:\n log.exception('Programming error:')\n return None\n\n def get_extra_details():\n raw = get_details(browser, details_url, timeout)\n if running_a_test:\n with open(os.path.join(tempfile.gettempdir(), 'Google-' + details_url.split('/')[-1] + '.xml'), 'wb') as f:\n f.write(raw)\n print('Book details saved to:', f.name, file=sys.stderr)\n feed = etree.fromstring(\n xml_to_unicode(clean_ascii_chars(raw), strip_encoding_pats=True)[0],\n parser=etree.XMLParser(recover=True, no_network=True, resolve_entities=False)\n )\n return entry(feed)[0]\n\n if isinstance(entry_, str):\n google_id = entry_\n details_url = 'https://www.google.com/books/feeds/volumes/' + google_id\n extra = get_extra_details()\n title_ = ': '.join([x.text for x in title(extra)]).strip()\n authors = [x.text.strip() for x in creator(extra) if x.text]\n else:\n id_url = entry_id(entry_)[0].text\n google_id = id_url.split('/')[-1]\n details_url = url(entry_)[0]\n title_ = ': '.join([x.text for x in title(entry_)]).strip()\n authors = [x.text.strip() for x in creator(entry_) if x.text]\n if not id_url or not title:\n # Silently discard this entry\n return None\n extra = None\n\n if not authors:\n authors = [_('Unknown')]\n if not title:\n return None\n if extra is None:\n extra = get_extra_details()\n mi = Metadata(title_, authors)\n mi.identifiers = {'google': google_id}\n mi.comments = get_text(extra, description)\n lang = canonicalize_lang(get_text(extra, language))\n if lang:\n mi.language = lang\n mi.publisher = get_text(extra, publisher)\n\n # ISBN\n isbns = []\n for x in identifier(extra):\n t = type('')(x.text).strip()\n if t[:5].upper() in ('ISBN:', 'LCCN:', 'OCLC:'):\n if t[:5].upper() == 'ISBN:':\n t = check_isbn(t[5:])\n if t:\n isbns.append(t)\n if isbns:\n mi.isbn = sorted(isbns, key=len)[-1]\n mi.all_isbns = isbns\n\n # Tags\n try:\n btags = [x.text for x in subject(extra) if x.text]\n tags = []\n for t in btags:\n atags = [y.strip() for y in t.split('/')]\n for tag in atags:\n if tag not in tags:\n tags.append(tag)\n except:\n log.exception('Failed to parse tags:')\n tags = []\n if tags:\n mi.tags = [x.replace(',', ';') for x in tags]\n\n # pubdate\n pubdate = get_text(extra, date)\n if pubdate:\n from calibre.utils.date import parse_date, utcnow\n try:\n default = utcnow().replace(day=15)\n mi.pubdate = parse_date(pubdate, assume_utc=True, default=default)\n except:\n log.error('Failed to parse pubdate %r' % pubdate)\n\n # Cover\n mi.has_google_cover = None\n for x in extra.xpath(\n '//*[@href and @rel=\"http://schemas.google.com/books/2008/thumbnail\"]'\n ):\n mi.has_google_cover = x.get('href')\n break\n\n return mi\n\n# }}}\n\n\nclass GoogleBooks(Source):\n\n name = 'Google'\n version = (1, 1, 1)\n minimum_calibre_version = (2, 80, 0)\n description = _('Downloads metadata and covers from Google Books')\n\n capabilities = frozenset({'identify'})\n touched_fields = frozenset({\n 'title', 'authors', 'tags', 'pubdate', 'comments', 'publisher',\n 'identifier:isbn', 'identifier:google', 'languages'\n })\n supports_gzip_transfer_encoding = True\n cached_cover_url_is_reliable = False\n\n GOOGLE_COVER = 'https://books.google.com/books?id=%s&printsec=frontcover&img=1'\n\n DUMMY_IMAGE_MD5 = frozenset(\n ('0de4383ebad0adad5eeb8975cd796657', 'a64fa89d7ebc97075c1d363fc5fea71f')\n )\n\n def get_book_url(self, identifiers): # {{{\n goog = identifiers.get('google', None)\n if goog is not None:\n return ('google', goog, 'https://books.google.com/books?id=%s' % goog)\n # }}}\n\n def id_from_url(self, url): # {{{\n from polyglot.urllib import parse_qs, urlparse\n purl = urlparse(url)\n if purl.netloc == 'books.google.com':\n q = parse_qs(purl.query)\n gid = q.get('id')\n if gid:\n return 'google', gid[0]\n # }}}\n\n def create_query(self, title=None, authors=None, identifiers={}, capitalize_isbn=False): # {{{\n try:\n from urllib.parse import urlencode\n except ImportError:\n from urllib import urlencode\n BASE_URL = 'https://books.google.com/books/feeds/volumes?'\n isbn = check_isbn(identifiers.get('isbn', None))\n q = ''\n if isbn is not None:\n q += ('ISBN:' if capitalize_isbn else 'isbn:') + isbn\n elif title or authors:\n\n def build_term(prefix, parts):\n return ' '.join('in' + prefix + ':' + x for x in parts)\n\n title_tokens = list(self.get_title_tokens(title))\n if title_tokens:\n q += build_term('title', title_tokens)\n author_tokens = list(self.get_author_tokens(authors, only_first_author=True))\n if author_tokens:\n q += ('+' if q else '') + build_term('author', author_tokens)\n\n if not q:\n return None\n if not isinstance(q, bytes):\n q = q.encode('utf-8')\n return BASE_URL + urlencode({\n 'q': q,\n 'max-results': 20,\n 'start-index': 1,\n 'min-viewability': 'none',\n })\n\n # }}}\n\n def download_cover( # {{{\n self,\n log,\n result_queue,\n abort,\n title=None,\n authors=None,\n identifiers={},\n timeout=30,\n get_best_cover=False\n ):\n cached_url = self.get_cached_cover_url(identifiers)\n if cached_url is None:\n log.info('No cached cover found, running identify')\n rq = Queue()\n self.identify(\n log,\n rq,\n abort,\n title=title,\n authors=authors,\n identifiers=identifiers\n )\n if abort.is_set():\n return\n results = []\n while True:\n try:\n results.append(rq.get_nowait())\n except Empty:\n break\n results.sort(\n key=self.identify_results_keygen(\n title=title, authors=authors, identifiers=identifiers\n )\n )\n for mi in results:\n cached_url = self.get_cached_cover_url(mi.identifiers)\n if cached_url is not None:\n break\n if cached_url is None:\n log.info('No cover found')\n return\n\n br = self.browser\n for candidate in (0, 1):\n if abort.is_set():\n return\n url = cached_url + '&zoom={}'.format(candidate)\n log('Downloading cover from:', cached_url)\n try:\n cdata = br.open_novisit(url, timeout=timeout).read()\n if cdata:\n if hashlib.md5(cdata).hexdigest() in self.DUMMY_IMAGE_MD5:\n log.warning('Google returned a dummy image, ignoring')\n else:\n result_queue.put((self, cdata))\n break\n except Exception:\n log.exception('Failed to download cover from:', cached_url)\n\n # }}}\n\n def get_cached_cover_url(self, identifiers): # {{{\n url = None\n goog = identifiers.get('google', None)\n if goog is None:\n isbn = identifiers.get('isbn', None)\n if isbn is not None:\n goog = self.cached_isbn_to_identifier(isbn)\n if goog is not None:\n url = self.cached_identifier_to_cover_url(goog)\n\n return url\n\n # }}}\n\n def postprocess_downloaded_google_metadata(self, ans, relevance=0): # {{{\n if not isinstance(ans, Metadata):\n return ans\n ans.source_relevance = relevance\n goog = ans.identifiers['google']\n for isbn in getattr(ans, 'all_isbns', []):\n self.cache_isbn_to_identifier(isbn, goog)\n if getattr(ans, 'has_google_cover', False):\n self.cache_identifier_to_cover_url(goog, self.GOOGLE_COVER % goog)\n if ans.comments:\n ans.comments = pretty_google_books_comments(ans.comments)\n self.clean_downloaded_metadata(ans)\n return ans\n # }}}\n\n def get_all_details( # {{{\n self,\n br,\n log,\n entries,\n abort,\n result_queue,\n timeout\n ):\n from lxml import etree\n for relevance, i in enumerate(entries):\n try:\n ans = self.postprocess_downloaded_google_metadata(to_metadata(br, log, i, timeout, self.running_a_test), relevance)\n if isinstance(ans, Metadata):\n result_queue.put(ans)\n except Exception:\n log.exception(\n 'Failed to get metadata for identify entry:', etree.tostring(i)\n )\n if abort.is_set():\n break\n\n # }}}\n\n def identify_via_web_search( # {{{\n self,\n log,\n result_queue,\n abort,\n title=None,\n authors=None,\n identifiers={},\n timeout=30\n ):\n from calibre.utils.filenames import ascii_text\n isbn = check_isbn(identifiers.get('isbn', None))\n q = []\n strip_punc_pat = regex.compile(r'[\\p{C}|\\p{M}|\\p{P}|\\p{S}|\\p{Z}]+', regex.UNICODE)\n google_ids = []\n check_tokens = set()\n has_google_id = 'google' in identifiers\n\n def to_check_tokens(*tokens):\n for t in tokens:\n if len(t) < 3:\n continue\n t = t.lower()\n if t in ('and', 'not', 'the'):\n continue\n yield ascii_text(strip_punc_pat.sub('', t))\n\n if has_google_id:\n google_ids.append(identifiers['google'])\n elif isbn is not None:\n q.append(isbn)\n elif title or authors:\n title_tokens = list(self.get_title_tokens(title))\n if title_tokens:\n q += title_tokens\n check_tokens |= set(to_check_tokens(*title_tokens))\n author_tokens = list(self.get_author_tokens(authors, only_first_author=True))\n if author_tokens:\n q += author_tokens\n check_tokens |= set(to_check_tokens(*author_tokens))\n if not q and not google_ids:\n return None\n from calibre.ebooks.metadata.sources.update import search_engines_module\n se = search_engines_module()\n br = se.google_specialize_browser(se.browser())\n if not has_google_id:\n url = se.google_format_query(q, tbm='bks')\n log('Making query:', url)\n r = []\n root = se.query(br, url, 'google', timeout=timeout, save_raw=r.append)\n pat = re.compile(r'id=([^&]+)')\n for q in se.google_parse_results(root, r[0], log=log, ignore_uncached=False):\n m = pat.search(q.url)\n if m is None or not q.url.startswith('https://books.google'):\n continue\n google_ids.append(m.group(1))\n\n if not google_ids and isbn and (title or authors):\n return self.identify_via_web_search(log, result_queue, abort, title, authors, {}, timeout)\n found = False\n seen = set()\n for relevance, gid in enumerate(google_ids):\n if gid in seen:\n continue\n seen.add(gid)\n try:\n ans = to_metadata(br, log, gid, timeout, self.running_a_test)\n if isinstance(ans, Metadata):\n if isbn:\n if isbn not in ans.all_isbns:\n log('Excluding', ans.title, 'by', authors_to_string(ans.authors), 'as it does not match the ISBN:', isbn,\n 'not in', ' '.join(ans.all_isbns))\n continue\n elif check_tokens:\n candidate = set(to_check_tokens(*self.get_title_tokens(ans.title)))\n candidate |= set(to_check_tokens(*self.get_author_tokens(ans.authors)))\n if candidate.intersection(check_tokens) != check_tokens:\n log('Excluding', ans.title, 'by', authors_to_string(ans.authors), 'as it does not match the query')\n continue\n ans = self.postprocess_downloaded_google_metadata(ans, relevance)\n result_queue.put(ans)\n found = True\n except:\n log.exception('Failed to get metadata for google books id:', gid)\n if abort.is_set():\n break\n if not found and isbn and (title or authors):\n return self.identify_via_web_search(log, result_queue, abort, title, authors, {}, timeout)\n # }}}\n\n def identify( # {{{\n self,\n log,\n result_queue,\n abort,\n title=None,\n authors=None,\n identifiers={},\n timeout=30\n ):\n from lxml import etree\n entry = XPath('//atom:entry')\n identifiers = identifiers.copy()\n br = self.browser\n if 'google' in identifiers:\n try:\n ans = to_metadata(br, log, identifiers['google'], timeout, self.running_a_test)\n if isinstance(ans, Metadata):\n self.postprocess_downloaded_google_metadata(ans)\n result_queue.put(ans)\n return\n except Exception:\n log.exception('Failed to get metadata for Google identifier:', identifiers['google'])\n del identifiers['google']\n\n query = self.create_query(\n title=title, authors=authors, identifiers=identifiers\n )\n if not query:\n log.error('Insufficient metadata to construct query')\n return\n\n def make_query(query):\n log('Making query:', query)\n try:\n raw = br.open_novisit(query, timeout=timeout).read()\n except Exception as e:\n log.exception('Failed to make identify query: %r' % query)\n return False, as_unicode(e)\n\n try:\n feed = etree.fromstring(\n xml_to_unicode(clean_ascii_chars(raw), strip_encoding_pats=True)[0],\n parser=etree.XMLParser(recover=True, no_network=True, resolve_entities=False)\n )\n return True, entry(feed)\n except Exception as e:\n log.exception('Failed to parse identify results')\n return False, as_unicode(e)\n ok, entries = make_query(query)\n if not ok:\n return entries\n if not entries and not abort.is_set():\n log('No results found, doing a web search instead')\n return self.identify_via_web_search(log, result_queue, abort, title, authors, identifiers, timeout)\n\n # There is no point running these queries in threads as google\n # throttles requests returning 403 Forbidden errors\n self.get_all_details(br, log, entries, abort, result_queue, timeout)\n\n # }}}\n\n\nif __name__ == '__main__': # tests {{{\n # To run these test use:\n # calibre-debug src/calibre/ebooks/metadata/sources/google.py\n from calibre.ebooks.metadata.sources.test import authors_test, test_identify_plugin, title_test\n tests = [\n ({\n 'identifiers': {'google': 's7NIrgEACAAJ'},\n }, [title_test('Ride Every Stride', exact=False)]),\n\n ({\n 'identifiers': {'isbn': '0743273567'},\n 'title': 'Great Gatsby',\n 'authors': ['Fitzgerald']\n }, [\n title_test('The great gatsby', exact=True),\n authors_test(['F. Scott Fitzgerald'])\n ]),\n\n ({\n 'title': 'Flatland',\n 'authors': ['Abbott']\n }, [title_test('Flatland', exact=False)]),\n\n ({\n 'title': 'The Blood Red Indian Summer: A Berger and Mitry Mystery',\n 'authors': ['David Handler'],\n }, [title_test('The Blood Red Indian Summer: A Berger and Mitry Mystery')\n ]),\n\n ({\n # requires using web search to find the book\n 'title': 'Dragon Done It',\n 'authors': ['Eric Flint'],\n }, [\n title_test('The dragon done it', exact=True),\n authors_test(['Eric Flint', 'Mike Resnick'])\n ]),\n\n ]\n test_identify_plugin(GoogleBooks.name, tests[:])\n\n# }}}\n",
+ "google_images": "#!/usr/bin/env python\n# vim:fileencoding=UTF-8\nfrom __future__ import absolute_import, division, print_function, unicode_literals\n\n__license__ = 'GPL v3'\n__copyright__ = '2013, Kovid Goyal <kovid@kovidgoyal.net>'\n__docformat__ = 'restructuredtext en'\n\nfrom collections import OrderedDict\n\nfrom calibre import random_user_agent\nfrom calibre.ebooks.metadata.sources.base import Option, Source\n\n\ndef parse_html(raw):\n try:\n from html5_parser import parse\n except ImportError:\n # Old versions of calibre\n import html5lib\n return html5lib.parse(raw, treebuilder='lxml', namespaceHTMLElements=False)\n else:\n return parse(raw)\n\n\ndef imgurl_from_id(raw, tbnid):\n from json import JSONDecoder\n q = '\"{}\",['.format(tbnid)\n start_pos = raw.index(q)\n if start_pos < 100:\n return\n jd = JSONDecoder()\n data = jd.raw_decode('[' + raw[start_pos:])[0]\n # from pprint import pprint\n # pprint(data)\n url_num = 0\n for x in data:\n if isinstance(x, list) and len(x) == 3:\n q = x[0]\n if hasattr(q, 'lower') and q.lower().startswith('http'):\n url_num += 1\n if url_num > 1:\n return q\n\n\ndef parse_google_markup(raw):\n root = parse_html(raw)\n # newer markup pages use data-docid not data-tbnid\n results = root.xpath('//div/@data-tbnid') or root.xpath('//div/@data-docid')\n ans = OrderedDict()\n for tbnid in results:\n try:\n imgurl = imgurl_from_id(raw, tbnid)\n except Exception:\n continue\n if imgurl:\n ans[imgurl] = True\n return list(ans)\n\n\nclass GoogleImages(Source):\n\n name = 'Google Images'\n version = (1, 0, 6)\n minimum_calibre_version = (2, 80, 0)\n description = _('Downloads covers from a Google Image search. Useful to find larger/alternate covers.')\n capabilities = frozenset(['cover'])\n can_get_multiple_covers = True\n supports_gzip_transfer_encoding = True\n options = (Option('max_covers', 'number', 5, _('Maximum number of covers to get'),\n _('The maximum number of covers to process from the Google search result')),\n Option('size', 'choices', 'svga', _('Cover size'),\n _('Search for covers larger than the specified size'),\n choices=OrderedDict((\n ('any', _('Any size'),),\n ('l', _('Large'),),\n ('qsvga', _('Larger than %s')%'400x300',),\n ('vga', _('Larger than %s')%'640x480',),\n ('svga', _('Larger than %s')%'600x800',),\n ('xga', _('Larger than %s')%'1024x768',),\n ('2mp', _('Larger than %s')%'2 MP',),\n ('4mp', _('Larger than %s')%'4 MP',),\n ))),\n )\n\n def download_cover(self, log, result_queue, abort,\n title=None, authors=None, identifiers={}, timeout=30, get_best_cover=False):\n if not title:\n return\n timeout = max(60, timeout) # Needs at least a minute\n title = ' '.join(self.get_title_tokens(title))\n author = ' '.join(self.get_author_tokens(authors))\n urls = self.get_image_urls(title, author, log, abort, timeout)\n self.download_multiple_covers(title, authors, urls, get_best_cover, timeout, result_queue, abort, log)\n\n @property\n def user_agent(self):\n return random_user_agent(allow_ie=False)\n\n def get_image_urls(self, title, author, log, abort, timeout):\n from calibre.utils.cleantext import clean_ascii_chars\n try:\n from urllib.parse import urlencode\n except ImportError:\n from urllib import urlencode\n br = self.browser\n q = urlencode({'as_q': ('%s %s'%(title, author)).encode('utf-8')})\n if isinstance(q, bytes):\n q = q.decode('utf-8')\n sz = self.prefs['size']\n if sz == 'any':\n sz = ''\n elif sz == 'l':\n sz = 'isz:l,'\n else:\n sz = 'isz:lt,islt:%s,' % sz\n # See https://www.google.com/advanced_image_search to understand this\n # URL scheme\n url = 'https://www.google.com/search?as_st=y&tbm=isch&{}&as_epq=&as_oq=&as_eq=&cr=&as_sitesearch=&safe=images&tbs={}iar:t,ift:jpg'.format(q, sz)\n log('Search URL: ' + url)\n # See https://github.com/benbusby/whoogle-search/pull/1054 for cookies\n br.set_simple_cookie('CONSENT', 'PENDING+987', '.google.com', path='/')\n template = b'\\x08\\x01\\x128\\x08\\x14\\x12+boq_identityfrontenduiserver_20231107.05_p0\\x1a\\x05en-US \\x03\\x1a\\x06\\x08\\x80\\xf1\\xca\\xaa\\x06'\n from base64 import standard_b64encode\n from datetime import date\n template.replace(b'20231107', date.today().strftime('%Y%m%d').encode('ascii'))\n br.set_simple_cookie('SOCS', standard_b64encode(template).decode('ascii').rstrip('='), '.google.com', path='/')\n # br.set_debug_http(True)\n raw = clean_ascii_chars(br.open(url).read().decode('utf-8'))\n # with open('/t/raw.html', 'w') as f:\n # f.write(raw)\n return parse_google_markup(raw)\n\n\ndef test_raw():\n import sys\n raw = open(sys.argv[-1]).read()\n for x in parse_google_markup(raw):\n print(x)\n\n\ndef test(title='Star Trek: Section 31: Control', authors=('David Mack',)):\n try:\n from queue import Queue\n except ImportError:\n from Queue import Queue\n from threading import Event\n\n from calibre.utils.logging import default_log\n p = GoogleImages(None)\n p.log = default_log\n rq = Queue()\n p.download_cover(default_log, rq, Event(), title=title, authors=authors)\n print('Downloaded', rq.qsize(), 'covers')\n\n\nif __name__ == '__main__':\n test()\n",
+ "hashes": {
+ "amazon": "f6cf0489e959fad81d2e05515829c79a1ae88565",
+ "big_book_search": "7a8b67c0f19ecbfe8a9d28b961aab1119f31c3e3",
+ "edelweiss": "54f2d2d6d00d4a7081e72d08d8b7b4bb4288cb53",
+ "google": "5964ec4972eade9c7e30cea611c82b9017b16402",
+ "google_images": "4244dd8267cb6215c7dfd2da166c6e02b1db31ea",
+ "openlibrary": "239077a692701cbf0281e7a2e64306cd00217410",
+ "search_engines": "9cd39fb1a1244d7784e2a6cfd363a1651ac9d10c"
+ },
+ "openlibrary": "#!/usr/bin/env python\n# vim:fileencoding=UTF-8:ts=4:sw=4:sta:et:sts=4:ai\nfrom __future__ import absolute_import, division, print_function, unicode_literals\n\n__license__ = 'GPL v3'\n__copyright__ = '2011, Kovid Goyal <kovid@kovidgoyal.net>'\n__docformat__ = 'restructuredtext en'\n\nfrom calibre.ebooks.metadata.sources.base import Source\n\n\nclass OpenLibrary(Source):\n\n name = 'Open Library'\n version = (1, 0, 2)\n minimum_calibre_version = (2, 80, 0)\n description = _('Downloads covers from The Open Library')\n\n capabilities = frozenset(['cover'])\n\n OPENLIBRARY = 'https://covers.openlibrary.org/b/isbn/%s-L.jpg?default=false'\n\n def download_cover(self, log, result_queue, abort,\n title=None, authors=None, identifiers={}, timeout=30, get_best_cover=False):\n if 'isbn' not in identifiers:\n return\n isbn = identifiers['isbn']\n br = self.browser\n try:\n ans = br.open_novisit(self.OPENLIBRARY%isbn, timeout=timeout).read()\n result_queue.put((self, ans))\n except Exception as e:\n if callable(getattr(e, 'getcode', None)) and e.getcode() == 404:\n log.error('No cover for ISBN: %r found'%isbn)\n else:\n log.exception('Failed to download cover for ISBN:', isbn)\n",
+ "search_engines": "#!/usr/bin/env python\n# vim:fileencoding=utf-8\n# License: GPLv3 Copyright: 2017, Kovid Goyal <kovid at kovidgoyal.net>\n\nfrom __future__ import absolute_import, division, print_function, unicode_literals\n\nimport json\nimport os\nimport re\nimport sys\nimport time\nfrom collections import namedtuple\nfrom contextlib import contextmanager\nfrom functools import partial\nfrom threading import Lock\n\ntry:\n from urllib.parse import parse_qs, quote, quote_plus, urlencode, urlparse\nexcept ImportError:\n from urllib import quote, quote_plus, urlencode\n\n from urlparse import parse_qs, urlparse\n\nfrom lxml import etree\n\nfrom calibre import browser as _browser\nfrom calibre import prints as safe_print\nfrom calibre import random_user_agent\nfrom calibre.constants import cache_dir\nfrom calibre.ebooks.chardet import xml_to_unicode\nfrom calibre.utils.lock import ExclusiveFile\nfrom calibre.utils.random_ua import accept_header_for_ua\n\ncurrent_version = (1, 2, 13)\nminimum_calibre_version = (2, 80, 0)\nwebcache = {}\nwebcache_lock = Lock()\nprints = partial(safe_print, file=sys.stderr)\n\n\nResult = namedtuple('Result', 'url title cached_url')\n\n\n@contextmanager\ndef rate_limit(name='test', time_between_visits=2, max_wait_seconds=5 * 60, sleep_time=0.2):\n lock_file = os.path.join(cache_dir(), 'search-engine.' + name + '.lock')\n with ExclusiveFile(lock_file, timeout=max_wait_seconds, sleep_time=sleep_time) as f:\n try:\n lv = float(f.read().decode('utf-8').strip())\n except Exception:\n lv = 0\n # we cannot use monotonic() as this is cross process and historical\n # data as well\n delta = time.time() - lv\n if delta < time_between_visits:\n time.sleep(time_between_visits - delta)\n try:\n yield\n finally:\n f.seek(0)\n f.truncate()\n f.write(repr(time.time()).encode('utf-8'))\n\n\ndef tostring(elem):\n return etree.tostring(elem, encoding='unicode', method='text', with_tail=False)\n\n\ndef browser():\n ua = random_user_agent(allow_ie=False)\n # ua = 'Mozilla/5.0 (Linux; Android 8.0.0; VTR-L29; rv:63.0) Gecko/20100101 Firefox/63.0'\n br = _browser(user_agent=ua)\n br.set_handle_gzip(True)\n br.addheaders += [\n ('Accept', accept_header_for_ua(ua)),\n ('Upgrade-insecure-requests', '1'),\n ]\n return br\n\n\ndef encode_query(**query):\n q = {k.encode('utf-8'): v.encode('utf-8') for k, v in query.items()}\n return urlencode(q).decode('utf-8')\n\n\ndef parse_html(raw):\n try:\n from html5_parser import parse\n except ImportError:\n # Old versions of calibre\n import html5lib\n return html5lib.parse(raw, treebuilder='lxml', namespaceHTMLElements=False)\n else:\n return parse(raw)\n\n\ndef query(br, url, key, dump_raw=None, limit=1, parser=parse_html, timeout=60, save_raw=None, simple_scraper=None):\n with rate_limit(key):\n if simple_scraper is None:\n raw = br.open_novisit(url, timeout=timeout).read()\n raw = xml_to_unicode(raw, strip_encoding_pats=True)[0]\n else:\n raw = simple_scraper(url, timeout=timeout)\n if dump_raw is not None:\n with open(dump_raw, 'w') as f:\n f.write(raw)\n if save_raw is not None:\n save_raw(raw)\n return parser(raw)\n\n\ndef quote_term(x):\n ans = quote_plus(x.encode('utf-8'))\n if isinstance(ans, bytes):\n ans = ans.decode('utf-8')\n return ans\n\n\n# DDG + Wayback machine {{{\n\ndef ddg_url_processor(url):\n return url\n\n\ndef ddg_term(t):\n t = t.replace('\"', '')\n if t.lower() in {'map', 'news'}:\n t = '\"' + t + '\"'\n if t in {'OR', 'AND', 'NOT'}:\n t = t.lower()\n return t\n\n\ndef ddg_href(url):\n if url.startswith('/'):\n q = url.partition('?')[2]\n url = parse_qs(q.encode('utf-8'))['uddg'][0].decode('utf-8')\n return url\n\n\ndef wayback_machine_cached_url(url, br=None, log=prints, timeout=60):\n q = quote_term(url)\n br = br or browser()\n try:\n data = query(br, 'https://archive.org/wayback/available?url=' +\n q, 'wayback', parser=json.loads, limit=0.25, timeout=timeout)\n except Exception as e:\n log('Wayback machine query failed for url: ' + url + ' with error: ' + str(e))\n return None\n try:\n closest = data['archived_snapshots']['closest']\n if closest['available']:\n ans = closest['url'].replace('http:', 'https:', 1)\n # get unmodified HTML\n ans = ans.replace(closest['timestamp'], closest['timestamp'] + 'id_', 1)\n return ans\n except Exception:\n pass\n from pprint import pformat\n log('Response from wayback machine:', pformat(data))\n\n\ndef wayback_url_processor(url):\n if url.startswith('/'):\n # Use original URL instead of absolutizing to wayback URL as wayback is\n # slow\n m = re.search(r'https?:', url)\n if m is None:\n url = 'https://web.archive.org' + url\n else:\n url = url[m.start():]\n return url\n\n\nddg_scraper_storage = []\n\n\ndef ddg_search(terms, site=None, br=None, log=prints, safe_search=False, dump_raw=None, timeout=60):\n # https://duck.co/help/results/syntax\n terms = [quote_term(ddg_term(t)) for t in terms]\n if site is not None:\n terms.append(quote_term(('site:' + site)))\n q = '+'.join(terms)\n url = 'https://duckduckgo.com/html/?q={q}&kp={kp}'.format(\n q=q, kp=1 if safe_search else -1)\n log('Making ddg query: ' + url)\n from calibre.scraper.simple import read_url\n br = br or browser()\n root = query(br, url, 'ddg', dump_raw, timeout=timeout, simple_scraper=partial(read_url, ddg_scraper_storage))\n ans = []\n for a in root.xpath('//*[@class=\"results\"]//*[@class=\"result__title\"]/a[@href and @class=\"result__a\"]'):\n try:\n ans.append(Result(ddg_href(a.get('href')), tostring(a), None))\n except KeyError:\n log('Failed to find ddg href in:', a.get('href'))\n return ans, url\n\n\ndef ddg_develop():\n br = browser()\n for result in ddg_search('heroes abercrombie'.split(), 'www.amazon.com', dump_raw='/t/raw.html', br=br)[0]:\n if '/dp/' in result.url:\n print(result.title)\n print(' ', result.url)\n print(' ', get_cached_url(result.url, br))\n print()\n# }}}\n\n\n# Bing {{{\n\ndef bing_term(t):\n t = t.replace('\"', '')\n if t in {'OR', 'AND', 'NOT'}:\n t = t.lower()\n return t\n\n\ndef bing_url_processor(url):\n return url\n\n\ndef resolve_bing_wrapper_page(url, br, log):\n raw = br.open_novisit(url).read().decode('utf-8', 'replace')\n m = re.search(r'var u = \"(.+)\"', raw)\n if m is None:\n log('Failed to resolve bing wrapper page for url: ' + url)\n return url\n log('Resolved bing wrapped URL: ' + url + ' to ' + m.group(1))\n return m.group(1)\n\n\nbing_scraper_storage = []\n\n\ndef bing_search(\n terms, site=None, br=None, log=prints, safe_search=False, dump_raw=None, timeout=60,\n show_user_agent=False, result_url_is_ok=lambda x: True\n):\n # http://vlaurie.com/computers2/Articles/bing_advanced_search.htm\n terms = [quote_term(bing_term(t)) for t in terms]\n if site is not None:\n terms.append(quote_term(('site:' + site)))\n q = '+'.join(terms)\n url = 'https://www.bing.com/search?q={q}'.format(q=q)\n log('Making bing query: ' + url)\n from calibre.scraper.simple import read_url\n root = query(br, url, 'bing', dump_raw, timeout=timeout, simple_scraper=partial(read_url, bing_scraper_storage))\n ans = []\n result_items = root.xpath('//*[@id=\"b_results\"]/li[@class=\"b_algo\"]')\n if not result_items:\n log('Bing returned no results')\n return ans, url\n for li in result_items:\n a = li.xpath('descendant::h2/a[@href]') or li.xpath('descendant::div[@class=\"b_algoheader\"]/a[@href]')\n a = a[0]\n title = tostring(a)\n ans_url = a.get('href')\n if ans_url.startswith('https://www.bing.com/'):\n ans_url = resolve_bing_wrapper_page(ans_url, br, log)\n if result_url_is_ok(ans_url):\n ans.append(Result(ans_url, title, None))\n if not ans:\n title = ' '.join(root.xpath('//title/text()'))\n log('Failed to find any results on results page, with title:', title)\n return ans, url\n\n\ndef bing_develop(terms='heroes abercrombie'):\n if isinstance(terms, str):\n terms = terms.split()\n for result in bing_search(terms, 'www.amazon.com', dump_raw='/t/raw.html', show_user_agent=True)[0]:\n if '/dp/' in result.url:\n print(result.title)\n print(' ', result.url)\n print(' ', result.cached_url)\n print()\n# }}}\n\n\n# Google {{{\n\ndef google_term(t):\n t = t.replace('\"', '')\n if t in {'OR', 'AND', 'NOT'}:\n t = t.lower()\n return t\n\n\ndef google_url_processor(url):\n return url\n\n\ndef google_cache_url_for_url(url):\n if not isinstance(url, bytes):\n url = url.encode('utf-8')\n cu = quote(url, safe='')\n if isinstance(cu, bytes):\n cu = cu.decode('utf-8')\n return 'https://webcache.googleusercontent.com/search?q=cache:' + cu\n\n\ndef google_get_cached_url(url, br=None, log=prints, timeout=60):\n # Google's webcache was discontinued in september 2024\n cached_url = google_cache_url_for_url(url)\n br = google_specialize_browser(br or browser())\n try:\n raw = query(br, cached_url, 'google-cache', parser=lambda x: x.encode('utf-8'), timeout=timeout)\n except Exception as err:\n log('Failed to get cached URL from google for URL: {} with error: {}'.format(url, err))\n else:\n with webcache_lock:\n webcache[cached_url] = raw\n return cached_url\n\n\ndef canonicalize_url_for_cache_map(url):\n try:\n purl = urlparse(url)\n except Exception:\n return url\n if '.amazon.' in purl.netloc:\n url = url.split('&', 1)[0]\n return url\n\n\ndef google_parse_results(root, raw, log=prints, ignore_uncached=True):\n ans = []\n seen = set()\n for div in root.xpath('//*[@id=\"search\"]//*[@id=\"rso\"]//div[descendant::h3]'):\n try:\n a = div.xpath('descendant::a[@href]')[0]\n except IndexError:\n log('Ignoring div with no main result link')\n continue\n title = tostring(a)\n src_url = a.get('href')\n # print(f'{src_url=}')\n curl = canonicalize_url_for_cache_map(src_url)\n if curl in seen:\n continue\n seen.add(curl)\n ans.append(Result(curl, title, None))\n if not ans:\n title = ' '.join(root.xpath('//title/text()'))\n log('Failed to find any results on results page, with title:', title)\n return ans\n\n\ndef google_consent_cookies():\n # See https://github.com/benbusby/whoogle-search/pull/1054 for cookies\n from base64 import standard_b64encode\n from datetime import date\n base = {'domain': '.google.com', 'path': '/'}\n b = base.copy()\n b['name'], b['value'] = 'CONSENT', 'PENDING+987'\n yield b\n template = b'\\x08\\x01\\x128\\x08\\x14\\x12+boq_identityfrontenduiserver_20231107.05_p0\\x1a\\x05en-US \\x03\\x1a\\x06\\x08\\x80\\xf1\\xca\\xaa\\x06'\n template.replace(b'20231107', date.today().strftime('%Y%m%d').encode('ascii'))\n b = base.copy()\n b['name'], b['value'] = 'SOCS', standard_b64encode(template).decode('ascii').rstrip('=')\n yield b\n\n\ndef google_specialize_browser(br):\n with webcache_lock:\n if not hasattr(br, 'google_consent_cookie_added'):\n for c in google_consent_cookies():\n br.set_simple_cookie(c['name'], c['value'], c['domain'], path=c['path'])\n br.google_consent_cookie_added = True\n return br\n\n\ndef is_probably_book_asin(t):\n return t and len(t) == 10 and t.startswith('B') and t.upper() == t\n\n\ndef is_asin_or_isbn(t):\n from calibre.ebooks.metadata import check_isbn\n return bool(check_isbn(t) or is_probably_book_asin(t))\n\n\ndef google_format_query(terms, site=None, tbm=None):\n prevent_spelling_correction = False\n for t in terms:\n if is_asin_or_isbn(t):\n prevent_spelling_correction = True\n break\n terms = [quote_term(google_term(t)) for t in terms]\n if site is not None:\n terms.append(quote_term(('site:' + site)))\n q = '+'.join(terms)\n url = 'https://www.google.com/search?q={q}'.format(q=q)\n if tbm:\n url += '&tbm=' + tbm\n if prevent_spelling_correction:\n url += '&nfpr=1'\n return url\n\n\ndef google_search(terms, site=None, br=None, log=prints, safe_search=False, dump_raw=None, timeout=60):\n url = google_format_query(terms, site)\n log('Making google query: ' + url)\n br = google_specialize_browser(br or browser())\n r = []\n root = query(br, url, 'google', dump_raw, timeout=timeout, save_raw=r.append)\n return google_parse_results(root, r[0], log=log), url\n\n\ndef google_develop(search_terms='1423146786', raw_from=''):\n if raw_from:\n with open(raw_from, 'rb') as f:\n raw = f.read()\n results = google_parse_results(parse_html(raw), raw)\n else:\n br = browser()\n results = google_search(search_terms.split(), 'www.amazon.com', dump_raw='/t/raw.html', br=br)[0]\n for result in results:\n if '/dp/' in result.url:\n print(result.title)\n print(' ', result.url)\n print(' ', result.cached_url)\n print()\n# }}}\n\n\ndef get_cached_url(url, br=None, log=prints, timeout=60):\n from threading import Lock, Thread\n\n from polyglot.queue import Queue\n print_lock = Lock()\n q = Queue()\n\n def safe_print(*a):\n with print_lock:\n log(*a)\n\n def doit(func):\n try:\n q.put(func(url, br, safe_print, timeout))\n except Exception as e:\n safe_print(e)\n q.put(None)\n\n threads = []\n threads.append(Thread(target=doit, args=(wayback_machine_cached_url,), daemon=True).start())\n while threads:\n x = q.get()\n if x is not None:\n return x\n threads.pop()\n\n\ndef get_data_for_cached_url(url):\n with webcache_lock:\n return webcache.get(url)\n\n\ndef resolve_url(url):\n prefix, rest = url.partition(':')[::2]\n if prefix == 'bing':\n return bing_url_processor(rest)\n if prefix == 'wayback':\n return wayback_url_processor(rest)\n return url\n\n\n# if __name__ == '__main__':\n# import sys\n# func = sys.argv[-1]\n# globals()[func]()\n"
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/metadata_sources/global.json b/dotfiles/system/.config/calibre/metadata_sources/global.json
new file mode 100644
index 0000000..7b91e39
--- /dev/null
+++ b/dotfiles/system/.config/calibre/metadata_sources/global.json
@@ -0,0 +1,15 @@
+{
+ "ignore_fields": [
+ "rating",
+ "series"
+ ],
+ "tag_map_rules": [
+ {
+ "action": "remove",
+ "match_type": "not_one_of",
+ "query": "Art, Biography & Autobiography, Business, Chess, Computers, Cooking, Critical Theory, Design, Economics, French, History, Law, Linguistics, Literature, Magic, Mathematics, Music, Mythology, Non Fiction, Philosophy, Poetry, Political Science, Politics, Psychology, Religion, Science, Social Critique, Sociology, Travel",
+ "replace": ""
+ }
+ ],
+ "txt_comments": true
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/mtp_devices.json b/dotfiles/system/.config/calibre/mtp_devices.json
new file mode 100644
index 0000000..274f3de
--- /dev/null
+++ b/dotfiles/system/.config/calibre/mtp_devices.json
@@ -0,0 +1,9 @@
+{
+ "blacklist": [],
+ "history": {
+ "G0W19E040464033L": [
+ "Fire",
+ "2021-01-28T21:54:04.815072+00:00"
+ ]
+ }
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/plugins/Clean Comments.zip b/dotfiles/system/.config/calibre/plugins/Clean Comments.zip
new file mode 100644
index 0000000..224fcd7
--- /dev/null
+++ b/dotfiles/system/.config/calibre/plugins/Clean Comments.zip
Binary files differ
diff --git a/dotfiles/system/.config/calibre/plugins/Extract ISBN.zip b/dotfiles/system/.config/calibre/plugins/Extract ISBN.zip
new file mode 100644
index 0000000..7214c0e
--- /dev/null
+++ b/dotfiles/system/.config/calibre/plugins/Extract ISBN.zip
Binary files differ
diff --git a/dotfiles/system/.config/calibre/plugins/Favourites Menu.json b/dotfiles/system/.config/calibre/plugins/Favourites Menu.json
new file mode 100644
index 0000000..4e7c163
--- /dev/null
+++ b/dotfiles/system/.config/calibre/plugins/Favourites Menu.json
@@ -0,0 +1,65 @@
+{
+ "menus": [
+ {
+ "display": "View default list",
+ "path": [
+ "Reading List",
+ "View default list"
+ ]
+ },
+ null,
+ {
+ "display": "Add to default list",
+ "path": [
+ "Reading List",
+ "Add to default list"
+ ]
+ },
+ {
+ "display": "Remove from default list",
+ "path": [
+ "Reading List",
+ "Remove from default list"
+ ]
+ },
+ {
+ "display": "Edit default list",
+ "path": [
+ "Reading List",
+ "Edit default list"
+ ]
+ },
+ {
+ "display": "Extract ISBN",
+ "path": [
+ "Extract ISBN"
+ ]
+ },
+ {
+ "display": "Clean Comments",
+ "path": [
+ "Clean Comments"
+ ]
+ },
+ {
+ "display": "Find Duplicates",
+ "path": [
+ "Find Duplicates"
+ ]
+ },
+ {
+ "display": "Convert books",
+ "path": [
+ "Convert Books"
+ ]
+ },
+ null,
+ {
+ "display": "Start Content server",
+ "path": [
+ "Connect Share",
+ "Start Content server"
+ ]
+ }
+ ]
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/plugins/Favourites Menu.zip b/dotfiles/system/.config/calibre/plugins/Favourites Menu.zip
new file mode 100644
index 0000000..767f621
--- /dev/null
+++ b/dotfiles/system/.config/calibre/plugins/Favourites Menu.zip
Binary files differ
diff --git a/dotfiles/system/.config/calibre/plugins/Find Duplicates.json b/dotfiles/system/.config/calibre/plugins/Find Duplicates.json
new file mode 100644
index 0000000..e58998a
--- /dev/null
+++ b/dotfiles/system/.config/calibre/plugins/Find Duplicates.json
@@ -0,0 +1,13 @@
+{
+ "authorMatch": "identical",
+ "authorSoundexLength": 8,
+ "autoDeleteBinaryDups": false,
+ "identifierType": "isbn",
+ "includeLanguages": false,
+ "searchType": "titleauthor",
+ "showAllGroups": true,
+ "showTagAuthor": true,
+ "sortGroupsByTitle": true,
+ "titleMatch": "identical",
+ "titleSoundexLength": 6
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/plugins/Find Duplicates.zip b/dotfiles/system/.config/calibre/plugins/Find Duplicates.zip
new file mode 100644
index 0000000..a6ce77a
--- /dev/null
+++ b/dotfiles/system/.config/calibre/plugins/Find Duplicates.zip
Binary files differ
diff --git a/dotfiles/system/.config/calibre/plugins/Kindle hi-res covers.zip b/dotfiles/system/.config/calibre/plugins/Kindle hi-res covers.zip
new file mode 100644
index 0000000..40106fe
--- /dev/null
+++ b/dotfiles/system/.config/calibre/plugins/Kindle hi-res covers.zip
Binary files differ
diff --git a/dotfiles/system/.config/calibre/plugins/Kobo Utilities.json b/dotfiles/system/.config/calibre/plugins/Kobo Utilities.json
new file mode 100644
index 0000000..092be8d
--- /dev/null
+++ b/dotfiles/system/.config/calibre/plugins/Kobo Utilities.json
@@ -0,0 +1,34 @@
+{
+ "Devices": {
+ "8de75c8a-f9b6-405c-86a3-515afd1e71fa": {
+ "active": true,
+ "backupOptionsStore": {
+ "backupCopiesToKeepSpin": 10,
+ "backupDestDirectory": "/home/cjennings/Documents/kobo",
+ "backupEachCOnnection": true,
+ "backupZipDatabase": true,
+ "doDailyBackp": false
+ },
+ "location_code": "main",
+ "name": "Kobo Libra 2",
+ "serial_no": "N4181C1037466",
+ "type": "Kobo Libra 2",
+ "updateOptionsStore": {
+ "doEarlyFirmwareUpdate": false,
+ "doFirmwareUpdateCheck": true,
+ "firmwareUpdateCheckLastTime": 0
+ },
+ "uuid": "8de75c8a-f9b6-405c-86a3-515afd1e71fa"
+ }
+ },
+ "commonOptionsStore": {
+ "buttonActionDevice": "",
+ "buttonActionLibrary": "",
+ "individualDeviceOptions": true
+ },
+ "updateOptionsStore": {
+ "doEarlyFirmwareUpdate": false,
+ "doFirmwareUpdateCheck": false,
+ "firmwareUpdateCheckLastTime": 1656213583
+ }
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/plugins/Kobo Utilities.zip b/dotfiles/system/.config/calibre/plugins/Kobo Utilities.zip
new file mode 100644
index 0000000..0fe0b20
--- /dev/null
+++ b/dotfiles/system/.config/calibre/plugins/Kobo Utilities.zip
Binary files differ
diff --git a/dotfiles/system/.config/calibre/plugins/KoboTouchExtended.zip b/dotfiles/system/.config/calibre/plugins/KoboTouchExtended.zip
new file mode 100644
index 0000000..3640da2
--- /dev/null
+++ b/dotfiles/system/.config/calibre/plugins/KoboTouchExtended.zip
Binary files differ
diff --git a/dotfiles/system/.config/calibre/plugins/Open With.json b/dotfiles/system/.config/calibre/plugins/Open With.json
new file mode 100644
index 0000000..81eaeb8
--- /dev/null
+++ b/dotfiles/system/.config/calibre/plugins/Open With.json
@@ -0,0 +1,61 @@
+{
+ "OpenWithMenus": {
+ "Menus": [
+ {
+ "active": false,
+ "appArgs": "",
+ "appPath": "firefox",
+ "format": "EPUB",
+ "image": "owp_firefox.png",
+ "menuText": "EPUBReader (EPUB)",
+ "subMenu": ""
+ },
+ {
+ "active": false,
+ "appArgs": "-c",
+ "appPath": "/usr/bin/emacsclient",
+ "format": "PDF",
+ "image": "reader.png",
+ "menuText": "Emacsclient",
+ "subMenu": ""
+ },
+ {
+ "active": true,
+ "appArgs": "",
+ "appPath": "/usr/bin/zathura",
+ "format": "EPUB",
+ "image": "edit_book.png",
+ "menuText": "Zathura (EPUB)",
+ "subMenu": ""
+ },
+ {
+ "active": true,
+ "appArgs": "",
+ "appPath": "/usr/bin/zathura",
+ "format": "PDF",
+ "image": "PDF.png",
+ "menuText": "Zathura (PDF)",
+ "subMenu": ""
+ },
+ {
+ "active": false,
+ "appArgs": "-c",
+ "appPath": "/usr/bin/emacsclient",
+ "format": "EPUB",
+ "image": "PDF.png",
+ "menuText": "Emacsclient",
+ "subMenu": ""
+ },
+ {
+ "active": false,
+ "appArgs": "",
+ "appPath": "gimp",
+ "format": "COVER",
+ "image": "owp_gimp.png",
+ "menuText": "Gimp (Cover)",
+ "subMenu": ""
+ }
+ ],
+ "UrlColWidth": 202
+ }
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/plugins/Open With.zip b/dotfiles/system/.config/calibre/plugins/Open With.zip
new file mode 100644
index 0000000..548c8ed
--- /dev/null
+++ b/dotfiles/system/.config/calibre/plugins/Open With.zip
Binary files differ
diff --git a/dotfiles/system/.config/calibre/plugins/Reading List.json b/dotfiles/system/.config/calibre/plugins/Reading List.json
new file mode 100644
index 0000000..cccd021
--- /dev/null
+++ b/dotfiles/system/.config/calibre/plugins/Reading List.json
@@ -0,0 +1,3 @@
+{
+ "SchemaVersion": 1.65
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/plugins/Reading List.zip b/dotfiles/system/.config/calibre/plugins/Reading List.zip
new file mode 100644
index 0000000..a5ea9d8
--- /dev/null
+++ b/dotfiles/system/.config/calibre/plugins/Reading List.zip
Binary files differ
diff --git a/dotfiles/system/.config/calibre/save_to_disk.py.json b/dotfiles/system/.config/calibre/save_to_disk.py.json
new file mode 100644
index 0000000..e4cd185
--- /dev/null
+++ b/dotfiles/system/.config/calibre/save_to_disk.py.json
@@ -0,0 +1,14 @@
+{
+ "asciiize": false,
+ "formats": "all",
+ "replace_whitespace": false,
+ "save_cover": true,
+ "send_template": "{author_sort}/{title} - {authors}",
+ "send_timefmt": "%b, %Y",
+ "single_dir": false,
+ "template": "{author_sort}/{title}/{title} - {authors}",
+ "timefmt": "%b, %Y",
+ "to_lowercase": false,
+ "update_metadata": true,
+ "write_opf": true
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/server-config.txt b/dotfiles/system/.config/calibre/server-config.txt
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/dotfiles/system/.config/calibre/server-config.txt
diff --git a/dotfiles/system/.config/calibre/server-users.sqlite b/dotfiles/system/.config/calibre/server-users.sqlite
new file mode 100644
index 0000000..c191559
--- /dev/null
+++ b/dotfiles/system/.config/calibre/server-users.sqlite
Binary files differ
diff --git a/dotfiles/system/.config/calibre/shortcuts/main.json b/dotfiles/system/.config/calibre/shortcuts/main.json
new file mode 100644
index 0000000..292c600
--- /dev/null
+++ b/dotfiles/system/.config/calibre/shortcuts/main.json
@@ -0,0 +1,18 @@
+{
+ "map": {
+ "Interface Action: Extract ISBN (Extract ISBN) - qaction": [
+ "Ctrl+I"
+ ],
+ "Interface Action: Open With (Open With) : menu action : EPUBZathura (EPUB)": [
+ "Z"
+ ],
+ "Interface Action: Open With (Open With) : menu action : PDFZathura (PDF)": [
+ "Shift+Z"
+ ],
+ "Toggle Quickview": [],
+ "quit calibre": [
+ "Q"
+ ]
+ },
+ "options_map": {}
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/tag-map-rules.json b/dotfiles/system/.config/calibre/tag-map-rules.json
new file mode 100644
index 0000000..7238834
--- /dev/null
+++ b/dotfiles/system/.config/calibre/tag-map-rules.json
@@ -0,0 +1,10 @@
+{
+ "default": [
+ {
+ "action": "remove",
+ "match_type": "not_one_of",
+ "query": "Art, Biography & Autobiography, Business, Chess, Comics, Computer, Cooking, Design, Economics, Fiction, Finance, Fitness, Games, Gardening, History, Latin, Law, Linguistics, Literary Critique, Literature, Magic, Mathematics, Music, Mythology, Non-Fiction, Philosophy, Poetry, Political Science, Politics, Psychology, Religion, Science, Social Critique, Sociology, Travel, Zen",
+ "replace": ""
+ }
+ ]
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/viewer-webengine.json b/dotfiles/system/.config/calibre/viewer-webengine.json
new file mode 100644
index 0000000..b573d7f
--- /dev/null
+++ b/dotfiles/system/.config/calibre/viewer-webengine.json
@@ -0,0 +1,294 @@
+{
+ "geometry-of-main_window_geometry": {
+ "frame_geometry": {
+ "height": 981,
+ "width": 1504,
+ "x": 0,
+ "y": 22
+ },
+ "full_screened": false,
+ "geometry": {
+ "height": 981,
+ "width": 1504,
+ "x": 0,
+ "y": 22
+ },
+ "maximized": false,
+ "normal_geometry": {
+ "height": 981,
+ "width": 1504,
+ "x": 0,
+ "y": 22
+ },
+ "qt": {
+ "__class__": "bytearray",
+ "__value__": "AdnQywADAAAAAAAAAAAAFgAABd8AAAPqAAAAAAAAABYAAAXfAAAD6gAAAAAAAAAABeAAAAAAAAAAFgAABd8AAAPq"
+ },
+ "screen": {
+ "depth": 24,
+ "device_pixel_ratio": 1.5,
+ "geometry_in_logical_pixels": {
+ "height": 1003,
+ "width": 1504,
+ "x": 0,
+ "y": 0
+ },
+ "index_in_screens_list": 0,
+ "manufacturer": "BOE",
+ "model": "",
+ "name": "eDP-1",
+ "serial": "",
+ "size_in_logical_pixels": {
+ "height": 1003,
+ "width": 1504
+ },
+ "virtual_geometry": {
+ "height": 1003,
+ "width": 1504,
+ "x": 0,
+ "y": 0
+ }
+ }
+ },
+ "local_storage": {
+ "search-bar-history-search-for-sc": [
+ "black",
+ "dark",
+ "reverse",
+ "invert",
+ "quit"
+ ]
+ },
+ "main_window_geometry": {
+ "__class__": "bytearray",
+ "__value__": "AdnQywADAAAAAAAAAAAAEwAABd8AAAPqAAAAAAAAABMAAAXfAAAD6gAAAAAAAAAABeAAAAAAAAAAEwAABd8AAAPq"
+ },
+ "main_window_state": {
+ "__class__": "bytearray",
+ "__value__": "AAAA/wAAAAH9AAAAAgAAAAAAAAAAAAAAAPwCAAAAAvsAAAAQAHQAbwBjAC0AZABvAGMAawAAAAAA/////wAAAIYA////+wAAABYAcwBlAGEAcgBjAGgALQBkAG8AYwBrAAAAAAD/////AAAAlAD///8AAAABAAAAAAAAAAD8AgAAAAT7AAAAFgBsAG8AbwBrAHUAcAAtAGQAbwBjAGsAAAAAAP////8AAAB7AP////sAAAAcAGIAbwBvAGsAbQBhAHIAawBzAC0AZABvAGMAawAAAAAA/////wAAAOYA////+wAAABwAaQBuAHMAcABlAGMAdABvAHIALQBkAG8AYwBrAAAAAAD/////AAAAEgD////7AAAAHgBoAGkAZwBoAGwAaQBnAGgAdABzAC0AZABvAGMAawAAAAAA/////wAAAM8A////AAAF4AAAA9UAAAAEAAAABAAAAAgAAAAI/AAAAAEAAAAAAAAAAQAAAB4AYQBjAHQAaQBvAG4AcwBfAHQAbwBvAGwAYgBhAHICAAAAAP////8AAAAAAAAAAA=="
+ },
+ "old_prefs_migrated": true,
+ "session_data": {
+ "base_font_size": 44,
+ "controls_help_shown_count": 2,
+ "current_color_scheme": "black",
+ "keyboard_shortcuts": {
+ "quit": [
+ {
+ "altKey": false,
+ "ctrlKey": false,
+ "key": "q",
+ "metaKey": false,
+ "shiftKey": false
+ }
+ ]
+ },
+ "margin_bottom": 100,
+ "margin_left": 100,
+ "margin_right": 100,
+ "margin_top": 100,
+ "standalone_font_settings": {
+ "minimum_font_size": 12,
+ "mono_family": "Fira Code",
+ "sans_family": "Verdana",
+ "serif_family": "Palatino Linotype"
+ },
+ "standalone_misc_settings": {
+ "remember_last_read": true,
+ "remember_window_geometry": false,
+ "save_annotations_in_ebook": true,
+ "singleinstance": false
+ },
+ "standalone_recently_opened": [
+ {
+ "authors": [
+ "Habermas, Jürgen"
+ ],
+ "key": "/home/cjennings/sync/books/Habermas, Jurgen/The Philosophical Discourse of Modernity (40589)/The Philosophical Discourse of Modernity - Habermas, Jurgen.epub",
+ "pathtoebook": "/home/cjennings/sync/books/Habermas, Jurgen/The Philosophical Discourse of Modernity (40589)/The Philosophical Discourse of Modernity - Habermas, Jurgen.epub",
+ "timestamp": "2024-12-13T02:38:28.792Z",
+ "title": "The Philosophical Discourse of Modernity"
+ },
+ {
+ "authors": [
+ "Tamsyn Muir"
+ ],
+ "key": "/home/cjennings/sync/books/Tamsyn Muir/Gideon the Ninth (40289)/Gideon the Ninth - Tamsyn Muir.epub",
+ "pathtoebook": "/home/cjennings/sync/books/Tamsyn Muir/Gideon the Ninth (40289)/Gideon the Ninth - Tamsyn Muir.epub",
+ "timestamp": "2024-11-15T19:06:33.047Z",
+ "title": "Gideon the Ninth"
+ },
+ {
+ "key": "/home/cjennings/.local/opt/tor-browser/app/Browser/downloads/Love and Rockets #1 (1981) [Pyramid].cbz",
+ "pathtoebook": "/home/cjennings/.local/opt/tor-browser/app/Browser/downloads/Love and Rockets #1 (1981) [Pyramid].cbz",
+ "timestamp": "2022-08-23T16:40:22.898Z",
+ "title": "Love and Rockets #1 (1981) [Pyramid]"
+ },
+ {
+ "key": "/home/cjennings/.local/opt/tor-browser/app/Browser/downloads/Love & Rockets v1 #05 (March 1984) [Cclay].cbr",
+ "pathtoebook": "/home/cjennings/.local/opt/tor-browser/app/Browser/downloads/Love & Rockets v1 #05 (March 1984) [Cclay].cbr",
+ "timestamp": "2022-08-23T16:40:04.599Z",
+ "title": "Love & Rockets v1 #05 (March 1984) [Cclay]"
+ },
+ {
+ "key": "/tmp/mozilla_cjennings0/Love & Rockets v1 #05 (March 1984) [Cclay].cbr",
+ "pathtoebook": "/tmp/mozilla_cjennings0/Love & Rockets v1 #05 (March 1984) [Cclay].cbr",
+ "timestamp": "2022-08-23T16:31:27.722Z",
+ "title": "Love & Rockets v1 #05 (March 1984) [Cclay]"
+ },
+ {
+ "authors": [
+ "George Grätzer"
+ ],
+ "key": "/home/cjennings/Library/George Gratzer/More Math Into LaTeX (27737)/More Math Into LaTeX - George Gratzer.mobi",
+ "pathtoebook": "/home/cjennings/Library/George Gratzer/More Math Into LaTeX (27737)/More Math Into LaTeX - George Gratzer.mobi",
+ "timestamp": "2022-01-14T10:36:05.803Z",
+ "title": "More Math Into LaTeX"
+ },
+ {
+ "authors": [
+ "Simenon Georges"
+ ],
+ "key": "/home/cjennings/Library/Simenon Georges/050 Maigret's Little Joke (27730)/050 Maigret's Little Joke - Simenon Georges.mobi",
+ "pathtoebook": "/home/cjennings/Library/Simenon Georges/050 Maigret's Little Joke (27730)/050 Maigret's Little Joke - Simenon Georges.mobi",
+ "timestamp": "2022-01-10T12:32:52.530Z",
+ "title": "050 Maigret's Little Joke"
+ },
+ {
+ "authors": [
+ "Will Durant"
+ ],
+ "key": "/home/cjennings/Library/Will Durant/Story of Philosophy (3224)/Story of Philosophy - Will Durant.azw3",
+ "pathtoebook": "/home/cjennings/Library/Will Durant/Story of Philosophy (3224)/Story of Philosophy - Will Durant.azw3",
+ "timestamp": "2022-01-05T19:33:13.710Z",
+ "title": "Story of Philosophy"
+ },
+ {
+ "authors": [
+ "P G Wodehouse"
+ ],
+ "key": "/home/cjennings/Library/P. G. Wodehouse/Laughing Gas (24469)/Laughing Gas - P. G. Wodehouse.mobi",
+ "pathtoebook": "/home/cjennings/Library/P. G. Wodehouse/Laughing Gas (24469)/Laughing Gas - P. G. Wodehouse.mobi",
+ "timestamp": "2022-01-03T00:51:21.126Z",
+ "title": "Laughing Gas"
+ },
+ {
+ "authors": [
+ "Peter Seibel"
+ ],
+ "key": "/home/cjennings/Library/Peter Seibel/Coders at Work_ Reflections on the Craft of Programming (316)/Coders at Work_ Reflections on the Craft o - Peter Seibel.htmlz",
+ "pathtoebook": "/home/cjennings/Library/Peter Seibel/Coders at Work_ Reflections on the Craft of Programming (316)/Coders at Work_ Reflections on the Craft o - Peter Seibel.htmlz",
+ "timestamp": "2022-01-03T00:38:17.903Z",
+ "title": "Coders at Work"
+ },
+ {
+ "authors": [
+ "by Mike Gancarz"
+ ],
+ "key": "/home/cjennings/Downloads/torrents/files/Linux and the Unix Philosophy by Mike Gancarz (z-lib.org).epub",
+ "pathtoebook": "/home/cjennings/Downloads/torrents/files/Linux and the Unix Philosophy by Mike Gancarz (z-lib.org).epub",
+ "timestamp": "2022-01-02T23:44:59.829Z",
+ "title": "4362"
+ },
+ {
+ "authors": [
+ "Margaret Dauler Wilson"
+ ],
+ "key": "/home/cjennings/Library/Margaret Dauler Wilson/Descartes (86)/Descartes - Margaret Dauler Wilson.mobi",
+ "pathtoebook": "/home/cjennings/Library/Margaret Dauler Wilson/Descartes (86)/Descartes - Margaret Dauler Wilson.mobi",
+ "timestamp": "2022-01-02T14:20:51.792Z",
+ "title": "Descartes (Arguments of the Philosophers)"
+ },
+ {
+ "authors": [
+ "Alexander Tarlinder"
+ ],
+ "key": "/home/cjennings/Library/Alexander Tarlinder/Developer Testing_ Building Quality Into Software (26)/Developer Testing_ Building Quality Into S - Alexander Tarlinder.azw3",
+ "pathtoebook": "/home/cjennings/Library/Alexander Tarlinder/Developer Testing_ Building Quality Into Software (26)/Developer Testing_ Building Quality Into S - Alexander Tarlinder.azw3",
+ "timestamp": "2022-01-02T03:53:52.454Z",
+ "title": "Developer Testing: Building Quality into Software (Addison-Wesley Signature Series (Cohn))"
+ },
+ {
+ "authors": [
+ "Dieter Lohmar, Jagna Brudzinska"
+ ],
+ "key": "/home/cjennings/Library/Dieter Lohmar/Founding Psychoanalysis Phenomenologically_ Phenomenological Theory of Subjectivity and the Ps (17064)/Founding Psychoanalysis Phenomenologically - Dieter Lohmar.pdf",
+ "pathtoebook": "/home/cjennings/Library/Dieter Lohmar/Founding Psychoanalysis Phenomenologically_ Phenomenological Theory of Subjectivity and the Ps (17064)/Founding Psychoanalysis Phenomenologically - Dieter Lohmar.pdf",
+ "timestamp": "2022-01-01T22:55:44.420Z",
+ "title": "Founding Psychoanalysis Phenomenologically: Phenomenological Theory of Subjectivity and the Psychoanalytic Experience (Phaenomenologica, 199)"
+ },
+ {
+ "authors": [
+ "Kevin Passmore"
+ ],
+ "key": "/home/cjennings/Library/Kevin Passmore/Fascism_ A Very Short Introduction (5508)/Fascism_ A Very Short Introduction - Kevin Passmore.mobi",
+ "pathtoebook": "/home/cjennings/Library/Kevin Passmore/Fascism_ A Very Short Introduction (5508)/Fascism_ A Very Short Introduction - Kevin Passmore.mobi",
+ "timestamp": "2021-11-01T00:49:09.044Z",
+ "title": "Fascism: A Very Short Introduction (Very Short Introductions)"
+ },
+ {
+ "authors": [
+ "Lewis Carroll"
+ ],
+ "key": "/home/cjennings/Library/Lewis Carroll/Alice's Adventures in Wonderland_ &, Through the Looking-Glass (784)/Alice's Adventures in Wonderland_ &, Throu - Lewis Carroll.mobi",
+ "pathtoebook": "/home/cjennings/Library/Lewis Carroll/Alice's Adventures in Wonderland_ &, Through the Looking-Glass (784)/Alice's Adventures in Wonderland_ &, Throu - Lewis Carroll.mobi",
+ "timestamp": "2021-11-01T00:48:02.197Z",
+ "title": "Alice's Adventures in Wonderland and Through the Looking-Glass"
+ },
+ {
+ "authors": [
+ "Timothy Snyder"
+ ],
+ "key": "/home/cjennings/Library/Timothy Snyder/On Tyranny_ Twenty Lessons From the Twentieth Century (635)/On Tyranny_ Twenty Lessons From the Twenti - Timothy Snyder.azw3",
+ "pathtoebook": "/home/cjennings/Library/Timothy Snyder/On Tyranny_ Twenty Lessons From the Twentieth Century (635)/On Tyranny_ Twenty Lessons From the Twenti - Timothy Snyder.azw3",
+ "timestamp": "2021-10-31T22:46:48.986Z",
+ "title": "On Tyranny: Twenty Lessons from the Twentieth Century"
+ },
+ {
+ "authors": [
+ "Cristóbal Rovira Kaltwasser, Paul Taggart, Paulina Ochoa Espejo and Pierre Ostiguy"
+ ],
+ "key": "/home/cjennings/Library/Cristobal Rovira Kaltwasser/The Oxford Handbook of Populism (8081)/The Oxford Handbook of Populism - Cristobal Rovira Kaltwasser.azw3",
+ "pathtoebook": "/home/cjennings/Library/Cristobal Rovira Kaltwasser/The Oxford Handbook of Populism (8081)/The Oxford Handbook of Populism - Cristobal Rovira Kaltwasser.azw3",
+ "timestamp": "2021-10-31T22:45:42.015Z",
+ "title": "The Oxford Handbook of Populism (Oxford Handbooks)"
+ },
+ {
+ "authors": [
+ "Richard Sennett"
+ ],
+ "key": "/home/cjennings/Library/Richard Sennett/The Craftsman (348)/The Craftsman - Richard Sennett.htmlz",
+ "pathtoebook": "/home/cjennings/Library/Richard Sennett/The Craftsman (348)/The Craftsman - Richard Sennett.htmlz",
+ "timestamp": "2021-10-16T20:12:17.272Z",
+ "title": "The Craftsman"
+ },
+ {
+ "authors": [
+ "Christine Ciarmello"
+ ],
+ "key": "/home/cjennings/Documents/Ciarmello-Soul-Tree.pdf",
+ "pathtoebook": "/home/cjennings/Documents/Ciarmello-Soul-Tree.pdf",
+ "timestamp": "2021-08-21T19:32:09.736Z",
+ "title": "Ciarmello-Soul-Tree"
+ },
+ {
+ "authors": [
+ "Robert Mecklenburg"
+ ],
+ "key": "/home/cjennings/Library/Robert Mecklenburg/Managing Projects With GNU Make (12231)/Managing Projects With GNU Make - Robert Mecklenburg.pdf",
+ "pathtoebook": "/home/cjennings/Library/Robert Mecklenburg/Managing Projects With GNU Make (12231)/Managing Projects With GNU Make - Robert Mecklenburg.pdf",
+ "timestamp": "2021-08-21T19:30:54.331Z",
+ "title": "Managing Projects With GNU Make"
+ },
+ {
+ "authors": [
+ "John Graham-Cumming"
+ ],
+ "key": "/home/cjennings/Library/John Graham-Cumming/The GNU Make Book (9542)/The GNU Make Book - John Graham-Cumming.pdf",
+ "pathtoebook": "/home/cjennings/Library/John Graham-Cumming/The GNU Make Book (9542)/The GNU Make Book - John Graham-Cumming.pdf",
+ "timestamp": "2021-08-21T19:23:09.672Z",
+ "title": "The GNU Make Book"
+ }
+ ]
+ }
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/viewer.json b/dotfiles/system/.config/calibre/viewer.json
new file mode 100644
index 0000000..ecc631e
--- /dev/null
+++ b/dotfiles/system/.config/calibre/viewer.json
@@ -0,0 +1,13 @@
+{
+ "print-to-pdf-bottom-margin": 1.0,
+ "print-to-pdf-geometry": {
+ "__class__": "bytearray",
+ "__value__": "AdnQywADAAAAAAEjAAAA7AAAAyQAAAIpAAABJQAAAO4AAAMiAAACJwAAAAAAAAAABVYAAAElAAAA7gAAAyIAAAIn"
+ },
+ "print-to-pdf-left-margin": 1.0,
+ "print-to-pdf-page-numbers": false,
+ "print-to-pdf-page-size": "letter",
+ "print-to-pdf-right-margin": 1.0,
+ "print-to-pdf-show-file": true,
+ "print-to-pdf-top-margin": 1.0
+} \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/viewer/annots/19f02e8b622152fd5d7c642d30ecac05080ddf3e9e288a22c4f49866ba57c8b2.json b/dotfiles/system/.config/calibre/viewer/annots/19f02e8b622152fd5d7c642d30ecac05080ddf3e9e288a22c4f49866ba57c8b2.json
new file mode 100644
index 0000000..6ecdf09
--- /dev/null
+++ b/dotfiles/system/.config/calibre/viewer/annots/19f02e8b622152fd5d7c642d30ecac05080ddf3e9e288a22c4f49866ba57c8b2.json
@@ -0,0 +1 @@
+[{"pos": "epubcfi(/10/2/4/2[sbo-rt-content]/2/2[idm45611906833112]/16/1:266)", "pos_type": "epubcfi", "timestamp": "2022-07-09T18:01:11.603570+00:00", "type": "last-read"}] \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/viewer/annots/5856c3e5aa41dd1b47711fa2b70e5ba9a2f61369f97c7fcc415321753e7c8bea.json b/dotfiles/system/.config/calibre/viewer/annots/5856c3e5aa41dd1b47711fa2b70e5ba9a2f61369f97c7fcc415321753e7c8bea.json
new file mode 100644
index 0000000..a44655c
--- /dev/null
+++ b/dotfiles/system/.config/calibre/viewer/annots/5856c3e5aa41dd1b47711fa2b70e5ba9a2f61369f97c7fcc415321753e7c8bea.json
@@ -0,0 +1 @@
+[{"pos": "epubcfi(/2/2/4/2[page_1]@50:50)", "pos_type": "epubcfi", "timestamp": "2022-08-23T16:40:12.749665+00:00", "type": "last-read"}] \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/viewer/annots/5d4b018509f9383872d23f1c4a0652d20e908edc16409bc7697635a28f96478e.json b/dotfiles/system/.config/calibre/viewer/annots/5d4b018509f9383872d23f1c4a0652d20e908edc16409bc7697635a28f96478e.json
new file mode 100644
index 0000000..1dfa74a
--- /dev/null
+++ b/dotfiles/system/.config/calibre/viewer/annots/5d4b018509f9383872d23f1c4a0652d20e908edc16409bc7697635a28f96478e.json
@@ -0,0 +1 @@
+[{"pos": "epubcfi(/2/2/4/12[page_6]@50:50)", "pos_type": "epubcfi", "timestamp": "2022-08-23T16:41:02.476450+00:00", "type": "last-read"}] \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/viewer/annots/6fd06a181469267e9c09d240ef2d3cca061e54ce37143a9e142524f61028cdd9.json b/dotfiles/system/.config/calibre/viewer/annots/6fd06a181469267e9c09d240ef2d3cca061e54ce37143a9e142524f61028cdd9.json
new file mode 100644
index 0000000..2579467
--- /dev/null
+++ b/dotfiles/system/.config/calibre/viewer/annots/6fd06a181469267e9c09d240ef2d3cca061e54ce37143a9e142524f61028cdd9.json
@@ -0,0 +1 @@
+[{"pos": "epubcfi(/2/2/4/6[page_3]@50:50)", "pos_type": "epubcfi", "timestamp": "2022-08-23T16:31:51.861250+00:00", "type": "last-read"}] \ No newline at end of file
diff --git a/dotfiles/system/.config/calibre/viewer/annots/90922c33b4cfd6cdf2f2f462bc5f6e6b0f18bdb829384144fdd13cc3b487deb1.json b/dotfiles/system/.config/calibre/viewer/annots/90922c33b4cfd6cdf2f2f462bc5f6e6b0f18bdb829384144fdd13cc3b487deb1.json
new file mode 100644
index 0000000..0637a08
--- /dev/null
+++ b/dotfiles/system/.config/calibre/viewer/annots/90922c33b4cfd6cdf2f2f462bc5f6e6b0f18bdb829384144fdd13cc3b487deb1.json
@@ -0,0 +1 @@
+[] \ No newline at end of file
diff --git a/dotfiles/system/.config/fontconfig/fonts.conf b/dotfiles/system/.config/fontconfig/fonts.conf
new file mode 100644
index 0000000..8e4f0ec
--- /dev/null
+++ b/dotfiles/system/.config/fontconfig/fonts.conf
@@ -0,0 +1,52 @@
+<?xml version="1.0"?>
+<!DOCTYPE fontconfig SYSTEM "fonts.dtd">
+
+<fontconfig>
+
+ <!-- ANTIALIAS ALL FONTS -->
+ <match target="font">
+ <edit name="antialias" mode="assign"><bool>true</bool></edit>
+ <edit name="hinting" mode="assign"><bool>false</bool></edit>
+ <edit name="hintstyle" mode="assign"><int>0</int></edit>
+ <edit name="dpi" mode="assign"><double>75</double></edit>
+ <edit name="rgba" mode="assign"><const>none</const></edit>
+ </match>
+
+ <!-- REPLACE THESE WITH A BETTER LOOKING FONT (MONO) -->
+ <match target="pattern">
+ <test name="family" qual="any"><string>Courier [Adobe]</string></test>
+ <edit name="family" mode="assign"><string>Courier 10 Pitch</string></edit>
+ </match>
+
+ <match target="pattern">
+ <test name="family" qual="any"><string>Fixed</string></test>
+ <edit name="family" mode="assign"><string>Courier 10 Pitch</string></edit>
+ </match>
+
+ <match target="pattern">
+ <test name="family" qual="any"><string>courier</string></test>
+ <edit name="family" mode="assign"><string>Courier 10 Pitch</string></edit>
+ </match>
+
+ <!-- REPLACE THESE WITH A BETTER LOOKING FONT (SANS) -->
+ <match target="pattern">
+ <test name="family" qual="any"><string>helvetica</string></test>
+ <edit name="family" mode="assign"><string>arial</string></edit>
+ </match>
+
+ <match target="pattern">
+ <test name="family" qual="any"><string>times</string></test>
+ <edit name="family" mode="assign"><string>garamond</string></edit>
+ </match>
+
+ <match target="pattern">
+ <test name="family" qual="any"><string>lucida</string></test>
+ <edit name="family" mode="assign"><string>trebuchet ms</string></edit>
+ </match>
+
+ <!-- DISABLE EMBEDDED BITMAPS -->
+ <match target="font" >
+ <edit name="embeddedbitmap" mode="assign"><bool>false</bool></edit>
+ </match>
+
+</fontconfig>
diff --git a/dotfiles/system/.config/mpd/mpd.conf b/dotfiles/system/.config/mpd/mpd.conf
new file mode 100644
index 0000000..25f204e
--- /dev/null
+++ b/dotfiles/system/.config/mpd/mpd.conf
@@ -0,0 +1,433 @@
+# An example configuration file for MPD.
+# Read the user manual for documentation: http://www.musicpd.org/doc/user/
+# or /usr/share/doc/mpd/user-manual.html
+
+
+# Files and directories #######################################################
+#
+# This setting controls the top directory which MPD will search to discover the
+# available audio files and add them to the daemon's online database. This
+# setting defaults to the XDG directory, otherwise the music directory will be
+# be disabled and audio files will only be accepted over ipc socket (using
+# file:// protocol) or streaming files over an accepted protocol.
+#
+music_directory "/home/cjennings/music"
+#
+# This setting sets the MPD internal playlist directory. The purpose of this
+# directory is storage for playlists created by MPD. The server will use
+# playlist files not created by the server but only if they are in the MPD
+# format. This setting defaults to playlist saving being disabled.
+#
+playlist_directory "/home/cjennings/music"
+#
+# This setting sets the location of the MPD database. This file is used to
+# load the database at server start up and store the database while the
+# server is not up. This setting defaults to disabled which will allow
+# MPD to accept files over ipc socket (using file:// protocol) or streaming
+# files over an accepted protocol.
+#
+db_file "/home/cjennings/.config/mpd/database"
+#
+# These settings are the locations for the daemon log files for the daemon.
+# These logs are great for troubleshooting, depending on your log_level
+# settings.
+#
+# The special value "syslog" makes MPD use the local syslog daemon. This
+# setting defaults to logging to syslog, otherwise logging is disabled.
+#
+log_file "/home/cjennings/.config/mpd/log"
+#
+# This setting sets the location of the file which stores the process ID
+# for use of mpd --kill and some init scripts. This setting is disabled by
+# default and the pid file will not be stored.
+#
+pid_file "/home/cjennings/.config/mpd/pid"
+#
+# This setting sets the location of the file which contains information about
+# most variables to get MPD back into the same general shape it was in before
+# it was brought down. This setting is disabled by default and the server
+# state will be reset on server start up.
+#
+state_file "/home/cjennings/.config/mpd/state"
+#
+# The location of the sticker database. This is a database which
+# manages dynamic information attached to songs.
+#
+sticker_file "/home/cjennings/.config/mpd/sticker.sql"
+#
+###############################################################################
+
+
+# General music daemon options ################################################
+#
+# This setting specifies the user that MPD will run as. MPD should never run as
+# root and you may use this setting to make MPD change its user ID after
+# initialization. This setting is disabled by default and MPD is run as the
+# current user.
+#
+user "cjennings"
+#
+# This setting specifies the group that MPD will run as. If not specified
+# primary group of user specified with "user" setting will be used (if set).
+# This is useful if MPD needs to be a member of group such as "audio" to
+# have permission to use sound card.
+#
+#group "nogroup"
+#
+# This setting sets the address for the daemon to listen on. Careful attention
+# should be paid if this is assigned to anything other then the default, any.
+# This setting can deny access to control of the daemon. Choose any if you want
+# to have mpd listen on every address. Not effective if systemd socket
+# activation is in use.
+#
+# For network
+# bind_to_address "0.0.0.0"
+#
+# And for Unix Socket
+bind_to_address "/home/cjennings/.config/mpd/socket"
+# bind_to_address "0.0.0.0"
+#
+# This setting is the TCP port that is desired for the daemon to get assigned
+# to.
+#
+#port "6600"
+#
+# This setting controls the type of information which is logged. Available
+# setting arguments are "default", "secure" or "verbose". The "verbose" setting
+# argument is recommended for troubleshooting, though can quickly stretch
+# available resources on limited hardware storage.
+#
+#log_level "default"
+#
+# If you have a problem with your MP3s ending abruptly it is recommended that
+# you set this argument to "no" to attempt to fix the problem. If this solves
+# the problem, it is highly recommended to fix the MP3 files with vbrfix
+# (available as vbrfix in the debian archive), at which
+# point gapless MP3 playback can be enabled.
+#
+#gapless_mp3_playback "yes"
+#
+# Setting "restore_paused" to "yes" puts MPD into pause mode instead
+# of starting playback after startup.
+#
+restore_paused "yes"
+#
+# This setting enables MPD to create playlists in a format usable by other
+# music players.
+#
+save_absolute_paths_in_playlists "yes"
+#
+# This setting defines a list of tag types that will be extracted during the
+# audio file discovery process. The complete list of possible values can be
+# found in the mpd.conf man page.
+#metadata_to_use "artist,album,title,track,name,genre,date,composer,performer,disc"
+#
+# This setting enables automatic update of MPD's database when files in
+# music_directory are changed.
+#
+auto_update "yes"
+#
+# Limit the depth of the directories being watched, 0 means only watch
+# the music directory itself. There is no limit by default.
+#
+#auto_update_depth "3"
+#
+###############################################################################
+
+
+# Symbolic link behavior ######################################################
+#
+# If this setting is set to "yes", MPD will discover audio files by following
+# symbolic links outside of the configured music_directory.
+#
+#follow_outside_symlinks "yes"
+#
+# If this setting is set to "yes", MPD will discover audio files by following
+# symbolic links inside of the configured music_directory.
+#
+#follow_inside_symlinks "yes"
+#
+###############################################################################
+
+
+# Zeroconf / Avahi Service Discovery ##########################################
+#
+# If this setting is set to "yes", service information will be published with
+# Zeroconf / Avahi.
+#
+# zeroconf_enabled "yes"
+#
+# The argument to this setting will be the Zeroconf / Avahi unique name for
+# this MPD server on the network.
+#
+# zeroconf_name "Music Player Daemon"
+#
+###############################################################################
+
+
+# Permissions #################################################################
+#
+# If this setting is set, MPD will require password authorization. The password
+# can setting can be specified multiple times for different password profiles.
+#
+#password "password@read,add,control,admin"
+#
+# This setting specifies the permissions a user has who has not yet logged in.
+#
+#default_permissions "read,add,control,admin"
+#
+###############################################################################
+
+
+# Database #######################################################################
+#
+
+#database {
+# plugin "proxy"
+# host "other.mpd.host"
+# port "6600"
+#}
+
+# Input #######################################################################
+#
+
+input {
+ plugin "curl"
+# proxy "proxy.isp.com:8080"
+# proxy_user "user"
+# proxy_password "password"
+}
+
+#
+###############################################################################
+
+# Audio Output ################################################################
+#
+# MPD supports various audio output types, as well as playing through multiple
+# audio outputs at the same time, through multiple audio_output settings
+# blocks. Setting this block is optional, though the server will only attempt
+# autodetection for one sound card.
+#
+# An example of an ALSA output:
+#
+#audio_output {
+# type "alsa"
+# name "My ALSA Device"
+# device "hw:0,0" # optional
+# mixer_type "hardware" # optional
+# mixer_device "default" # optional
+# mixer_control "PCM" # optional
+# mixer_index "0" # optional
+#}
+#
+# An example of an OSS output:
+#
+#audio_output {
+# type "oss"
+# name "My OSS Device"
+# device "/dev/dsp" # optional
+# mixer_type "hardware" # optional
+# mixer_device "/dev/mixer" # optional
+# mixer_control "PCM" # optional
+#}
+#
+# An example of a shout output (for streaming to Icecast):
+#
+#audio_output {
+# type "shout"
+# encoding "ogg" # optional
+# name "My Shout Stream"
+# host "localhost"
+# port "8000"
+# mount "/mpd.ogg"
+# password "hackme"
+# quality "5.0"
+# bitrate "128"
+# format "44100:16:1"
+# protocol "icecast2" # optional
+# user "source" # optional
+# description "My Stream Description" # optional
+# url "http://example.com" # optional
+# genre "jazz" # optional
+# public "no" # optional
+# timeout "2" # optional
+# mixer_type "software" # optional
+#}
+#
+# An example of a recorder output:
+#
+#audio_output {
+# type "recorder"
+# name "My recorder"
+# encoder "vorbis" # optional, vorbis or lame
+# path "/var/lib/mpd/recorder/mpd.ogg"
+## quality "5.0" # do not define if bitrate is defined
+# bitrate "128" # do not define if quality is defined
+# format "44100:16:1"
+#}
+#
+# An example of a httpd output (built-in HTTP streaming server):
+#
+#audio_output {
+# type "httpd"
+# name "My HTTP Stream"
+# encoder "vorbis" # optional, vorbis or lame
+# port "8000"
+# bind_to_address "0.0.0.0" # optional, IPv4 or IPv6
+# quality "5.0" # do not define if bitrate is defined
+# bitrate "128" # do not define if quality is defined
+# format "44100:16:1"
+# max_clients "0" # optional 0=no limit
+#}
+#
+## cjennings 2021-06-26
+
+audio_output {
+ type "pulse"
+ name "pulse audio"
+}
+
+audio_output {
+ type "fifo"
+ name "my_fifo"
+ path "/tmp/mpd.fifo"
+ format "44100:16:2"
+}
+# An example of a pulseaudio output (streaming to a remote pulseaudio server)
+# Please see README.Debian if you want mpd to play through the pulseaudio
+# daemon started as part of your graphical desktop session!
+#
+#audio_output {
+# type "pulse"
+# name "My Pulse Output"
+# server "remote_server" # optional
+# sink "remote_server_sink" # optional
+#}
+#
+# An example of a winmm output (Windows multimedia API).
+#
+#audio_output {
+# type "winmm"
+# name "My WinMM output"
+# device "Digital Audio (S/PDIF) (High Definition Audio Device)" # optional
+# or
+# device "0" # optional
+# mixer_type "hardware" # optional
+#}
+#
+# An example of an openal output.
+#
+#audio_output {
+# type "openal"
+# name "My OpenAL output"
+# device "Digital Audio (S/PDIF) (High Definition Audio Device)" # optional
+#}
+#
+## Example "pipe" output:
+#
+#audio_output {
+# type "pipe"
+# name "my pipe"
+# command "aplay -f cd 2>/dev/null"
+## Or if you're want to use AudioCompress
+# command "AudioCompress -m | aplay -f cd 2>/dev/null"
+## Or to send raw PCM stream through PCM:
+# command "nc example.org 8765"
+# format "44100:16:2"
+#}
+#
+## An example of a null output (for no audio output):
+#
+#audio_output {
+# type "null"
+# name "My Null Output"
+# mixer_type "none" # optional
+#}
+#
+# If MPD has been compiled with libsamplerate support, this setting specifies
+# the sample rate converter to use. Possible values can be found in the
+# mpd.conf man page or the libsamplerate documentation. By default, this is
+# setting is disabled.
+#
+#samplerate_converter "Fastest Sinc Interpolator"
+#
+###############################################################################
+
+
+# Normalization automatic volume adjustments ##################################
+#
+# This setting specifies the type of ReplayGain to use. This setting can have
+# the argument "off", "album", "track" or "auto". "auto" is a special mode that
+# chooses between "track" and "album" depending on the current state of
+# random playback. If random playback is enabled then "track" mode is used.
+# See <http://www.replaygain.org> for more details about ReplayGain.
+# This setting is off by default.
+#
+replaygain "album"
+#
+# This setting sets the pre-amp used for files that have ReplayGain tags. By
+# default this setting is disabled.
+#
+#replaygain_preamp "0"
+#
+# This setting sets the pre-amp used for files that do NOT have ReplayGain tags.
+# By default this setting is disabled.
+#
+#replaygain_missing_preamp "0"
+#
+# This setting enables or disables ReplayGain limiting.
+# MPD calculates actual amplification based on the ReplayGain tags
+# and replaygain_preamp / replaygain_missing_preamp setting.
+# If replaygain_limit is enabled MPD will never amplify audio signal
+# above its original level. If replaygain_limit is disabled such amplification
+# might occur. By default this setting is enabled.
+#
+#replaygain_limit "yes"
+#
+# This setting enables on-the-fly normalization volume adjustment. This will
+# result in the volume of all playing audio to be adjusted so the output has
+# equal "loudness". This setting is disabled by default.
+#
+volume_normalization "yes"
+#
+###############################################################################
+
+
+# Character Encoding ##########################################################
+#
+# If file or directory names do not display correctly for your locale then you
+# may need to modify this setting.
+#
+filesystem_charset "UTF-8"
+#
+# This setting controls the encoding that ID3v1 tags should be converted from.
+#
+# id3v1_encoding "UTF-8" (this is now deprecated)
+#
+###############################################################################
+
+
+# SIDPlay decoder #############################################################
+#
+# songlength_database:
+# Location of your songlengths file, as distributed with the HVSC.
+# The sidplay plugin checks this for matching MD5 fingerprints.
+# See http://www.c64.org/HVSC/DOCUMENTS/Songlengths.faq
+#
+# default_songlength:
+# This is the default playing time in seconds for songs not in the
+# songlength database, or in case you're not using a database.
+# A value of 0 means play indefinitely.
+#
+# filter:
+# Turns the SID filter emulation on or off.
+#
+#decoder {
+# plugin "sidplay"
+# songlength_database "/media/C64Music/DOCUMENTS/Songlengths.txt"
+# default_songlength "120"
+# filter "true"
+#}
+#
+###############################################################################
+
diff --git a/dotfiles/system/.config/mpd/musicpd.conf b/dotfiles/system/.config/mpd/musicpd.conf
new file mode 100644
index 0000000..9f34c44
--- /dev/null
+++ b/dotfiles/system/.config/mpd/musicpd.conf
@@ -0,0 +1,436 @@
+# An example configuration file for MPD.
+# Read the user manual for documentation: http://www.musicpd.org/doc/user/
+# or /usr/share/doc/mpd/user-manual.html
+
+
+# Files and directories #######################################################
+#
+# This setting controls the top directory which MPD will search to discover the
+# available audio files and add them to the daemon's online database. This
+# setting defaults to the XDG directory, otherwise the music directory will be
+# be disabled and audio files will only be accepted over ipc socket (using
+# file:// protocol) or streaming files over an accepted protocol.
+#
+music_directory "~cjennings/music"
+#
+# This setting sets the MPD internal playlist directory. The purpose of this
+# directory is storage for playlists created by MPD. The server will use
+# playlist files not created by the server but only if they are in the MPD
+# format. This setting defaults to playlist saving being disabled.
+#
+playlist_directory "~cjennings/music"
+#
+# This setting sets the location of the MPD database. This file is used to
+# load the database at server start up and store the database while the
+# server is not up. This setting defaults to disabled which will allow
+# MPD to accept files over ipc socket (using file:// protocol) or streaming
+# files over an accepted protocol.
+#
+db_file "~cjennings/.config/mpd/database"
+#
+# These settings are the locations for the daemon log files for the daemon.
+# These logs are great for troubleshooting, depending on your log_level
+# settings.
+#
+# The special value "syslog" makes MPD use the local syslog daemon. This
+# setting defaults to logging to syslog, otherwise logging is disabled.
+#
+log_file "~cjennings/.config/mpd/mpd.log"
+#
+# This setting sets the location of the file which stores the process ID
+# for use of mpd --kill and some init scripts. This setting is disabled by
+# default and the pid file will not be stored.
+#
+pid_file "~cjennings/.config/mpd/pid"
+#
+# This setting sets the location of the file which contains information about
+# most variables to get MPD back into the same general shape it was in before
+# it was brought down. This setting is disabled by default and the server
+# state will be reset on server start up.
+#
+state_file "~cjennings/.config/mpd/state"
+#
+# The location of the sticker database. This is a database which
+# manages dynamic information attached to songs.
+#
+sticker_file "~cjennings/.config/mpd/sticker.sql"
+#
+###############################################################################
+
+
+# General music daemon options ################################################
+#
+# This setting specifies the user that MPD will run as. MPD should never run as
+# root and you may use this setting to make MPD change its user ID after
+# initialization. This setting is disabled by default and MPD is run as the
+# current user.
+#
+user "cjennings"
+#
+# This setting specifies the group that MPD will run as. If not specified
+# primary group of user specified with "user" setting will be used (if set).
+# This is useful if MPD needs to be a member of group such as "audio" to
+# have permission to use sound card.
+#
+#group "nogroup"
+#
+# This setting sets the address for the daemon to listen on. Careful attention
+# should be paid if this is assigned to anything other then the default, any.
+# This setting can deny access to control of the daemon. Choose any if you want
+# to have mpd listen on every address. Not effective if systemd socket
+# activation is in use.
+#
+# For network
+bind_to_address "0.0.0.0"
+#
+# And for Unix Socket
+#bind_to_address "/run/mpd/socket"
+#
+# This setting is the TCP port that is desired for the daemon to get assigned
+# to.
+#
+#port "6600"
+#
+# This setting controls the type of information which is logged. Available
+# setting arguments are "default", "secure" or "verbose". The "verbose" setting
+# argument is recommended for troubleshooting, though can quickly stretch
+# available resources on limited hardware storage.
+#
+#log_level "default"
+#
+# If you have a problem with your MP3s ending abruptly it is recommended that
+# you set this argument to "no" to attempt to fix the problem. If this solves
+# the problem, it is highly recommended to fix the MP3 files with vbrfix
+# (available as vbrfix in the debian archive), at which
+# point gapless MP3 playback can be enabled.
+#
+#gapless_mp3_playback "yes"
+#
+# Setting "restore_paused" to "yes" puts MPD into pause mode instead
+# of starting playback after startup.
+#
+restore_paused "yes"
+#
+# This setting enables MPD to create playlists in a format usable by other
+# music players.
+#
+save_absolute_paths_in_playlists "yes"
+#
+# This setting defines a list of tag types that will be extracted during the
+# audio file discovery process. The complete list of possible values can be
+# found in the mpd.conf man page.
+#metadata_to_use "artist,album,title,track,name,genre,date,composer,performer,disc"
+#
+# This setting enables automatic update of MPD's database when files in
+# music_directory are changed.
+#
+auto_update "yes"
+#
+# Limit the depth of the directories being watched, 0 means only watch
+# the music directory itself. There is no limit by default.
+#
+#auto_update_depth "3"
+#
+###############################################################################
+
+
+# Symbolic link behavior ######################################################
+#
+# If this setting is set to "yes", MPD will discover audio files by following
+# symbolic links outside of the configured music_directory.
+#
+#follow_outside_symlinks "yes"
+#
+# If this setting is set to "yes", MPD will discover audio files by following
+# symbolic links inside of the configured music_directory.
+#
+#follow_inside_symlinks "yes"
+#
+###############################################################################
+
+
+# Zeroconf / Avahi Service Discovery ##########################################
+#
+# If this setting is set to "yes", service information will be published with
+# Zeroconf / Avahi.
+#
+# zeroconf_enabled "yes"
+#
+# The argument to this setting will be the Zeroconf / Avahi unique name for
+# this MPD server on the network.
+#
+# zeroconf_name "Music Player Daemon"
+#
+###############################################################################
+
+
+# Permissions #################################################################
+#
+# If this setting is set, MPD will require password authorization. The password
+# can setting can be specified multiple times for different password profiles.
+#
+#password "password@read,add,control,admin"
+#
+# This setting specifies the permissions a user has who has not yet logged in.
+#
+#default_permissions "read,add,control,admin"
+#
+###############################################################################
+
+
+# Database #######################################################################
+#
+
+#database {
+# plugin "proxy"
+# host "other.mpd.host"
+# port "6600"
+#}
+
+# Input #######################################################################
+#
+
+input {
+ plugin "curl"
+# proxy "proxy.isp.com:8080"
+# proxy_user "user"
+# proxy_password "password"
+}
+
+#
+###############################################################################
+
+# Audio Output ################################################################
+#
+# MPD supports various audio output types, as well as playing through multiple
+# audio outputs at the same time, through multiple audio_output settings
+# blocks. Setting this block is optional, though the server will only attempt
+# autodetection for one sound card.
+#
+# An example of an ALSA output:
+#
+#audio_output {
+# type "alsa"
+# name "My ALSA Device"
+# device "hw:0,0" # optional
+# mixer_type "hardware" # optional
+# mixer_device "default" # optional
+# mixer_control "PCM" # optional
+# mixer_index "0" # optional
+#}
+#
+# An example of an OSS output:
+#
+#audio_output {
+# type "oss"
+# name "My OSS Device"
+# device "/dev/dsp" # optional
+# mixer_type "hardware" # optional
+# mixer_device "/dev/mixer" # optional
+# mixer_control "PCM" # optional
+#}
+#
+# An example of a shout output (for streaming to Icecast):
+#
+#audio_output {
+# type "shout"
+# encoding "ogg" # optional
+# name "My Shout Stream"
+# host "localhost"
+# port "8000"
+# mount "/mpd.ogg"
+# password "hackme"
+# quality "5.0"
+# bitrate "128"
+# format "44100:16:1"
+# protocol "icecast2" # optional
+# user "source" # optional
+# description "My Stream Description" # optional
+# url "http://example.com" # optional
+# genre "jazz" # optional
+# public "no" # optional
+# timeout "2" # optional
+# mixer_type "software" # optional
+#}
+#
+# An example of a recorder output:
+#
+#audio_output {
+# type "recorder"
+# name "My recorder"
+# encoder "vorbis" # optional, vorbis or lame
+# path "/var/lib/mpd/recorder/mpd.ogg"
+## quality "5.0" # do not define if bitrate is defined
+# bitrate "128" # do not define if quality is defined
+# format "44100:16:1"
+#}
+#
+# An example of a httpd output (built-in HTTP streaming server):
+#
+#audio_output {
+# type "httpd"
+# name "My HTTP Stream"
+# encoder "vorbis" # optional, vorbis or lame
+# port "8000"
+# bind_to_address "0.0.0.0" # optional, IPv4 or IPv6
+# quality "5.0" # do not define if bitrate is defined
+# bitrate "128" # do not define if quality is defined
+# format "44100:16:1"
+# max_clients "0" # optional 0=no limit
+#}
+#
+## cjennings 2021-06-26
+
+audio_output {
+ type "oss"
+ name "OSS Audio"
+ device "/dev/dsp" # optional
+ mixer_type "hardware" # optional
+ mixer_device "/dev/mixer" # optional
+ mixer_control "vol" # optional
+}
+
+audio_output {
+ type "fifo"
+ name "my_fifo"
+ path "/tmp/mpd.fifo"
+ format "44100:16:2"
+}
+# An example of a pulseaudio output (streaming to a remote pulseaudio server)
+# Please see README.Debian if you want mpd to play through the pulseaudio
+# daemon started as part of your graphical desktop session!
+#
+#audio_output {
+# type "pulse"
+# name "My Pulse Output"
+# server "remote_server" # optional
+# sink "remote_server_sink" # optional
+#}
+#
+# An example of a winmm output (Windows multimedia API).
+#
+#audio_output {
+# type "winmm"
+# name "My WinMM output"
+# device "Digital Audio (S/PDIF) (High Definition Audio Device)" # optional
+# or
+# device "0" # optional
+# mixer_type "hardware" # optional
+#}
+#
+# An example of an openal output.
+#
+#audio_output {
+# type "openal"
+# name "My OpenAL output"
+# device "Digital Audio (S/PDIF) (High Definition Audio Device)" # optional
+#}
+#
+## Example "pipe" output:
+#
+#audio_output {
+# type "pipe"
+# name "my pipe"
+# command "aplay -f cd 2>/dev/null"
+## Or if you're want to use AudioCompress
+# command "AudioCompress -m | aplay -f cd 2>/dev/null"
+## Or to send raw PCM stream through PCM:
+# command "nc example.org 8765"
+# format "44100:16:2"
+#}
+#
+## An example of a null output (for no audio output):
+#
+#audio_output {
+# type "null"
+# name "My Null Output"
+# mixer_type "none" # optional
+#}
+#
+# If MPD has been compiled with libsamplerate support, this setting specifies
+# the sample rate converter to use. Possible values can be found in the
+# mpd.conf man page or the libsamplerate documentation. By default, this is
+# setting is disabled.
+#
+#samplerate_converter "Fastest Sinc Interpolator"
+#
+###############################################################################
+
+
+# Normalization automatic volume adjustments ##################################
+#
+# This setting specifies the type of ReplayGain to use. This setting can have
+# the argument "off", "album", "track" or "auto". "auto" is a special mode that
+# chooses between "track" and "album" depending on the current state of
+# random playback. If random playback is enabled then "track" mode is used.
+# See <http://www.replaygain.org> for more details about ReplayGain.
+# This setting is off by default.
+#
+replaygain "album"
+#
+# This setting sets the pre-amp used for files that have ReplayGain tags. By
+# default this setting is disabled.
+#
+#replaygain_preamp "0"
+#
+# This setting sets the pre-amp used for files that do NOT have ReplayGain tags.
+# By default this setting is disabled.
+#
+#replaygain_missing_preamp "0"
+#
+# This setting enables or disables ReplayGain limiting.
+# MPD calculates actual amplification based on the ReplayGain tags
+# and replaygain_preamp / replaygain_missing_preamp setting.
+# If replaygain_limit is enabled MPD will never amplify audio signal
+# above its original level. If replaygain_limit is disabled such amplification
+# might occur. By default this setting is enabled.
+#
+#replaygain_limit "yes"
+#
+# This setting enables on-the-fly normalization volume adjustment. This will
+# result in the volume of all playing audio to be adjusted so the output has
+# equal "loudness". This setting is disabled by default.
+#
+volume_normalization "yes"
+#
+###############################################################################
+
+
+# Character Encoding ##########################################################
+#
+# If file or directory names do not display correctly for your locale then you
+# may need to modify this setting.
+#
+filesystem_charset "UTF-8"
+#
+# This setting controls the encoding that ID3v1 tags should be converted from.
+#
+# id3v1_encoding "UTF-8"
+#
+###############################################################################
+
+
+# SIDPlay decoder #############################################################
+#
+# songlength_database:
+# Location of your songlengths file, as distributed with the HVSC.
+# The sidplay plugin checks this for matching MD5 fingerprints.
+# See http://www.c64.org/HVSC/DOCUMENTS/Songlengths.faq
+#
+# default_songlength:
+# This is the default playing time in seconds for songs not in the
+# songlength database, or in case you're not using a database.
+# A value of 0 means play indefinitely.
+#
+# filter:
+# Turns the SID filter emulation on or off.
+#
+#decoder {
+# plugin "sidplay"
+# songlength_database "/media/C64Music/DOCUMENTS/Songlengths.txt"
+# default_songlength "120"
+# filter "true"
+#}
+#
+###############################################################################
+
diff --git a/dotfiles/system/.config/ncmpcpp/bindings b/dotfiles/system/.config/ncmpcpp/bindings
new file mode 100644
index 0000000..a7ca6c0
--- /dev/null
+++ b/dotfiles/system/.config/ncmpcpp/bindings
@@ -0,0 +1,551 @@
+##############################################################
+## This is the example bindings file. Copy it to ##
+## $XDG_CONFIG_HOME/ncmpcpp/bindings or ~/.ncmpcpp/bindings ##
+## and set up your preferences. ##
+##############################################################
+##
+##### General rules #####
+##
+## 1) Because each action has runtime checks whether it's
+## ok to run it, a few actions can be bound to one key.
+## Actions will be bound in order given in configuration
+## file. When a key is pressed, first action in order
+## will test itself whether it's possible to run it. If
+## test succeeds, action is executed and other actions
+## bound to this key are ignored. If it doesn't, next
+## action in order tests itself etc.
+##
+## 2) It's possible to bind more that one action at once
+## to a key. It can be done using the following syntax:
+##
+## def_key "key"
+## action1
+## action2
+## ...
+##
+## This creates a chain of actions. When such chain is
+## executed, each action in chain is run until the end of
+## chain is reached or one of its actions fails to execute
+## due to its requirements not being met. If multiple actions
+## and/or chains are bound to the same key, they will be
+## consecutively run until one of them gets fully executed.
+##
+## 3) When ncmpcpp starts, bindings configuration file is
+## parsed and then ncmpcpp provides "missing pieces"
+## of default keybindings. If you want to disable some
+## bindings, there is a special action called 'dummy'
+## for that purpose. Eg. if you want to disable ability
+## to crop playlists, you need to put the following
+## into configuration file:
+##
+## def_key "C"
+## dummy
+##
+## After that ncmpcpp will not bind any default action
+## to this key.
+##
+## 4) To let you write simple macros, the following special
+## actions are provided:
+##
+## - push_character "character" - pushes given special
+## character into input queue, so it will be immediately
+## picked by ncmpcpp upon next call to readKey function.
+## Accepted values: mouse, up, down, page_up, page_down,
+## home, end, space, enter, insert, delete, left, right,
+## tab, ctrl-a, ctrl-b, ..., ctrl-z, ctrl-[, ctrl-\\,
+## ctrl-], ctrl-^, ctrl-_, f1, f2, ..., f12, backspace.
+## In addition, most of these names can be prefixed with
+## alt-/ctrl-/shift- to be recognized with the appropriate
+## modifier key(s).
+##
+## - push_characters "string" - pushes given string into
+## input queue.
+##
+## - require_runnable "action" - checks whether given action
+## is runnable and fails if it isn't. This is especially
+## useful when mixed with previous two functions. Consider
+## the following macro definition:
+##
+## def_key "key"
+## push_characters "custom_filter"
+## apply_filter
+##
+## If apply_filter can't be currently run, we end up with
+## sequence of characters in input queue which will be
+## treated just as we typed them. This may lead to unexpected
+## results (in this case 'c' will most likely clear current
+## playlist, 'u' will trigger database update, 's' will stop
+## playback etc.). To prevent such thing from happening, we
+## need to change above definition to this one:
+##
+## def_key "key"
+## require_runnable "apply_filter"
+## push_characters "custom_filter"
+## apply_filter
+##
+## Here, first we test whether apply_filter can be actually run
+## before we stuff characters into input queue, so if condition
+## is not met, whole chain is aborted and we're fine.
+##
+## - require_screen "screen" - checks whether given screen is
+## currently active. accepted values: browser, clock, help,
+## media_library, outputs, playlist, playlist_editor,
+## search_engine, tag_editor, visualizer, last_fm, lyrics,
+## selected_items_adder, server_info, song_info,
+## sort_playlist_dialog, tiny_tag_editor.
+##
+## - run_external_command "command" - runs given command using
+## system() function.
+##
+## - run_external_console_command "command" - runs given console
+## command using system() function.
+##
+##
+## 5) In addition to binding to a key, you can also bind actions
+## or chains of actions to a command. If it comes to commands,
+## syntax is very similar to defining keys. Here goes example
+## definition of a command:
+##
+## def_command "quit" [deferred]
+## stop
+## quit
+##
+## If you execute the above command (which can be done by
+## invoking action execute_command, typing 'quit' and pressing
+## enter), ncmpcpp will stop the player and then quit. Note the
+## presence of word 'deferred' enclosed in square brackets. It
+## tells ncmpcpp to wait for confirmation (ie. pressing enter)
+## after you typed quit. Instead of 'deferred', 'immediate'
+## could be used. Then ncmpcpp will not wait for confirmation
+## (enter) and will execute the command the moment it sees it.
+##
+## Note: while command chains are executed, internal environment
+## update (which includes current window refresh and mpd status
+## update) is not performed for performance reasons. However, it
+## may be desirable to do so in some situration. Therefore it's
+## possible to invoke by hand by performing 'update enviroment'
+## action.
+##
+## Note: There is a difference between:
+##
+## def_key "key"
+## action1
+##
+## def_key "key"
+## action2
+##
+## and
+##
+## def_key "key"
+## action1
+## action2
+##
+## First one binds two single actions to the same key whilst
+## second one defines a chain of actions. The behavior of
+## these two is different and is described in (1) and (2).
+##
+## Note: Function def_key accepts non-ascii characters.
+##
+##### List of unbound actions #####
+##
+## The following actions are not bound to any key/command:
+##
+## - set_volume
+## - load
+##
+#
+#def_key "mouse"
+# mouse_event
+#
+#def_key "up"
+# scroll_up
+#
+#def_key "shift-up"
+# select_item
+# scroll_up
+#
+#def_key "down"
+# scroll_down
+#
+#def_key "shift-down"
+# select_item
+# scroll_down
+#
+#def_key "["
+# scroll_up_album
+#
+#def_key "]"
+# scroll_down_album
+#
+#def_key "{"
+# scroll_up_artist
+#
+#def_key "}"
+# scroll_down_artist
+#
+#def_key "page_up"
+# page_up
+#
+#def_key "page_down"
+# page_down
+#
+#def_key "home"
+# move_home
+#
+#def_key "end"
+# move_end
+#
+#def_key "insert"
+# select_item
+#
+#def_key "enter"
+# enter_directory
+#
+#def_key "enter"
+# toggle_output
+#
+#def_key "enter"
+# run_action
+#
+#def_key "enter"
+# play_item
+#
+#def_key "space"
+# add_item_to_playlist
+#
+#def_key "space"
+# toggle_lyrics_update_on_song_change
+#
+#def_key "space"
+# toggle_visualization_type
+#
+#def_key "delete"
+# delete_playlist_items
+#
+#def_key "delete"
+# delete_browser_items
+#
+#def_key "delete"
+# delete_stored_playlist
+#
+#def_key "right"
+# next_column
+#
+#def_key "right"
+# slave_screen
+#
+#def_key "right"
+# volume_up
+#
+#def_key "+"
+# volume_up
+#
+#def_key "left"
+# previous_column
+#
+#def_key "left"
+# master_screen
+#
+#def_key "left"
+# volume_down
+#
+#def_key "-"
+# volume_down
+#
+#def_key ":"
+# execute_command
+#
+#def_key "tab"
+# next_screen
+#
+#def_key "shift-tab"
+# previous_screen
+#
+#def_key "f1"
+# show_help
+#
+#def_key "1"
+# show_playlist
+#
+#def_key "2"
+# show_browser
+#
+#def_key "2"
+# change_browse_mode
+#
+#def_key "3"
+# show_search_engine
+#
+#def_key "3"
+# reset_search_engine
+#
+#def_key "4"
+# show_media_library
+#
+#def_key "4"
+# toggle_media_library_columns_mode
+#
+#def_key "5"
+# show_playlist_editor
+#
+#def_key "6"
+# show_tag_editor
+#
+#def_key "7"
+# show_outputs
+#
+#def_key "8"
+# show_visualizer
+#
+def_key "="
+ show_clock
+#
+#def_key "@"
+# show_server_info
+#
+#def_key "s"
+# stop
+#
+#def_key "p"
+# pause
+#
+#def_key ">"
+# next
+#
+#def_key "<"
+# previous
+#
+#def_key "ctrl-h"
+# jump_to_parent_directory
+#
+#def_key "ctrl-h"
+# replay_song
+#
+#def_key "backspace"
+# jump_to_parent_directory
+#
+#def_key "backspace"
+# replay_song
+#
+#def_key "backspace"
+# play
+#
+#def_key "f"
+# seek_forward
+#
+#def_key "b"
+# seek_backward
+#
+#def_key "r"
+# toggle_repeat
+#
+#def_key "z"
+# toggle_random
+#
+#def_key "y"
+# save_tag_changes
+#
+#def_key "y"
+# start_searching
+#
+def_key "t"
+ toggle_single
+#
+#def_key "R"
+# toggle_consume
+#
+#def_key "Y"
+# toggle_replay_gain_mode
+#
+#def_key "T"
+# toggle_add_mode
+#
+#def_key "|"
+# toggle_mouse
+#
+#def_key "#"
+# toggle_bitrate_visibility
+#
+#def_key "Z"
+# shuffle
+#
+#def_key "x"
+# toggle_crossfade
+#
+#def_key "X"
+# set_crossfade
+#
+#def_key "u"
+# update_database
+#
+#def_key "ctrl-s"
+# sort_playlist
+#
+#def_key "ctrl-s"
+# toggle_browser_sort_mode
+#
+#def_key "ctrl-s"
+# toggle_media_library_sort_mode
+#
+#def_key "ctrl-r"
+# reverse_playlist
+#
+#def_key "ctrl-f"
+# apply_filter
+#
+#def_key "ctrl-_"
+# select_found_items
+#
+#def_key "/"
+# find
+#
+#def_key "/"
+# find_item_forward
+#
+#def_key "?"
+# find
+#
+#def_key "?"
+# find_item_backward
+#
+#def_key "."
+# next_found_item
+#
+#def_key ","
+# previous_found_item
+#
+#def_key "w"
+# toggle_find_mode
+#
+#def_key "e"
+# edit_song
+#
+#def_key "e"
+# edit_library_tag
+#
+#def_key "e"
+# edit_library_album
+#
+#def_key "e"
+# edit_directory_name
+#
+#def_key "e"
+# edit_playlist_name
+#
+#def_key "e"
+# edit_lyrics
+#
+def_key "i"
+ show_song_info
+#
+#def_key "I"
+# show_artist_info
+#
+#def_key "g"
+# jump_to_position_in_song
+#
+def_key "l"
+ show_lyrics
+#
+#def_key "ctrl-v"
+# select_range
+#
+#def_key "v"
+# reverse_selection
+#
+#def_key "V"
+# remove_selection
+#
+#def_key "B"
+# select_album
+#
+#def_key "a"
+# add_selected_items
+#
+#def_key "c"
+# clear_playlist
+#
+#def_key "c"
+# clear_main_playlist
+#
+#def_key "C"
+# crop_playlist
+#
+#def_key "C"
+# crop_main_playlist
+#
+#def_key "m"
+# move_sort_order_up
+#
+def_key "shift-up"
+ move_selected_items_up
+#
+#def_key "n"
+# move_sort_order_down
+#
+def_key "shift-down"
+ move_selected_items_down
+#
+#def_key "M"
+# move_selected_items_to
+#
+#def_key "A"
+# add
+#
+def_key "S"
+ save_playlist
+#
+#def_key "o"
+# jump_to_playing_song
+#
+#def_key "G"
+# jump_to_browser
+#
+#def_key "G"
+# jump_to_playlist_editor
+#
+#def_key "~"
+# jump_to_media_library
+#
+#def_key "E"
+# jump_to_tag_editor
+#
+#def_key "U"
+# toggle_playing_song_centering
+#
+#def_key "P"
+# toggle_display_mode
+#
+#def_key "\\"
+# toggle_interface
+#
+#def_key "!"
+# toggle_separators_between_albums
+#
+#def_key "L"
+# toggle_lyrics_fetcher
+#
+#def_key "F"
+# fetch_lyrics_in_background
+#
+#def_key "alt-l"
+# toggle_fetching_lyrics_in_background
+#
+#def_key "ctrl-l"
+# toggle_screen_lock
+#
+#def_key "`"
+# toggle_library_tag_type
+#
+#def_key "`"
+# refetch_lyrics
+#
+#def_key "`"
+# add_random_items
+#
+#def_key "ctrl-p"
+# set_selected_items_priority
+#
+#def_key "q"
+# quit
+#
diff --git a/dotfiles/system/.config/ncmpcpp/config b/dotfiles/system/.config/ncmpcpp/config
new file mode 100644
index 0000000..a4f9c40
--- /dev/null
+++ b/dotfiles/system/.config/ncmpcpp/config
@@ -0,0 +1,71 @@
+# Connection
+# mpd_host = "127.0.0.1"
+mpd_host = "/home/cjennings/.config/mpd/socket"
+#mpd_port = "6600"
+mpd_music_dir = "/home/cjennings/music"
+mpd_connection_timeout = "10"
+mpd_crossfade_time = "1"
+
+# Visualizer
+visualizer_data_source = "/tmp/mpd.fifo"
+visualizer_output_name = "FIFO"
+visualizer_in_stereo = "yes"
+visualizer_type = "wave_filled"
+visualizer_color = 246,245,244,243,242,241,240,239,238,237,236,235
+visualizer_look = "|○"
+
+# Columns
+song_columns_list_format = "(3f)[239]{} (35)[246]{t|f} (30)[blue]{a} (30)[green]{b} (5f)[240]{l}"
+song_list_format = "{$5 %a$9 $1│$9 $8%t$9 }|{ $8%f$9}$R{$5%b $7}"
+song_status_format = "{{{$5%a$9}} $8-$9 {$2%t$9}|{$0%f$9}{ $8-$9 $3%b$9{ $8-$9 $5%y$9}}}"
+song_library_format = "{%n $8-$9 }{%t}|{%f}"
+now_playing_prefix = "$8$b ➤ "
+browser_playlist_prefix = "playlist"
+selected_item_prefix = "$5"
+selected_item_suffix = "$9"
+song_window_title_format = "{%t}|{%f} - {%a}"
+
+# Various
+playlist_show_remaining_time = "no"
+playlist_shorten_total_times = "yes"
+playlist_separate_albums = "no"
+playlist_display_mode = "columns"
+browser_display_mode = "columns"
+search_engine_display_mode = "columns"
+discard_colors_if_item_is_selected = "no"
+incremental_seeking = "yes"
+seek_time = "1"
+autocenter_mode = "yes"
+centered_cursor = "yes"
+progressbar_look = "─╼─"
+progressbar_color = 240
+progressbar_elapsed_color = white
+user_interface = "classic"
+header_visibility = "no"
+titles_visibility = "no"
+header_text_scrolling = "yes"
+cyclic_scrolling = "no"
+lines_scrolled = "2"
+follow_now_playing_lyrics = "yes"
+show_hidden_files_in_local_browser = "no"
+jump_to_now_playing_song_at_start = "yes"
+clock_display_seconds = "no"
+display_volume_level = "no"
+display_bitrate = "yes"
+display_remaining_time = "no"
+regular_expressions = "extended"
+ignore_leading_the = "no"
+block_search_constraints_change_if_items_found = "yes"
+mouse_support = "yes"
+mouse_list_scroll_whole_page = "yes"
+external_editor = "vim"
+use_console_editor = "yes"
+colors_enabled = "yes"
+empty_tag_color = "white"
+header_window_color = "yellow"
+state_line_color = "black"
+state_flags_color = "black"
+main_window_color = 243
+statusbar_color = "yellow"
+active_window_border = "yellow"
+
diff --git a/dotfiles/system/.config/ranger/commands.py b/dotfiles/system/.config/ranger/commands.py
new file mode 100644
index 0000000..97b7909
--- /dev/null
+++ b/dotfiles/system/.config/ranger/commands.py
@@ -0,0 +1,62 @@
+# This is a sample commands.py. You can add your own commands here.
+#
+# Please refer to commands_full.py for all the default commands and a complete
+# documentation. Do NOT add them all here, or you may end up with defunct
+# commands when upgrading ranger.
+
+# A simple command for demonstration purposes follows.
+# -----------------------------------------------------------------------------
+
+from __future__ import (absolute_import, division, print_function)
+
+# You can import any python module as needed.
+import os
+
+# You always need to import ranger.api.commands here to get the Command class:
+from ranger.api.commands import Command
+
+
+# Any class that is a subclass of "Command" will be integrated into ranger as a
+# command. Try typing ":my_edit<ENTER>" in ranger!
+class my_edit(Command):
+ # The so-called doc-string of the class will be visible in the built-in
+ # help that is accessible by typing "?c" inside ranger.
+ """:my_edit <filename>
+
+ A sample command for demonstration purposes that opens a file in an editor.
+ """
+
+ # The execute method is called when you run this command in ranger.
+ def execute(self):
+ # self.arg(1) is the first (space-separated) argument to the function.
+ # This way you can write ":my_edit somefilename<ENTER>".
+ if self.arg(1):
+ # self.rest(1) contains self.arg(1) and everything that follows
+ target_filename = self.rest(1)
+ else:
+ # self.fm is a ranger.core.filemanager.FileManager object and gives
+ # you access to internals of ranger.
+ # self.fm.thisfile is a ranger.container.file.File object and is a
+ # reference to the currently selected file.
+ target_filename = self.fm.thisfile.path
+
+ # This is a generic function to print text in ranger.
+ self.fm.notify("Let's edit the file " + target_filename + "!")
+
+ # Using bad=True in fm.notify allows you to print error messages:
+ if not os.path.exists(target_filename):
+ self.fm.notify("The given file does not exist!", bad=True)
+ return
+
+ # This executes a function from ranger.core.acitons, a module with a
+ # variety of subroutines that can help you construct commands.
+ # Check out the source, or run "pydoc ranger.core.actions" for a list.
+ self.fm.edit_file(target_filename)
+
+ # The tab method is called when you press tab, and should return a list of
+ # suggestions that the user will tab through.
+ # tabnum is 1 for <TAB> and -1 for <S-TAB> by default
+ def tab(self, tabnum):
+ # This is a generic tab-completion function that iterates through the
+ # content of the current directory.
+ return self._tab_directory_content()
diff --git a/dotfiles/system/.config/ranger/commands_full.py b/dotfiles/system/.config/ranger/commands_full.py
new file mode 100644
index 0000000..d177203
--- /dev/null
+++ b/dotfiles/system/.config/ranger/commands_full.py
@@ -0,0 +1,1836 @@
+# -*- coding: utf-8 -*-
+# This file is part of ranger, the console file manager.
+# This configuration file is licensed under the same terms as ranger.
+# ===================================================================
+#
+# NOTE: If you copied this file to /etc/ranger/commands_full.py or
+# ~/.config/ranger/commands_full.py, then it will NOT be loaded by ranger,
+# and only serve as a reference.
+#
+# ===================================================================
+# This file contains ranger's commands.
+# It's all in python; lines beginning with # are comments.
+#
+# Note that additional commands are automatically generated from the methods
+# of the class ranger.core.actions.Actions.
+#
+# You can customize commands in the files /etc/ranger/commands.py (system-wide)
+# and ~/.config/ranger/commands.py (per user).
+# They have the same syntax as this file. In fact, you can just copy this
+# file to ~/.config/ranger/commands_full.py with
+# `ranger --copy-config=commands_full' and make your modifications, don't
+# forget to rename it to commands.py. You can also use
+# `ranger --copy-config=commands' to copy a short sample commands.py that
+# has everything you need to get started.
+# But make sure you update your configs when you update ranger.
+#
+# ===================================================================
+# Every class defined here which is a subclass of `Command' will be used as a
+# command in ranger. Several methods are defined to interface with ranger:
+# execute(): called when the command is executed.
+# cancel(): called when closing the console.
+# tab(tabnum): called when <TAB> is pressed.
+# quick(): called after each keypress.
+#
+# tab() argument tabnum is 1 for <TAB> and -1 for <S-TAB> by default
+#
+# The return values for tab() can be either:
+# None: There is no tab completion
+# A string: Change the console to this string
+# A list/tuple/generator: cycle through every item in it
+#
+# The return value for quick() can be:
+# False: Nothing happens
+# True: Execute the command afterwards
+#
+# The return value for execute() and cancel() doesn't matter.
+#
+# ===================================================================
+# Commands have certain attributes and methods that facilitate parsing of
+# the arguments:
+#
+# self.line: The whole line that was written in the console.
+# self.args: A list of all (space-separated) arguments to the command.
+# self.quantifier: If this command was mapped to the key "X" and
+# the user pressed 6X, self.quantifier will be 6.
+# self.arg(n): The n-th argument, or an empty string if it doesn't exist.
+# self.rest(n): The n-th argument plus everything that followed. For example,
+# if the command was "search foo bar a b c", rest(2) will be "bar a b c"
+# self.start(n): Anything before the n-th argument. For example, if the
+# command was "search foo bar a b c", start(2) will be "search foo"
+#
+# ===================================================================
+# And this is a little reference for common ranger functions and objects:
+#
+# self.fm: A reference to the "fm" object which contains most information
+# about ranger.
+# self.fm.notify(string): Print the given string on the screen.
+# self.fm.notify(string, bad=True): Print the given string in RED.
+# self.fm.reload_cwd(): Reload the current working directory.
+# self.fm.thisdir: The current working directory. (A File object.)
+# self.fm.thisfile: The current file. (A File object too.)
+# self.fm.thistab.get_selection(): A list of all selected files.
+# self.fm.execute_console(string): Execute the string as a ranger command.
+# self.fm.open_console(string): Open the console with the given string
+# already typed in for you.
+# self.fm.move(direction): Moves the cursor in the given direction, which
+# can be something like down=3, up=5, right=1, left=1, to=6, ...
+#
+# File objects (for example self.fm.thisfile) have these useful attributes and
+# methods:
+#
+# tfile.path: The path to the file.
+# tfile.basename: The base name only.
+# tfile.load_content(): Force a loading of the directories content (which
+# obviously works with directories only)
+# tfile.is_directory: True/False depending on whether it's a directory.
+#
+# For advanced commands it is unavoidable to dive a bit into the source code
+# of ranger.
+# ===================================================================
+
+from __future__ import (absolute_import, division, print_function)
+
+from collections import deque
+import os
+import re
+
+from ranger.api.commands import Command
+
+
+class alias(Command):
+ """:alias <newcommand> <oldcommand>
+
+ Copies the oldcommand as newcommand.
+ """
+
+ context = 'browser'
+ resolve_macros = False
+
+ def execute(self):
+ if not self.arg(1) or not self.arg(2):
+ self.fm.notify('Syntax: alias <newcommand> <oldcommand>', bad=True)
+ return
+
+ self.fm.commands.alias(self.arg(1), self.rest(2))
+
+
+class echo(Command):
+ """:echo <text>
+
+ Display the text in the statusbar.
+ """
+
+ def execute(self):
+ self.fm.notify(self.rest(1))
+
+
+class cd(Command):
+ """:cd [-r] <path>
+
+ The cd command changes the directory.
+ If the path is a file, selects that file.
+ The command 'cd -' is equivalent to typing ``.
+ Using the option "-r" will get you to the real path.
+ """
+
+ def execute(self):
+ if self.arg(1) == '-r':
+ self.shift()
+ destination = os.path.realpath(self.rest(1))
+ if os.path.isfile(destination):
+ self.fm.select_file(destination)
+ return
+ else:
+ destination = self.rest(1)
+
+ if not destination:
+ destination = '~'
+
+ if destination == '-':
+ self.fm.enter_bookmark('`')
+ else:
+ self.fm.cd(destination)
+
+ def _tab_args(self):
+ # dest must be rest because path could contain spaces
+ if self.arg(1) == '-r':
+ start = self.start(2)
+ dest = self.rest(2)
+ else:
+ start = self.start(1)
+ dest = self.rest(1)
+
+ if dest:
+ head, tail = os.path.split(os.path.expanduser(dest))
+ if head:
+ dest_exp = os.path.join(os.path.normpath(head), tail)
+ else:
+ dest_exp = tail
+ else:
+ dest_exp = ''
+ return (start, dest_exp, os.path.join(self.fm.thisdir.path, dest_exp),
+ dest.endswith(os.path.sep))
+
+ @staticmethod
+ def _tab_paths(dest, dest_abs, ends_with_sep):
+ if not dest:
+ try:
+ return next(os.walk(dest_abs))[1], dest_abs
+ except (OSError, StopIteration):
+ return [], ''
+
+ if ends_with_sep:
+ try:
+ return [os.path.join(dest, path) for path in next(os.walk(dest_abs))[1]], ''
+ except (OSError, StopIteration):
+ return [], ''
+
+ return None, None
+
+ def _tab_match(self, path_user, path_file):
+ if self.fm.settings.cd_tab_case == 'insensitive':
+ path_user = path_user.lower()
+ path_file = path_file.lower()
+ elif self.fm.settings.cd_tab_case == 'smart' and path_user.islower():
+ path_file = path_file.lower()
+ return path_file.startswith(path_user)
+
+ def _tab_normal(self, dest, dest_abs):
+ dest_dir = os.path.dirname(dest)
+ dest_base = os.path.basename(dest)
+
+ try:
+ dirnames = next(os.walk(os.path.dirname(dest_abs)))[1]
+ except (OSError, StopIteration):
+ return [], ''
+
+ return [os.path.join(dest_dir, d) for d in dirnames if self._tab_match(dest_base, d)], ''
+
+ def _tab_fuzzy_match(self, basepath, tokens):
+ """ Find directories matching tokens recursively """
+ if not tokens:
+ tokens = ['']
+ paths = [basepath]
+ while True:
+ token = tokens.pop()
+ matches = []
+ for path in paths:
+ try:
+ directories = next(os.walk(path))[1]
+ except (OSError, StopIteration):
+ continue
+ matches += [os.path.join(path, d) for d in directories
+ if self._tab_match(token, d)]
+ if not tokens or not matches:
+ return matches
+ paths = matches
+
+ return None
+
+ def _tab_fuzzy(self, dest, dest_abs):
+ tokens = []
+ basepath = dest_abs
+ while True:
+ basepath_old = basepath
+ basepath, token = os.path.split(basepath)
+ if basepath == basepath_old:
+ break
+ if os.path.isdir(basepath_old) and not token.startswith('.'):
+ basepath = basepath_old
+ break
+ tokens.append(token)
+
+ paths = self._tab_fuzzy_match(basepath, tokens)
+ if not os.path.isabs(dest):
+ paths_rel = basepath
+ paths = [os.path.relpath(path, paths_rel) for path in paths]
+ else:
+ paths_rel = ''
+ return paths, paths_rel
+
+ def tab(self, tabnum):
+ from os.path import sep
+
+ start, dest, dest_abs, ends_with_sep = self._tab_args()
+
+ paths, paths_rel = self._tab_paths(dest, dest_abs, ends_with_sep)
+ if paths is None:
+ if self.fm.settings.cd_tab_fuzzy:
+ paths, paths_rel = self._tab_fuzzy(dest, dest_abs)
+ else:
+ paths, paths_rel = self._tab_normal(dest, dest_abs)
+
+ paths.sort()
+
+ if self.fm.settings.cd_bookmarks:
+ paths[0:0] = [
+ os.path.relpath(v.path, paths_rel) if paths_rel else v.path
+ for v in self.fm.bookmarks.dct.values() for path in paths
+ if v.path.startswith(os.path.join(paths_rel, path) + sep)
+ ]
+
+ if not paths:
+ return None
+ if len(paths) == 1:
+ return start + paths[0] + sep
+ return [start + dirname for dirname in paths]
+
+
+class chain(Command):
+ """:chain <command1>; <command2>; ...
+
+ Calls multiple commands at once, separated by semicolons.
+ """
+
+ def execute(self):
+ if not self.rest(1).strip():
+ self.fm.notify('Syntax: chain <command1>; <command2>; ...', bad=True)
+ return
+ for command in [s.strip() for s in self.rest(1).split(";")]:
+ self.fm.execute_console(command)
+
+
+class shell(Command):
+ escape_macros_for_shell = True
+
+ def execute(self):
+ if self.arg(1) and self.arg(1)[0] == '-':
+ flags = self.arg(1)[1:]
+ command = self.rest(2)
+ else:
+ flags = ''
+ command = self.rest(1)
+
+ if command:
+ self.fm.execute_command(command, flags=flags)
+
+ def tab(self, tabnum):
+ from ranger.ext.get_executables import get_executables
+ if self.arg(1) and self.arg(1)[0] == '-':
+ command = self.rest(2)
+ else:
+ command = self.rest(1)
+ start = self.line[0:len(self.line) - len(command)]
+
+ try:
+ position_of_last_space = command.rindex(" ")
+ except ValueError:
+ return (start + program + ' ' for program
+ in get_executables() if program.startswith(command))
+ if position_of_last_space == len(command) - 1:
+ selection = self.fm.thistab.get_selection()
+ if len(selection) == 1:
+ return self.line + selection[0].shell_escaped_basename + ' '
+ return self.line + '%s '
+
+ before_word, start_of_word = self.line.rsplit(' ', 1)
+ return (before_word + ' ' + file.shell_escaped_basename
+ for file in self.fm.thisdir.files or []
+ if file.shell_escaped_basename.startswith(start_of_word))
+
+
+class open_with(Command):
+
+ def execute(self):
+ app, flags, mode = self._get_app_flags_mode(self.rest(1))
+ self.fm.execute_file(
+ files=[f for f in self.fm.thistab.get_selection()],
+ app=app,
+ flags=flags,
+ mode=mode)
+
+ def tab(self, tabnum):
+ return self._tab_through_executables()
+
+ def _get_app_flags_mode(self, string): # pylint: disable=too-many-branches,too-many-statements
+ """Extracts the application, flags and mode from a string.
+
+ examples:
+ "mplayer f 1" => ("mplayer", "f", 1)
+ "atool 4" => ("atool", "", 4)
+ "p" => ("", "p", 0)
+ "" => None
+ """
+
+ app = ''
+ flags = ''
+ mode = 0
+ split = string.split()
+
+ if len(split) == 1:
+ part = split[0]
+ if self._is_app(part):
+ app = part
+ elif self._is_flags(part):
+ flags = part
+ elif self._is_mode(part):
+ mode = part
+
+ elif len(split) == 2:
+ part0 = split[0]
+ part1 = split[1]
+
+ if self._is_app(part0):
+ app = part0
+ if self._is_flags(part1):
+ flags = part1
+ elif self._is_mode(part1):
+ mode = part1
+ elif self._is_flags(part0):
+ flags = part0
+ if self._is_mode(part1):
+ mode = part1
+ elif self._is_mode(part0):
+ mode = part0
+ if self._is_flags(part1):
+ flags = part1
+
+ elif len(split) >= 3:
+ part0 = split[0]
+ part1 = split[1]
+ part2 = split[2]
+
+ if self._is_app(part0):
+ app = part0
+ if self._is_flags(part1):
+ flags = part1
+ if self._is_mode(part2):
+ mode = part2
+ elif self._is_mode(part1):
+ mode = part1
+ if self._is_flags(part2):
+ flags = part2
+ elif self._is_flags(part0):
+ flags = part0
+ if self._is_mode(part1):
+ mode = part1
+ elif self._is_mode(part0):
+ mode = part0
+ if self._is_flags(part1):
+ flags = part1
+
+ return app, flags, int(mode)
+
+ def _is_app(self, arg):
+ return not self._is_flags(arg) and not arg.isdigit()
+
+ @staticmethod
+ def _is_flags(arg):
+ from ranger.core.runner import ALLOWED_FLAGS
+ return all(x in ALLOWED_FLAGS for x in arg)
+
+ @staticmethod
+ def _is_mode(arg):
+ return all(x in '0123456789' for x in arg)
+
+
+class set_(Command):
+ """:set <option name>=<python expression>
+
+ Gives an option a new value.
+
+ Use `:set <option>!` to toggle or cycle it, e.g. `:set flush_input!`
+ """
+ name = 'set' # don't override the builtin set class
+
+ def execute(self):
+ name = self.arg(1)
+ name, value, _, toggle = self.parse_setting_line_v2()
+ if toggle:
+ self.fm.toggle_option(name)
+ else:
+ self.fm.set_option_from_string(name, value)
+
+ def tab(self, tabnum): # pylint: disable=too-many-return-statements
+ from ranger.gui.colorscheme import get_all_colorschemes
+ name, value, name_done = self.parse_setting_line()
+ settings = self.fm.settings
+ if not name:
+ return sorted(self.firstpart + setting for setting in settings)
+ if not value and not name_done:
+ return sorted(self.firstpart + setting for setting in settings
+ if setting.startswith(name))
+ if not value:
+ value_completers = {
+ "colorscheme":
+ # Cycle through colorschemes when name, but no value is specified
+ lambda: sorted(self.firstpart + colorscheme for colorscheme
+ in get_all_colorschemes(self.fm)),
+
+ "column_ratios":
+ lambda: self.firstpart + ",".join(map(str, settings[name])),
+ }
+
+ def default_value_completer():
+ return self.firstpart + str(settings[name])
+
+ return value_completers.get(name, default_value_completer)()
+ if bool in settings.types_of(name):
+ if 'true'.startswith(value.lower()):
+ return self.firstpart + 'True'
+ if 'false'.startswith(value.lower()):
+ return self.firstpart + 'False'
+ # Tab complete colorscheme values if incomplete value is present
+ if name == "colorscheme":
+ return sorted(self.firstpart + colorscheme for colorscheme
+ in get_all_colorschemes(self.fm) if colorscheme.startswith(value))
+ return None
+
+
+class setlocal(set_):
+ """:setlocal path=<regular expression> <option name>=<python expression>
+
+ Gives an option a new value.
+ """
+ PATH_RE_DQUOTED = re.compile(r'^setlocal\s+path="(.*?)"')
+ PATH_RE_SQUOTED = re.compile(r"^setlocal\s+path='(.*?)'")
+ PATH_RE_UNQUOTED = re.compile(r'^path=(.*?)$')
+
+ def _re_shift(self, match):
+ if not match:
+ return None
+ path = os.path.expanduser(match.group(1))
+ for _ in range(len(path.split())):
+ self.shift()
+ return path
+
+ def execute(self):
+ path = self._re_shift(self.PATH_RE_DQUOTED.match(self.line))
+ if path is None:
+ path = self._re_shift(self.PATH_RE_SQUOTED.match(self.line))
+ if path is None:
+ path = self._re_shift(self.PATH_RE_UNQUOTED.match(self.arg(1)))
+ if path is None and self.fm.thisdir:
+ path = self.fm.thisdir.path
+ if not path:
+ return
+
+ name, value, _ = self.parse_setting_line()
+ self.fm.set_option_from_string(name, value, localpath=path)
+
+
+class setintag(set_):
+ """:setintag <tag or tags> <option name>=<option value>
+
+ Sets an option for directories that are tagged with a specific tag.
+ """
+
+ def execute(self):
+ tags = self.arg(1)
+ self.shift()
+ name, value, _ = self.parse_setting_line()
+ self.fm.set_option_from_string(name, value, tags=tags)
+
+
+class default_linemode(Command):
+
+ def execute(self):
+ from ranger.container.fsobject import FileSystemObject
+
+ if len(self.args) < 2:
+ self.fm.notify(
+ "Usage: default_linemode [path=<regexp> | tag=<tag(s)>] <linemode>", bad=True)
+
+ # Extract options like "path=..." or "tag=..." from the command line
+ arg1 = self.arg(1)
+ method = "always"
+ argument = None
+ if arg1.startswith("path="):
+ method = "path"
+ argument = re.compile(arg1[5:])
+ self.shift()
+ elif arg1.startswith("tag="):
+ method = "tag"
+ argument = arg1[4:]
+ self.shift()
+
+ # Extract and validate the line mode from the command line
+ lmode = self.rest(1)
+ if lmode not in FileSystemObject.linemode_dict:
+ self.fm.notify(
+ "Invalid linemode: %s; should be %s" % (
+ lmode, "/".join(FileSystemObject.linemode_dict)),
+ bad=True,
+ )
+
+ # Add the prepared entry to the fm.default_linemodes
+ entry = [method, argument, lmode]
+ self.fm.default_linemodes.appendleft(entry)
+
+ # Redraw the columns
+ if self.fm.ui.browser:
+ for col in self.fm.ui.browser.columns:
+ col.need_redraw = True
+
+ def tab(self, tabnum):
+ return (self.arg(0) + " " + lmode
+ for lmode in self.fm.thisfile.linemode_dict.keys()
+ if lmode.startswith(self.arg(1)))
+
+
+class quit(Command): # pylint: disable=redefined-builtin
+ """:quit
+
+ Closes the current tab, if there's only one tab.
+ Otherwise quits if there are no tasks in progress.
+ """
+ def _exit_no_work(self):
+ if self.fm.loader.has_work():
+ self.fm.notify('Not quitting: Tasks in progress: Use `quit!` to force quit')
+ else:
+ self.fm.exit()
+
+ def execute(self):
+ if len(self.fm.tabs) >= 2:
+ self.fm.tab_close()
+ else:
+ self._exit_no_work()
+
+
+class quit_bang(Command):
+ """:quit!
+
+ Closes the current tab, if there's only one tab.
+ Otherwise force quits immediately.
+ """
+ name = 'quit!'
+ allow_abbrev = False
+
+ def execute(self):
+ if len(self.fm.tabs) >= 2:
+ self.fm.tab_close()
+ else:
+ self.fm.exit()
+
+
+class quitall(Command):
+ """:quitall
+
+ Quits if there are no tasks in progress.
+ """
+ def _exit_no_work(self):
+ if self.fm.loader.has_work():
+ self.fm.notify('Not quitting: Tasks in progress: Use `quitall!` to force quit')
+ else:
+ self.fm.exit()
+
+ def execute(self):
+ self._exit_no_work()
+
+
+class quitall_bang(Command):
+ """:quitall!
+
+ Force quits immediately.
+ """
+ name = 'quitall!'
+ allow_abbrev = False
+
+ def execute(self):
+ self.fm.exit()
+
+
+class terminal(Command):
+ """:terminal
+
+ Spawns an "x-terminal-emulator" starting in the current directory.
+ """
+
+ def execute(self):
+ from ranger.ext.get_executables import get_term
+ self.fm.run(get_term(), flags='f')
+
+
+class delete(Command):
+ """:delete
+
+ Tries to delete the selection or the files passed in arguments (if any).
+ The arguments use a shell-like escaping.
+
+ "Selection" is defined as all the "marked files" (by default, you
+ can mark files with space or v). If there are no marked files,
+ use the "current file" (where the cursor is)
+
+ When attempting to delete non-empty directories or multiple
+ marked files, it will require a confirmation.
+ """
+
+ allow_abbrev = False
+ escape_macros_for_shell = True
+
+ def execute(self):
+ import shlex
+ from functools import partial
+
+ def is_directory_with_files(path):
+ return os.path.isdir(path) and not os.path.islink(path) and len(os.listdir(path)) > 0
+
+ if self.rest(1):
+ files = shlex.split(self.rest(1))
+ many_files = (len(files) > 1 or is_directory_with_files(files[0]))
+ else:
+ cwd = self.fm.thisdir
+ tfile = self.fm.thisfile
+ if not cwd or not tfile:
+ self.fm.notify("Error: no file selected for deletion!", bad=True)
+ return
+
+ # relative_path used for a user-friendly output in the confirmation.
+ files = [f.relative_path for f in self.fm.thistab.get_selection()]
+ many_files = (cwd.marked_items or is_directory_with_files(tfile.path))
+
+ confirm = self.fm.settings.confirm_on_delete
+ if confirm != 'never' and (confirm != 'multiple' or many_files):
+ self.fm.ui.console.ask(
+ "Confirm deletion of: %s (y/N)" % ', '.join(files),
+ partial(self._question_callback, files),
+ ('n', 'N', 'y', 'Y'),
+ )
+ else:
+ # no need for a confirmation, just delete
+ self.fm.delete(files)
+
+ def tab(self, tabnum):
+ return self._tab_directory_content()
+
+ def _question_callback(self, files, answer):
+ if answer == 'y' or answer == 'Y':
+ self.fm.delete(files)
+
+
+class jump_non(Command):
+ """:jump_non [-FLAGS...]
+
+ Jumps to first non-directory if highlighted file is a directory and vice versa.
+
+ Flags:
+ -r Jump in reverse order
+ -w Wrap around if reaching end of filelist
+ """
+ def __init__(self, *args, **kwargs):
+ super(jump_non, self).__init__(*args, **kwargs)
+
+ flags, _ = self.parse_flags()
+ self._flag_reverse = 'r' in flags
+ self._flag_wrap = 'w' in flags
+
+ @staticmethod
+ def _non(fobj, is_directory):
+ return fobj.is_directory if not is_directory else not fobj.is_directory
+
+ def execute(self):
+ tfile = self.fm.thisfile
+ passed = False
+ found_before = None
+ found_after = None
+ for fobj in self.fm.thisdir.files[::-1] if self._flag_reverse else self.fm.thisdir.files:
+ if fobj.path == tfile.path:
+ passed = True
+ continue
+
+ if passed:
+ if self._non(fobj, tfile.is_directory):
+ found_after = fobj.path
+ break
+ elif not found_before and self._non(fobj, tfile.is_directory):
+ found_before = fobj.path
+
+ if found_after:
+ self.fm.select_file(found_after)
+ elif self._flag_wrap and found_before:
+ self.fm.select_file(found_before)
+
+
+class mark_tag(Command):
+ """:mark_tag [<tags>]
+
+ Mark all tags that are tagged with either of the given tags.
+ When leaving out the tag argument, all tagged files are marked.
+ """
+ do_mark = True
+
+ def execute(self):
+ cwd = self.fm.thisdir
+ tags = self.rest(1).replace(" ", "")
+ if not self.fm.tags or not cwd.files:
+ return
+ for fileobj in cwd.files:
+ try:
+ tag = self.fm.tags.tags[fileobj.realpath]
+ except KeyError:
+ continue
+ if not tags or tag in tags:
+ cwd.mark_item(fileobj, val=self.do_mark)
+ self.fm.ui.status.need_redraw = True
+ self.fm.ui.need_redraw = True
+
+
+class console(Command):
+ """:console <command>
+
+ Open the console with the given command.
+ """
+
+ def execute(self):
+ position = None
+ if self.arg(1)[0:2] == '-p':
+ try:
+ position = int(self.arg(1)[2:])
+ except ValueError:
+ pass
+ else:
+ self.shift()
+ self.fm.open_console(self.rest(1), position=position)
+
+
+class load_copy_buffer(Command):
+ """:load_copy_buffer
+
+ Load the copy buffer from datadir/copy_buffer
+ """
+ copy_buffer_filename = 'copy_buffer'
+
+ def execute(self):
+ import sys
+ from ranger.container.file import File
+ from os.path import exists
+ fname = self.fm.datapath(self.copy_buffer_filename)
+ unreadable = IOError if sys.version_info[0] < 3 else OSError
+ try:
+ fobj = open(fname, 'r')
+ except unreadable:
+ return self.fm.notify(
+ "Cannot open %s" % (fname or self.copy_buffer_filename), bad=True)
+
+ self.fm.copy_buffer = set(File(g)
+ for g in fobj.read().split("\n") if exists(g))
+ fobj.close()
+ self.fm.ui.redraw_main_column()
+ return None
+
+
+class save_copy_buffer(Command):
+ """:save_copy_buffer
+
+ Save the copy buffer to datadir/copy_buffer
+ """
+ copy_buffer_filename = 'copy_buffer'
+
+ def execute(self):
+ import sys
+ fname = None
+ fname = self.fm.datapath(self.copy_buffer_filename)
+ unwritable = IOError if sys.version_info[0] < 3 else OSError
+ try:
+ fobj = open(fname, 'w')
+ except unwritable:
+ return self.fm.notify("Cannot open %s" %
+ (fname or self.copy_buffer_filename), bad=True)
+ fobj.write("\n".join(fobj.path for fobj in self.fm.copy_buffer))
+ fobj.close()
+ return None
+
+
+class unmark_tag(mark_tag):
+ """:unmark_tag [<tags>]
+
+ Unmark all tags that are tagged with either of the given tags.
+ When leaving out the tag argument, all tagged files are unmarked.
+ """
+ do_mark = False
+
+
+class mkdir(Command):
+ """:mkdir <dirname>
+
+ Creates a directory with the name <dirname>.
+ """
+
+ def execute(self):
+ from os.path import join, expanduser, lexists
+ from os import makedirs
+
+ dirname = join(self.fm.thisdir.path, expanduser(self.rest(1)))
+ if not lexists(dirname):
+ makedirs(dirname)
+ else:
+ self.fm.notify("file/directory exists!", bad=True)
+
+ def tab(self, tabnum):
+ return self._tab_directory_content()
+
+
+class touch(Command):
+ """:touch <fname>
+
+ Creates a file with the name <fname>.
+ """
+
+ def execute(self):
+ from os.path import join, expanduser, lexists
+
+ fname = join(self.fm.thisdir.path, expanduser(self.rest(1)))
+ if not lexists(fname):
+ open(fname, 'a').close()
+ else:
+ self.fm.notify("file/directory exists!", bad=True)
+
+ def tab(self, tabnum):
+ return self._tab_directory_content()
+
+
+class edit(Command):
+ """:edit <filename>
+
+ Opens the specified file in vim
+ """
+
+ def execute(self):
+ if not self.arg(1):
+ self.fm.edit_file(self.fm.thisfile.path)
+ else:
+ self.fm.edit_file(self.rest(1))
+
+ def tab(self, tabnum):
+ return self._tab_directory_content()
+
+
+class eval_(Command):
+ """:eval [-q] <python code>
+
+ Evaluates the python code.
+ `fm' is a reference to the FM instance.
+ To display text, use the function `p'.
+
+ Examples:
+ :eval fm
+ :eval len(fm.directories)
+ :eval p("Hello World!")
+ """
+ name = 'eval'
+ resolve_macros = False
+
+ def execute(self):
+ # The import is needed so eval() can access the ranger module
+ import ranger # NOQA pylint: disable=unused-import,unused-variable
+ if self.arg(1) == '-q':
+ code = self.rest(2)
+ quiet = True
+ else:
+ code = self.rest(1)
+ quiet = False
+ global cmd, fm, p, quantifier # pylint: disable=invalid-name,global-variable-undefined
+ fm = self.fm
+ cmd = self.fm.execute_console
+ p = fm.notify
+ quantifier = self.quantifier
+ try:
+ try:
+ result = eval(code) # pylint: disable=eval-used
+ except SyntaxError:
+ exec(code) # pylint: disable=exec-used
+ else:
+ if result and not quiet:
+ p(result)
+ except Exception as err: # pylint: disable=broad-except
+ fm.notify("The error `%s` was caused by evaluating the "
+ "following code: `%s`" % (err, code), bad=True)
+
+
+class rename(Command):
+ """:rename <newname>
+
+ Changes the name of the currently highlighted file to <newname>
+ """
+
+ def execute(self):
+ from ranger.container.file import File
+ from os import access
+
+ new_name = self.rest(1)
+
+ if not new_name:
+ return self.fm.notify('Syntax: rename <newname>', bad=True)
+
+ if new_name == self.fm.thisfile.relative_path:
+ return None
+
+ if access(new_name, os.F_OK):
+ return self.fm.notify("Can't rename: file already exists!", bad=True)
+
+ if self.fm.rename(self.fm.thisfile, new_name):
+ file_new = File(new_name)
+ self.fm.bookmarks.update_path(self.fm.thisfile.path, file_new)
+ self.fm.tags.update_path(self.fm.thisfile.path, file_new.path)
+ self.fm.thisdir.pointed_obj = file_new
+ self.fm.thisfile = file_new
+
+ return None
+
+ def tab(self, tabnum):
+ return self._tab_directory_content()
+
+
+class rename_append(Command):
+ """:rename_append [-FLAGS...]
+
+ Opens the console with ":rename <current file>" with the cursor positioned
+ before the file extension.
+
+ Flags:
+ -a Position before all extensions
+ -r Remove everything before extensions
+ """
+ def __init__(self, *args, **kwargs):
+ super(rename_append, self).__init__(*args, **kwargs)
+
+ flags, _ = self.parse_flags()
+ self._flag_ext_all = 'a' in flags
+ self._flag_remove = 'r' in flags
+
+ def execute(self):
+ from ranger import MACRO_DELIMITER, MACRO_DELIMITER_ESC
+
+ tfile = self.fm.thisfile
+ relpath = tfile.relative_path.replace(MACRO_DELIMITER, MACRO_DELIMITER_ESC)
+ basename = tfile.basename.replace(MACRO_DELIMITER, MACRO_DELIMITER_ESC)
+
+ if basename.find('.') <= 0:
+ self.fm.open_console('rename ' + relpath)
+ return
+
+ if self._flag_ext_all:
+ pos_ext = re.search(r'[^.]+', basename).end(0)
+ else:
+ pos_ext = basename.rindex('.')
+ pos = len(relpath) - len(basename) + pos_ext
+
+ if self._flag_remove:
+ relpath = relpath[:-len(basename)] + basename[pos_ext:]
+ pos -= pos_ext
+
+ self.fm.open_console('rename ' + relpath, position=(7 + pos))
+
+
+class chmod(Command):
+ """:chmod <octal number>
+
+ Sets the permissions of the selection to the octal number.
+
+ The octal number is between 0 and 777. The digits specify the
+ permissions for the user, the group and others.
+
+ A 1 permits execution, a 2 permits writing, a 4 permits reading.
+ Add those numbers to combine them. So a 7 permits everything.
+ """
+
+ def execute(self):
+ mode_str = self.rest(1)
+ if not mode_str:
+ if not self.quantifier:
+ self.fm.notify("Syntax: chmod <octal number>", bad=True)
+ return
+ mode_str = str(self.quantifier)
+
+ try:
+ mode = int(mode_str, 8)
+ if mode < 0 or mode > 0o777:
+ raise ValueError
+ except ValueError:
+ self.fm.notify("Need an octal number between 0 and 777!", bad=True)
+ return
+
+ for fobj in self.fm.thistab.get_selection():
+ try:
+ os.chmod(fobj.path, mode)
+ except OSError as ex:
+ self.fm.notify(ex)
+
+ # reloading directory. maybe its better to reload the selected
+ # files only.
+ self.fm.thisdir.content_outdated = True
+
+
+class bulkrename(Command):
+ """:bulkrename
+
+ This command opens a list of selected files in an external editor.
+ After you edit and save the file, it will generate a shell script
+ which does bulk renaming according to the changes you did in the file.
+
+ This shell script is opened in an editor for you to review.
+ After you close it, it will be executed.
+ """
+
+ def execute(self): # pylint: disable=too-many-locals,too-many-statements
+ import sys
+ import tempfile
+ from ranger.container.file import File
+ from ranger.ext.shell_escape import shell_escape as esc
+ py3 = sys.version_info[0] >= 3
+
+ # Create and edit the file list
+ filenames = [f.relative_path for f in self.fm.thistab.get_selection()]
+ listfile = tempfile.NamedTemporaryFile(delete=False)
+ listpath = listfile.name
+
+ if py3:
+ listfile.write("\n".join(filenames).encode("utf-8"))
+ else:
+ listfile.write("\n".join(filenames))
+ listfile.close()
+ self.fm.execute_file([File(listpath)], app='editor')
+ listfile = open(listpath, 'r')
+ new_filenames = listfile.read().split("\n")
+ listfile.close()
+ os.unlink(listpath)
+ if all(a == b for a, b in zip(filenames, new_filenames)):
+ self.fm.notify("No renaming to be done!")
+ return
+
+ # Generate script
+ cmdfile = tempfile.NamedTemporaryFile()
+ script_lines = []
+ script_lines.append("# This file will be executed when you close the editor.\n")
+ script_lines.append("# Please double-check everything, clear the file to abort.\n")
+ script_lines.extend("mv -vi -- %s %s\n" % (esc(old), esc(new))
+ for old, new in zip(filenames, new_filenames) if old != new)
+ script_content = "".join(script_lines)
+ if py3:
+ cmdfile.write(script_content.encode("utf-8"))
+ else:
+ cmdfile.write(script_content)
+ cmdfile.flush()
+
+ # Open the script and let the user review it, then check if the script
+ # was modified by the user
+ self.fm.execute_file([File(cmdfile.name)], app='editor')
+ cmdfile.seek(0)
+ script_was_edited = (script_content != cmdfile.read())
+
+ # Do the renaming
+ self.fm.run(['/bin/sh', cmdfile.name], flags='w')
+ cmdfile.close()
+
+ # Retag the files, but only if the script wasn't changed during review,
+ # because only then we know which are the source and destination files.
+ if not script_was_edited:
+ tags_changed = False
+ for old, new in zip(filenames, new_filenames):
+ if old != new:
+ oldpath = self.fm.thisdir.path + '/' + old
+ newpath = self.fm.thisdir.path + '/' + new
+ if oldpath in self.fm.tags:
+ old_tag = self.fm.tags.tags[oldpath]
+ self.fm.tags.remove(oldpath)
+ self.fm.tags.tags[newpath] = old_tag
+ tags_changed = True
+ if tags_changed:
+ self.fm.tags.dump()
+ else:
+ fm.notify("files have not been retagged")
+
+
+class relink(Command):
+ """:relink <newpath>
+
+ Changes the linked path of the currently highlighted symlink to <newpath>
+ """
+
+ def execute(self):
+ new_path = self.rest(1)
+ tfile = self.fm.thisfile
+
+ if not new_path:
+ return self.fm.notify('Syntax: relink <newpath>', bad=True)
+
+ if not tfile.is_link:
+ return self.fm.notify('%s is not a symlink!' % tfile.relative_path, bad=True)
+
+ if new_path == os.readlink(tfile.path):
+ return None
+
+ try:
+ os.remove(tfile.path)
+ os.symlink(new_path, tfile.path)
+ except OSError as err:
+ self.fm.notify(err)
+
+ self.fm.reset()
+ self.fm.thisdir.pointed_obj = tfile
+ self.fm.thisfile = tfile
+
+ return None
+
+ def tab(self, tabnum):
+ if not self.rest(1):
+ return self.line + os.readlink(self.fm.thisfile.path)
+ return self._tab_directory_content()
+
+
+class help_(Command):
+ """:help
+
+ Display ranger's manual page.
+ """
+ name = 'help'
+
+ def execute(self):
+ def callback(answer):
+ if answer == "q":
+ return
+ elif answer == "m":
+ self.fm.display_help()
+ elif answer == "c":
+ self.fm.dump_commands()
+ elif answer == "k":
+ self.fm.dump_keybindings()
+ elif answer == "s":
+ self.fm.dump_settings()
+
+ self.fm.ui.console.ask(
+ "View [m]an page, [k]ey bindings, [c]ommands or [s]ettings? (press q to abort)",
+ callback,
+ list("mqkcs")
+ )
+
+
+class copymap(Command):
+ """:copymap <keys> <newkeys1> [<newkeys2>...]
+
+ Copies a "browser" keybinding from <keys> to <newkeys>
+ """
+ context = 'browser'
+
+ def execute(self):
+ if not self.arg(1) or not self.arg(2):
+ return self.fm.notify("Not enough arguments", bad=True)
+
+ for arg in self.args[2:]:
+ self.fm.ui.keymaps.copy(self.context, self.arg(1), arg)
+
+ return None
+
+
+class copypmap(copymap):
+ """:copypmap <keys> <newkeys1> [<newkeys2>...]
+
+ Copies a "pager" keybinding from <keys> to <newkeys>
+ """
+ context = 'pager'
+
+
+class copycmap(copymap):
+ """:copycmap <keys> <newkeys1> [<newkeys2>...]
+
+ Copies a "console" keybinding from <keys> to <newkeys>
+ """
+ context = 'console'
+
+
+class copytmap(copymap):
+ """:copycmap <keys> <newkeys1> [<newkeys2>...]
+
+ Copies a "taskview" keybinding from <keys> to <newkeys>
+ """
+ context = 'taskview'
+
+
+class unmap(Command):
+ """:unmap <keys> [<keys2>, ...]
+
+ Remove the given "browser" mappings
+ """
+ context = 'browser'
+
+ def execute(self):
+ for arg in self.args[1:]:
+ self.fm.ui.keymaps.unbind(self.context, arg)
+
+
+class cunmap(unmap):
+ """:cunmap <keys> [<keys2>, ...]
+
+ Remove the given "console" mappings
+ """
+ context = 'browser'
+
+
+class punmap(unmap):
+ """:punmap <keys> [<keys2>, ...]
+
+ Remove the given "pager" mappings
+ """
+ context = 'pager'
+
+
+class tunmap(unmap):
+ """:tunmap <keys> [<keys2>, ...]
+
+ Remove the given "taskview" mappings
+ """
+ context = 'taskview'
+
+
+class map_(Command):
+ """:map <keysequence> <command>
+
+ Maps a command to a keysequence in the "browser" context.
+
+ Example:
+ map j move down
+ map J move down 10
+ """
+ name = 'map'
+ context = 'browser'
+ resolve_macros = False
+
+ def execute(self):
+ if not self.arg(1) or not self.arg(2):
+ self.fm.notify("Syntax: {0} <keysequence> <command>".format(self.get_name()), bad=True)
+ return
+
+ self.fm.ui.keymaps.bind(self.context, self.arg(1), self.rest(2))
+
+
+class cmap(map_):
+ """:cmap <keysequence> <command>
+
+ Maps a command to a keysequence in the "console" context.
+
+ Example:
+ cmap <ESC> console_close
+ cmap <C-x> console_type test
+ """
+ context = 'console'
+
+
+class tmap(map_):
+ """:tmap <keysequence> <command>
+
+ Maps a command to a keysequence in the "taskview" context.
+ """
+ context = 'taskview'
+
+
+class pmap(map_):
+ """:pmap <keysequence> <command>
+
+ Maps a command to a keysequence in the "pager" context.
+ """
+ context = 'pager'
+
+
+class scout(Command):
+ """:scout [-FLAGS...] <pattern>
+
+ Swiss army knife command for searching, traveling and filtering files.
+
+ Flags:
+ -a Automatically open a file on unambiguous match
+ -e Open the selected file when pressing enter
+ -f Filter files that match the current search pattern
+ -g Interpret pattern as a glob pattern
+ -i Ignore the letter case of the files
+ -k Keep the console open when changing a directory with the command
+ -l Letter skipping; e.g. allow "rdme" to match the file "readme"
+ -m Mark the matching files after pressing enter
+ -M Unmark the matching files after pressing enter
+ -p Permanent filter: hide non-matching files after pressing enter
+ -r Interpret pattern as a regular expression pattern
+ -s Smart case; like -i unless pattern contains upper case letters
+ -t Apply filter and search pattern as you type
+ -v Inverts the match
+
+ Multiple flags can be combined. For example, ":scout -gpt" would create
+ a :filter-like command using globbing.
+ """
+ # pylint: disable=bad-whitespace
+ AUTO_OPEN = 'a'
+ OPEN_ON_ENTER = 'e'
+ FILTER = 'f'
+ SM_GLOB = 'g'
+ IGNORE_CASE = 'i'
+ KEEP_OPEN = 'k'
+ SM_LETTERSKIP = 'l'
+ MARK = 'm'
+ UNMARK = 'M'
+ PERM_FILTER = 'p'
+ SM_REGEX = 'r'
+ SMART_CASE = 's'
+ AS_YOU_TYPE = 't'
+ INVERT = 'v'
+ # pylint: enable=bad-whitespace
+
+ def __init__(self, *args, **kwargs):
+ super(scout, self).__init__(*args, **kwargs)
+ self._regex = None
+ self.flags, self.pattern = self.parse_flags()
+
+ def execute(self): # pylint: disable=too-many-branches
+ thisdir = self.fm.thisdir
+ flags = self.flags
+ pattern = self.pattern
+ regex = self._build_regex()
+ count = self._count(move=True)
+
+ self.fm.thistab.last_search = regex
+ self.fm.set_search_method(order="search")
+
+ if (self.MARK in flags or self.UNMARK in flags) and thisdir.files:
+ value = flags.find(self.MARK) > flags.find(self.UNMARK)
+ if self.FILTER in flags:
+ for fobj in thisdir.files:
+ thisdir.mark_item(fobj, value)
+ else:
+ for fobj in thisdir.files:
+ if regex.search(fobj.relative_path):
+ thisdir.mark_item(fobj, value)
+
+ if self.PERM_FILTER in flags:
+ thisdir.filter = regex if pattern else None
+
+ # clean up:
+ self.cancel()
+
+ if self.OPEN_ON_ENTER in flags or \
+ (self.AUTO_OPEN in flags and count == 1):
+ if pattern == '..':
+ self.fm.cd(pattern)
+ else:
+ self.fm.move(right=1)
+ if self.quickly_executed:
+ self.fm.block_input(0.5)
+
+ if self.KEEP_OPEN in flags and thisdir != self.fm.thisdir:
+ # reopen the console:
+ if not pattern:
+ self.fm.open_console(self.line)
+ else:
+ self.fm.open_console(self.line[0:-len(pattern)])
+
+ if self.quickly_executed and thisdir != self.fm.thisdir and pattern != "..":
+ self.fm.block_input(0.5)
+
+ def cancel(self):
+ self.fm.thisdir.temporary_filter = None
+ self.fm.thisdir.refilter()
+
+ def quick(self):
+ asyoutype = self.AS_YOU_TYPE in self.flags
+ if self.FILTER in self.flags:
+ self.fm.thisdir.temporary_filter = self._build_regex()
+ if self.PERM_FILTER in self.flags and asyoutype:
+ self.fm.thisdir.filter = self._build_regex()
+ if self.FILTER in self.flags or self.PERM_FILTER in self.flags:
+ self.fm.thisdir.refilter()
+ if self._count(move=asyoutype) == 1 and self.AUTO_OPEN in self.flags:
+ return True
+ return False
+
+ def tab(self, tabnum):
+ self._count(move=True, offset=tabnum)
+
+ def _build_regex(self):
+ if self._regex is not None:
+ return self._regex
+
+ frmat = "%s"
+ flags = self.flags
+ pattern = self.pattern
+
+ if pattern == ".":
+ return re.compile("")
+
+ # Handle carets at start and dollar signs at end separately
+ if pattern.startswith('^'):
+ pattern = pattern[1:]
+ frmat = "^" + frmat
+ if pattern.endswith('$'):
+ pattern = pattern[:-1]
+ frmat += "$"
+
+ # Apply one of the search methods
+ if self.SM_REGEX in flags:
+ regex = pattern
+ elif self.SM_GLOB in flags:
+ regex = re.escape(pattern).replace("\\*", ".*").replace("\\?", ".")
+ elif self.SM_LETTERSKIP in flags:
+ regex = ".*".join(re.escape(c) for c in pattern)
+ else:
+ regex = re.escape(pattern)
+
+ regex = frmat % regex
+
+ # Invert regular expression if necessary
+ if self.INVERT in flags:
+ regex = "^(?:(?!%s).)*$" % regex
+
+ # Compile Regular Expression
+ # pylint: disable=no-member
+ options = re.UNICODE
+ if self.IGNORE_CASE in flags or self.SMART_CASE in flags and \
+ pattern.islower():
+ options |= re.IGNORECASE
+ # pylint: enable=no-member
+ try:
+ self._regex = re.compile(regex, options)
+ except re.error:
+ self._regex = re.compile("")
+ return self._regex
+
+ def _count(self, move=False, offset=0):
+ count = 0
+ cwd = self.fm.thisdir
+ pattern = self.pattern
+
+ if not pattern or not cwd.files:
+ return 0
+ if pattern == '.':
+ return 0
+ if pattern == '..':
+ return 1
+
+ deq = deque(cwd.files)
+ deq.rotate(-cwd.pointer - offset)
+ i = offset
+ regex = self._build_regex()
+ for fsobj in deq:
+ if regex.search(fsobj.relative_path):
+ count += 1
+ if move and count == 1:
+ cwd.move(to=(cwd.pointer + i) % len(cwd.files))
+ self.fm.thisfile = cwd.pointed_obj
+ if count > 1:
+ return count
+ i += 1
+
+ return count == 1
+
+
+class narrow(Command):
+ """
+ :narrow
+
+ Show only the files selected right now. If no files are selected,
+ disable narrowing.
+ """
+ def execute(self):
+ if self.fm.thisdir.marked_items:
+ selection = [f.basename for f in self.fm.thistab.get_selection()]
+ self.fm.thisdir.narrow_filter = selection
+ else:
+ self.fm.thisdir.narrow_filter = None
+ self.fm.thisdir.refilter()
+
+
+class filter_inode_type(Command):
+ """
+ :filter_inode_type [dfl]
+
+ Displays only the files of specified inode type. Parameters
+ can be combined.
+
+ d display directories
+ f display files
+ l display links
+ """
+
+ def execute(self):
+ if not self.arg(1):
+ self.fm.thisdir.inode_type_filter = ""
+ else:
+ self.fm.thisdir.inode_type_filter = self.arg(1)
+ self.fm.thisdir.refilter()
+
+
+class filter_stack(Command):
+ """
+ :filter_stack ...
+
+ Manages the filter stack.
+
+ filter_stack add FILTER_TYPE ARGS...
+ filter_stack pop
+ filter_stack decompose
+ filter_stack rotate [N=1]
+ filter_stack clear
+ filter_stack show
+ """
+ def execute(self):
+ from ranger.core.filter_stack import SIMPLE_FILTERS, FILTER_COMBINATORS
+
+ subcommand = self.arg(1)
+
+ if subcommand == "add":
+ try:
+ self.fm.thisdir.filter_stack.append(
+ SIMPLE_FILTERS[self.arg(2)](self.rest(3))
+ )
+ except KeyError:
+ FILTER_COMBINATORS[self.arg(2)](self.fm.thisdir.filter_stack)
+ elif subcommand == "pop":
+ self.fm.thisdir.filter_stack.pop()
+ elif subcommand == "decompose":
+ inner_filters = self.fm.thisdir.filter_stack.pop().decompose()
+ if inner_filters:
+ self.fm.thisdir.filter_stack.extend(inner_filters)
+ elif subcommand == "clear":
+ self.fm.thisdir.filter_stack = []
+ elif subcommand == "rotate":
+ rotate_by = int(self.arg(2) or 1)
+ self.fm.thisdir.filter_stack = (
+ self.fm.thisdir.filter_stack[-rotate_by:]
+ + self.fm.thisdir.filter_stack[:-rotate_by]
+ )
+ elif subcommand == "show":
+ stack = list(map(str, self.fm.thisdir.filter_stack))
+ pager = self.fm.ui.open_pager()
+ pager.set_source(["Filter stack: "] + stack)
+ pager.move(to=100, percentage=True)
+ return
+ else:
+ self.fm.notify(
+ "Unknown subcommand: {}".format(subcommand),
+ bad=True
+ )
+ return
+
+ self.fm.thisdir.refilter()
+
+
+class grep(Command):
+ """:grep <string>
+
+ Looks for a string in all marked files or directories
+ """
+
+ def execute(self):
+ if self.rest(1):
+ action = ['grep', '--line-number']
+ action.extend(['-e', self.rest(1), '-r'])
+ action.extend(f.path for f in self.fm.thistab.get_selection())
+ self.fm.execute_command(action, flags='p')
+
+
+class flat(Command):
+ """
+ :flat <level>
+
+ Flattens the directory view up to the specified level.
+
+ -1 fully flattened
+ 0 remove flattened view
+ """
+
+ def execute(self):
+ try:
+ level_str = self.rest(1)
+ level = int(level_str)
+ except ValueError:
+ level = self.quantifier
+ if level is None:
+ self.fm.notify("Syntax: flat <level>", bad=True)
+ return
+ if level < -1:
+ self.fm.notify("Need an integer number (-1, 0, 1, ...)", bad=True)
+ self.fm.thisdir.unload()
+ self.fm.thisdir.flat = level
+ self.fm.thisdir.load_content()
+
+# Version control commands
+# --------------------------------
+
+
+class stage(Command):
+ """
+ :stage
+
+ Stage selected files for the corresponding version control system
+ """
+
+ def execute(self):
+ from ranger.ext.vcs import VcsError
+
+ if self.fm.thisdir.vcs and self.fm.thisdir.vcs.track:
+ filelist = [f.path for f in self.fm.thistab.get_selection()]
+ try:
+ self.fm.thisdir.vcs.action_add(filelist)
+ except VcsError as ex:
+ self.fm.notify('Unable to stage files: {0}'.format(ex))
+ self.fm.ui.vcsthread.process(self.fm.thisdir)
+ else:
+ self.fm.notify('Unable to stage files: Not in repository')
+
+
+class unstage(Command):
+ """
+ :unstage
+
+ Unstage selected files for the corresponding version control system
+ """
+
+ def execute(self):
+ from ranger.ext.vcs import VcsError
+
+ if self.fm.thisdir.vcs and self.fm.thisdir.vcs.track:
+ filelist = [f.path for f in self.fm.thistab.get_selection()]
+ try:
+ self.fm.thisdir.vcs.action_reset(filelist)
+ except VcsError as ex:
+ self.fm.notify('Unable to unstage files: {0}'.format(ex))
+ self.fm.ui.vcsthread.process(self.fm.thisdir)
+ else:
+ self.fm.notify('Unable to unstage files: Not in repository')
+
+# Metadata commands
+# --------------------------------
+
+
+class prompt_metadata(Command):
+ """
+ :prompt_metadata <key1> [<key2> [<key3> ...]]
+
+ Prompt the user to input metadata for multiple keys in a row.
+ """
+
+ _command_name = "meta"
+ _console_chain = None
+
+ def execute(self):
+ prompt_metadata._console_chain = self.args[1:]
+ self._process_command_stack()
+
+ def _process_command_stack(self):
+ if prompt_metadata._console_chain:
+ key = prompt_metadata._console_chain.pop()
+ self._fill_console(key)
+ else:
+ for col in self.fm.ui.browser.columns:
+ col.need_redraw = True
+
+ def _fill_console(self, key):
+ metadata = self.fm.metadata.get_metadata(self.fm.thisfile.path)
+ if key in metadata and metadata[key]:
+ existing_value = metadata[key]
+ else:
+ existing_value = ""
+ text = "%s %s %s" % (self._command_name, key, existing_value)
+ self.fm.open_console(text, position=len(text))
+
+
+class meta(prompt_metadata):
+ """
+ :meta <key> [<value>]
+
+ Change metadata of a file. Deletes the key if value is empty.
+ """
+
+ def execute(self):
+ key = self.arg(1)
+ update_dict = dict()
+ update_dict[key] = self.rest(2)
+ selection = self.fm.thistab.get_selection()
+ for fobj in selection:
+ self.fm.metadata.set_metadata(fobj.path, update_dict)
+ self._process_command_stack()
+
+ def tab(self, tabnum):
+ key = self.arg(1)
+ metadata = self.fm.metadata.get_metadata(self.fm.thisfile.path)
+ if key in metadata and metadata[key]:
+ return [" ".join([self.arg(0), self.arg(1), metadata[key]])]
+ return [self.arg(0) + " " + k for k in sorted(metadata)
+ if k.startswith(self.arg(1))]
+
+
+class linemode(default_linemode):
+ """
+ :linemode <mode>
+
+ Change what is displayed as a filename.
+
+ - "mode" may be any of the defined linemodes (see: ranger.core.linemode).
+ "normal" is mapped to "filename".
+ """
+
+ def execute(self):
+ mode = self.arg(1)
+
+ if mode == "normal":
+ from ranger.core.linemode import DEFAULT_LINEMODE
+ mode = DEFAULT_LINEMODE
+
+ if mode not in self.fm.thisfile.linemode_dict:
+ self.fm.notify("Unhandled linemode: `%s'" % mode, bad=True)
+ return
+
+ self.fm.thisdir.set_linemode_of_children(mode)
+
+ # Ask the browsercolumns to redraw
+ for col in self.fm.ui.browser.columns:
+ col.need_redraw = True
+
+
+class yank(Command):
+ """:yank [name|dir|path]
+
+ Copies the file's name (default), directory or path into both the primary X
+ selection and the clipboard.
+ """
+
+ modes = {
+ '': 'basename',
+ 'name_without_extension': 'basename_without_extension',
+ 'name': 'basename',
+ 'dir': 'dirname',
+ 'path': 'path',
+ }
+
+ def execute(self):
+ import subprocess
+
+ def clipboards():
+ from ranger.ext.get_executables import get_executables
+ clipboard_managers = {
+ 'xclip': [
+ ['xclip'],
+ ['xclip', '-selection', 'clipboard'],
+ ],
+ 'xsel': [
+ ['xsel'],
+ ['xsel', '-b'],
+ ],
+ 'pbcopy': [
+ ['pbcopy'],
+ ],
+ }
+ ordered_managers = ['pbcopy', 'xclip', 'xsel']
+ executables = get_executables()
+ for manager in ordered_managers:
+ if manager in executables:
+ return clipboard_managers[manager]
+ return []
+
+ clipboard_commands = clipboards()
+
+ mode = self.modes[self.arg(1)]
+ selection = self.get_selection_attr(mode)
+
+ new_clipboard_contents = "\n".join(selection)
+ for command in clipboard_commands:
+ process = subprocess.Popen(command, universal_newlines=True,
+ stdin=subprocess.PIPE)
+ process.communicate(input=new_clipboard_contents)
+
+ def get_selection_attr(self, attr):
+ return [getattr(item, attr) for item in
+ self.fm.thistab.get_selection()]
+
+ def tab(self, tabnum):
+ return (
+ self.start(1) + mode for mode
+ in sorted(self.modes.keys())
+ if mode
+ )
diff --git a/dotfiles/system/.config/ranger/rc.conf b/dotfiles/system/.config/ranger/rc.conf
new file mode 100644
index 0000000..9da29f7
--- /dev/null
+++ b/dotfiles/system/.config/ranger/rc.conf
@@ -0,0 +1,790 @@
+
+# ===================================================================
+# This file contains the default startup commands for ranger.
+# To change them, it is recommended to create either /etc/ranger/rc.conf
+# (system-wide) or ~/.config/ranger/rc.conf (per user) and add your custom
+# commands there.
+#
+# If you copy this whole file there, you may want to set the environment
+# variable RANGER_LOAD_DEFAULT_RC to FALSE to avoid loading it twice.
+#
+# The purpose of this file is mainly to define keybindings and settings.
+# For running more complex python code, please create a plugin in "plugins/" or
+# a command in "commands.py".
+#
+# Each line is a command that will be run before the user interface
+# is initialized. As a result, you can not use commands which rely
+# on the UI such as :delete or :mark.
+# ===================================================================
+
+# ===================================================================
+# == Options
+# ===================================================================
+
+# Which viewmode should be used? Possible values are:
+# miller: Use miller columns which show multiple levels of the hierarchy
+# multipane: Midnight-commander like multipane view showing all tabs next
+# to each other
+set viewmode miller
+#set viewmode multipane
+
+# How many columns are there, and what are their relative widths?
+set column_ratios 1,3,4
+
+# Which files should be hidden? (regular expression)
+set hidden_filter ^\.|\.(?:pyc|pyo|bak|swp)$|^lost\+found$|^__(py)?cache__$
+
+# Show hidden files? You can toggle this by typing 'zh'
+set show_hidden false
+
+# Ask for a confirmation when running the "delete" command?
+# Valid values are "always", "never", "multiple" (default)
+# With "multiple", ranger will ask only if you delete multiple files at once.
+set confirm_on_delete multiple
+
+# Use non-default path for file preview script?
+# ranger ships with scope.sh, a script that calls external programs (see
+# README.md for dependencies) to preview images, archives, etc.
+set preview_script ~/.config/ranger/scope.sh
+
+# Use the external preview script or display simple plain text or image previews?
+set use_preview_script true
+
+# Automatically count files in the directory, even before entering them?
+set automatically_count_files true
+
+# Open all images in this directory when running certain image viewers
+# like feh or sxiv? You can still open selected files by marking them.
+set open_all_images true
+
+# Be aware of version control systems and display information.
+set vcs_aware true
+
+# State of the four backends git, hg, bzr, svn. The possible states are
+# disabled, local (only show local info), enabled (show local and remote
+# information).
+set vcs_backend_git enabled
+set vcs_backend_hg disabled
+set vcs_backend_bzr disabled
+set vcs_backend_svn disabled
+
+# Use one of the supported image preview protocols
+set preview_images true
+
+# Set the preview image method. Supported methods:
+#
+# * w3m (default):
+# Preview images in full color with the external command "w3mimgpreview"?
+# This requires the console web browser "w3m" and a supported terminal.
+# It has been successfully tested with "xterm" and "urxvt" without tmux.
+#
+# * iterm2:
+# Preview images in full color using iTerm2 image previews
+# (http://iterm2.com/images.html). This requires using iTerm2 compiled
+# with image preview support.
+#
+# This feature relies on the dimensions of the terminal's font. By default, a
+# width of 8 and height of 11 are used. To use other values, set the options
+# iterm2_font_width and iterm2_font_height to the desired values.
+#
+# * terminology:
+# Previews images in full color in the terminology terminal emulator.
+# Supports a wide variety of formats, even vector graphics like svg.
+#
+# * urxvt:
+# Preview images in full color using urxvt image backgrounds. This
+# requires using urxvt compiled with pixbuf support.
+#
+# * urxvt-full:
+# The same as urxvt but utilizing not only the preview pane but the
+# whole terminal window.
+#
+# * kitty:
+# Preview images in full color using kitty image protocol.
+# Requires python PIL or pillow library.
+# If ranger does not share the local filesystem with kitty
+# the transfer method is changed to encode the whole image;
+# while slower, this allows remote previews,
+# for example during an ssh session.
+# Tmux is unsupported.
+set preview_images_method ueberzug
+
+# Delay in seconds before displaying an image with the w3m method.
+# Increase it in case of experiencing display corruption.
+set w3m_delay 0.05
+
+# Default iTerm2 font size (see: preview_images_method: iterm2)
+set iterm2_font_width 8
+set iterm2_font_height 11
+
+# Use a unicode "..." character to mark cut-off filenames?
+set unicode_ellipsis false
+
+# BIDI support - try to properly display file names in RTL languages (Hebrew, Arabic).
+# Requires the python-bidi pip package
+set bidi_support false
+
+# Show dotfiles in the bookmark preview box?
+set show_hidden_bookmarks true
+
+# Which colorscheme to use? These colorschemes are available by default:
+# default, jungle, snow, solarized
+# set colorscheme gruvbox
+
+# Preview files on the rightmost column?
+# And collapse (shrink) the last column if there is nothing to preview?
+set preview_files true
+set preview_directories true
+set collapse_preview true
+
+# Save the console history on exit?
+set save_console_history true
+
+# Draw the status bar on top of the browser window (default: bottom)
+set status_bar_on_top false
+
+# Draw a progress bar in the status bar which displays the average state of all
+# currently running tasks which support progress bars?
+set draw_progress_bar_in_status_bar true
+
+# Draw borders around columns? (separators, outline, both, or none)
+# Separators are vertical lines between columns.
+# Outline draws a box around all the columns.
+# Both combines the two.
+set draw_borders none
+
+# Display the directory name in tabs?
+set dirname_in_tabs false
+
+# Enable the mouse support?
+set mouse_enabled true
+
+# Display the file size in the main column or status bar?
+set display_size_in_main_column true
+set display_size_in_status_bar true
+
+# Display the free disk space in the status bar?
+set display_free_space_in_status_bar true
+
+# Display files tags in all columns or only in main column?
+set display_tags_in_all_columns true
+
+# Set a title for the window?
+set update_title false
+
+# Set the title to "ranger" in the tmux program?
+set update_tmux_title true
+
+# Shorten the title if it gets long? The number defines how many
+# directories are displayed at once, 0 turns off this feature.
+set shorten_title 3
+
+# Show hostname in titlebar?
+set hostname_in_titlebar true
+
+# Abbreviate $HOME with ~ in the titlebar (first line) of ranger?
+set tilde_in_titlebar false
+
+# How many directory-changes or console-commands should be kept in history?
+set max_history_size 20
+set max_console_history_size 50
+
+# Try to keep so much space between the top/bottom border when scrolling:
+set scroll_offset 8
+
+# Flush the input after each key hit? (Noticeable when ranger lags)
+set flushinput true
+
+# Padding on the right when there's no preview?
+# This allows you to click into the space to run the file.
+set padding_right true
+
+# Save bookmarks (used with mX and `X) instantly?
+# This helps to synchronize bookmarks between multiple ranger
+# instances but leads to *slight* performance loss.
+# When false, bookmarks are saved when ranger is exited.
+set autosave_bookmarks true
+
+# Save the "`" bookmark to disk. This can be used to switch to the last
+# directory by typing "``".
+set save_backtick_bookmark true
+
+# You can display the "real" cumulative size of directories by using the
+# command :get_cumulative_size or typing "dc". The size is expensive to
+# calculate and will not be updated automatically. You can choose
+# to update it automatically though by turning on this option:
+set autoupdate_cumulative_size false
+
+# Turning this on makes sense for screen readers:
+set show_cursor false
+
+# One of: size, natural, basename, atime, ctime, mtime, type, random
+set sort natural
+
+# Additional sorting options
+set sort_reverse false
+set sort_case_insensitive true
+set sort_directories_first true
+set sort_unicode false
+
+# Enable this if key combinations with the Alt Key don't work for you.
+# (Especially on xterm)
+set xterm_alt_key false
+
+# Whether to include bookmarks in cd command
+set cd_bookmarks true
+
+# Changes case sensitivity for the cd command tab completion
+set cd_tab_case sensitive
+
+# Use fuzzy tab completion with the "cd" command. For example,
+# ":cd /u/lo/b<tab>" expands to ":cd /usr/local/bin".
+set cd_tab_fuzzy false
+
+# Avoid previewing files larger than this size, in bytes. Use a value of 0 to
+# disable this feature.
+set preview_max_size 0
+
+# The key hint lists up to this size have their sublists expanded.
+# Otherwise the submaps are replaced with "...".
+set hint_collapse_threshold 10
+
+# Add the highlighted file to the path in the titlebar
+set show_selection_in_titlebar true
+
+# The delay that ranger idly waits for user input, in milliseconds, with a
+# resolution of 100ms. Lower delay reduces lag between directory updates but
+# increases CPU load.
+set idle_delay 2000
+
+# When the metadata manager module looks for metadata, should it only look for
+# a ".metadata.json" file in the current directory, or do a deep search and
+# check all directories above the current one as well?
+set metadata_deep_search false
+
+# Clear all existing filters when leaving a directory
+set clear_filters_on_dir_change false
+
+# Disable displaying line numbers in main column.
+# Possible values: false, absolute, relative.
+set line_numbers false
+
+# When line_numbers=relative show the absolute line number in the
+# current line.
+set relative_current_zero false
+
+# Start line numbers from 1 instead of 0
+set one_indexed false
+
+# Save tabs on exit
+set save_tabs_on_exit false
+
+# Enable scroll wrapping - moving down while on the last item will wrap around to
+# the top and vice versa.
+set wrap_scroll false
+
+# Set the global_inode_type_filter to nothing. Possible options: d, f and l for
+# directories, files and symlinks respectively.
+set global_inode_type_filter
+
+# This setting allows to freeze the list of files to save I/O bandwidth. It
+# should be 'false' during start-up, but you can toggle it by pressing F.
+set freeze_files false
+
+# ===================================================================
+# == Local Options
+# ===================================================================
+# You can set local options that only affect a single directory.
+
+# Examples:
+# setlocal path=~/downloads sort mtime
+
+# ===================================================================
+# == Command Aliases in the Console
+# ===================================================================
+
+alias e edit
+alias q quit
+alias q! quit!
+alias qa quitall
+alias qa! quitall!
+alias qall quitall
+alias qall! quitall!
+alias setl setlocal
+
+alias filter scout -prts
+alias find scout -aets
+alias mark scout -mr
+alias unmark scout -Mr
+alias search scout -rs
+alias search_inc scout -rts
+alias travel scout -aefklst
+
+# ===================================================================
+# == Define keys for the browser
+# ===================================================================
+
+# Basic
+map Q quitall
+map q quit
+copymap q ZZ ZQ
+
+map R reload_cwd
+map F set freeze_files!
+map <C-r> reset
+map <C-l> redraw_window
+map <C-c> abort
+map <esc> change_mode normal
+map ~ set viewmode!
+
+map i display_file
+map ? help
+map W display_log
+map w taskview_open
+map S shell $SHELL
+
+map : console
+map ; console
+map ! console shell%space
+map @ console -p6 shell %%s
+map # console shell -p%space
+map s console shell%space
+map r chain draw_possible_programs; console open_with%%space
+map f console find%space
+map cd console cd%space
+
+map <C-p> chain console; eval fm.ui.console.history_move(-1)
+
+# Change the line mode
+map Mf linemode filename
+map Mi linemode fileinfo
+map Mm linemode mtime
+map Mp linemode permissions
+map Ms linemode sizemtime
+map Mt linemode metatitle
+
+# Tagging / Marking
+map t tag_toggle
+map ut tag_remove
+map "<any> tag_toggle tag=%any
+map <Space> mark_files toggle=True
+map v mark_files all=True toggle=True
+map uv mark_files all=True val=False
+map V toggle_visual_mode
+map uV toggle_visual_mode reverse=True
+
+# For the nostalgics: Midnight Commander bindings
+map <F1> help
+map <F2> rename_append
+map <F3> display_file
+map <F4> edit
+map <F5> copy
+map <F6> cut
+map <F7> console mkdir%space
+map <F8> console delete
+map <F10> exit
+
+# In case you work on a keyboard with dvorak layout
+map <UP> move up=1
+map <DOWN> move down=1
+map <LEFT> move left=1
+map <RIGHT> move right=1
+map <HOME> move to=0
+map <END> move to=-1
+map <PAGEDOWN> move down=1 pages=True
+map <PAGEUP> move up=1 pages=True
+map <CR> move right=1
+#map <DELETE> console delete
+map <INSERT> console touch%space
+
+# VIM-like
+copymap <UP> k
+copymap <DOWN> j
+copymap <LEFT> h
+copymap <RIGHT> l
+copymap <HOME> gg
+copymap <END> G
+copymap <PAGEDOWN> <C-F>
+copymap <PAGEUP> <C-B>
+
+map J move down=0.5 pages=True
+map K move up=0.5 pages=True
+copymap J <C-D>
+copymap K <C-U>
+
+# Jumping around
+map H history_go -1
+map L history_go 1
+map ] move_parent 1
+map [ move_parent -1
+map } traverse
+map { traverse_backwards
+map ) jump_non
+
+map gh cd ~
+map ge cd /etc
+map gu cd /usr
+map gd cd /dev
+map gl cd -r .
+map gL cd -r %f
+map go cd /opt
+map gv cd /var
+map gi eval fm.cd('/run/media/' + os.getenv('USER'))
+map gM cd /media
+map gs cd /srv
+map gp cd /tmp
+map gR eval fm.cd(ranger.RANGERDIR)
+map g/ cd /
+map g? cd /usr/share/doc/ranger
+
+# External Programs
+map E edit
+map du shell -p du --max-depth=1 -h --apparent-size
+map dU shell -p du --max-depth=1 -h --apparent-size | sort -rh
+map yp yank path
+map yd yank dir
+map yn yank name
+map y. yank name_without_extension
+
+# Filesystem Operations
+map = chmod
+
+map cw console rename%space
+map a rename_append
+map A eval fm.open_console('rename ' + fm.thisfile.relative_path.replace("%", "%%"))
+map I eval fm.open_console('rename ' + fm.thisfile.relative_path.replace("%", "%%"), position=7)
+
+map pp paste
+map po paste overwrite=True
+map pP paste append=True
+map pO paste overwrite=True append=True
+map pl paste_symlink relative=False
+map pL paste_symlink relative=True
+map phl paste_hardlink
+map pht paste_hardlinked_subtree
+
+map dd console delete
+
+map da cut mode=add
+map dr cut mode=remove
+map dt cut mode=toggle
+
+map yy copy
+map uy uncut
+map ya copy mode=add
+map yr copy mode=remove
+map yt copy mode=toggle
+
+# Temporary workarounds
+map dgg eval fm.cut(dirarg=dict(to=0), narg=quantifier)
+map dG eval fm.cut(dirarg=dict(to=-1), narg=quantifier)
+map dj eval fm.cut(dirarg=dict(down=1), narg=quantifier)
+map dk eval fm.cut(dirarg=dict(up=1), narg=quantifier)
+map ygg eval fm.copy(dirarg=dict(to=0), narg=quantifier)
+map yG eval fm.copy(dirarg=dict(to=-1), narg=quantifier)
+map yj eval fm.copy(dirarg=dict(down=1), narg=quantifier)
+map yk eval fm.copy(dirarg=dict(up=1), narg=quantifier)
+
+# Searching
+map / console search%space
+map n search_next
+map N search_next forward=False
+map ct search_next order=tag
+map cs search_next order=size
+map ci search_next order=mimetype
+map cc search_next order=ctime
+map cm search_next order=mtime
+map ca search_next order=atime
+
+# Tabs
+map <C-n> tab_new
+map <C-w> tab_close
+map <TAB> tab_move 1
+map <S-TAB> tab_move -1
+map <A-Right> tab_move 1
+map <A-Left> tab_move -1
+map gt tab_move 1
+map gT tab_move -1
+map gn tab_new
+map gc tab_close
+map uq tab_restore
+map <a-1> tab_open 1
+map <a-2> tab_open 2
+map <a-3> tab_open 3
+map <a-4> tab_open 4
+map <a-5> tab_open 5
+map <a-6> tab_open 6
+map <a-7> tab_open 7
+map <a-8> tab_open 8
+map <a-9> tab_open 9
+map <a-r> tab_shift 1
+map <a-l> tab_shift -1
+
+# Sorting
+map or set sort_reverse!
+map oz set sort=random
+map os chain set sort=size; set sort_reverse=False
+map ob chain set sort=basename; set sort_reverse=False
+map on chain set sort=natural; set sort_reverse=False
+map om chain set sort=mtime; set sort_reverse=False
+map oc chain set sort=ctime; set sort_reverse=False
+map oa chain set sort=atime; set sort_reverse=False
+map ot chain set sort=type; set sort_reverse=False
+map oe chain set sort=extension; set sort_reverse=False
+
+map oS chain set sort=size; set sort_reverse=True
+map oB chain set sort=basename; set sort_reverse=True
+map oN chain set sort=natural; set sort_reverse=True
+map oM chain set sort=mtime; set sort_reverse=True
+map oC chain set sort=ctime; set sort_reverse=True
+map oA chain set sort=atime; set sort_reverse=True
+map oT chain set sort=type; set sort_reverse=True
+map oE chain set sort=extension; set sort_reverse=True
+
+map dc get_cumulative_size
+
+# Settings
+map zc set collapse_preview!
+map zd set sort_directories_first!
+map zh set show_hidden!
+map <C-h> set show_hidden!
+copymap <C-h> <backspace>
+copymap <backspace> <backspace2>
+map zI set flushinput!
+map zi set preview_images!
+map zm set mouse_enabled!
+map zp set preview_files!
+map zP set preview_directories!
+map zs set sort_case_insensitive!
+map zu set autoupdate_cumulative_size!
+map zv set use_preview_script!
+map zf console filter%space
+copymap zf zz
+
+# Filter stack
+map .n console filter_stack add name%space
+map .m console filter_stack add mime%space
+map .d filter_stack add type d
+map .f filter_stack add type f
+map .l filter_stack add type l
+map .| filter_stack add or
+map .& filter_stack add and
+map .! filter_stack add not
+map .r console filter_stack rotate
+map .c filter_stack clear
+map .* filter_stack decompose
+map .p filter_stack pop
+map .. filter_stack show
+
+# Bookmarks
+map `<any> enter_bookmark %any
+map '<any> enter_bookmark %any
+map m<any> set_bookmark %any
+map um<any> unset_bookmark %any
+
+map m<bg> draw_bookmarks
+copymap m<bg> um<bg> `<bg> '<bg>
+
+# Generate all the chmod bindings with some python help:
+eval for arg in "rwxXst": cmd("map +u{0} shell -f chmod u+{0} %s".format(arg))
+eval for arg in "rwxXst": cmd("map +g{0} shell -f chmod g+{0} %s".format(arg))
+eval for arg in "rwxXst": cmd("map +o{0} shell -f chmod o+{0} %s".format(arg))
+eval for arg in "rwxXst": cmd("map +a{0} shell -f chmod a+{0} %s".format(arg))
+eval for arg in "rwxXst": cmd("map +{0} shell -f chmod u+{0} %s".format(arg))
+
+eval for arg in "rwxXst": cmd("map -u{0} shell -f chmod u-{0} %s".format(arg))
+eval for arg in "rwxXst": cmd("map -g{0} shell -f chmod g-{0} %s".format(arg))
+eval for arg in "rwxXst": cmd("map -o{0} shell -f chmod o-{0} %s".format(arg))
+eval for arg in "rwxXst": cmd("map -a{0} shell -f chmod a-{0} %s".format(arg))
+eval for arg in "rwxXst": cmd("map -{0} shell -f chmod u-{0} %s".format(arg))
+
+# ===================================================================
+# == Define keys for the console
+# ===================================================================
+# Note: Unmapped keys are passed directly to the console.
+
+# Basic
+cmap <tab> eval fm.ui.console.tab()
+cmap <s-tab> eval fm.ui.console.tab(-1)
+cmap <ESC> eval fm.ui.console.close()
+cmap <CR> eval fm.ui.console.execute()
+cmap <C-l> redraw_window
+
+copycmap <ESC> <C-c>
+copycmap <CR> <C-j>
+
+# Move around
+cmap <up> eval fm.ui.console.history_move(-1)
+cmap <down> eval fm.ui.console.history_move(1)
+cmap <left> eval fm.ui.console.move(left=1)
+cmap <right> eval fm.ui.console.move(right=1)
+cmap <home> eval fm.ui.console.move(right=0, absolute=True)
+cmap <end> eval fm.ui.console.move(right=-1, absolute=True)
+cmap <a-b> eval fm.ui.console.move_word(left=1)
+cmap <a-f> eval fm.ui.console.move_word(right=1)
+
+copycmap <a-b> <a-left>
+copycmap <a-f> <a-right>
+
+# Line Editing
+cmap <backspace> eval fm.ui.console.delete(-1)
+cmap <delete> eval fm.ui.console.delete(0)
+cmap <C-w> eval fm.ui.console.delete_word()
+cmap <A-d> eval fm.ui.console.delete_word(backward=False)
+cmap <C-k> eval fm.ui.console.delete_rest(1)
+cmap <C-u> eval fm.ui.console.delete_rest(-1)
+cmap <C-y> eval fm.ui.console.paste()
+
+# And of course the emacs way
+copycmap <ESC> <C-g>
+copycmap <up> <C-p>
+copycmap <down> <C-n>
+copycmap <left> <C-b>
+copycmap <right> <C-f>
+copycmap <home> <C-a>
+copycmap <end> <C-e>
+copycmap <delete> <C-d>
+copycmap <backspace> <C-h>
+
+# Note: There are multiple ways to express backspaces. <backspace> (code 263)
+# and <backspace2> (code 127). To be sure, use both.
+copycmap <backspace> <backspace2>
+
+# This special expression allows typing in numerals:
+cmap <allow_quantifiers> false
+
+# ===================================================================
+# == Pager Keybindings
+# ===================================================================
+
+# Movement
+pmap <down> pager_move down=1
+pmap <up> pager_move up=1
+pmap <left> pager_move left=4
+pmap <right> pager_move right=4
+pmap <home> pager_move to=0
+pmap <end> pager_move to=-1
+pmap <pagedown> pager_move down=1.0 pages=True
+pmap <pageup> pager_move up=1.0 pages=True
+pmap <C-d> pager_move down=0.5 pages=True
+pmap <C-u> pager_move up=0.5 pages=True
+
+copypmap <UP> k <C-p>
+copypmap <DOWN> j <C-n> <CR>
+copypmap <LEFT> h
+copypmap <RIGHT> l
+copypmap <HOME> g
+copypmap <END> G
+copypmap <C-d> d
+copypmap <C-u> u
+copypmap <PAGEDOWN> n f <C-F> <Space>
+copypmap <PAGEUP> p b <C-B>
+
+# Basic
+pmap <C-l> redraw_window
+pmap <ESC> pager_close
+copypmap <ESC> q Q i <F3>
+pmap E edit_file
+
+# ===================================================================
+# == Taskview Keybindings
+# ===================================================================
+
+# Movement
+tmap <up> taskview_move up=1
+tmap <down> taskview_move down=1
+tmap <home> taskview_move to=0
+tmap <end> taskview_move to=-1
+tmap <pagedown> taskview_move down=1.0 pages=True
+tmap <pageup> taskview_move up=1.0 pages=True
+tmap <C-d> taskview_move down=0.5 pages=True
+tmap <C-u> taskview_move up=0.5 pages=True
+
+copytmap <UP> k <C-p>
+copytmap <DOWN> j <C-n> <CR>
+copytmap <HOME> g
+copytmap <END> G
+copytmap <C-u> u
+copytmap <PAGEDOWN> n f <C-F> <Space>
+copytmap <PAGEUP> p b <C-B>
+
+# Changing priority and deleting tasks
+tmap J eval -q fm.ui.taskview.task_move(-1)
+tmap K eval -q fm.ui.taskview.task_move(0)
+# tmap dd eval -q fm.ui.taskview.task_remove()
+tmap <pagedown> eval -q fm.ui.taskview.task_move(-1)
+tmap <pageup> eval -q fm.ui.taskview.task_move(0)
+tmap <delete> eval -q fm.ui.taskview.task_remove()
+
+# Basic
+tmap <C-l> redraw_window
+tmap <ESC> taskview_close
+copytmap <ESC> q Q w <C-c>
+
+######### cjennings
+
+## image transformation
+map r9 shell convert %s -rotate 90 %s
+
+
+## navigation and file management
+map gslr cd /media/remote0/3
+map mslr shell mv /media/remote0/3
+map cslr shell cp /media/remote0/3
+
+### MAIN DIRECTORIES
+map mdx shell mv %s ~/documents
+map cdx shell cp %s ~/documents
+map gdx cd ~/documents
+
+map gdr cd ~/documents/reference
+map mdr shell mv %s ~/documents/reference
+map cdr shell cp %s ~/documents/reference
+
+map mdl shell mv %d ~/downloads
+map cdl shell cp %d ~/downloads
+map gdl cd ~/downloads
+
+map mpx shell mv %s ~/pictures
+map cpx shell cp %s ~/pictures
+map gpx cd ~/pictures
+
+map gps cd ~/pictures/screenshots
+map mps shell mv %s ~/pictures/screenshots
+map cps shell cp %s ~/pictures/screenshots
+
+map gpw cd ~/pictures/wallpaper
+map mpw shell mv %s ~/pictures/wallpaper
+map cpw shell cp %s ~/pictures/wallpaper
+
+map gmx cd ~/music
+
+map gvx cd ~/videos
+map cvx shell cp %s ~/videos
+map mvx shell mv %s ~/videos
+
+## CONFIG
+map grc cd ~/.config/ranger
+map crc shell cp %s ~/.config/ranger
+map mrc shell mv %s ~/.config/ranger
+
+### OPEN WITH
+# open with alternate video player
+map owm shell mpv %s
+
+# open with gimp
+map owg shell gimp %s
+
+# open with zathura
+map owz shell zathura %s
+
+### MISC ACTIONS
+# set background wallpaper using nitrogen
+map bg shell nitrogen --save --set-zoom-fill %s >> /dev/null 2>&1 && notify-send "ranger" "wallpaper updated"
+
+# delete
+map dx shell rm -f %s
+
+# remap cut/uncut
+map xx cut
+map ux uncut
diff --git a/dotfiles/system/.config/ranger/rifle.conf b/dotfiles/system/.config/ranger/rifle.conf
new file mode 100644
index 0000000..f18ace8
--- /dev/null
+++ b/dotfiles/system/.config/ranger/rifle.conf
@@ -0,0 +1,257 @@
+# vim: ft=cfg
+#
+# This is the configuration file of "rifle", ranger's file executor/opener.
+# Each line consists of conditions and a command. For each line the conditions
+# are checked and if they are met, the respective command is run.
+#
+# Syntax:
+# <condition1> , <condition2> , ... = command
+#
+# The command can contain these environment variables:
+# $1-$9 | The n-th selected file
+# $@ | All selected files
+#
+# If you use the special command "ask", rifle will ask you what program to run.
+#
+# Prefixing a condition with "!" will negate its result.
+# These conditions are currently supported:
+# match <regexp> | The regexp matches $1
+# ext <regexp> | The regexp matches the extension of $1
+# mime <regexp> | The regexp matches the mime type of $1
+# name <regexp> | The regexp matches the basename of $1
+# path <regexp> | The regexp matches the absolute path of $1
+# has <program> | The program is installed (i.e. located in $PATH)
+# env <variable> | The environment variable "variable" is non-empty
+# file | $1 is a file
+# directory | $1 is a directory
+# number <n> | change the number of this command to n
+# terminal | stdin, stderr and stdout are connected to a terminal
+# X | $DISPLAY is not empty (i.e. Xorg runs)
+#
+# There are also pseudo-conditions which have a "side effect":
+# flag <flags> | Change how the program is run. See below.
+# label <label> | Assign a label or name to the command so it can
+# | be started with :open_with <label> in ranger
+# | or `rifle -p <label>` in the standalone executable.
+# else | Always true.
+#
+# Flags are single characters which slightly transform the command:
+# f | Fork the program, make it run in the background.
+# | New command = setsid $command >& /dev/null &
+# r | Execute the command with root permissions
+# | New command = sudo $command
+# t | Run the program in a new terminal. If $TERMCMD is not defined,
+# | rifle will attempt to extract it from $TERM.
+# | New command = $TERMCMD -e $command
+# Note: The "New command" serves only as an illustration, the exact
+# implementation may differ.
+# Note: When using rifle in ranger, there is an additional flag "c" for
+# only running the current file even if you have marked multiple files.
+
+#-------------------------------------------
+# Websites
+#-------------------------------------------
+# Rarely installed browsers get higher priority; It is assumed that if you
+# install a rare browser, you probably use it. Firefox/konqueror/w3m on the
+# other hand are often only installed as fallback browsers.
+ext x?html?, has surf, X, flag f = surf -- file://"$1"
+ext x?html?, has vimprobable, X, flag f = vimprobable -- "$@"
+ext x?html?, has vimprobable2, X, flag f = vimprobable2 -- "$@"
+ext x?html?, has qutebrowser, X, flag f = qutebrowser -- "$@"
+ext x?html?, has dwb, X, flag f = dwb -- "$@"
+ext x?html?, has jumanji, X, flag f = jumanji -- "$@"
+ext x?html?, has luakit, X, flag f = luakit -- "$@"
+ext x?html?, has uzbl, X, flag f = uzbl -- "$@"
+ext x?html?, has uzbl-tabbed, X, flag f = uzbl-tabbed -- "$@"
+ext x?html?, has uzbl-browser, X, flag f = uzbl-browser -- "$@"
+ext x?html?, has uzbl-core, X, flag f = uzbl-core -- "$@"
+ext x?html?, has midori, X, flag f = midori -- "$@"
+ext x?html?, has chromium-browser, X, flag f = chromium-browser -- "$@"
+ext x?html?, has chromium, X, flag f = chromium -- "$@"
+ext x?html?, has google-chrome, X, flag f = google-chrome -- "$@"
+ext x?html?, has opera, X, flag f = opera -- "$@"
+ext x?html?, has firefox, X, flag f = firefox -- "$@"
+ext x?html?, has seamonkey, X, flag f = seamonkey -- "$@"
+ext x?html?, has iceweasel, X, flag f = iceweasel -- "$@"
+ext x?html?, has epiphany, X, flag f = epiphany -- "$@"
+ext x?html?, has konqueror, X, flag f = konqueror -- "$@"
+ext x?html?, has elinks, terminal = elinks "$@"
+ext x?html?, has links2, terminal = links2 "$@"
+ext x?html?, has links, terminal = links "$@"
+ext x?html?, has lynx, terminal = lynx -- "$@"
+ext x?html?, has w3m, terminal = w3m "$@"
+
+#-------------------------------------------
+# Misc
+#-------------------------------------------
+# Define the "editor" for text files as first action
+mime ^text, label editor = ${VISUAL:-$EDITOR} -- "$@"
+mime ^text, label pager = "$PAGER" -- "$@"
+!mime ^text, label editor, ext xml|json|csv|tex|py|pl|rb|js|sh|php = ${VISUAL:-$EDITOR} -- "$@"
+!mime ^text, label pager, ext xml|json|csv|tex|py|pl|rb|js|sh|php = "$PAGER" -- "$@"
+
+ext 1 = man "$1"
+ext s[wmf]c, has zsnes, X = zsnes "$1"
+ext s[wmf]c, has snes9x-gtk,X = snes9x-gtk "$1"
+ext nes, has fceux, X = fceux "$1"
+ext exe = wine "$1"
+name ^[mM]akefile$ = make
+
+#--------------------------------------------
+# Code
+#-------------------------------------------
+ext py = python3 -- "$1"
+ext pl = perl -- "$1"
+ext rb = ruby -- "$1"
+ext js = node -- "$1"
+ext sh = sh -- "$1"
+ext php = php -- "$1"
+
+#--------------------------------------------
+# Audio without X
+#-------------------------------------------
+mime ^audio|ogg$, terminal, has mpv = mpv -- "$@"
+mime ^audio|ogg$, terminal, has mplayer2 = mplayer2 -- "$@"
+mime ^audio|ogg$, terminal, has mplayer = mplayer -- "$@"
+ext midi?, terminal, has wildmidi = wildmidi -- "$@"
+
+#--------------------------------------------
+# Video/Audio with a GUI
+#-------------------------------------------
+mime ^video|audio, has vlc, X, flag f = vlc -- "$@"
+mime ^video, has mpv, X, flag f = mpv -- "$@"
+mime ^video, has mpv, X, flag f = mpv --fs -- "$@"
+mime ^video|audio, has gmplayer, X, flag f = gmplayer -- "$@"
+mime ^video|audio, has smplayer, X, flag f = smplayer "$@"
+mime ^video, has mplayer2, X, flag f = mplayer2 -- "$@"
+mime ^video, has mplayer2, X, flag f = mplayer2 -fs -- "$@"
+mime ^video, has mplayer, X, flag f = mplayer -- "$@"
+mime ^video, has mplayer, X, flag f = mplayer -fs -- "$@"
+mime ^video|audio, has totem, X, flag f = totem -- "$@"
+mime ^video|audio, has totem, X, flag f = totem --fullscreen -- "$@"
+
+#--------------------------------------------
+# Video without X:
+#-------------------------------------------
+mime ^video, terminal, !X, has mpv = mpv -- "$@"
+mime ^video, terminal, !X, has mplayer2 = mplayer2 -- "$@"
+mime ^video, terminal, !X, has mplayer = mplayer -- "$@"
+
+#-------------------------------------------
+# Documents
+#-------------------------------------------
+ext pdf, has llpp, X, flag f = llpp "$@"
+ext pdf, has zathura, X, flag f = zathura -- "$@"
+ext pdf, has mupdf, X, flag f = mupdf "$@"
+ext pdf, has mupdf-x11,X, flag f = mupdf-x11 "$@"
+ext pdf, has apvlv, X, flag f = apvlv -- "$@"
+ext pdf, has xpdf, X, flag f = xpdf -- "$@"
+ext pdf, has evince, X, flag f = evince -- "$@"
+ext pdf, has atril, X, flag f = atril -- "$@"
+ext pdf, has okular, X, flag f = okular -- "$@"
+ext pdf, has epdfview, X, flag f = epdfview -- "$@"
+ext pdf, has qpdfview, X, flag f = qpdfview "$@"
+ext pdf, has open, X, flag f = open "$@"
+
+ext docx?, has catdoc, terminal = catdoc -- "$@" | "$PAGER"
+
+ext sxc|xlsx?|xlt|xlw|gnm|gnumeric, has gnumeric, X, flag f = gnumeric -- "$@"
+ext sxc|xlsx?|xlt|xlw|gnm|gnumeric, has kspread, X, flag f = kspread -- "$@"
+ext pptx?|od[dfgpst]|docx?|sxc|xlsx?|xlt|xlw|gnm|gnumeric, has libreoffice, X, flag f = libreoffice "$@"
+ext pptx?|od[dfgpst]|docx?|sxc|xlsx?|xlt|xlw|gnm|gnumeric, has soffice, X, flag f = soffice "$@"
+ext pptx?|od[dfgpst]|docx?|sxc|xlsx?|xlt|xlw|gnm|gnumeric, has ooffice, X, flag f = ooffice "$@"
+
+ext djvu, has zathura,X, flag f = zathura -- "$@"
+ext djvu, has evince, X, flag f = evince -- "$@"
+ext djvu, has atril, X, flag f = atril -- "$@"
+ext djvu, has djview, X, flag f = djview -- "$@"
+
+ext epub, has zathura, X, flag f = zathura -- "$@"
+ext mobi, has ebook-viewer, X, flag f = ebook-viewer -- "$@"
+
+#-------------------------------------------
+# Image Viewing:
+#-------------------------------------------
+mime ^image/svg, has inkscape, X, flag f = inkscape -- "$@"
+mime ^image/svg, has display, X, flag f = display -- "$@"
+
+mime ^image, has pqiv, X, flag f = pqiv -- "$@"
+mime ^image, has nsxiv, X, flag f = nsxiv -- "$@"
+mime ^image, has sxiv, X, flag f = sxiv -- "$@"
+mime ^image, has feh, X, flag f = feh -- "$@"
+mime ^image, has mirage, X, flag f = mirage -- "$@"
+mime ^image, has ristretto, X, flag f = ristretto "$@"
+mime ^image, has eog, X, flag f = eog -- "$@"
+mime ^image, has eom, X, flag f = eom -- "$@"
+mime ^image, has nomacs, X, flag f = nomacs -- "$@"
+mime ^image, has geeqie, X, flag f = geeqie -- "$@"
+mime ^image, has gwenview, X, flag f = gwenview -- "$@"
+mime ^image, has gimp, X, flag f = gimp -- "$@"
+ext xcf, X, flag f = gimp -- "$@"
+
+#-------------------------------------------
+# Archives
+#-------------------------------------------
+
+# avoid password prompt by providing empty password
+ext 7z, has 7z = 7z -p l "$@" | "$PAGER"
+# This requires atool
+ext ace|ar|arc|bz2?|cab|cpio|cpt|deb|dgc|dmg|gz, has atool = atool --list --each -- "$@" | "$PAGER"
+ext iso|jar|msi|pkg|rar|shar|tar|tgz|xar|xpi|xz|zip, has atool = atool --list --each -- "$@" | "$PAGER"
+ext 7z|ace|ar|arc|bz2?|cab|cpio|cpt|deb|dgc|dmg|gz, has atool = atool --extract --each -- "$@"
+ext iso|jar|msi|pkg|rar|shar|tar|tgz|xar|xpi|xz|zip, has atool = atool --extract --each -- "$@"
+
+# Listing and extracting archives without atool:
+ext tar|gz|bz2|xz, has tar = tar vvtf "$1" | "$PAGER"
+ext tar|gz|bz2|xz, has tar = for file in "$@"; do tar vvxf "$file"; done
+ext bz2, has bzip2 = for file in "$@"; do bzip2 -dk "$file"; done
+ext zip, has unzip = unzip -l "$1" | "$PAGER"
+ext zip, has unzip = for file in "$@"; do unzip -d "${file%.*}" "$file"; done
+ext ace, has unace = unace l "$1" | "$PAGER"
+ext ace, has unace = for file in "$@"; do unace e "$file"; done
+ext rar, has unrar = unrar l "$1" | "$PAGER"
+ext rar, has unrar = for file in "$@"; do unrar x "$file"; done
+
+#-------------------------------------------
+# Flag t fallback terminals
+#-------------------------------------------
+# Rarely installed terminal emulators get higher priority; It is assumed that
+# if you install a rare terminal emulator, you probably use it.
+# gnome-terminal/konsole/xterm on the other hand are often installed as part of
+# a desktop environment or as fallback terminal emulators.
+mime ^ranger/x-terminal-emulator, has terminator = terminator -x "$@"
+mime ^ranger/x-terminal-emulator, has st = st -e "$@"
+mime ^ranger/x-terminal-emulator, has terminology = terminology -e "$@"
+mime ^ranger/x-terminal-emulator, has kitty = kitty -- "$@"
+mime ^ranger/x-terminal-emulator, has alacritty = alacritty -e "$@"
+mime ^ranger/x-terminal-emulator, has sakura = sakura -e "$@"
+mime ^ranger/x-terminal-emulator, has lilyterm = lilyterm -e "$@"
+#mime ^ranger/x-terminal-emulator, has cool-retro-term = cool-retro-term -e "$@"
+mime ^ranger/x-terminal-emulator, has termite = termite -x '"$@"'
+#mime ^ranger/x-terminal-emulator, has yakuake = yakuake -e "$@"
+mime ^ranger/x-terminal-emulator, has guake = guake -ne "$@"
+mime ^ranger/x-terminal-emulator, has tilda = tilda -c "$@"
+mime ^ranger/x-terminal-emulator, has urxvt = urxvt -e "$@"
+mime ^ranger/x-terminal-emulator, has pantheon-terminal = pantheon-terminal -e "$@"
+mime ^ranger/x-terminal-emulator, has lxterminal = lxterminal -e "$@"
+mime ^ranger/x-terminal-emulator, has mate-terminal = mate-terminal -x "$@"
+mime ^ranger/x-terminal-emulator, has xfce4-terminal = xfce4-terminal -x "$@"
+mime ^ranger/x-terminal-emulator, has konsole = konsole -e "$@"
+mime ^ranger/x-terminal-emulator, has gnome-terminal = gnome-terminal -- "$@"
+mime ^ranger/x-terminal-emulator, has xterm = xterm -e "$@"
+
+#-------------------------------------------
+# Misc
+#-------------------------------------------
+label wallpaper, number 11, mime ^image, has feh, X = feh --bg-scale "$1"
+label wallpaper, number 12, mime ^image, has feh, X = feh --bg-tile "$1"
+label wallpaper, number 13, mime ^image, has feh, X = feh --bg-center "$1"
+label wallpaper, number 14, mime ^image, has feh, X = feh --bg-fill "$1"
+
+# Define the editor for non-text files + pager as last action
+ !mime ^text, !ext xml|json|csv|tex|py|pl|rb|js|sh|php = ask
+label editor, !mime ^text, !ext xml|json|csv|tex|py|pl|rb|js|sh|php = ${VISUAL:-$EDITOR} -- "$@"
+label pager, !mime ^text, !ext xml|json|csv|tex|py|pl|rb|js|sh|php = "$PAGER" -- "$@"
+
+# The very last action, so that it's never triggered accidentally, is to execute a program:
+mime application/x-executable = "$1"
diff --git a/dotfiles/system/.config/ranger/scope.sh b/dotfiles/system/.config/ranger/scope.sh
new file mode 100755
index 0000000..13a25b4
--- /dev/null
+++ b/dotfiles/system/.config/ranger/scope.sh
@@ -0,0 +1,216 @@
+#!/usr/bin/env bash
+
+set -o noclobber -o noglob -o nounset -o pipefail
+IFS=$'\n'
+
+# If the option `use_preview_script` is set to `true`,
+# then this script will be called and its output will be displayed in ranger.
+# ANSI color codes are supported.
+# STDIN is disabled, so interactive scripts won't work properly
+
+# This script is considered a configuration file and must be updated manually.
+# It will be left untouched if you upgrade ranger.
+
+# Meanings of exit codes:
+# code | meaning | action of ranger
+# -----+------------+-------------------------------------------
+# 0 | success | Display stdout as preview
+# 1 | no preview | Display no preview at all
+# 2 | plain text | Display the plain content of the file
+# 3 | fix width | Don't reload when width changes
+# 4 | fix height | Don't reload when height changes
+# 5 | fix both | Don't ever reload
+# 6 | image | Display the image `$IMAGE_CACHE_PATH` points to as an image preview
+# 7 | image | Display the file directly as an image
+
+# Script arguments
+FILE_PATH="${1}" # Full path of the highlighted file
+PV_WIDTH="${2}" # Width of the preview pane (number of fitting characters)
+PV_HEIGHT="${3}" # Height of the preview pane (number of fitting characters)
+IMAGE_CACHE_PATH="${4}" # Full path that should be used to cache image preview
+PV_IMAGE_ENABLED="${5}" # 'True' if image previews are enabled, 'False' otherwise.
+
+FILE_EXTENSION="${FILE_PATH##*.}"
+FILE_EXTENSION_LOWER=$(echo ${FILE_EXTENSION} | tr '[:upper:]' '[:lower:]')
+
+# Settings
+HIGHLIGHT_SIZE_MAX=262143 # 256KiB
+HIGHLIGHT_TABWIDTH=8
+HIGHLIGHT_STYLE='pablo'
+PYGMENTIZE_STYLE='autumn'
+
+
+handle_extension() {
+ case "${FILE_EXTENSION_LOWER}" in
+ # Archive
+ a|ace|alz|arc|arj|bz|bz2|cab|cpio|deb|gz|jar|lha|lz|lzh|lzma|lzo|\
+ rpm|rz|t7z|tar|tbz|tbz2|tgz|tlz|txz|tZ|tzo|war|xpi|xz|Z|zip)
+ atool --list -- "${FILE_PATH}" && exit 5
+ bsdtar --list --file "${FILE_PATH}" && exit 5
+ exit 1;;
+ rar)
+ # Avoid password prompt by providing empty password
+ unrar lt -p- -- "${FILE_PATH}" && exit 5
+ exit 1;;
+ 7z)
+ # Avoid password prompt by providing empty password
+ 7z l -p -- "${FILE_PATH}" && exit 5
+ exit 1;;
+
+ # PDF
+ pdf)
+ # Preview as text conversion
+ pdftotext -l 10 -nopgbrk -q -- "${FILE_PATH}" - | fmt -w ${PV_WIDTH} && exit 5
+ mutool draw -F txt -i -- "${FILE_PATH}" 1-10 | fmt -w ${PV_WIDTH} && exit 5
+ exiftool "${FILE_PATH}" && exit 5
+ exit 1;;
+
+ # BitTorrent
+ torrent)
+ transmission-show -- "${FILE_PATH}" && exit 5
+ exit 1;;
+
+ # OpenDocument
+ odt|ods|odp|sxw)
+ # Preview as text conversion
+ odt2txt "${FILE_PATH}" && exit 5
+ exit 1;;
+
+ # HTML
+ htm|html|xhtml)
+ # Preview as text conversion
+ w3m -dump "${FILE_PATH}" && exit 5
+ lynx -dump -- "${FILE_PATH}" && exit 5
+ elinks -dump "${FILE_PATH}" && exit 5
+ ;; # Continue with next handler on failure
+ esac
+}
+
+handle_image() {
+ local mimetype="${1}"
+ case "${mimetype}" in
+ # SVG
+ # image/svg+xml)
+ # convert "${FILE_PATH}" "${IMAGE_CACHE_PATH}" && exit 6
+ # exit 1;;
+
+ # Image
+ image/*)
+ local orientation
+ orientation="$( identify -format '%[EXIF:Orientation]\n' -- "${FILE_PATH}" )"
+ # If orientation data is present and the image actually
+ # needs rotating ("1" means no rotation)...
+ if [[ -n "$orientation" && "$orientation" != 1 ]]; then
+ # ...auto-rotate the image according to the EXIF data.
+ convert -- "${FILE_PATH}" -auto-orient "${IMAGE_CACHE_PATH}" && exit 6
+ fi
+
+ # `w3mimgdisplay` will be called for all images (unless overriden as above),
+ # but might fail for unsupported types.
+ exit 7;;
+
+ # Video
+ # video/*)
+ # # Thumbnail
+ # ffmpegthumbnailer -i "${FILE_PATH}" -o "${IMAGE_CACHE_PATH}" -s 0 && exit 6
+ # exit 1;;
+ # PDF
+ # application/pdf)
+ # pdftoppm -f 1 -l 1 \
+ # -scale-to-x 1920 \
+ # -scale-to-y -1 \
+ # -singlefile \
+ # -jpeg -tiffcompression jpeg \
+ # -- "${FILE_PATH}" "${IMAGE_CACHE_PATH%.*}" \
+ # && exit 6 || exit 1;;
+
+ # Preview archives using the first image inside.
+ # (Very useful for comic book collections for example.)
+ # application/zip|application/x-rar|application/x-7z-compressed|\
+ # application/x-xz|application/x-bzip2|application/x-gzip|application/x-tar)
+ # local fn=""; local fe=""
+ # local zip=""; local rar=""; local tar=""; local bsd=""
+ # case "${mimetype}" in
+ # application/zip) zip=1 ;;
+ # application/x-rar) rar=1 ;;
+ # application/x-7z-compressed) ;;
+ # *) tar=1 ;;
+ # esac
+ # { [ "$tar" ] && fn=$(tar --list --file "${FILE_PATH}"); } || \
+ # { fn=$(bsdtar --list --file "${FILE_PATH}") && bsd=1 && tar=""; } || \
+ # { [ "$rar" ] && fn=$(unrar lb -p- -- "${FILE_PATH}"); } || \
+ # { [ "$zip" ] && fn=$(zipinfo -1 -- "${FILE_PATH}"); } || return
+ #
+ # fn=$(echo "$fn" | python -c "import sys; import mimetypes as m; \
+ # [ print(l, end='') for l in sys.stdin if \
+ # (m.guess_type(l[:-1])[0] or '').startswith('image/') ]" |\
+ # sort -V | head -n 1)
+ # [ "$fn" = "" ] && return
+ # [ "$bsd" ] && fn=$(printf '%b' "$fn")
+ #
+ # [ "$tar" ] && tar --extract --to-stdout \
+ # --file "${FILE_PATH}" -- "$fn" > "${IMAGE_CACHE_PATH}" && exit 6
+ # fe=$(echo -n "$fn" | sed 's/[][*?\]/\\\0/g')
+ # [ "$bsd" ] && bsdtar --extract --to-stdout \
+ # --file "${FILE_PATH}" -- "$fe" > "${IMAGE_CACHE_PATH}" && exit 6
+ # [ "$bsd" ] || [ "$tar" ] && rm -- "${IMAGE_CACHE_PATH}"
+ # [ "$rar" ] && unrar p -p- -inul -- "${FILE_PATH}" "$fn" > \
+ # "${IMAGE_CACHE_PATH}" && exit 6
+ # [ "$zip" ] && unzip -pP "" -- "${FILE_PATH}" "$fe" > \
+ # "${IMAGE_CACHE_PATH}" && exit 6
+ # [ "$rar" ] || [ "$zip" ] && rm -- "${IMAGE_CACHE_PATH}"
+ # ;;
+ esac
+}
+
+handle_mime() {
+ local mimetype="${1}"
+ case "${mimetype}" in
+ # Text
+ text/* | */xml)
+ # Syntax highlight
+ if [[ "$( stat --printf='%s' -- "${FILE_PATH}" )" -gt "${HIGHLIGHT_SIZE_MAX}" ]]; then
+ exit 2
+ fi
+ if [[ "$( tput colors )" -ge 256 ]]; then
+ local pygmentize_format='terminal256'
+ local highlight_format='xterm256'
+ else
+ local pygmentize_format='terminal'
+ local highlight_format='ansi'
+ fi
+ highlight --replace-tabs="${HIGHLIGHT_TABWIDTH}" --out-format="${highlight_format}" \
+ --style="${HIGHLIGHT_STYLE}" --force -- "${FILE_PATH}" && exit 5
+ # pygmentize -f "${pygmentize_format}" -O "style=${PYGMENTIZE_STYLE}" -- "${FILE_PATH}" && exit 5
+ exit 2;;
+
+ # Image
+ image/*)
+ # Preview as text conversion
+ # img2txt --gamma=0.6 --width="${PV_WIDTH}" -- "${FILE_PATH}" && exit 4
+ exiftool "${FILE_PATH}" && exit 5
+ exit 1;;
+
+ # Video and audio
+ video/* | audio/*)
+ mediainfo "${FILE_PATH}" && exit 5
+ exiftool "${FILE_PATH}" && exit 5
+ exit 1;;
+ esac
+}
+
+handle_fallback() {
+ echo '----- File Type Classification -----' && file --dereference --brief -- "${FILE_PATH}" && exit 5
+ exit 1
+}
+
+
+MIMETYPE="$( file --dereference --brief --mime-type -- "${FILE_PATH}" )"
+if [[ "${PV_IMAGE_ENABLED}" == 'True' ]]; then
+ handle_image "${MIMETYPE}"
+fi
+handle_extension
+handle_mime "${MIMETYPE}"
+handle_fallback
+
+exit 1
diff --git a/dotfiles/system/.config/sway/config.d/termdrop.conf b/dotfiles/system/.config/sway/config.d/termdrop.conf
new file mode 120000
index 0000000..a19fe76
--- /dev/null
+++ b/dotfiles/system/.config/sway/config.d/termdrop.conf
@@ -0,0 +1 @@
+../../../code/bsdsetup/dotfiles/system/.config/sway/config.d/termdrop.conf \ No newline at end of file
diff --git a/dotfiles/system/.config/youtube-dl/youtube-dl.conf b/dotfiles/system/.config/youtube-dl/youtube-dl.conf
new file mode 100644
index 0000000..e8fc22a
--- /dev/null
+++ b/dotfiles/system/.config/youtube-dl/youtube-dl.conf
@@ -0,0 +1,11 @@
+# self explanatory
+--add-metadata
+--format best
+--no-overwrites
+--ignore-errors
+
+# insert a value between 0 (better) and 9 (worse) for VBR or a specific bitrate like 128K (default 5)
+--audio-quality 0
+
+# save all videos under videos directory with channel, title, and extension
+-o ~/videos/%(channel)s-%(title)s.%(ext)s
diff --git a/dotfiles/system/.config/zathura/zathurarc b/dotfiles/system/.config/zathura/zathurarc
new file mode 100644
index 0000000..7f61084
--- /dev/null
+++ b/dotfiles/system/.config/zathura/zathurarc
@@ -0,0 +1,8 @@
+set selection-clipboard clipboard
+set recolor true
+map [normal] F2 bmark current
+map [normal] F2 blist
+map [fullscreen] F2 bmark current
+map [fullscreen] F3 blist
+map [normal] = zoom in
+map [fullscreen] = zoom in \ No newline at end of file
diff --git a/dotfiles/system/.gitconfig b/dotfiles/system/.gitconfig
new file mode 100644
index 0000000..d9b1efd
--- /dev/null
+++ b/dotfiles/system/.gitconfig
@@ -0,0 +1,17 @@
+[user]
+ email = c@cjennings.net
+ name = Craig Jennings
+[init]
+ defaultBranch = main
+[pull]
+ rebase = true
+[fetch]
+ prune = true
+[merge]
+ tool = meld
+[core]
+ editor = emacs
+[safe]
+ directory = /home/cjennings/.dotfiles
+[help]
+ autocorrect = 1
diff --git a/dotfiles/system/.local/bin/ec b/dotfiles/system/.local/bin/ec
new file mode 100755
index 0000000..b409195
--- /dev/null
+++ b/dotfiles/system/.local/bin/ec
@@ -0,0 +1,2 @@
+#!/bin/sh
+emacsclient -c -a "" $1 $2 $3 $4 &
diff --git a/dotfiles/system/.local/bin/em b/dotfiles/system/.local/bin/em
new file mode 100755
index 0000000..b409195
--- /dev/null
+++ b/dotfiles/system/.local/bin/em
@@ -0,0 +1,2 @@
+#!/bin/sh
+emacsclient -c -a "" $1 $2 $3 $4 &
diff --git a/dotfiles/system/.local/bin/et b/dotfiles/system/.local/bin/et
new file mode 100755
index 0000000..1c3c4a0
--- /dev/null
+++ b/dotfiles/system/.local/bin/et
@@ -0,0 +1,2 @@
+#!/bin/sh
+emacsclient -c -nw --alternate-editor="" $1 $2 $3 $4 &
diff --git a/dotfiles/system/.local/bin/extractaudio b/dotfiles/system/.local/bin/extractaudio
new file mode 100755
index 0000000..a665451
--- /dev/null
+++ b/dotfiles/system/.local/bin/extractaudio
@@ -0,0 +1,2 @@
+#!/bin/sh
+ffmpeg -i $1 -q:a 0 -map a $1.mp3
diff --git a/dotfiles/system/.local/bin/mpd_play_yt_stream b/dotfiles/system/.local/bin/mpd_play_yt_stream
new file mode 100755
index 0000000..b53f298
--- /dev/null
+++ b/dotfiles/system/.local/bin/mpd_play_yt_stream
@@ -0,0 +1,14 @@
+#!/bin/bash
+#
+MYHOST='127.0.0.1' # or your MPD host
+
+mpduri="$(yt-dlp -f best -g $1)#"
+# mpduri="$(yt-dlp -g $1)#"
+# TAG=$(yt-dlp -i --get-filename $1)
+# cadena="{\"title\":\"$TAG\"}"
+# echo "$cadena"
+# mpduri="$mpduri$cadena"
+# echo "$mpduri"
+mpc insert "$mpduri"
+mpc next
+mpc play
diff --git a/dotfiles/system/.local/bin/opus2mp3 b/dotfiles/system/.local/bin/opus2mp3
new file mode 100755
index 0000000..eef37ed
--- /dev/null
+++ b/dotfiles/system/.local/bin/opus2mp3
@@ -0,0 +1,3 @@
+#!/bin/sh
+# Craig Jennings Monday, April 25, 2022
+for f in *.opus; do ffmpeg -i "$f" -codec:v copy -codec:a libmp3lame -q:a 2 "${f%.opus}.mp3"; done
diff --git a/dotfiles/system/.local/bin/ps-mem b/dotfiles/system/.local/bin/ps-mem
new file mode 100755
index 0000000..b24b003
--- /dev/null
+++ b/dotfiles/system/.local/bin/ps-mem
@@ -0,0 +1,28 @@
+#!/bin/bash
+# Craig Jennings <c@cjennings.net>
+# Outputs a process's memory usage in multiple size units.
+
+# Get a list of all processes
+procs=$(ps aux --sort=-%mem | awk '{print $2, $4, $11}' | fzf)
+
+# Check if a process was selected
+if [ -z "$procs" ]; then
+ echo "No process selected."
+ exit 1
+fi
+
+# Get the PID of the selected process (first field)
+PID=$(echo $procs | awk '{print $1}')
+
+# Get the process name
+PROCNAME=$(ps -p $PID -o comm=)
+
+# Get the memory usage
+KB=$(pmap -x $PID | grep total | awk '{print $4}')
+
+# Convert to MB and GB
+MB=$(echo "scale=2; $KB / 1024" | bc)
+GB=$(echo "scale=2; $MB / 1024" | bc)
+
+# Print the memory usage
+printf "$PROCNAME (pid $PID) mem usage: $KB KB | $MB MB | $GB GB\n\n"
diff --git a/dotfiles/system/.local/bin/recordnow b/dotfiles/system/.local/bin/recordnow
new file mode 100755
index 0000000..4e2d04a
--- /dev/null
+++ b/dotfiles/system/.local/bin/recordnow
@@ -0,0 +1,26 @@
+#!/usr/bin/env sh
+# Craig Jennings <c@cjennings.net>
+
+# Start a screen recording using ffmpeg to capture the entire
+# screen along with all audio and the microphone.
+
+# Make sure that ffmpeg is in the path and the destination directory
+# exists.
+
+LOCATION="$HOME/videos/recordings"
+NAME=$(date +'%Y-%m-%d-%H-%M-%S')
+echo $NAME
+
+# create the directory if it doesn't exist
+if [ ! -d "$LOCATION" ]; then
+ mkdir -p "$LOCATION"
+fi
+
+# error out if ffmpeg isn't installed
+if ! command -v ffmpeg &> /dev/null
+then
+ echo "ERROR: ffmpeg couldn't be found. Please ensure it's installed and added to your PATH."
+ exit
+fi
+
+ffmpeg -framerate 30 -f x11grab -i :0.0+ -f pulse -i alsa_input.pci-0000_00_1b.0.analog-stereo -ac 1 -f pulse -i alsa_output.pci-0000_00_1b.0.analog-stereo.monitor -ac 2 "$LOCATION/$NAME".mkv
diff --git a/dotfiles/system/.local/share/applications/org-protocol.desktop b/dotfiles/system/.local/share/applications/org-protocol.desktop
new file mode 100644
index 0000000..acdb8ad
--- /dev/null
+++ b/dotfiles/system/.local/share/applications/org-protocol.desktop
@@ -0,0 +1,11 @@
+[Desktop Entry]
+Name=org-protocol
+Comment=Intercept calls from emacsclient to trigger custom actions
+Categories=Other;
+Keywords=org-protocol;
+Icon=emacs
+Type=Application
+Exec=emacsclient -- %u
+Terminal=false
+StartupWMClass=Emacs
+MimeType=x-scheme-handler/org-protocol;
diff --git a/dotfiles/system/.local/share/thequestionconcerningtechnology.txt b/dotfiles/system/.local/share/thequestionconcerningtechnology.txt
new file mode 100644
index 0000000..3d33ac7
--- /dev/null
+++ b/dotfiles/system/.local/share/thequestionconcerningtechnology.txt
@@ -0,0 +1,180 @@
+The Question Concerning Technology
+== Martin Heidegger ==
+
+In what follows we shall be questioning concerning technology. Questioning builds a way. We would be advised, therefore, above all to pay heed to the way, and not to fix our attention on isolated sentences and topics. The way is a way of thinking. All ways of thinking, more or less perceptibly, lead through language in a manner that is extraordinary. We shall be questioning concerning technology, and in so doing we should like to prepare a free relationship to it. The relationship will be free if it opens our human existence to the essence of technology. When we can respond to this essence, we shall be able to experience the technological within its own bounds.
+
+Technology is not equivalent to the essence of technology. When we are seeking the essence of “tree,” we have to become aware that that which pervades every tree, as tree, is not itself a tree that can be encountered among all the other trees. Likewise, the essence of technology is by no means anything technological. Thus we shall never experience our relationship to the essence of technology so long as we merely conceive and push forward the technological, put up with it, or evade it. Everywhere we remain unfree and chained to technology, whether we passionately affirm or deny it. But we are delivered over to it in the worst possible way when we regard it as something neutral; for this conception of it, to which today we particularly like to do homage, makes us utterly blind to the essence of technology.
+
+According to ancient doctrine, the essence of a thing is considered to be what the thing is. We ask the question concerning technology when we ask what it is. Everyone knows the two statements that answer our question. One says: Technology is a means to an end. The other says: Technology is a human activity. The two definitions of technology belong together. For to posit ends and procure and utilize the means to them is a human activity. The manufacture and utilization of equipment, tools, and machines, the manufactured and used things themselves, and the needs and ends that they serve, all belong to what technology is. The whole complex of these contrivances is technology. Technology itself is a contrivance, or, in Latin, an instrumentum.
+
+The current conception of technology, according to which it is a means and a human activity, can therefore be called the instrumental and anthropological definition of technology. Who would ever deny that it is correct? It is in obvious conformity with what we are envisioning when we talk about technology. The instrumental definition of technology is indeed so uncannily correct that it even holds for modern technology, of which, in other respects, we maintain with some justification that it is, in contrast to the older handwork technology, something completely different and therefore new. Even the power plant with its turbines and generators is a manmade means to an end established by man. Even the jet aircraft and the high-frequency apparatus are means to ends. A radar station is of course less simple than a weather vane. To be sure, the construction of a high-frequency apparatus requires the interlocking of various processes of technical-industrial production. And certainly a sawmill in a secluded valley of the Black Forest is a primitive means compared with the hydroelectric plant in the Rhine River.
+
+But this much remains correct: modern technology too is a means to an end. That is why the instrumental conception of technology conditions every attempt to bring man into the right relation to technology. Everything depends on our manipulating technology in the proper manner as a means. We will, as we say, “get” technology “spiritually in hand.” We will master it. The will to mastery becomes all the more urgent the more technology threatens to slip from human control.
+
+But suppose now that technology were no mere means, how would it stand with the will to master it? Yet we said, did we not, that the instrumental definition of technology is correct? To be sure. The correct always fixes upon something pertinent in whatever is under consideration. However, in order to be correct, this fixing by no means needs to uncover the thing in question in its essence. Only at the point where such an uncovering happens does the true come to pass. For that reason the merely correct is not yet the true. Only the true brings us into a free relationship with that which concerns us from out of its essence. Accordingly, the correct instrumental definition of technology still does not show us technology’s essence.
+
+In order that we may arrive at this, or at least come close to it, we must seek the true by way of the correct. We must ask: What is the instrumental itself? Within what do such things as means and end belong? A means is that whereby something is effected and thus attained. Whatever has an effect as its consequence is called a cause. But not only that by means of which something else is effected is a cause. The end in keeping with which the kind of means to be used is determined is also considered a cause. Wherever ends are pursued and means are employed, wherever instrumentality reigns, there reigns causality.
+
+For centuries philosophy has taught that there are four causes: (1) the causa materialis, the material, the matter out of which, for example, a silver chalice is made; (2) the causa formalis, the form, the shape into which the material enters; (3) the causa finalis, the end, for example, the sacrificial rite in relation to which the chalice required is determined as to its form and matter; and (4) the causa efficiens, which brings about the effect that is the finished, actual chalice, in this instance, the silversmith. What technology is, when represented as a means, discloses itself when we trace instrumentality back to fourfold causality.
+
+But suppose that causality, for its part, is veiled in darkness with respect to what it is? Certainly for centuries we have acted as though the doctrine of the four causes had fallen from heaven as a truth as clear as daylight. But it might be that the time has come to ask, Why are there just four causes? In relation to the aforementioned four, what does “cause” really mean? From whence does it come that the causal character of the four causes is so unifiedly determined that they belong together?
+
+So long as we do not allow ourselves to go into these questions, causality, and with it instrumentality, and with the latter the accepted definition of technology, remain obscure and groundless.
+
+For a long time we have been accustomed to representing cause as that which brings something about. In this connection, to bring about means to obtain results, effects. The causa efficiens, but one among the four causes, sets the standard for all causality. This goes so far that we no longer even count the causa finalis, telic finality, as causality. Causa, casus, belongs to the verb cadere, “to fall,” and means that which brings it about that something falls out as a result in such and such a way. The doctrine of the four causes goes back to Aristotle. But everything that later ages seek in Greek thought under the conception and rubric “causality,” in the realm of Greek thought and for Greek thought per se has simply nothing at all to do with bringing about and effecting. What we call cause [Ursache] and the Romans call causa is called aition by the Greeks, that to which something else is indebted [das, was ein anderes verschuldet].
+
+The four causes are the ways, all belonging at once to each other, of being responsible for something else. An example can clarify this.
+
+Silver is that out of which the silver chalice is made. As this matter (hyle), it is co-responsible for the chalice. The chalice is indebted to, that is, owes thanks to, the silver for that out of which it consists. But the sacrificial vessel is indebted not only to the silver. As a chalice, that which is indebted to the silver appears in the aspect of a chalice and not in that of a brooch or a ring. Thus the sacrificial vessel is at the same time indebted to the aspect (eidos) of chaliceness. Both the silver into which the aspect is admitted as chalice and the aspect in which the silver appears are in their respective ways co-responsible for the sacrificial vessel.
+
+But there remains yet a third that is above all responsible for the sacrificial vessel. It is that which in advance confines the chalice within the realm of consecration and bestowal. Through this the chalice is circumscribed as sacrificial vessel. Circumscribing gives bounds to the thing. With the bounds the thing does not stop; rather from out of them it begins to be what, after production, it will be. That which gives bounds, that which completes, in this sense is called in Greek telos, which is all too often translated as “aim” or “purpose,” and so misinterpreted. The telos is responsible for what as matter and for what as aspect are together co-responsible for the sacrificial vessel.
+
+Finally there is a fourth participant in the responsibility for the finished sacrificial vessel’s lying before us ready for use, that is, the silversmith — but not at all because he, in working, brings about the finished sacrificial chalice as if it were the effect of a making; the silversmith is not a causa efficiens.
+
+The Aristotelian doctrine neither knows the cause that is named by this term nor uses a Greek word that would correspond to it. The silversmith considers carefully and gathers together the three aforementioned ways of being responsible and indebted. To consider carefully [überlegen] is in Greek legein, logos. Legein is rooted in apophainesthai, to bring forward into appearance. The silversmith is co-responsible as that from whence the sacrificial vessel’s bringing forth and resting-in-self take and retain their first departure. The three previously mentioned ways of being responsible owe thanks to the pondering of the silversmith for the “that” and the “how” of their coming into appearance and into play for the production of the sacrificial vessel.
+
+Thus four ways of being responsible hold sway in the sacrificial vessel that lies ready before us. They differ from one another, yet they belong together. What unites them from the beginning? In what does this playing in unison of the four ways of being responsible play? What is the source of the unity of the four causes? What, after all, does this owing and being responsible mean, thought as the Greeks thought it?
+
+Today we are too easily inclined either to understand being responsible and being indebted moralistically as a lapse, or else to construe them in terms of effecting. In either case we bar to ourselves the way to the primal meaning of that which is later called causality. So long as this way is not opened up to us we shall also fail to see what instrumentality, which is based on causality, actually is.
+
+In order to guard against such misinterpretations of being responsible and being indebted, let us clarify the four ways of being responsible in terms of that for which they are responsible. According to our example, they are responsible for the silver chalice’s lying ready before us as a sacrificial vessel. Lying before and lying ready (hypokeisthai) characterize the presencing of something that presences. The four ways of being responsible bring something into appearance. They let it come forth into presencing [An-wesen]. They set it free to that place and so start it on its way, namely, into its complete arrival. The principal characteristic of being responsible is this starting something on its way into arrival. It is in the sense of such a starting something on its way into arrival that being responsible is an occasioning or an inducing to go forward [ver-anlassen]. On the basis of a look at what the Greeks experienced in being responsible, in aitia, we now give this verb “to occasion” a more inclusive meaning, so that it now is the name for the essence of causality thought as the Greeks thought it. The common and narrower meaning of “occasion” in contrast is nothing more than striking against and releasing, and means a kind of secondary cause within the whole of causality.
+
+But in what, then, does the playing in unison of the four ways of occasioning play? They let what is not yet present arrive into presencing. Accordingly, they are unifiedly ruled over by a bringing that brings what presences into appearance. Plato tells us what this bringing is in a sentence from the Symposium (205b): hē gar toi ek tou mē onton eis to on ionti hotōioun aitia pasa esti poiēsis. “Every occasion for whatever passes over and goes forward into presencing from that which is not presencing is poiēsis, is bringing-forth [hervor-bringen].” It is of utmost importance that we think bringing-forth in its full scope and at the same time in the sense in which the Greeks thought it. Not only handcraft manufacture, not only artistic and poetical bringing into appearance and concrete imagery, is a bringing-forth, poiēsis. Physis also, the arising of something from out of itself, is a bringing-forth, poiēsis. Physis is indeed poiēsis in the highest sense. For what presences by means of physis has the bursting open belonging to bringing-forth, for example, the bursting of a blossom into bloom, in itself (en heautōi). In contrast, what is brought forth by the artisan or the artist, for example, the silver chalice, has the bursting open belonging to bringing-forth not in itself, but in another (en allōi), in the craftsman or artist.
+
+The modes of occasioning, the four causes, are at play, then, within bringing-forth. Through bringing-forth, the growing things of nature as well as whatever is completed through the crafts and the arts come at any given time to their appearance. But how does bringing-forth happen, be it in nature or in handwork and art? What is the bringing-forth in which the fourfold way of occasioning plays? Occasioning has to do with the presencing [Anwesen] of that which at any given time comes to appearance in bringing-forth. Bringing-forth brings hither out of concealment forth into unconcealment. Bringing-forth comes to pass only insofar as something concealed comes into unconcealment. This coming rests and moves freely within what we call revealing [das Entbergen]. The Greeks have the word alētheia for revealing. The Romans translate this with veritas. We say “truth” and usually understand it as the correctness of an idea.
+
+But where have we strayed to? We are questioning concerning technology, and we have arrived now at alētheia, at revealing. What has the essence of technology to do with revealing? The answer: everything. For every bringing-forth is grounded in revealing. Bringing-forth, indeed, gathers within itself the four modes of occasioning—causality—and rules them throughout. Within its domain belong end and means, belongs instrumentality.
+
+Instrumentality is considered to be the fundamental characteristic of technology. If we inquire, step by step, into what technology, represented as means, actually is, then we shall arrive at revealing. The possibility of all productive manufacturing lies in revealing. Technology is therefore no mere means. Technology is a way of revealing. If we give heed to this, then another whole realm for the essence of technology will open itself up to us. It is the realm of revealing, that is, of truth.
+
+This prospect strikes us as strange. Indeed, it should do so, should do so as persistently as possible and with so much urgency that we will finally take seriously the simple question of what the name “technology” means. The word stems from the Greek. Technikon means that which belongs to technē. We must observe two things with respect to the meaning of this word. One is that technē is the name not only for the activities and skills of the craftsman, but also for the arts of the mind and the fine arts. Technē belongs to bringingforth, to poiēsis; it is something poietic. The other point that we should observe with regard to technē is even more important. From earliest times until Plato the word technē is linked with the word epistēmē. Both words are names for knowing in the widest sense. They mean to be entirely at home in something, to understand and be expert in it. Such knowing provides an opening up. As an opening up it is a revealing. Aristotle, in a discussion of special importance (Nicomachean Ethics, Bk. VI, chaps. 3 and 4), distinguishes between epistēmē and technē and indeed with respect to what and how they reveal. Technē is a mode of alētheuein. It reveals whatever does not bring itself forth and does not yet lie here before us, whatever can look and turn out now one way and now another. Whoever builds a house or a ship or forges a sacrificial chalice reveals what is to be brought forth, according to the perspectives of the four modes of occasioning. This revealing gathers together in advance the aspect and the matter of ship or house, with a view to the finished thing envisioned as completed, and from this gathering determines the manner of its construction. Thus what is decisive in technē does not lie at all in making and manipulating nor in the using of means, but rather in the aforementioned revealing. It is as revealing, and not as manufacturing, that technē is a bringing forth. Thus the clue to what the word technē means and to how the Greeks defined it leads us into the same context that opened itself to us when we pursued the question of what instrumentality as such in truth might be.
+
+Technology is a mode of revealing. Technology comes to presence in the realm where revealing and unconcealment take place, where alētheia, truth, happens.
+
+In opposition to this definition of the essential domain of technology, one can object that it indeed holds for Greek thought and that at best it might apply to the techniques of the handcraftsman, but that it simply does not fit modern machine-powered technology. And it is precisely the latter and it alone that is the disturbing thing, that moves us to ask the question concerning technology per se. It is said that modern technology is something incomparably different from all earlier technologies because it is based on modern physics as an exact science. Meanwhile we have come to understand more clearly that the reverse holds true as well: Modern physics, as experimental, is dependent upon technical apparatus and upon progress in the building of apparatus. The establishing of this mutual relationship between technology and physics is correct. But it remains a merely historiographical establishing of facts and says nothing about that in which this mutual relationship is grounded. The decisive question still remains: Of what essence is modern technology that it happens to think of putting exact science to use? What is modern technology? It too is a revealing. Only when we allow our attention to rest on this fundamental characteristic does that which is new in modern technology show itself to us.
+
+And yet the revealing that holds sway throughout modern technology does not unfold into a bringing-forth in the sense of poiēsis. The revealing that rules in modern technology is challenging [herausfordern], which puts to nature the unreasonable demand that it supply energy that can be extracted and stored as such. But does this not hold true for the old windmill as well? No. Its sails do indeed turn in the wind; they are left entirely to the wind’s blowing. But the windmill does not unlock energy from the air currents in order to store it.
+
+In contrast, a tract of land is challenged into the putting out of coal and ore. The earth now reveals itself as a coal mining district, the soil as a mineral deposit. The field that the peasant formerly cultivated and set in order appears differently than it did when to set in order still meant to take care of and to maintain. The work of the peasant does not challenge the soil of the field. In the sowing of the grain it places the seed in the keeping of the forces of growth and watches over its increase. But meanwhile even the cultivation of the field has come under the grip of another kind of setting-in-order, which sets upon nature. It sets upon it in the sense of challenging it.
+
+Agriculture is now the mechanized food industry. Air is now set upon to yield nitrogen, the earth to yield ore, ore to yield uranium, for example; uranium is set upon to yield atomic energy, which can be released either for destruction or for peaceful use.
+
+This setting-upon that challenges forth the energies of nature is an expediting, and in two ways. It expedites in that it unlocks and exposes. Yet that expediting is always itself directed from the beginning toward furthering something else, i.e., toward driving on to the maximum yield at the minimum expense. The coal that has been hauled out in some mining district has not been supplied in order that it may simply be present somewhere or other. It is stockpiled; that is, it is on call, ready to deliver the sun’s warmth that is stored in it. The sun’s warmth is challenged forth for heat, which in turn is ordered to deliver steam whose pressure turns the wheels that keep a factory running.
+
+The hydroelectric plant is set into the current of the Rhine. It sets the Rhine to supplying its hydraulic pressure, which then sets the turbines turning. This turning sets those machines in motion whose thrust sets going the electric current for which the long-distance power station and its network of cables are set up to dispatch electricity. In the context of the interlocking processes pertaining to the orderly disposition of electrical energy, even the Rhine itself appears as something at our command. The hydroelectric plant is not built into the Rhine River as was the old wooden bridge that joined bank with bank for hundreds of years. Rather the river is dammed up into the power plant. What the river is now, namely, a water power supplier, derives from out of the essence of the power station. In order that we may even remotely consider the monstrousness that reigns here, let us ponder for a moment the contrast that speaks out of the two titles, “The Rhine” as dammed up into the power works, and “The Rhine” as uttered out of the art work, in Hölderlin’s hymn by that name. But, it will be replied, the Rhine is still a river in the landscape, is it not? Perhaps. But how? In no other way than as an object on call for inspection by a tour group ordered there by the vacation industry.
+
+The revealing that rules throughout modern technology has the character of a setting-upon, in the sense of a challenging-forth. That challenging happens in that the energy concealed in nature is unlocked, what is unlocked is transformed, what is transformed is stored up, what is stored up is, in turn, distributed, and what is distributed is switched about ever anew. Unlocking, transforming, storing, distributing, and switching about are ways of revealing. But the revealing never simply comes to an end. Neither does it run off into the indeterminate. The revealing reveals to itself its own manifoldly interlocking paths, through regulating their course. This regulating itself is, for its part, everywhere secured. Regulating and securing even become the chief characteristics of the challenging revealing.
+
+What kind of unconcealment is it, then, that is peculiar to that which comes to stand forth through this setting-upon that challenges? Everywhere everything is ordered to stand by, to be immediately at hand, indeed to stand there just so that it may be on call for a further ordering. Whatever is ordered about in this way has its own standing. We call it the standing-reserve [Bestand]. The word expresses here something more, and something more essential, than mere “stock.” The name “standing-reserve” assumes the rank of an inclusive rubric. It designates nothing less than the way in which everything presences that is wrought upon by the challenging revealing. Whatever stands by in the sense of standing-reserve no longer stands over against us as object.
+
+Yet an airliner that stands on the runway is surely an object. Certainly. We can represent the machine so. But then it conceals itself as to what and how it is. Revealed, it stands on the taxi strip only as standing-reserve, inasmuch as it is ordered to ensure the possibility of transportation. For this it must be in its whole structure and in every one of its constituent parts, on call for duty, that is, ready for takeoff. (Here it would be appropriate to discuss Hegel’s definition of the machine as an autonomous tool. When applied to the tools of the craftsman, his characterization is correct. Characterized in this way, however, the machine is not thought at all from out of the essence of technology within which it belongs. Seen in terms of the standing-reserve, the machine is completely unautonomous, for it has its standing only from the ordering of the orderable.)
+
+The fact that now, wherever we try to point to modern technology as the challenging revealing, the words “setting-upon,” “ordering,” “standing-reserve,” obtrude and accumulate in a dry, monotonous, and therefore oppressive way, has its basis in what is now coming to utterance.
+
+Who accomplishes the challenging setting-upon through which what we call the real is revealed as standing-reserve? Obviously, man. To what extent is man capable of such a revealing? Man can indeed conceive, fashion, and carry through this or that in one way or another. But man does not have control over unconcealment itself, in which at any given time the real shows itself or withdraws. The fact that the real has been showing itself in the light of Ideas ever since the time of Plato, Plato did not bring about. The thinker only responded to what addressed itself to him.
+
+Only to the extent that man for his part is already challenged to exploit the energies of nature can this ordering revealing happen. If man is challenged, ordered, to do this, then does not man himself belong even more originally than nature within the standing-reserve? The current talk about human resources, about the supply of patients for a clinic, gives evidence of this. The forester who, in the wood, measures the felled timber and to all appearances walks the same forest path in the same way as did his grandfather is today commanded by profit-making in the lumber industry, whether he knows it or not. He is made subordinate to the orderability of cellulose, which for its part is challenged forth by the need for paper, which is then delivered to newspapers and illustrated magazines. The latter, in their turn, set public opinion to swallowing what is printed, so that a set configuration of opinion becomes available on demand. Yet precisely because man is challenged more originally than are the energies of nature, that is, into the process of ordering, he never is transformed into mere standing-reserve. Since man drives technology forward, he takes part in ordering as a way of revealing. But the unconcealment itself, within which ordering unfolds, is never a human handiwork, any more than is the realm through which man is already passing every time he as a subject relates to an object. Where and how does this revealing happen if it is no mere handiwork of man? We need not look far. We need only apprehend in an unbiased way that which has already claimed man and has done so, so decisively that he can only be man at any given time as the one so claimed. Wherever man opens his eyes and ears, unlocks his heart, and gives himself over to meditating and striving, shaping and working, entreating and thanking, he finds himself everywhere already brought into the unconcealed. The unconcealment of the unconcealed has already come to pass whenever it calls man forth into the modes of revealing allotted to him. When man, in his way, from within unconcealment reveals that which presences, he merely responds to the call of unconcealment even when he contradicts it. Thus when man, investigating, observing, ensnares nature as an area of his own conceiving, he has already been claimed by a way of revealing that challenges him to approach nature as an object of research, until even the object disappears into the objectlessness of standing-reserve.
+
+Modern technology as an ordering revealing is, then, no merely human doing. Therefore we must take that challenging that sets upon man to order the real as standing-reserve in accordance with the way in which it shows itself. That challenging gathers man into ordering. This gathering concentrates man upon ordering the real as standing-reserve.
+
+That which primordially unfolds the mountains into mountain ranges and courses through them in their folded togetherness is the gathering that we call Gebirg [mountain chain]. That original gathering from which unfold the ways in which we have feelings of one kind or another we name Gemüt [disposition]. We now name that challenging claim which gathers man thither to order the self-revealing as standing-reserve: Ge-stell [Enframing]. We dare to use this word in a sense that has been thoroughly unfamiliar up to now.
+
+According to ordinary usage, the word Gestell [frame] means some kind of apparatus, for example, a bookrack. Gestell is also the name for a skeleton. And the employment of the word Gestell [Enframing] that is now required of us seems equally eerie, not to speak of the arbitrariness with which words of a mature language are thus misused. Can anything be more strange? Surely not. Yet this strangeness is an old usage of thinking. And indeed thinkers accord with this usage precisely at the point where it is a matter of thinking that which is highest. We, late born, are no longer in a position to appreciate the significance of Plato’s daring to use the word eidos for that which in everything and in each particular thing endures as present. For eidos, in the common speech, meant the outward aspect [Ansicht] that a visible thing offers to the physical eye. Plato exacts of this word, however, something utterly extraordinary: that it name what precisely is not and never will be perceivable with physical eyes. But even this is by no means the full extent of what is extraordinary here. For idea names not only the nonsensuous aspect of what is physically visible. Aspect (idea) names and is, also, that which constitutes the essence in the audible, the tasteable, the tactile, in everything that is in any way accessible. Compared with the demands that Plato makes on language and thought in this and other instances, the use of the word Gestell as the name for the essence of modern technology, which we now venture here, is almost harmless. Even so, the usage now required remains something exacting and is open to misinterpretation.
+
+Enframing means the gathering together of that setting-upon which sets upon man, i.e., challenges him forth, to reveal the real, in the mode of ordering, as standing-reserve. Enframing means that way of revealing which holds sway in the essence of modern technology and which is itself nothing technological. On the other hand, all those things that are so familiar to us and are standard parts of an assembly, such as rods, pistons, and chassis, belong to the technological. The assembly itself, however, together with the aforementioned stockparts, falls within the sphere of technological activity; and this activity always merely responds to the challenge of Enframing, but it never comprises Enframing itself or brings it about. The word stellen [to set upon] in the name Ge-stell [Enframing] not only means challenging. At the same time it should preserve the suggestion of another Stellen from which it stems, namely, that producing and presenting [her- und dar-stellen] which, in the sense of poiēsis, lets what presences come forth into unconcealment. This producing that brings forth—for example, the erecting of a statue in the temple precinct—and the challenging ordering now under consideration are indeed fundamentally different, and yet they remain related in their essence. Both are ways of revealing, of alētheia. In Enframing, that unconcealment comes to pass in conformity with which the work of modern technology reveals the real as standing-reserve. This work is therefore neither only a human activity nor a mere means within such activity. The merely instrumental, merely anthropological definition of technology is therefore in principle untenable. And it cannot be rounded out by being referred back to some metaphysical or religious explanation that undergirds it.
+It remains true, nonetheless, that man in the technological age is, in a particularly striking way, challenged forth into revealing. That revealing concerns nature, above all, as the chief storehouse of the standing energy reserve. Accordingly, man’s ordering attitude and behavior display themselves first in the rise of modern physics as an exact science. Modern science’s way of representing pursues and entraps nature as a calculable coherence of forces. Modern physics is not experimental physics because it applies apparatus to the questioning of nature. Rather the reverse is true. Because physics, indeed already as pure theory, sets nature up to exhibit itself as a coherence of forces calculable in advance, it therefore orders its experiments precisely for the purpose of asking whether and how nature reports itself when set up in this way.
+
+But after all, mathematical physics arose almost two centuries before technology. How, then, could it have already been set upon by modern technology and placed in its service? The facts testify to the contrary. Surely technology got under way only when it could be supported by exact physical science. Reckoned chronologically, this is correct. Thought historically, it does not hit upon the truth. The modern physical theory of nature prepares the way first not simply for technology but for the essence of modern technology. For already in physics the challenging gathering-together into ordering revealing holds sway. But in it that gathering does not yet come expressly to appearance. Modern physics is the herald of Enframing, a herald whose origin is still unknown. The essence of modern technology has for a long time been concealing itself, even where power machinery has been invented, where electrical technology is in full swing, and where atomic technology is well under way. All coming to presence, not only modern technology, keeps itself everywhere concealed to the last. Nevertheless, it remains, with respect to its holding sway, that which precedes all: the earliest. The Greek thinkers already knew of this when they said: That which is earlier with regard to the arising that holds sway becomes manifest to us men only later. That which is primally early shows itself only ultimately to men. Therefore, in the realm of thinking, a painstaking effort to think through still more primally what was primally thought is not the absurd wish to revive what is past, but rather the sober readiness to be astounded before the coming of what is early.
+
+Chronologically speaking, modern physical science begins in the seventeenth century. In contrast, machine-power technology develops only in the second half of the eighteenth century. But modern technology, which for chronological reckoning is the later, is, from the point of view of the essence holding sway within it, the historically earlier.
+
+If modern physics must resign itself ever increasingly to the fact that its realm of representation remains inscrutable and incapable of being visualized, this resignation is not dictated by any committee of researchers. It is challenged forth by the rule of Enframing, which demands that nature be orderable as standing-reserve. Hence physics, in all its retreating from the representation turned only toward objects that has alone been standard till recently, will never be able to renounce this one thing: that nature reports itself in some way or other that is identifiable through calculation and that it remains orderable as a system of information. This system is determined, then, out of a causality that has changed once again. Causality now displays neither the character of the occasioning that brings forth nor the nature of the causa efficiens, let alone that of the causa formalis. It seems as though causality is shrinking into a reporting—a reporting challenged forth—of standing-reserves that must be guaranteed either simultaneously or in sequence. To this shrinking would correspond the process of growing resignation that Heisenberg’s lecture depicts in so impressive a manner.* Because the essence of modern technology lies in Enframing, modern technology must employ exact physical science. Through its so doing, the deceptive illusion arises that modern technology is applied physical science. This illusion can maintain itself only so long as neither the essential origin of modern science nor indeed the essence of modern technology is adequately found out through questioning.
+
+We are questioning concerning technology in order to bring to light our relationship to its essence. The essence of modern technology shows itself in what we call Enframing. But simply to point to Where do we find ourselves brought to, if now we think one step further regarding what Enframing itself actually is? It is nothing technological, nothing on the order of a machine. It is the way in which the real reveals itself as standing-reserve. Again we ask: Does this revealing happen somewhere beyond all human doing? No. But neither does it happen exclusively in man, or decisively through man.
+
+Enframing is the gathering together that belongs to that setting upon which sets upon man and puts him in position to reveal the real, in the mode of ordering, as standing-reserve. As the one who is challenged forth in this way, man stands within the essential realm of Enframing. He can never take up a relationship to it only subsequently. Thus the question as to how we are to arrive at a relationship to the essence of technology, asked in this way, always comes too late. But never too late comes the question as to whether we actually experience ourselves as the ones whose activities everywhere, public and private, are challenged forth by Enframing. Above all, never too late comes the question as to whether and how we actually admit ourselves into that wherein Enframing itself comes to presence.
+
+The essence of modern technology starts man upon the way of that revealing through which the real everywhere, more or less distinctly, becomes standing-reserve. “To start upon a way” means “to send” in our ordinary language. We shall call that sending-thatgathers [versammelde Schicken] which first starts man upon a way of revealing, destining [Geschick]. It is from out of this destining that the essence of all history [Geschichte] is determined. History is neither simply the object of written chronicle nor simply the fulfillment of human activity. That activity first becomes history as something destined. And it is only the destining into objectifying representation that makes the historical accessible as an object for historiography, that is, for a science, and on this basis makes possible the current equating of the historical with that which is chronicled. Enframing, as a challenging-forth into ordering, sends into a way of revealing. Enframing is an ordaining of destining, as is every way of revealing. Bringing-forth, poiēsis, is also a destining in this sense. Always the unconcealment of that which is goes upon a way of revealing. Always the destining of revealing holds complete sway over man. But that destining is never a fate that compels. For man becomes truly free only insofar as he belongs to the realm of destining and so becomes one who listens and hears, and not one who is simply constrained to obey.
+
+The essence of freedom is originally not connected with the will or even with the causality of human willing.
+
+Freedom governs the open in the sense of the cleared and lighted up, i.e., of the revealed. It is to the happening of revealing, that is, of truth, that freedom stands in the closest and most intimate kinship. All revealing belongs within a harboring and a concealing. But that which frees—the mystery—is concealed and always concealing itself. All revealing comes out of the open, goes into the open, and brings into the open. The freedom of the open consists neither in unfettered arbitrariness nor in the constraint of mere laws. Freedom is that which conceals in a way that opens to light, in whose clearing there shimmers that veil that covers what comes to presence of all truth and lets the veil appear as what veils. Freedom is the realm of the destining that at any given time starts a revealing upon its way. The essence of modern technology lies in Enframing. Enframing belongs within the destining of revealing. These sentences express something different from the talk that we hear more frequently, to the effect that technology is the fate of our age, where “fate” means the inevitableness of an unalterable course.
+
+But when we consider the essence of technology, then we experience Enframing as a destining of revealing. In this way we are already sojourning within the open space of destining, a destining that in no way confines us to a stultified compulsion to push on blindly with technology or, what comes to the same thing, to rebel helplessly against it and curse it as the work of the devil. Quite to the contrary, when we once open ourselves expressly to the essence of technology, we find ourselves unexpectedly taken into a freeing claim.
+
+The essence of technology lies in Enframing. Its holding sway belongs within destining. Since destining at any given time starts man on a way of revealing, man, thus under way, is continually approaching the brink of the possibility of pursuing and pushing forward nothing but what is revealed in ordering, and of deriving all his standards on this basis. Through this the other possibility is blocked, that man might be admitted more and sooner and ever more primally to the essence of that which is unconcealed and to its unconcealment, in order that he might experience as his essence his needed belonging to revealing.
+
+Placed between these possibilities, man is endangered from out of destining. The destining of revealing is as such, in every one of its modes, and therefore necessarily, danger.
+
+In whatever way the destining of revealing may hold sway, the unconcealment in which everything that is shows itself at any given time harbors the danger that man may misconstrue the unconcealed and misinterpret it. Thus where everything that presences exhibits itself in the light of a cause-effect coherence, even God can, for representational thinking, lose all that is exalted and holy, the mysteriousness of his distance. In the light of causality, God can sink to the level of a cause, of causa efficiens. He then becomes, even in theology, the god of the philosophers, namely, of those who define the unconcealed and the concealed in terms of the causality of making, without ever considering the essential origin of this causality.
+
+In a similar way the unconcealment in accordance with which nature presents itself as a calculable complex of the effects of forces can indeed permit correct determinations; but precisely through these successes the danger can remain that in the midst of all that is correct the true will withdraw.
+
+The destining of revealing is in itself not just any danger, but the danger.
+
+Yet when destining reigns in the mode of Enframing, it is the supreme danger. This danger attests itself to us in two ways. As soon as what is unconcealed no longer concerns man even as object, but does so, rather, exclusively as standing-reserve, and man in the midst of objectlessness is nothing but the orderer of the standing-reserve, then he comes to the very brink of a precipitous fall; that is, he comes to the point where he himself will have to be taken as standing-reserve. Meanwhile man, precisely as the one so threatened, exalts himself to the posture of lord of the earth. In this way the impression comes to prevail that everything man encounters exists only insofar as it is his construct. This illusion gives rise in turn to one final delusion: It seems as though man everywhere and always encounters only himself. Heisenberg has with complete correctness pointed out that the real must present itself to contemporary man in this way. In truth, however, precisely nowhere does man today any longer encounter himself, that is, his essence. Man stands so decisively in attendance on the challenging-forth of Enframing that he does not apprehend Enframing as a claim, that he fails to see himself as the one spoken to, and hence also fails in every way to hear in what respect he ek-sists, from out of his essence, in the realm of an exhortation or address, and thus can never encounter only himself. But Enframing does not simply endanger man in his relationship to himself and to everything that is. As a destining, it banishes man into that kind of revealing which is an ordering. Where this ordering holds sway, it drives out every other possibility of revealing. Above all, Enframing conceals that revealing which, in the sense of poiēsis, lets what presences come forth into appearance. As compared with that other revealing, the setting-upon that challenges forth thrusts man into a relation to that which is, that is at once antithetical and rigorously ordered. Where Enframing holds sway, regulating and securing of the standing-reserve mark all revealing. They no longer even let their own fundamental characteristic appear, namely, this revealing as such.
+
+Thus the challenging Enframing not only conceals a former way of revealing, bringing-forth, but it conceals revealing itself and with it That wherein unconcealment, that is, truth, comes to pass. Enframing blocks the shining-forth and holding-sway of truth. The destining that sends into ordering is consequently the extreme danger. What is dangerous is not technology. There is no demonry of technology, but rather there is the mystery of its essence. The essence of technology, as a destining of revealing, is the danger. The transformed meaning of the word “Enframing” will perhaps become somewhat more familiar to us now if we think Enframing in the sense of destining and danger.
+
+The threat to man does not come in the first instance from the potentially lethal machines and apparatus of technology. The actual threat has already affected man in his essence. The rule of Enframing threatens man with the possibility that it could be denied to him to enter into a more original revealing and hence to experience the call of a more primal truth.
+
+Thus, where Enframing reigns, there is danger in the highest sense.
+
+But where danger is, grows The saving power also.
+
+Let us think carefully about these words of Hölderlin. What does it mean “to save”? Usually we think that it means only to seize hold of a thing threatened by ruin, in order to secure it in its former continuance. But the verb “to save” says more. “To save” is to fetch something home into its essence, in order to bring the essence for the first time into its genuine appearing. If the essence of technology, Enframing, is the extreme danger, and if there is truth in Hölderlin’s words, then the rule of Enframing cannot exhaust itself solely in blocking all lighting-up of every revealing, all appearing of truth. Rather, precisely the essence of technology must harbor in itself the growth of the saving power. But in that case, might not an adequate look into what Enframing is as a destining of revealing bring into appearance the saving power in its arising?
+
+In what respect does the saving power grow there also where the danger is? Where something grows, there it takes root, from thence it thrives. Both happen concealedly and quietly and in their own time. But according to the words of the poet we have no right whatsoever to expect that there where the danger is we should be able to lay hold of the saving power immediately and without preparation. Therefore we must consider now, in advance, in what respect the saving power does most profoundly take root and thence thrive even in that wherein the extreme danger lies, in the holding sway of Enframing. In order to consider this, it is necessary, as a last step upon our way, to look with yet clearer eyes into the danger. Accordingly, we must once more question concerning technology. For we have said that in technology’s essence roots and thrives the saving power. But how shall we behold the saving power in the essence of technology so long as we do not consider in what sense of “essence” it is that Enframing is actually the essence of technology? Thus far we have understood “essence” in its current meaning. In the academic language of philosophy, “essence” means what something is; in Latin, quid. Quidditas, whatness, provides the answer to the question concerning essence. For example, what pertains to all kinds of trees—oaks, beeches, birches, firs—is the same “treeness.” Under this inclusive genus—the “universal”—fall all real and possible trees. Is then the essence of technology, Enframing, the common genus for everything technological? If that were the case then the steam turbine, the radio transmitter, and the cyclotron would each be an Enframing. But the word “Enframing” does not mean here a tool or any kind of apparatus. Still less does it mean the general concept of such resources. The machines and apparatus are no more cases and kinds of Enframing than are the man at the switchboard and the engineer in the drafting room. Each of these in its own way indeed belongs as stock-part, available resource, or executer, within Enframing; but Enframing is never the essence of technology in the sense of a genus. Enframing is a way of revealing having the character of destining, namely, the way that challenges forth. The revealing that brings forth (poiēsis) is also a way that has the character of destining. But these ways are not kinds that, arrayed beside one another, fall under the concept of revealing. Revealing is that destining which, ever suddenly and inexplicably to all thinking, apportions itself into the revealing that brings forth and that also challenges, and which allots itself to man. The challenging revealing has its origin as a destining in bringing-forth. But at the same time Enframing, in a way characteristic of a destining, blocks poiēsis. Thus Enframing, as a destining of revealing, is indeed the essence of technology, but never in the sense of genus and essentia. If we pay heed to this, something astounding strikes us: It is technology itself that makes the demand on us to think in another way what is usually understood by “essence.” But in what way?
+
+If we speak of the “essence of a house” and the “essence of a state,” we do not mean a generic type; rather we mean the ways in which house and state hold sway, administer themselves, develop and decay—the way in which they “essence” [Wesen]. Johann Peter Hebel in a poem, “Ghost on Kanderer Street,” for which Goethe had a special fondness, uses the old word die Weserei. It means the city hall inasmuch as there the life of the community gathers and village existence is constantly in play, that is, comes to presence. It is from the verb wesen that the noun is derived. Wesen understood as a verb is the same as währen [to last or endure], not only in terms of meaning, but also in terms of the phonetic formation of the word.
+
+Socrates and Plato already think the essence of something as what essences, what comes to presence, in the sense of what endures. But they think what endures as what remains permanently (aei on). And they find what endures permanently in what, as that which remains, tenaciously persists throughout all that happens. That which remains they discover, in turn, in the aspect (eidos, idea), for example, the Idea “house.”
+
+The Idea “house” displays what anything is that is fashioned as a house. Particular, real, and possible houses, in contrast, are changing and transitory derivatives of the Idea and thus belong to what does not endure.
+
+But it can never in any way be established that enduring is based solely on what Plato thinks as idea and Aristotle thinks as to ti ēn einai (that which any particular thing has always been), or what metaphysics in its most varied interpretations thinks as essentia. All essencing endures. But is enduring only permanent enduring? Does the essence of technology endure in the sense of the permanent enduring of an Idea that hovers over everything technological, thus making it seem that by technology we mean some mythological abstraction? The way in which technology essences lets itself be seen only from out of that permanent enduring in which Enframing comes to pass as a destining of revealing. Goethe once uses the mysterious word fortgewähren [to grant permanently] in place of fortwähren [to endure permanently].* He hears währen [to endure] and gewähren [to grant] here in one unarticulated accord. And if we now ponder more carefully than we did before what it is that actually endures and perhaps alone endures, we may venture to say: Only what is granted endures. That which endures primally out of the earliest beginning is what grants.
+
+As the essencing of technology, Enframing is that which endures. Does Enframing hold sway at all in the sense of granting? No doubt the question seems a horrendous blunder. For according to everything that has been said, Enframing is, rather, a destining that gathers together into the revealing that challenges forth. Challenging is anything but a granting. So it seems, so long as we do not notice that the challenging-forth into the ordering of the real as standing-reserve still remains a destining that starts man upon a way of revealing. As this destining, the coming to presence of technology gives man entry into That which, of himself, he can neither invent nor in any way make. For there is no such thing as a man who, solely of himself, is only man.
+
+But if this destining, Enframing, is the extreme danger, not only for man’s coming to presence, but for all revealing as such, should this destining still be called a granting? Yes, most emphatically, if in this destining the saving power is said to grow. Every destining of revealing comes to pass from out of a granting and as such a granting. For it is granting that first conveys to man that share in revealing which the coming-to-pass of revealing needs. As the one so needed and used, man is given to belong to the coming-to-pass of truth. The granting that sends in one way or another into revealing is as such the saving power. For the saving power lets man see and enter into the highest dignity of his essence. This dignity lies in keeping watch over the unconcealment—and with it, from the first, the concealment —of all coming to presence on this earth. It is precisely in Enframing, which threatens to sweep man away into ordering as the supposed single way of revealing, and so thrusts man into the danger of the surrender of his free essence—it is precisely in this extreme danger that the innermost indestructible belongingness of man within granting may come to light, provided that we, for our part, begin to pay heed to the coming to presence of technology.
+
+Thus the coming to presence of technology harbors in itself what we least suspect, the possible arising of the saving power. Everything, then, depends upon this: that we ponder this arising and that, recollecting, we watch over it. How can this happen? Above all through our catching sight of what comes to presence in technology, instead of merely staring at the technological. So long as we represent technology as an instrument, we remain held fast in the will to master it. We press on past the essence of technology. When, however, we ask how the instrumental comes to presence as a kind of causality, then we experience this coming to presence as the destining of a revealing.
+
+When we consider, finally, that the coming to presence of the essence of technology comes to pass in the granting that needs and uses man so that he may share in revealing, then the following becomes clear:
+
+The essence of technology is in a lofty sense ambiguous. Such ambiguity points to the mystery of all revealing, that is, of truth. On the one hand, Enframing challenges forth into the frenziedness of ordering that blocks every view into the coming-topass of revealing and so radically endangers the relation to the essence of truth.
+
+On the other hand, Enframing comes to pass for its part in the granting that lets man endure—as yet unexperienced, but perhaps more experienced in the future—that he may be the one who is needed and used for the safekeeping of the coming to presence of truth. Thus does the arising of the saving power appear. The irresistibility of ordering and the restraint of the saving power draw past each other like the paths of two stars in the course of the heavens. But precisely this, their passing by, is the hidden side of their nearness.
+
+When we look into the ambiguous essence of technology, we behold the constellation, the stellar course of the mystery. The question concerning technology is the question concerning the constellation in which revealing and concealing, in which the coming to presence of truth, comes to pass. But what help is it to us to look into the constellation of truth? We look into the danger and see the growth of the saving power. Through this we are not yet saved. But we are thereupon summoned to hope in the growing light of the saving power. How can this happen? Here and now and in little things, that we may foster the saving power in its increase. This includes holding always before our eyes the extreme danger.
+
+The coming to presence of technology threatens revealing, threatens it with the possibility that all revealing will be consumed in ordering and that everything will present itself only in the unconcealedness of standing-reserve. Human activity can never directly counter this danger. Human achievement alone can never banish it. But human reflection can ponder the fact that all saving power must be of a higher essence than what is endangered, though at the same time kindred to it.
+
+But might there not perhaps be a more primally granted revealing that could bring the saving power into its first shining forth in the midst of the danger, a revealing that in the technological age rather conceals than shows itself? There was a time when it was not technology alone that bore the name technē. Once that revealing that brings forth truth into the splendor of radiant appearing also was called technē. Once there was a time when the bringing-forth of the true into the beautiful was called technē. And the poiēsis of the fine arts also was called technē.
+
+In Greece, at the outset of the destining of the West, the arts soared to the supreme height of the revealing granted them. They brought the presence [Gegenwart] of the gods, brought the dialogue of divine and human destinings, to radiance. And art was simply called technē. It was a single, manifold revealing. It was pious, promos, i.e., yielding to the holding-sway and the safekeeping of truth.
+
+The arts were not derived from the artistic. Art works were not enjoyed aesthetically. Art was not a sector of cultural activity. What, then, was art—perhaps only for that brief but magnificent time? Why did art bear the modest name technē? Because it was a revealing that brought forth and hither, and therefore belonged within poiēsis. It was finally that revealing which holds complete sway in all the fine arts, in poetry, and in everything poetical that obtained poiēsis as its proper name.
+
+
+The same poet from whom we heard the words:
+But where danger is, grows
+The saving power also.
+
+says to us:
+… poetically dwells man upon this earth.
+
+The poetical brings the true into the splendor of what Plato in the Phaedrus calls to ekphanestaton, that which shines forth most purely. The poetical thoroughly pervades every art, every revealing of coming to presence into the beautiful.
+
+Could it be that the fine arts are called to poetic revealing? Could it be that revealing lays claim to the arts most primally, so that they for their part may expressly foster the growth of the saving power, may awaken and found anew our look into that which grants and our trust in it?
+
+Whether art may be granted this highest possibility of its essence in the midst of the extreme danger, no one can tell. Yet we can be astounded. Before what? Before this other possibility: that the frenziedness of technology may entrench itself everywhere to such an extent that someday, throughout everything technological, the essence of technology may come to presence in the coming-to-pass of truth.
+
+Because the essence of technology is nothing technological, essential reflection upon technology and decisive confrontation with it must happen in a realm that is, on the one hand, akin to the essence of technology and, on the other, fundamentally different from it.
+
+Such a realm is art. But certainly only if reflection on art, for its part, does not shut its eyes to the constellation of truth after which we are questioning.
+
+Thus questioning, we bear witness to the crisis that in our sheer preoccupation with technology we do not yet experience the coming to presence of technology, that in our sheer aesthetic-mindedness we no longer guard and preserve the coming to presence of art. Yet the more questioningly we ponder the essence of technology, the more mysterious the essence of art becomes.
+
+The closer we come to the danger, the more brightly do the ways into the saving power begin to shine and the more questioning we become. For questioning is the piety of thought.
+
diff --git a/dotfiles/system/.msmtprc b/dotfiles/system/.msmtprc
new file mode 100644
index 0000000..f81d0aa
--- /dev/null
+++ b/dotfiles/system/.msmtprc
@@ -0,0 +1,38 @@
+# Set default values for all the accounts.
+
+defaults
+logfile ~/.mail/msmtp.log
+
+# ======================================================================
+
+account gmail
+tls_trust_file /etc/ssl/certs/ca-certificates.crt
+auth on
+host smtp.gmail.com
+port 465
+protocol smtp
+from craigmartinjennings@gmail.com
+user craigmartinjennings
+passwordeval "gpg2 -q --for-your-eyes-only --no-tty -d ~/.config/.gmailpass.gpg"
+tls on
+tls_starttls off
+logfile ~/.msmtp.gmail.log
+
+# ======================================================================
+
+account cmail
+tls_trust_file /home/cjennings/.config/protonbridge.cert.pem
+auth on
+host 127.0.0.1
+port 1025
+protocol smtp
+from c@cjennings.net
+user c@cjennings.net
+passwordeval "cat ~/.config/.protonmailsmtp"
+tls on
+tls_starttls on
+logfile ~/.msmtp.cmail.log
+
+# ======================================================================
+
+account default : cmail
diff --git a/dotfiles/system/.stow-global-ignore b/dotfiles/system/.stow-global-ignore
new file mode 100644
index 0000000..8d6861e
--- /dev/null
+++ b/dotfiles/system/.stow-global-ignore
@@ -0,0 +1,2 @@
+\.git
+^\.gitignore$
diff --git a/dotfiles/system/music/60s Sounds.m3u b/dotfiles/system/music/60s Sounds.m3u
new file mode 100644
index 0000000..1507649
--- /dev/null
+++ b/dotfiles/system/music/60s Sounds.m3u
@@ -0,0 +1,3 @@
+#EXTM3U
+#EXTINF:1,60's Sounds
+https://streams.fluxfm.de/60er/mp3-320/audio/
diff --git a/dotfiles/system/music/90s Sounds.m3u b/dotfiles/system/music/90s Sounds.m3u
new file mode 100644
index 0000000..70c45c1
--- /dev/null
+++ b/dotfiles/system/music/90s Sounds.m3u
@@ -0,0 +1,3 @@
+#EXTM3U
+#EXTINF:1,90's Sounds
+https://streams.fluxfm.de/90er/mp3-320/audio/
diff --git a/dotfiles/system/music/Ambient Sleeping Pill.m3u b/dotfiles/system/music/Ambient Sleeping Pill.m3u
new file mode 100644
index 0000000..891a266
--- /dev/null
+++ b/dotfiles/system/music/Ambient Sleeping Pill.m3u
@@ -0,0 +1,9 @@
+#EXTM3U
+#RADIOBROWSERUUID:961fa288-0601-11e8-ae97-52543be04c81
+#EXTINF:1,Ambient Sleeping Pill
+http://radio.stereoscenic.com/asp-h
+
+#RADIOBROWSERUUID:962fd9a1-0601-11e8-ae97-52543be04c81
+#EXTINF:1,Ambient Sleeping Pill
+http://radio.stereoscenic.com/asp-s
+
diff --git a/dotfiles/system/music/Andor.m3u b/dotfiles/system/music/Andor.m3u
new file mode 100644
index 0000000..658dce3
--- /dev/null
+++ b/dotfiles/system/music/Andor.m3u
@@ -0,0 +1 @@
+playlists/andor/andor.opus
diff --git a/dotfiles/system/music/BAGeL Radio.m3u b/dotfiles/system/music/BAGeL Radio.m3u
new file mode 100644
index 0000000..546030c
--- /dev/null
+++ b/dotfiles/system/music/BAGeL Radio.m3u
@@ -0,0 +1 @@
+https://ais-sa3.cdnstream1.com/2606_128.mp3
diff --git a/dotfiles/system/music/BBC World Service.m3u b/dotfiles/system/music/BBC World Service.m3u
new file mode 100644
index 0000000..47ab17d
--- /dev/null
+++ b/dotfiles/system/music/BBC World Service.m3u
@@ -0,0 +1,41 @@
+#EXTM3U
+#RADIOBROWSERUUID:98adecf7-2683-4408-9be7-02d3f9098eb8
+#EXTINF:1,BBC World Service
+http://stream.live.vc.bbcmedia.co.uk/bbc_world_service
+
+#RADIOBROWSERUUID:35c98744-7d97-4739-9c48-3161f1155cc6
+#EXTINF:1,BBC World Service
+http://open.live.bbc.co.uk/mediaselector/5/select/version/2.0/mediaset/http-icy-mp3-a/vpid/bbc_world_service/format/pls.pls
+
+#RADIOBROWSERUUID:59e28043-e349-43a2-8695-ab67ff30b77e
+#EXTINF:1,BBC World Service for East Asia
+https://stream.live.vc.bbcmedia.co.uk/bbc_world_service_east_asia
+
+#RADIOBROWSERUUID:961e70ca-0601-11e8-ae97-52543be04c81
+#EXTINF:1,WRVO-3 BBC World Service Stream - Oswego, NY
+http://playerservices.streamtheworld.com/m3u/WRVOHD3.m3u
+
+#RADIOBROWSERUUID:3e1ea4e1-aac3-4617-93e3-b35b67b1ff86
+#EXTINF:1,BBC World Service
+http://a.files.bbci.co.uk/media/live/manifesto/audio/simulcast/hls/nonuk/sbr_vlow/ak/bbc_world_service.m3u8
+
+#RADIOBROWSERUUID:14b6c684-bb7c-4926-b2a3-fd5a02bf7867
+#EXTINF:1,BBC World Service
+http://a.files.bbci.co.uk/media/live/manifesto/audio/simulcast/hls/nonuk/sbr_low/ak/bbc_world_service.m3u8
+
+#RADIOBROWSERUUID:96248807-0601-11e8-ae97-52543be04c81
+#EXTINF:1,WYPR-HD2 BBC World Service Stream - Baltimore, MD
+http://provisioning.streamtheworld.com/pls/WYPR_HD2AAC.pls
+
+#RADIOBROWSERUUID:964d751a-0601-11e8-ae97-52543be04c81
+#EXTINF:1,KUER 90.1 HD2 Salt Lake City, UT (BBC World Service) [low]
+http://audio.kuer.org:8000/kuer2low
+
+#RADIOBROWSERUUID:9613cb5d-0601-11e8-ae97-52543be04c81
+#EXTINF:1,KUER 90.1 HD2 Salt Lake City, UT (BBC World Service) [high]
+http://audio.kuer.org:8000/kuer2high
+
+#RADIOBROWSERUUID:a347209e-6ce6-4c94-81ed-003c1275188f
+#EXTINF:1,BBC World Service
+https://stream.live.vc.bbcmedia.co.uk/bbc_world_service_east_asia
+
diff --git a/dotfiles/system/music/Black Flamingos - Space Bar.m4a b/dotfiles/system/music/Black Flamingos - Space Bar.m4a
new file mode 100644
index 0000000..281e6b8
--- /dev/null
+++ b/dotfiles/system/music/Black Flamingos - Space Bar.m4a
Binary files differ
diff --git a/dotfiles/system/music/Blues Radio.m3u b/dotfiles/system/music/Blues Radio.m3u
new file mode 100644
index 0000000..abd4e2b
--- /dev/null
+++ b/dotfiles/system/music/Blues Radio.m3u
@@ -0,0 +1 @@
+http://cast3.radiohost.ovh:8352/
diff --git a/dotfiles/system/music/Dark Ambient.m3u b/dotfiles/system/music/Dark Ambient.m3u
new file mode 100644
index 0000000..2db37ae
--- /dev/null
+++ b/dotfiles/system/music/Dark Ambient.m3u
@@ -0,0 +1,9 @@
+#EXTM3U
+#RADIOBROWSERUUID:9641191e-0601-11e8-ae97-52543be04c81
+#EXTINF:1,Dark Ambient Radio (96k AAC+)
+http://s3.viastreaming.net:8835/
+
+#RADIOBROWSERUUID:2d498b21-6d3a-49e8-a581-35e220d4b53a
+#EXTINF:1,Dark Ambient Radio
+http://s3.viastreaming.net:8835/
+
diff --git a/dotfiles/system/music/Flux FM Radio.m3u b/dotfiles/system/music/Flux FM Radio.m3u
new file mode 100644
index 0000000..9a5aaf9
--- /dev/null
+++ b/dotfiles/system/music/Flux FM Radio.m3u
@@ -0,0 +1,3 @@
+#EXTM3U
+#EXTINF:1,Flux FM Radio
+https://streams.fluxfm.de/Chillhop/mp3-320/streams.fluxfm.de/
diff --git a/dotfiles/system/music/Jazz Radio Happy Hour.m3u b/dotfiles/system/music/Jazz Radio Happy Hour.m3u
new file mode 100644
index 0000000..caa1802
--- /dev/null
+++ b/dotfiles/system/music/Jazz Radio Happy Hour.m3u
@@ -0,0 +1,5 @@
+#EXTM3U
+#RADIOBROWSERUUID:96136da2-0601-11e8-ae97-52543be04c81
+#EXTINF:1,Jazz Radio Happy Hour
+http://jazz-wr14.ice.infomaniak.ch/jazz-wr14-128.mp3
+
diff --git a/dotfiles/system/music/Jazz Radio Latin Jazz.m3u b/dotfiles/system/music/Jazz Radio Latin Jazz.m3u
new file mode 100644
index 0000000..f957d29
--- /dev/null
+++ b/dotfiles/system/music/Jazz Radio Latin Jazz.m3u
@@ -0,0 +1,5 @@
+#EXTM3U
+#RADIOBROWSERUUID:96136cda-0601-11e8-ae97-52543be04c81
+#EXTINF:1,Jazz Radio Latin Jazz
+http://jazz-wr09.ice.infomaniak.ch/jazz-wr09-128.mp3
+
diff --git a/dotfiles/system/music/Jazz Radio New Orleans.m3u b/dotfiles/system/music/Jazz Radio New Orleans.m3u
new file mode 100644
index 0000000..21f13d6
--- /dev/null
+++ b/dotfiles/system/music/Jazz Radio New Orleans.m3u
@@ -0,0 +1 @@
+http://jazz-wr03.ice.infomaniak.ch/jazz-wr03-128.mp3
diff --git a/dotfiles/system/music/Jazz Radio Only Women.m3u b/dotfiles/system/music/Jazz Radio Only Women.m3u
new file mode 100644
index 0000000..aebd263
--- /dev/null
+++ b/dotfiles/system/music/Jazz Radio Only Women.m3u
@@ -0,0 +1,5 @@
+#EXTM3U
+#RADIOBROWSERUUID:9610a72f-0601-11e8-ae97-52543be04c81
+#EXTINF:1,Jazz Radio Only Women
+http://jazz-wr16.ice.infomaniak.ch/jazz-wr16-128.mp3
+
diff --git a/dotfiles/system/music/Lofi Girl.m3u b/dotfiles/system/music/Lofi Girl.m3u
new file mode 100644
index 0000000..1a713f3
--- /dev/null
+++ b/dotfiles/system/music/Lofi Girl.m3u
@@ -0,0 +1,3 @@
+#EXTM3U
+#EXTINF:1,Lofi Girl
+https://www.youtube.com/watch?v=jfKfPfyJRdk \ No newline at end of file
diff --git a/dotfiles/system/music/Malvern Radio International Classical.m3u b/dotfiles/system/music/Malvern Radio International Classical.m3u
new file mode 100644
index 0000000..95b8080
--- /dev/null
+++ b/dotfiles/system/music/Malvern Radio International Classical.m3u
@@ -0,0 +1,5 @@
+#EXTM3U
+#RADIOBROWSERUUID:a23a00e2-ca9b-4869-82ec-063d7303d98b
+#EXTINF:1,Malvern Radio International - Pumpkin FM
+https://cast2.asurahosting.com/proxy/radiomalvernint/stream
+
diff --git a/dotfiles/system/music/NPR 24 Hour Radio.m3u b/dotfiles/system/music/NPR 24 Hour Radio.m3u
new file mode 100644
index 0000000..557cb53
--- /dev/null
+++ b/dotfiles/system/music/NPR 24 Hour Radio.m3u
@@ -0,0 +1,9 @@
+#EXTM3U
+#RADIOBROWSERUUID:7ba4c184-fc2b-11e9-bbf2-52543be04c81
+#EXTINF:1,NPR 24 Hour Program Stream
+http://npr-ice.streamguys1.com/live.mp3
+
+#RADIOBROWSERUUID:14543b1e-44bf-4151-ae89-ec23b6eb711f
+#EXTINF:1,NPR 24 Hour Program Stream
+http://npr-ice.streamguys1.com/live.aac
+
diff --git a/dotfiles/system/music/Radio Caprice Acoustic Blues.m3u b/dotfiles/system/music/Radio Caprice Acoustic Blues.m3u
new file mode 100644
index 0000000..360e093
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Acoustic Blues.m3u
@@ -0,0 +1 @@
+http://79.111.14.76:8000/acousticblues
diff --git a/dotfiles/system/music/Radio Caprice Breakbeat.m3u b/dotfiles/system/music/Radio Caprice Breakbeat.m3u
new file mode 100644
index 0000000..93c26c4
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Breakbeat.m3u
@@ -0,0 +1 @@
+http://79.120.39.202:8000/breakbeat
diff --git a/dotfiles/system/music/Radio Caprice Classical Baroque.m3u b/dotfiles/system/music/Radio Caprice Classical Baroque.m3u
new file mode 100644
index 0000000..c4943da
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Classical Baroque.m3u
@@ -0,0 +1 @@
+http://79.111.14.76:8000/baroque
diff --git a/dotfiles/system/music/Radio Caprice Classical Cello.m3u b/dotfiles/system/music/Radio Caprice Classical Cello.m3u
new file mode 100644
index 0000000..8bc683b
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Classical Cello.m3u
@@ -0,0 +1 @@
+http://79.120.12.130:8000/cello
diff --git a/dotfiles/system/music/Radio Caprice Classical Impressionism.m3u b/dotfiles/system/music/Radio Caprice Classical Impressionism.m3u
new file mode 100644
index 0000000..3bb18fd
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Classical Impressionism.m3u
@@ -0,0 +1 @@
+http://79.120.12.130:8000/impressionism
diff --git a/dotfiles/system/music/Radio Caprice Classical Lute.m3u b/dotfiles/system/music/Radio Caprice Classical Lute.m3u
new file mode 100644
index 0000000..2061560
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Classical Lute.m3u
@@ -0,0 +1 @@
+http://79.120.12.130:8000/lute
diff --git a/dotfiles/system/music/Radio Caprice Classical Medieval.m3u b/dotfiles/system/music/Radio Caprice Classical Medieval.m3u
new file mode 100644
index 0000000..7ad7e78
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Classical Medieval.m3u
@@ -0,0 +1 @@
+http://213.141.131.10:8000/medieval
diff --git a/dotfiles/system/music/Radio Caprice Classical Piano.m3u b/dotfiles/system/music/Radio Caprice Classical Piano.m3u
new file mode 100644
index 0000000..d94613c
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Classical Piano.m3u
@@ -0,0 +1 @@
+http://79.120.39.202:8000/classpiano
diff --git a/dotfiles/system/music/Radio Caprice Classical Renaissance.m3u b/dotfiles/system/music/Radio Caprice Classical Renaissance.m3u
new file mode 100644
index 0000000..5eb695c
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Classical Renaissance.m3u
@@ -0,0 +1 @@
+http://213.141.131.10:8000/renaissance
diff --git a/dotfiles/system/music/Radio Caprice Classical Sonata.m3u b/dotfiles/system/music/Radio Caprice Classical Sonata.m3u
new file mode 100644
index 0000000..bf6f77f
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Classical Sonata.m3u
@@ -0,0 +1 @@
+http://213.141.131.10:8000/sonata
diff --git a/dotfiles/system/music/Radio Caprice Classical Strings.m3u b/dotfiles/system/music/Radio Caprice Classical Strings.m3u
new file mode 100644
index 0000000..06d6b98
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Classical Strings.m3u
@@ -0,0 +1 @@
+http://79.120.39.202:8000/strings
diff --git a/dotfiles/system/music/Radio Caprice Classical Violin.m3u b/dotfiles/system/music/Radio Caprice Classical Violin.m3u
new file mode 100644
index 0000000..fe8e97e
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Classical Violin.m3u
@@ -0,0 +1 @@
+http://213.141.131.10:8000/violin
diff --git a/dotfiles/system/music/Radio Caprice Delta Blues.m3u b/dotfiles/system/music/Radio Caprice Delta Blues.m3u
new file mode 100644
index 0000000..8788935
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Delta Blues.m3u
@@ -0,0 +1,5 @@
+#EXTM3U
+#RADIOBROWSERUUID:7db77a9e-502e-11ea-b877-52543be04c81
+#EXTINF:1,Radio Caprice Delta Blues
+http://79.120.77.11:8002/deltablues
+
diff --git a/dotfiles/system/music/Radio Caprice Downtempo.m3u b/dotfiles/system/music/Radio Caprice Downtempo.m3u
new file mode 100644
index 0000000..7a72ca6
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Downtempo.m3u
@@ -0,0 +1 @@
+http://79.120.77.11:8000/downtempo
diff --git a/dotfiles/system/music/Radio Caprice Dubstep.m3u b/dotfiles/system/music/Radio Caprice Dubstep.m3u
new file mode 100644
index 0000000..eab9c17
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Dubstep.m3u
@@ -0,0 +1 @@
+http://79.120.39.202:8000/dubstep
diff --git a/dotfiles/system/music/Radio Caprice Gregorian Chants.m3u b/dotfiles/system/music/Radio Caprice Gregorian Chants.m3u
new file mode 100644
index 0000000..a8bdf5a
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Gregorian Chants.m3u
@@ -0,0 +1 @@
+http://213.141.131.10:8002/chants
diff --git a/dotfiles/system/music/Radio Caprice Hardcore Punk.m3u b/dotfiles/system/music/Radio Caprice Hardcore Punk.m3u
new file mode 100644
index 0000000..b8ba07e
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Hardcore Punk.m3u
@@ -0,0 +1 @@
+http://213.141.131.10:8000/hardcorepunk
diff --git a/dotfiles/system/music/Radio Caprice Jazz Bebop.m3u b/dotfiles/system/music/Radio Caprice Jazz Bebop.m3u
new file mode 100644
index 0000000..08f98b7
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Jazz Bebop.m3u
@@ -0,0 +1 @@
+http://79.120.12.130:8000/bebop
diff --git a/dotfiles/system/music/Radio Caprice Jazz Rap.m3u b/dotfiles/system/music/Radio Caprice Jazz Rap.m3u
new file mode 100644
index 0000000..275b470
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Jazz Rap.m3u
@@ -0,0 +1 @@
+http://79.120.39.202:8000/jazzrap
diff --git a/dotfiles/system/music/Radio Caprice Old School Hip-Hop.m3u b/dotfiles/system/music/Radio Caprice Old School Hip-Hop.m3u
new file mode 100644
index 0000000..bff948d
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Old School Hip-Hop.m3u
@@ -0,0 +1 @@
+http://213.141.131.10:8000/oldschoolhiphop
diff --git a/dotfiles/system/music/Radio Caprice Oldies.m3u b/dotfiles/system/music/Radio Caprice Oldies.m3u
new file mode 100644
index 0000000..7421d1b
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Oldies.m3u
@@ -0,0 +1 @@
+http://79.120.77.11:8000/oldies
diff --git a/dotfiles/system/music/Radio Caprice Reggae Roots.m3u b/dotfiles/system/music/Radio Caprice Reggae Roots.m3u
new file mode 100644
index 0000000..f9f2863
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Reggae Roots.m3u
@@ -0,0 +1 @@
+http://79.111.119.111:8000/rootsreggae
diff --git a/dotfiles/system/music/Radio Caprice Reggae.m3u b/dotfiles/system/music/Radio Caprice Reggae.m3u
new file mode 100644
index 0000000..c7ea1ff
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Reggae.m3u
@@ -0,0 +1 @@
+http://79.120.39.202:8000/reggae
diff --git a/dotfiles/system/music/Radio Caprice Street Punk.m3u b/dotfiles/system/music/Radio Caprice Street Punk.m3u
new file mode 100644
index 0000000..e5603ab
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Street Punk.m3u
@@ -0,0 +1 @@
+http://79.111.119.111:8000/oistreetpunk
diff --git a/dotfiles/system/music/Radio Caprice Trip Hop.m3u b/dotfiles/system/music/Radio Caprice Trip Hop.m3u
new file mode 100644
index 0000000..159e86a
--- /dev/null
+++ b/dotfiles/system/music/Radio Caprice Trip Hop.m3u
@@ -0,0 +1,4 @@
+#EXTM3U
+#EXTINF:1,Radio Caprice Trip Hop
+http://79.111.14.76:9013/
+
diff --git a/dotfiles/system/music/Radio Swiss Classic French.m3u b/dotfiles/system/music/Radio Swiss Classic French.m3u
new file mode 100644
index 0000000..20e5a6e
--- /dev/null
+++ b/dotfiles/system/music/Radio Swiss Classic French.m3u
@@ -0,0 +1,9 @@
+#EXTM3U
+#RADIOBROWSERUUID:9645be61-0601-11e8-ae97-52543be04c81
+#EXTINF:1,Radio Swiss Classic French
+http://www.radioswissclassic.ch/fr/live/aacp.m3u
+
+#RADIOBROWSERUUID:964a1754-0601-11e8-ae97-52543be04c81
+#EXTINF:1,Radio Swiss Classic French
+http://www.radioswissclassic.ch/fr/live/aacp32.m3u
+
diff --git a/dotfiles/system/music/Radio Swiss Classic German.m3u b/dotfiles/system/music/Radio Swiss Classic German.m3u
new file mode 100644
index 0000000..8a1ec72
--- /dev/null
+++ b/dotfiles/system/music/Radio Swiss Classic German.m3u
@@ -0,0 +1,9 @@
+#EXTM3U
+#RADIOBROWSERUUID:96077079-0601-11e8-ae97-52543be04c81
+#EXTINF:1,Radio Swiss Classic German
+http://stream.srg-ssr.ch/m/rsc_de/mp3_128
+
+#RADIOBROWSERUUID:964a181c-0601-11e8-ae97-52543be04c81
+#EXTINF:1,Radio Swiss Classic German
+http://www.radioswissclassic.ch/de/live/aacp32.m3u
+
diff --git a/dotfiles/system/music/Radio Swiss Classic Italian.m3u b/dotfiles/system/music/Radio Swiss Classic Italian.m3u
new file mode 100644
index 0000000..e0c7d4a
--- /dev/null
+++ b/dotfiles/system/music/Radio Swiss Classic Italian.m3u
@@ -0,0 +1,13 @@
+#EXTM3U
+#RADIOBROWSERUUID:9628ea33-0601-11e8-ae97-52543be04c81
+#EXTINF:1,Radio Swiss Classic Italian
+http://www.radioswissclassic.ch/it/live/aacp.m3u
+
+#RADIOBROWSERUUID:b6202b76-06b4-11e8-ae97-52543be04c81
+#EXTINF:1,Radio Swiss Classic Italian
+http://www.radioswissclassic.ch/it/live/aacp32.m3u
+
+#RADIOBROWSERUUID:1ff4a420-f6a8-4c09-8084-5cc834882cd2
+#EXTINF:1,Radio Swiss Classic Italian
+https://stream.srg-ssr.ch/rsc_it/aacp_96.m3u
+
diff --git a/dotfiles/system/music/SomaFM Beat Blender.m3u b/dotfiles/system/music/SomaFM Beat Blender.m3u
new file mode 100644
index 0000000..1f86a51
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Beat Blender.m3u
@@ -0,0 +1,6 @@
+https://ice6.somafm.com/beatblender-128-mp3
+https://ice4.somafm.com/beatblender-128-mp3
+https://ice1.somafm.com/beatblender-128-mp3
+https://ice2.somafm.com/beatblender-128-mp3
+
+
diff --git a/dotfiles/system/music/SomaFM Black Rock FM.m3u b/dotfiles/system/music/SomaFM Black Rock FM.m3u
new file mode 100644
index 0000000..9c3c4e2
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Black Rock FM.m3u
@@ -0,0 +1,4 @@
+https://ice6.somafm.com/brfm-128-mp3
+https://ice1.somafm.com/brfm-128-mp3
+https://ice4.somafm.com/brfm-128-mp3
+https://ice2.somafm.com/brfm-128-mp3
diff --git a/dotfiles/system/music/SomaFM Boot Liquor.m3u b/dotfiles/system/music/SomaFM Boot Liquor.m3u
new file mode 100644
index 0000000..490aa24
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Boot Liquor.m3u
@@ -0,0 +1,4 @@
+https://ice6.somafm.com/bootliquor-128-mp3
+https://ice4.somafm.com/bootliquor-128-mp3
+https://ice1.somafm.com/bootliquor-128-mp3
+https://ice2.somafm.com/bootliquor-128-mp3
diff --git a/dotfiles/system/music/SomaFM Cliqhop IDM.m3u b/dotfiles/system/music/SomaFM Cliqhop IDM.m3u
new file mode 100644
index 0000000..1ca516f
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Cliqhop IDM.m3u
@@ -0,0 +1,4 @@
+https://ice4.somafm.com/cliqhop-128-mp3
+https://ice6.somafm.com/cliqhop-128-mp3
+https://ice1.somafm.com/cliqhop-128-mp3
+https://ice2.somafm.com/cliqhop-128-mp3
diff --git a/dotfiles/system/music/SomaFM Dark Zone.m3u b/dotfiles/system/music/SomaFM Dark Zone.m3u
new file mode 100644
index 0000000..5cb6af2
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Dark Zone.m3u
@@ -0,0 +1,4 @@
+https://ice6.somafm.com/darkzone-128-mp3
+https://ice1.somafm.com/darkzone-128-mp3
+https://ice4.somafm.com/darkzone-128-mp3
+https://ice2.somafm.com/darkzone-128-mp3
diff --git a/dotfiles/system/music/SomaFM Deep Space One.m3u b/dotfiles/system/music/SomaFM Deep Space One.m3u
new file mode 100644
index 0000000..31dab20
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Deep Space One.m3u
@@ -0,0 +1,4 @@
+https://ice1.somafm.com/deepspaceone-128-mp3
+https://ice6.somafm.com/deepspaceone-128-mp3
+https://ice4.somafm.com/deepspaceone-128-mp3
+https://ice2.somafm.com/deepspaceone-128-mp3
diff --git a/dotfiles/system/music/SomaFM Digitalis.m3u b/dotfiles/system/music/SomaFM Digitalis.m3u
new file mode 100644
index 0000000..4a15156
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Digitalis.m3u
@@ -0,0 +1,4 @@
+https://ice6.somafm.com/digitalis-128-mp3
+https://ice1.somafm.com/digitalis-128-mp3
+https://ice4.somafm.com/digitalis-128-mp3
+https://ice2.somafm.com/digitalis-128-mp3
diff --git a/dotfiles/system/music/SomaFM Drone Zone.m3u b/dotfiles/system/music/SomaFM Drone Zone.m3u
new file mode 100644
index 0000000..1463f76
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Drone Zone.m3u
@@ -0,0 +1,5 @@
+https://ice6.somafm.com/dronezone-256-mp3
+https://ice1.somafm.com/dronezone-256-mp3
+https://ice4.somafm.com/dronezone-256-mp3
+https://ice2.somafm.com/dronezone-256-mp3
+
diff --git a/dotfiles/system/music/SomaFM Dub Step Beyond.m3u b/dotfiles/system/music/SomaFM Dub Step Beyond.m3u
new file mode 100644
index 0000000..e5d58d7
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Dub Step Beyond.m3u
@@ -0,0 +1,4 @@
+https://ice6.somafm.com/dubstep-128-mp3
+https://ice4.somafm.com/dubstep-128-mp3
+https://ice1.somafm.com/dubstep-128-mp3
+https://ice2.somafm.com/dubstep-128-mp3
diff --git a/dotfiles/system/music/SomaFM Fluid.m3u b/dotfiles/system/music/SomaFM Fluid.m3u
new file mode 100644
index 0000000..c3eda9d
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Fluid.m3u
@@ -0,0 +1,4 @@
+https://ice4.somafm.com/fluid-128-mp3
+https://ice6.somafm.com/fluid-128-mp3
+https://ice1.somafm.com/fluid-128-mp3
+https://ice2.somafm.com/fluid-128-mp3
diff --git a/dotfiles/system/music/SomaFM Folk Forward.m3u b/dotfiles/system/music/SomaFM Folk Forward.m3u
new file mode 100644
index 0000000..77919cf
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Folk Forward.m3u
@@ -0,0 +1,4 @@
+https://ice1.somafm.com/folkfwd-128-mp3
+https://ice4.somafm.com/folkfwd-128-mp3
+https://ice6.somafm.com/folkfwd-128-mp3
+https://ice2.somafm.com/folkfwd-128-mp3
diff --git a/dotfiles/system/music/SomaFM Groove Salad Classic.m3u b/dotfiles/system/music/SomaFM Groove Salad Classic.m3u
new file mode 100644
index 0000000..3dc3e70
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Groove Salad Classic.m3u
@@ -0,0 +1,4 @@
+https://ice1.somafm.com/gsclassic-128-mp3
+https://ice4.somafm.com/gsclassic-128-mp3
+https://ice6.somafm.com/gsclassic-128-mp3
+https://ice2.somafm.com/gsclassic-128-mp3
diff --git a/dotfiles/system/music/SomaFM Groove Salad.m3u b/dotfiles/system/music/SomaFM Groove Salad.m3u
new file mode 100644
index 0000000..ab50669
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Groove Salad.m3u
@@ -0,0 +1,4 @@
+https://ice6.somafm.com/groovesalad-256-mp3
+https://ice1.somafm.com/groovesalad-256-mp3
+https://ice4.somafm.com/groovesalad-256-mp3
+https://ice2.somafm.com/groovesalad-256-mp3
diff --git a/dotfiles/system/music/SomaFM Heavyweight Reggae.m3u b/dotfiles/system/music/SomaFM Heavyweight Reggae.m3u
new file mode 100644
index 0000000..ead2744
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Heavyweight Reggae.m3u
@@ -0,0 +1,4 @@
+https://ice6.somafm.com/reggae-128-mp3
+https://ice1.somafm.com/reggae-128-mp3
+https://ice4.somafm.com/reggae-128-mp3
+https://ice2.somafm.com/reggae-128-mp3
diff --git a/dotfiles/system/music/SomaFM Illinois Street Lounge.m3u b/dotfiles/system/music/SomaFM Illinois Street Lounge.m3u
new file mode 100644
index 0000000..3c1f9f2
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Illinois Street Lounge.m3u
@@ -0,0 +1,4 @@
+https://ice6.somafm.com/illstreet-128-mp3
+https://ice4.somafm.com/illstreet-128-mp3
+https://ice1.somafm.com/illstreet-128-mp3
+https://ice2.somafm.com/illstreet-128-mp3
diff --git a/dotfiles/system/music/SomaFM Indie Pop Rocks.m3u b/dotfiles/system/music/SomaFM Indie Pop Rocks.m3u
new file mode 100644
index 0000000..7bbcbf9
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Indie Pop Rocks.m3u
@@ -0,0 +1,4 @@
+https://ice6.somafm.com/indiepop-128-mp3
+https://ice1.somafm.com/indiepop-128-mp3
+https://ice4.somafm.com/indiepop-128-mp3
+https://ice2.somafm.com/indiepop-128-mp3
diff --git a/dotfiles/system/music/SomaFM PopTron.m3u b/dotfiles/system/music/SomaFM PopTron.m3u
new file mode 100644
index 0000000..513581a
--- /dev/null
+++ b/dotfiles/system/music/SomaFM PopTron.m3u
@@ -0,0 +1,4 @@
+https://ice4.somafm.com/poptron-128-mp3
+https://ice6.somafm.com/poptron-128-mp3
+https://ice1.somafm.com/poptron-128-mp3
+https://ice2.somafm.com/poptron-128-mp3
diff --git a/dotfiles/system/music/SomaFM Secret Agent.m3u b/dotfiles/system/music/SomaFM Secret Agent.m3u
new file mode 100644
index 0000000..d789a20
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Secret Agent.m3u
@@ -0,0 +1,4 @@
+https://ice4.somafm.com/secretagent-128-mp3
+https://ice6.somafm.com/secretagent-128-mp3
+https://ice1.somafm.com/secretagent-128-mp3
+https://ice2.somafm.com/secretagent-128-mp3
diff --git a/dotfiles/system/music/SomaFM Sonic Universe.m3u b/dotfiles/system/music/SomaFM Sonic Universe.m3u
new file mode 100644
index 0000000..f195f30
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Sonic Universe.m3u
@@ -0,0 +1,4 @@
+https://ice4.somafm.com/sonicuniverse-128-mp3
+https://ice6.somafm.com/sonicuniverse-128-mp3
+https://ice1.somafm.com/sonicuniverse-128-mp3
+https://ice2.somafm.com/sonicuniverse-128-mp3
diff --git a/dotfiles/system/music/SomaFM Space Station Soma.m3u b/dotfiles/system/music/SomaFM Space Station Soma.m3u
new file mode 100644
index 0000000..6ef616c
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Space Station Soma.m3u
@@ -0,0 +1,4 @@
+https://ice1.somafm.com/spacestation-128-mp3
+https://ice6.somafm.com/spacestation-128-mp3
+https://ice4.somafm.com/spacestation-128-mp3
+https://ice2.somafm.com/spacestation-128-mp3
diff --git a/dotfiles/system/music/SomaFM Suburbs of Goa.m3u b/dotfiles/system/music/SomaFM Suburbs of Goa.m3u
new file mode 100644
index 0000000..0ceb925
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Suburbs of Goa.m3u
@@ -0,0 +1,4 @@
+https://ice1.somafm.com/suburbsofgoa-128-mp3
+https://ice6.somafm.com/suburbsofgoa-128-mp3
+https://ice4.somafm.com/suburbsofgoa-128-mp3
+https://ice2.somafm.com/suburbsofgoa-128-mp3
diff --git a/dotfiles/system/music/SomaFM Synphaera.m3u b/dotfiles/system/music/SomaFM Synphaera.m3u
new file mode 100644
index 0000000..a2b73be
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Synphaera.m3u
@@ -0,0 +1,4 @@
+https://ice6.somafm.com/synphaera-128-mp3
+https://ice1.somafm.com/synphaera-128-mp3
+https://ice4.somafm.com/synphaera-128-mp3
+https://ice2.somafm.com/synphaera-128-mp3
diff --git a/dotfiles/system/music/SomaFM The Trip.m3u b/dotfiles/system/music/SomaFM The Trip.m3u
new file mode 100644
index 0000000..f29d14a
--- /dev/null
+++ b/dotfiles/system/music/SomaFM The Trip.m3u
@@ -0,0 +1,4 @@
+https://ice6.somafm.com/thetrip-128-mp3
+https://ice4.somafm.com/thetrip-128-mp3
+https://ice1.somafm.com/thetrip-128-mp3
+https://ice2.somafm.com/thetrip-128-mp3
diff --git a/dotfiles/system/music/SomaFM Underground 80s.m3u b/dotfiles/system/music/SomaFM Underground 80s.m3u
new file mode 100644
index 0000000..04ca280
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Underground 80s.m3u
@@ -0,0 +1,5 @@
+https://ice4.somafm.com/u80s-128-mp3
+https://ice1.somafm.com/u80s-128-mp3
+https://ice6.somafm.com/u80s-128-mp3
+https://ice2.somafm.com/u80s-128-mp3
+
diff --git a/dotfiles/system/music/SomaFM Vaporwaves.m3u b/dotfiles/system/music/SomaFM Vaporwaves.m3u
new file mode 100644
index 0000000..07158a1
--- /dev/null
+++ b/dotfiles/system/music/SomaFM Vaporwaves.m3u
@@ -0,0 +1,4 @@
+https://ice1.somafm.com/vaporwaves-128-mp3
+https://ice6.somafm.com/vaporwaves-128-mp3
+https://ice4.somafm.com/vaporwaves-128-mp3
+https://ice2.somafm.com/vaporwaves-128-mp3
diff --git a/dotfiles/system/music/SomaFM n5MD Radio.m3u b/dotfiles/system/music/SomaFM n5MD Radio.m3u
new file mode 100644
index 0000000..6a86dab
--- /dev/null
+++ b/dotfiles/system/music/SomaFM n5MD Radio.m3u
@@ -0,0 +1,4 @@
+https://ice1.somafm.com/n5md-128-mp3
+https://ice6.somafm.com/n5md-128-mp3
+https://ice4.somafm.com/n5md-128-mp3
+https://ice2.somafm.com/n5md-128-mp3
diff --git a/dotfiles/system/music/Sunday Baroque.m3u b/dotfiles/system/music/Sunday Baroque.m3u
new file mode 100644
index 0000000..c040ac6
--- /dev/null
+++ b/dotfiles/system/music/Sunday Baroque.m3u
@@ -0,0 +1 @@
+http://wshu.streamguys.org/wshu-baroque
diff --git a/dotfiles/system/music/Surf Rock.m3u b/dotfiles/system/music/Surf Rock.m3u
new file mode 100644
index 0000000..8ea997e
--- /dev/null
+++ b/dotfiles/system/music/Surf Rock.m3u
@@ -0,0 +1,37 @@
+#EXTM3U
+#RADIOBROWSERUUID:81001fc1-72fd-483c-91f7-8475bdc8bbc4
+#EXTINF:1,Surf Rock Radio
+http://139.162.89.191:8020/radio.mp3
+
+#RADIOBROWSERUUID:2a05de15-62ba-4221-b530-3031fd27ca26
+#EXTINF:1,Caprice - Surf Rock
+http://79.111.119.111:8002/surfrock
+
+#RADIOBROWSERUUID:4bb8a5b0-ea88-4b3d-8c44-b99d3d8e5d9e
+#EXTINF:1,Surf Rock Radio
+http://139.162.89.191:8020/radio.mp3
+
+#RADIOBROWSERUUID:fd966a77-6c7b-40be-b1c0-a7f8d56579dc
+#EXTINF:1,Radio Surf Rock
+https://streaming.live365.com/a06592
+
+#RADIOBROWSERUUID:421c9216-dd9e-4e70-993a-708a47e5c29a
+#EXTINF:1,Caprice - Surf Rock
+http://79.111.119.111:8002/surfrock
+
+#RADIOBROWSERUUID:96446fd7-0601-11e8-ae97-52543be04c81
+#EXTINF:1,Radio Caprice - Surf Rock
+http://79.111.119.111:8000/surfrock
+
+#RADIOBROWSERUUID:86ee76c0-1e09-4799-ba9b-3c3211ea3859
+#EXTINF:1,Radio Caprice - Surf Rock
+http://79.111.119.111:8000/surfrock
+
+#RADIOBROWSERUUID:16c1f981-289e-4b47-af2c-2c3356fd519d
+#EXTINF:1,Surf Rock Radio
+http://139.162.89.191:8020/radio.mp3
+
+#RADIOBROWSERUUID:1cf0eb0c-927f-4983-bdea-c0b6527fe52f
+#EXTINF:1,Radio Caprice - Surf Rock
+http://79.111.119.111:8000/surfrock
+
diff --git a/dotfiles/system/music/Venice Classic Radio.m3u b/dotfiles/system/music/Venice Classic Radio.m3u
new file mode 100644
index 0000000..8202906
--- /dev/null
+++ b/dotfiles/system/music/Venice Classic Radio.m3u
@@ -0,0 +1 @@
+http://116.202.241.212:8020/stream
diff --git a/dotfiles/system/music/WWNO.m3u b/dotfiles/system/music/WWNO.m3u
new file mode 100644
index 0000000..b5a19ff
--- /dev/null
+++ b/dotfiles/system/music/WWNO.m3u
@@ -0,0 +1,13 @@
+#EXTM3U
+#RADIOBROWSERUUID:96260f22-0601-11e8-ae97-52543be04c81
+#EXTINF:1,WWNO Jazz Stream - University of New Orleans, LA
+http://tektite.streamguys1.com:5140/wwnojazz-mp3
+
+#RADIOBROWSERUUID:96260dab-0601-11e8-ae97-52543be04c81
+#EXTINF:1,WWNO 89.9 University of New Orleans, LA
+http://tektite.streamguys1.com:5140/wwnolive-mp3
+
+#RADIOBROWSERUUID:96260e6a-0601-11e8-ae97-52543be04c81
+#EXTINF:1,WWNO Classical Stream - University of New Orleans, LA
+http://tektite.streamguys1.com:5140/wwnoclassical-mp3
+
diff --git a/dotfiles/system/music/WWOZ New Orleans.m3u b/dotfiles/system/music/WWOZ New Orleans.m3u
new file mode 100644
index 0000000..a2f35a2
--- /dev/null
+++ b/dotfiles/system/music/WWOZ New Orleans.m3u
@@ -0,0 +1,4 @@
+https://www.wwoz.org/listen/hi
+https://wwoz-sc.streamguys1.com/wwoz-hi.mp3
+https://wwoz-sc.streamguys1.com/wwozhd2-hi
+https://wwoz-sc.streamguys1.com/wwoz-lo.mp3
diff --git a/dotfiles/system/pictures/cjennings.jpg b/dotfiles/system/pictures/cjennings.jpg
new file mode 100644
index 0000000..5870e0a
--- /dev/null
+++ b/dotfiles/system/pictures/cjennings.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/devilman.jpg b/dotfiles/system/pictures/devilman.jpg
new file mode 100644
index 0000000..5e01371
--- /dev/null
+++ b/dotfiles/system/pictures/devilman.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/Trolley-New-Orleans.jpg b/dotfiles/system/pictures/wallpaper/Trolley-New-Orleans.jpg
new file mode 100644
index 0000000..3345ecd
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/Trolley-New-Orleans.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/a-sexy-curvy-beautiful-bottom_earth.jpg b/dotfiles/system/pictures/wallpaper/a-sexy-curvy-beautiful-bottom_earth.jpg
new file mode 100644
index 0000000..b480c93
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/a-sexy-curvy-beautiful-bottom_earth.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/atari-canyon.png b/dotfiles/system/pictures/wallpaper/atari-canyon.png
new file mode 100644
index 0000000..3d81c64
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/atari-canyon.png
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/barrelled_teahupoo-french-polynesia.jpg b/dotfiles/system/pictures/wallpaper/barrelled_teahupoo-french-polynesia.jpg
new file mode 100644
index 0000000..2e2b0f9
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/barrelled_teahupoo-french-polynesia.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/beatles_st_pancras_old_church_1968.jpg b/dotfiles/system/pictures/wallpaper/beatles_st_pancras_old_church_1968.jpg
new file mode 100644
index 0000000..9f9b35a
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/beatles_st_pancras_old_church_1968.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/big-j-mcneely-los-angeles-1951.jpg b/dotfiles/system/pictures/wallpaper/big-j-mcneely-los-angeles-1951.jpg
new file mode 100644
index 0000000..3ea382a
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/big-j-mcneely-los-angeles-1951.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/black.jpg b/dotfiles/system/pictures/wallpaper/black.jpg
new file mode 100644
index 0000000..e6a9b72
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/black.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/bondi-beach-new-south-wales-australia.jpg b/dotfiles/system/pictures/wallpaper/bondi-beach-new-south-wales-australia.jpg
new file mode 100644
index 0000000..25849e6
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/bondi-beach-new-south-wales-australia.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/capetown-south-africa.jpg b/dotfiles/system/pictures/wallpaper/capetown-south-africa.jpg
new file mode 100644
index 0000000..f998c79
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/capetown-south-africa.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/damrak-amsterdam-netherlands.jpg b/dotfiles/system/pictures/wallpaper/damrak-amsterdam-netherlands.jpg
new file mode 100644
index 0000000..f3f9dc8
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/damrak-amsterdam-netherlands.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/dark-lion.jpg b/dotfiles/system/pictures/wallpaper/dark-lion.jpg
new file mode 100644
index 0000000..f3c8990
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/dark-lion.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/dolomites-italy.jpg b/dotfiles/system/pictures/wallpaper/dolomites-italy.jpg
new file mode 100644
index 0000000..b863bf0
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/dolomites-italy.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/duckdive_teahupoo-french-polynesia.jpg b/dotfiles/system/pictures/wallpaper/duckdive_teahupoo-french-polynesia.jpg
new file mode 100644
index 0000000..157e702
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/duckdive_teahupoo-french-polynesia.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/eltz-castle-wiershem-germany.jpg b/dotfiles/system/pictures/wallpaper/eltz-castle-wiershem-germany.jpg
new file mode 100644
index 0000000..3e3a154
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/eltz-castle-wiershem-germany.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/fu_some-field-near-you.jpg b/dotfiles/system/pictures/wallpaper/fu_some-field-near-you.jpg
new file mode 100644
index 0000000..f38873f
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/fu_some-field-near-you.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/hawker-sea-fury.jpg b/dotfiles/system/pictures/wallpaper/hawker-sea-fury.jpg
new file mode 100644
index 0000000..2cd33b5
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/hawker-sea-fury.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/highway-59-kansas-us.jpg b/dotfiles/system/pictures/wallpaper/highway-59-kansas-us.jpg
new file mode 100644
index 0000000..9d5959b
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/highway-59-kansas-us.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/it.saves.more.than.text.png b/dotfiles/system/pictures/wallpaper/it.saves.more.than.text.png
new file mode 100644
index 0000000..e585a82
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/it.saves.more.than.text.png
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/jack.rabbit.slims.jpeg b/dotfiles/system/pictures/wallpaper/jack.rabbit.slims.jpeg
new file mode 100644
index 0000000..2a2cdcf
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/jack.rabbit.slims.jpeg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/jackson-lake-lodge-wyoming-us.jpg b/dotfiles/system/pictures/wallpaper/jackson-lake-lodge-wyoming-us.jpg
new file mode 100644
index 0000000..fb74235
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/jackson-lake-lodge-wyoming-us.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/khan-al-khalili-egypt.jpg b/dotfiles/system/pictures/wallpaper/khan-al-khalili-egypt.jpg
new file mode 100644
index 0000000..5c90144
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/khan-al-khalili-egypt.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/knockturn-alley-london-uk.jpg b/dotfiles/system/pictures/wallpaper/knockturn-alley-london-uk.jpg
new file mode 100644
index 0000000..acf21af
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/knockturn-alley-london-uk.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/last-jedis-neighbor_faroe-islands-denmark.jpg b/dotfiles/system/pictures/wallpaper/last-jedis-neighbor_faroe-islands-denmark.jpg
new file mode 100644
index 0000000..4c40563
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/last-jedis-neighbor_faroe-islands-denmark.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/loch-muick-scotland-uk.jpg b/dotfiles/system/pictures/wallpaper/loch-muick-scotland-uk.jpg
new file mode 100644
index 0000000..05bee98
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/loch-muick-scotland-uk.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/maps.jpg b/dotfiles/system/pictures/wallpaper/maps.jpg
new file mode 100644
index 0000000..408ec9d
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/maps.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/napa-valley-california-us.jpg b/dotfiles/system/pictures/wallpaper/napa-valley-california-us.jpg
new file mode 100644
index 0000000..89f1d4d
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/napa-valley-california-us.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/nazaré-portugal.jpg b/dotfiles/system/pictures/wallpaper/nazaré-portugal.jpg
new file mode 100644
index 0000000..604641d
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/nazaré-portugal.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/notre-dame-paris-france.jpg b/dotfiles/system/pictures/wallpaper/notre-dame-paris-france.jpg
new file mode 100644
index 0000000..70c270c
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/notre-dame-paris-france.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/petit-piton-st-lucia.jpg b/dotfiles/system/pictures/wallpaper/petit-piton-st-lucia.jpg
new file mode 100644
index 0000000..64cb9b8
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/petit-piton-st-lucia.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/reading-room_new-york-public-library-new-york.us.jpg b/dotfiles/system/pictures/wallpaper/reading-room_new-york-public-library-new-york.us.jpg
new file mode 100644
index 0000000..5a5da19
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/reading-room_new-york-public-library-new-york.us.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/saville-dam-barkhamsted-connecticut-us.jpg b/dotfiles/system/pictures/wallpaper/saville-dam-barkhamsted-connecticut-us.jpg
new file mode 100644
index 0000000..39cc6c2
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/saville-dam-barkhamsted-connecticut-us.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/teahupoo-french-polynesia.jpg b/dotfiles/system/pictures/wallpaper/teahupoo-french-polynesia.jpg
new file mode 100644
index 0000000..c071802
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/teahupoo-french-polynesia.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/tlulum-mexico.jpg b/dotfiles/system/pictures/wallpaper/tlulum-mexico.jpg
new file mode 100644
index 0000000..29c645e
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/tlulum-mexico.jpg
Binary files differ
diff --git a/dotfiles/system/pictures/wallpaper/trinity-college-library-dublin-ireland-uk.jpg b/dotfiles/system/pictures/wallpaper/trinity-college-library-dublin-ireland-uk.jpg
new file mode 100644
index 0000000..9dca336
--- /dev/null
+++ b/dotfiles/system/pictures/wallpaper/trinity-college-library-dublin-ireland-uk.jpg
Binary files differ